From 4eba5fbc9c784eb7cbae11f5ee19693c3c38a1ba Mon Sep 17 00:00:00 2001 From: benni Date: Wed, 11 May 2011 01:32:21 +0200 Subject: [PATCH 001/335] First step for upgrading to rails 3. Check rake rails:upgrade:check for next steps. --- Gemfile | 6 +- Gemfile.lock | 85 +- Rakefile | 7 +- app/views/layouts/application.html.erb | 14 + config.ru | 4 + config/application.rb | 42 + config/boot.rb | 131 +- config/environment.rb | 73 +- config/environments/production.rb | 60 +- config/environments/test.rb | 46 +- config/initializers/backtrace_silencers.rb | 7 + config/initializers/inflections.rb | 2 +- config/initializers/secret_token.rb | 7 + config/locales/en.yml | 2 +- lib/tasks/.gitkeep | 0 public/422.html | 26 + public/images/rails.png | Bin 1787 -> 6646 bytes public/index.html | 239 + public/javascripts/controls.js | 8 +- public/javascripts/dragdrop.js | 13 +- public/javascripts/effects.js | 21 +- public/javascripts/prototype.js | 5493 +++++++++++------ public/javascripts/rails.js | 191 + public/stylesheets/.gitkeep | 0 script/rails | 6 + test/performance/browsing_test.rb | 9 + test/test_helper.rb | 29 +- vendor/plugins/.gitkeep | 0 vendor/plugins/rails_upgrade/MIT-LICENSE | 20 + vendor/plugins/rails_upgrade/README | 26 + vendor/plugins/rails_upgrade/Rakefile | 22 + vendor/plugins/rails_upgrade/init.rb | 2 + vendor/plugins/rails_upgrade/install.rb | 38 + .../rails_upgrade/lib/application_checker.rb | 477 ++ .../rails_upgrade/lib/gemfile_generator.rb | 95 + .../lib/new_configuration_generator.rb | 51 + .../rails_upgrade/lib/rails_upgrade.rb | 0 .../rails_upgrade/lib/routes_upgrader.rb | 366 ++ .../lib/tasks/rails_upgrade_tasks.rake | 78 + .../test/application_checker_test.rb | 330 + .../test/gemfile_generator_test.rb | 72 + .../test/new_configuration_generator_test.rb | 63 + .../test/routes_upgrader_test.rb | 184 + .../plugins/rails_upgrade/test/test_helper.rb | 5 + vendor/plugins/rails_upgrade/uninstall.rb | 1 + 45 files changed, 6139 insertions(+), 2212 deletions(-) create mode 100644 app/views/layouts/application.html.erb create mode 100644 config.ru create mode 100644 config/application.rb create mode 100644 config/initializers/backtrace_silencers.rb create mode 100644 config/initializers/secret_token.rb create mode 100644 lib/tasks/.gitkeep create mode 100644 public/422.html create mode 100644 public/index.html create mode 100644 public/javascripts/rails.js create mode 100644 public/stylesheets/.gitkeep create mode 100755 script/rails create mode 100644 test/performance/browsing_test.rb create mode 100644 vendor/plugins/.gitkeep create mode 100644 vendor/plugins/rails_upgrade/MIT-LICENSE create mode 100644 vendor/plugins/rails_upgrade/README create mode 100644 vendor/plugins/rails_upgrade/Rakefile create mode 100644 vendor/plugins/rails_upgrade/init.rb create mode 100644 vendor/plugins/rails_upgrade/install.rb create mode 100644 vendor/plugins/rails_upgrade/lib/application_checker.rb create mode 100644 vendor/plugins/rails_upgrade/lib/gemfile_generator.rb create mode 100644 vendor/plugins/rails_upgrade/lib/new_configuration_generator.rb create mode 100644 vendor/plugins/rails_upgrade/lib/rails_upgrade.rb create mode 100644 vendor/plugins/rails_upgrade/lib/routes_upgrader.rb create mode 100644 vendor/plugins/rails_upgrade/lib/tasks/rails_upgrade_tasks.rake create mode 100644 vendor/plugins/rails_upgrade/test/application_checker_test.rb create mode 100644 vendor/plugins/rails_upgrade/test/gemfile_generator_test.rb create mode 100644 vendor/plugins/rails_upgrade/test/new_configuration_generator_test.rb create mode 100644 vendor/plugins/rails_upgrade/test/routes_upgrader_test.rb create mode 100644 vendor/plugins/rails_upgrade/test/test_helper.rb create mode 100644 vendor/plugins/rails_upgrade/uninstall.rb diff --git a/Gemfile b/Gemfile index 2bf05686..4a79f72d 100644 --- a/Gemfile +++ b/Gemfile @@ -1,14 +1,14 @@ # A sample Gemfile source "http://rubygems.org" -gem "rails", '2.3.11' +gem "rails", '3.0.7' gem 'mysql' gem "fastercsv" gem "prawn", '<=0.6.3' gem 'haml', '>=2.0.6' -gem 'routing-filter', '0.0.1', :require => 'routing_filter' -gem 'sqlite3-ruby' +#gem 'routing-filter', '0.0.1', :require => 'routing_filter' +#gem 'sqlite3-ruby' group :development do gem 'annotate' diff --git a/Gemfile.lock b/Gemfile.lock index 0a86c296..d8fdbe59 100644 --- a/Gemfile.lock +++ b/Gemfile.lock @@ -1,21 +1,50 @@ GEM remote: http://rubygems.org/ specs: - actionmailer (2.3.11) - actionpack (= 2.3.11) - actionpack (2.3.11) - activesupport (= 2.3.11) - rack (~> 1.1.0) - activerecord (2.3.11) - activesupport (= 2.3.11) - activeresource (2.3.11) - activesupport (= 2.3.11) - activesupport (2.3.11) + abstract (1.0.0) + actionmailer (3.0.7) + actionpack (= 3.0.7) + mail (~> 2.2.15) + actionpack (3.0.7) + activemodel (= 3.0.7) + activesupport (= 3.0.7) + builder (~> 2.1.2) + erubis (~> 2.6.6) + i18n (~> 0.5.0) + rack (~> 1.2.1) + rack-mount (~> 0.6.14) + rack-test (~> 0.5.7) + tzinfo (~> 0.3.23) + activemodel (3.0.7) + activesupport (= 3.0.7) + builder (~> 2.1.2) + i18n (~> 0.5.0) + activerecord (3.0.7) + activemodel (= 3.0.7) + activesupport (= 3.0.7) + arel (~> 2.0.2) + tzinfo (~> 0.3.23) + activeresource (3.0.7) + activemodel (= 3.0.7) + activesupport (= 3.0.7) + activesupport (3.0.7) annotate (2.4.0) + arel (2.0.9) + builder (2.1.2) + erubis (2.6.6) + abstract (>= 1.0.0) fastercsv (1.5.4) haml (3.0.25) hirb (0.3.4) + i18n (0.5.0) + mail (2.2.19) + activesupport (>= 2.3.6) + i18n (>= 0.4.0) + mime-types (~> 1.16) + treetop (~> 1.4.8) + mime-types (1.16) mysql (2.8.1) + polyglot (0.3.1) prawn (0.6.3) prawn-core (< 0.7, >= 0.6.3) prawn-format (< 0.3, >= 0.2.3) @@ -26,17 +55,29 @@ GEM prawn-core prawn-layout (0.3.2) prawn-security (0.1.1) - rack (1.1.2) - rails (2.3.11) - actionmailer (= 2.3.11) - actionpack (= 2.3.11) - activerecord (= 2.3.11) - activeresource (= 2.3.11) - activesupport (= 2.3.11) - rake (>= 0.8.3) + rack (1.2.2) + rack-mount (0.6.14) + rack (>= 1.0.0) + rack-test (0.5.7) + rack (>= 1.0) + rails (3.0.7) + actionmailer (= 3.0.7) + actionpack (= 3.0.7) + activerecord (= 3.0.7) + activeresource (= 3.0.7) + activesupport (= 3.0.7) + bundler (~> 1.0) + railties (= 3.0.7) + railties (3.0.7) + actionpack (= 3.0.7) + activesupport (= 3.0.7) + rake (>= 0.8.7) + thor (~> 0.14.4) rake (0.8.7) - routing-filter (0.0.1) - sqlite3-ruby (1.2.4) + thor (0.14.6) + treetop (1.4.9) + polyglot (>= 0.3.1) + tzinfo (0.3.27) PLATFORMS ruby @@ -48,6 +89,4 @@ DEPENDENCIES hirb mysql prawn (<= 0.6.3) - rails (= 2.3.11) - routing-filter (= 0.0.1) - sqlite3-ruby + rails (= 3.0.7) diff --git a/Rakefile b/Rakefile index 3bb0e859..28c599e4 100644 --- a/Rakefile +++ b/Rakefile @@ -1,10 +1,7 @@ # Add your own tasks in files placed in lib/tasks ending in .rake, # for example lib/tasks/capistrano.rake, and they will automatically be available to Rake. -require(File.join(File.dirname(__FILE__), 'config', 'boot')) - +require File.expand_path('../config/application', __FILE__) require 'rake' -require 'rake/testtask' -require 'rake/rdoctask' -require 'tasks/rails' +Foodsoft::Application.load_tasks diff --git a/app/views/layouts/application.html.erb b/app/views/layouts/application.html.erb new file mode 100644 index 00000000..9a412bb1 --- /dev/null +++ b/app/views/layouts/application.html.erb @@ -0,0 +1,14 @@ + + + + Foodsoft + <%= stylesheet_link_tag :all %> + <%= javascript_include_tag :defaults %> + <%= csrf_meta_tag %> + + + +<%= yield %> + + + diff --git a/config.ru b/config.ru new file mode 100644 index 00000000..fdb3d348 --- /dev/null +++ b/config.ru @@ -0,0 +1,4 @@ +# This file is used by Rack-based servers to start the application. + +require ::File.expand_path('../config/environment', __FILE__) +run Foodsoft::Application diff --git a/config/application.rb b/config/application.rb new file mode 100644 index 00000000..b71de928 --- /dev/null +++ b/config/application.rb @@ -0,0 +1,42 @@ +require File.expand_path('../boot', __FILE__) + +require 'rails/all' + +# If you have a Gemfile, require the gems listed there, including any gems +# you've limited to :test, :development, or :production. +Bundler.require(:default, Rails.env) if defined?(Bundler) + +module Foodsoft + class Application < Rails::Application + # Settings in config/environments/* take precedence over those specified here. + # Application configuration should go into files in config/initializers + # -- all .rb files in that directory are automatically loaded. + + # Custom directories with classes and modules you want to be autoloadable. + # config.autoload_paths += %W(#{config.root}/extras) + + # Only load the plugins named here, in the order given (default is alphabetical). + # :all can be used as a placeholder for all plugins not explicitly named. + # config.plugins = [ :exception_notification, :ssl_requirement, :all ] + + # Activate observers that should always be running. + # config.active_record.observers = :cacher, :garbage_collector, :forum_observer + + # Set Time.zone default to the specified zone and make Active Record auto-convert to this zone. + # Run "rake -D time" for a list of tasks for finding time zone names. Default is UTC. + # config.time_zone = 'Central Time (US & Canada)' + + # The default locale is :en and all translations from config/locales/*.rb,yml are auto loaded. + # config.i18n.load_path += Dir[Rails.root.join('my', 'locales', '*.{rb,yml}').to_s] + # config.i18n.default_locale = :de + + # JavaScript files you want as :defaults (application.js is always included). + # config.action_view.javascript_expansions[:defaults] = %w(jquery rails) + + # Configure the default encoding used in templates for Ruby 1.9. + config.encoding = "utf-8" + + # Configure sensitive parameters which will be filtered from the log file. + config.filter_parameters += [:password] + end +end diff --git a/config/boot.rb b/config/boot.rb index d4242094..4489e586 100644 --- a/config/boot.rb +++ b/config/boot.rb @@ -1,129 +1,6 @@ -# Don't change this file! -# Configure your app in config/environment.rb and config/environments/*.rb +require 'rubygems' -RAILS_ROOT = "#{File.dirname(__FILE__)}/.." unless defined?(RAILS_ROOT) +# Set up gems listed in the Gemfile. +ENV['BUNDLE_GEMFILE'] ||= File.expand_path('../../Gemfile', __FILE__) -module Rails - class << self - def boot! - unless booted? - preinitialize - pick_boot.run - end - end - - def booted? - defined? Rails::Initializer - end - - def pick_boot - (vendor_rails? ? VendorBoot : GemBoot).new - end - - def vendor_rails? - File.exist?("#{RAILS_ROOT}/vendor/rails") - end - - def preinitialize - load(preinitializer_path) if File.exist?(preinitializer_path) - end - - def preinitializer_path - "#{RAILS_ROOT}/config/preinitializer.rb" - end - end - - class Boot - def run - load_initializer - Rails::Initializer.run(:set_load_path) - end - end - - class VendorBoot < Boot - def load_initializer - require "#{RAILS_ROOT}/vendor/rails/railties/lib/initializer" - Rails::Initializer.run(:install_gem_spec_stubs) - Rails::GemDependency.add_frozen_gem_path - end - end - - class GemBoot < Boot - def load_initializer - self.class.load_rubygems - load_rails_gem - require 'initializer' - end - - def load_rails_gem - if version = self.class.gem_version - gem 'rails', version - else - gem 'rails' - end - rescue Gem::LoadError => load_error - if load_error.message =~ /Could not find RubyGem rails/ - STDERR.puts %(Missing the Rails #{version} gem. Please `gem install -v=#{version} rails`, update your RAILS_GEM_VERSION setting in config/environment.rb for the Rails version you do have installed, or comment out RAILS_GEM_VERSION to use the latest version installed.) - exit 1 - else - raise - end - end - - class << self - def rubygems_version - Gem::RubyGemsVersion rescue nil - end - - def gem_version - if defined? RAILS_GEM_VERSION - RAILS_GEM_VERSION - elsif ENV.include?('RAILS_GEM_VERSION') - ENV['RAILS_GEM_VERSION'] - else - parse_gem_version(read_environment_rb) - end - end - - def load_rubygems - min_version = '1.3.2' - require 'rubygems' - unless rubygems_version >= min_version - $stderr.puts %Q(Rails requires RubyGems >= #{min_version} (you have #{rubygems_version}). Please `gem update --system` and try again.) - exit 1 - end - - rescue LoadError - $stderr.puts %Q(Rails requires RubyGems >= #{min_version}. Please install RubyGems and try again: http://rubygems.rubyforge.org) - exit 1 - end - - def parse_gem_version(text) - $1 if text =~ /^[^#]*RAILS_GEM_VERSION\s*=\s*["']([!~<>=]*\s*[\d.]+)["']/ - end - - private - def read_environment_rb - File.read("#{RAILS_ROOT}/config/environment.rb") - end - end - end -end - -# Bundler requirements -class Rails::Boot - def run - load_initializer - - Rails::Initializer.class_eval do - def load_gems - @bundler_loaded ||= Bundler.require :default, Rails.env - end - end - - Rails::Initializer.run(:set_load_path) - end -end - -# All that for this: -Rails.boot! +require 'bundler/setup' if File.exists?(ENV['BUNDLE_GEMFILE']) diff --git a/config/environment.rb b/config/environment.rb index b5d15ab0..39cacab4 100644 --- a/config/environment.rb +++ b/config/environment.rb @@ -1,70 +1,5 @@ -# Be sure to restart your web server when you modify this file. +# Load the rails application +require File.expand_path('../application', __FILE__) -# Uncomment below to force Rails into production mode when -# you don't control web/app server and can't set it the proper way -# ENV['RAILS_ENV'] ||= 'production' - -# Specifies gem version of Rails to use when vendor/rails is not present -RAILS_GEM_VERSION = '2.3.11' unless defined? RAILS_GEM_VERSION - -# Bootstrap the Rails environment, frameworks, and default configuration -require File.join(File.dirname(__FILE__), 'boot') - -Rails::Initializer.run do |config| - # Settings in config/environments/* take precedence over those specified here. - # Application configuration should go into files in config/initializers - # -- all .rb files in that directory are automatically loaded. - # See Rails::Configuration for more options. - - # Skip frameworks you're not going to use (only works if using vendor/rails) - # config.frameworks -= [ :action_web_service, :action_mailer ] - - # Only load the plugins named here, by default all plugins in vendor/plugins are loaded - # config.plugins = [ :exception_notification, :ssl_requirement, :all ] - - # Add additional load paths for your own custom dirs - # config.load_paths += %W( #{RAILS_ROOT}/extras ) - - # Force all environments to use the same logger level - # (by default production uses :info, the others :debug) - # config.log_level = :debug - - # Disable colorized logging output for ActiveRecord: - config.active_record.colorize_logging = false - - # Use the database for sessions instead of the file system - # (create the session table with 'rake db:sessions:create') - # config.action_controller.session_store = :active_record_store - - # Use SQL instead of Active Record's schema dumper when creating the test database. - # This is necessary if your schema can't be completely dumped by the schema dumper, - # like if you have constraints or database-specific column types - # config.active_record.schema_format = :sql - - # Activate observers that should always be running - # config.active_record.observers = :cacher, :garbage_collector - - # Make Active Record use UTC-base instead of local time - config.time_zone = 'Berlin' - - # Specify gems that this application depends on. - # They can then be installed with "rake gems:install" on new installations. - # You have to specify the :lib option for libraries, where the Gem name (sqlite3-ruby) differs from the file itself (sqlite3) - # config.gem "bj" - # config.gem "hpricot", :version => '0.6', :source => "http://code.whytheluckystiff.net" - # config.gem "sqlite3-ruby", :lib => "sqlite3" - # config.gem "aws-s3", :lib => "aws/s3" - # - # config.gem "fastercsv" - # config.gem "prawn", :version => '<=0.6.3' - # config.gem "haml", :version => '>=2.0.6' - # config.gem "routing-filter", :lib => "routing_filter" - - # The internationalization framework can be changed to have another default locale (standard is :en) or more load paths. - # library for parsing/writing files from/to csv-file - # All files from config/locales/*.rb,yml are added automatically. - # config.i18n.load_path << Dir[File.join(RAILS_ROOT, 'my', 'locales', '*.{rb,yml}')] - config.i18n.default_locale = :de - - # See Rails::Configuration for more options -end +# Initialize the rails application +Foodsoft::Application.initialize! diff --git a/config/environments/production.rb b/config/environments/production.rb index ce84c103..f43a7d1a 100644 --- a/config/environments/production.rb +++ b/config/environments/production.rb @@ -1,25 +1,49 @@ -# Settings specified here will take precedence over those in config/environment.rb +Foodsoft::Application.configure do + # Settings specified here will take precedence over those in config/application.rb -# The production environment is meant for finished, "live" apps. -# Code is not reloaded between requests -config.cache_classes = true + # The production environment is meant for finished, "live" apps. + # Code is not reloaded between requests + config.cache_classes = true -# Enable threaded mode -# config.threadsafe! + # Full error reports are disabled and caching is turned on + config.consider_all_requests_local = false + config.action_controller.perform_caching = true -# Use a different logger for distributed setups -# config.logger = SyslogLogger.new -config.log_level = :warn + # Specifies the header that your server uses for sending files + config.action_dispatch.x_sendfile_header = "X-Sendfile" -# Full error reports are disabled and caching is turned on -config.action_controller.consider_all_requests_local = false -config.action_controller.perform_caching = true + # For nginx: + # config.action_dispatch.x_sendfile_header = 'X-Accel-Redirect' -# Use a different cache store in production -# config.cache_store = :mem_cache_store + # If you have no front-end server that supports something like X-Sendfile, + # just comment this out and Rails will serve the files -# Enable serving of images, stylesheets, and javascripts from an asset server -# config.action_controller.asset_host = "http://assets.example.com" + # See everything in the log (default is :info) + # config.log_level = :debug -# Disable delivery errors if you bad email addresses should just be ignored -# config.action_mailer.raise_delivery_errors = false + # Use a different logger for distributed setups + # config.logger = SyslogLogger.new + + # Use a different cache store in production + # config.cache_store = :mem_cache_store + + # Disable Rails's static asset server + # In production, Apache or nginx will already do this + config.serve_static_assets = false + + # Enable serving of images, stylesheets, and javascripts from an asset server + # config.action_controller.asset_host = "http://assets.example.com" + + # Disable delivery errors, bad email addresses will be ignored + # config.action_mailer.raise_delivery_errors = false + + # Enable threaded mode + # config.threadsafe! + + # Enable locale fallbacks for I18n (makes lookups for any locale fall back to + # the I18n.default_locale when a translation can not be found) + config.i18n.fallbacks = true + + # Send deprecation notices to registered listeners + config.active_support.deprecation = :notify +end diff --git a/config/environments/test.rb b/config/environments/test.rb index f0689b92..c1afcdbf 100644 --- a/config/environments/test.rb +++ b/config/environments/test.rb @@ -1,19 +1,35 @@ -# Settings specified here will take precedence over those in config/environment.rb +Foodsoft::Application.configure do + # Settings specified here will take precedence over those in config/application.rb -# The test environment is used exclusively to run your application's -# test suite. You never need to work with it otherwise. Remember that -# your test database is "scratch space" for the test suite and is wiped -# and recreated between test runs. Don't rely on the data there! -config.cache_classes = true + # The test environment is used exclusively to run your application's + # test suite. You never need to work with it otherwise. Remember that + # your test database is "scratch space" for the test suite and is wiped + # and recreated between test runs. Don't rely on the data there! + config.cache_classes = true -# Log error messages when you accidentally call methods on nil. -config.whiny_nils = true + # Log error messages when you accidentally call methods on nil. + config.whiny_nils = true -# Show full error reports and disable caching -config.action_controller.consider_all_requests_local = true -config.action_controller.perform_caching = false + # Show full error reports and disable caching + config.consider_all_requests_local = true + config.action_controller.perform_caching = false -# Tell ActionMailer not to deliver emails to the real world. -# The :test delivery method accumulates sent emails in the -# ActionMailer::Base.deliveries array. -config.action_mailer.delivery_method = :test \ No newline at end of file + # Raise exceptions instead of rendering exception templates + config.action_dispatch.show_exceptions = false + + # Disable request forgery protection in test environment + config.action_controller.allow_forgery_protection = false + + # Tell Action Mailer not to deliver emails to the real world. + # The :test delivery method accumulates sent emails in the + # ActionMailer::Base.deliveries array. + config.action_mailer.delivery_method = :test + + # Use SQL instead of Active Record's schema dumper when creating the test database. + # This is necessary if your schema can't be completely dumped by the schema dumper, + # like if you have constraints or database-specific column types + # config.active_record.schema_format = :sql + + # Print deprecation notices to the stderr + config.active_support.deprecation = :stderr +end diff --git a/config/initializers/backtrace_silencers.rb b/config/initializers/backtrace_silencers.rb new file mode 100644 index 00000000..59385cdf --- /dev/null +++ b/config/initializers/backtrace_silencers.rb @@ -0,0 +1,7 @@ +# Be sure to restart your server when you modify this file. + +# You can add backtrace silencers for libraries that you're using but don't wish to see in your backtraces. +# Rails.backtrace_cleaner.add_silencer { |line| line =~ /my_noisy_library/ } + +# You can also remove all the silencers if you're trying to debug a problem that might stem from framework code. +# Rails.backtrace_cleaner.remove_silencers! diff --git a/config/initializers/inflections.rb b/config/initializers/inflections.rb index d531b8bb..9e8b0131 100644 --- a/config/initializers/inflections.rb +++ b/config/initializers/inflections.rb @@ -1,6 +1,6 @@ # Be sure to restart your server when you modify this file. -# Add new inflection rules using the following format +# Add new inflection rules using the following format # (all these examples are active by default): # ActiveSupport::Inflector.inflections do |inflect| # inflect.plural /^(ox)$/i, '\1en' diff --git a/config/initializers/secret_token.rb b/config/initializers/secret_token.rb new file mode 100644 index 00000000..fcbd6c1e --- /dev/null +++ b/config/initializers/secret_token.rb @@ -0,0 +1,7 @@ +# Be sure to restart your server when you modify this file. + +# Your secret key for verifying the integrity of signed cookies. +# If you change this key, all old signed cookies will become invalid! +# Make sure the secret is at least 30 characters and all random, +# no regular words or you'll be exposed to dictionary attacks. +Foodsoft::Application.config.secret_token = '2be5574568ff4d270b108399078a8e485b363af84d441d02d2a6fd3fc51a8c015065790b7e414134e6d97ffc40da898a5a12f66f9de6b992b7ea96e7a34839b8' diff --git a/config/locales/en.yml b/config/locales/en.yml index f265c068..a747bfa6 100644 --- a/config/locales/en.yml +++ b/config/locales/en.yml @@ -2,4 +2,4 @@ # See http://github.com/svenfuchs/rails-i18n/tree/master/rails%2Flocale for starting points. en: - hello: "Hello world" \ No newline at end of file + hello: "Hello world" diff --git a/lib/tasks/.gitkeep b/lib/tasks/.gitkeep new file mode 100644 index 00000000..e69de29b diff --git a/public/422.html b/public/422.html new file mode 100644 index 00000000..83660ab1 --- /dev/null +++ b/public/422.html @@ -0,0 +1,26 @@ + + + + The change you wanted was rejected (422) + + + + + +
+

The change you wanted was rejected.

+

Maybe you tried to change something you didn't have access to.

+
+ + diff --git a/public/images/rails.png b/public/images/rails.png index b8441f182e06974083cf08f0acaf0e2fd612bd40..d5edc04e65f555e3ba4dcdaad39dc352e75b575e 100644 GIT binary patch delta 6644 zcmVy3_koRb9)g_uhQ>|6eVg1W}mBdFiV6Uj6Uh|K9K3@818%xGvp`@P9CZ z09OXUUl|5A8-UGg0h$i^V(?}V%)8vU`G*dpHo&Vq7c>pVcQya!6@Dsmj@#jv7C*qh zIhOJ6_K0n?*d`*T7TDuW-}m`9Kz3~>+7`DUkbAraU%yi+R{N~~X{qFX zUo)a_^PjgnhVkB|@hFur;POSjI-#uK@q^FVY46L@5;m%3&dgW=ZlR25M-pZt27|)- z6ij?mD-kFw1TJULq`sD|XFaG{hhvw@XgzHsR$u$K6s(FP|N9dhedrz-@fd;<$Exz( z70!IIjKJb_QVH<{pWYHgIDb~z5CPSMi3Lr5cz+vbA#Q0UL}V97n=U}#Wm{n<O4NcCvw51l z7RBs~&!99uj7Tbj_D$!)=}1v1N@p8%ErZsgyHQDv4PLi`@Sdq;(0{^&K;h?e)6~)r zEukkZvAtpo_FZ^4j8%5d^NPl;?6IcET7Lnf=K`l~J zAr9)5=1>?Ipk;~}bsvP4NWp1s$LNy}BDHiK+BR%PvS+!n(5oFS%TEO^xDw@=F^oU= z1je5F9nx!aSbp_Z?E31BbZuHn@KQ1AiqtXa=?JC)PWR08b-^akJkNji1fb%*sVr2P znqtT-VDRU6qJQ(u3$XBwS5Seacr8b?HH)4LujCk)@ zt*k)@jT7Lh_H?MkNfK5VO6OmzU8kEcFSMPqiN3vw7M(fd#27NYs&~?t`Q88( zau2UOhw1&#V)pP}6ptOEYfd8)UjTP{230qYXlExwdkQVRYmhzXBCL7$hfyLP_uhVw znriF3X!`G4BUW5o%@u%?7Id%b)2&Bgu=0YjQ##a zT9;5^Nb7Wiqoh}j;KknqHzSpDh~hjdvv!6 zS|x(H;ePD?=8cdPW5yjNnzBgBHsU^WL4PcpLD#Z{+SleOp`(Lg5J}`kxdTHe(nV5B zdpLrD=l|)e$gEqAwI6vuX-PFCtcDIH>bGY2dwq&^tf+&R?)nY-@7_j%4CMRAF}C9w z%p86W<2!aSY$p+krkFtG=cGo38RnrG28;?PNk%7a@faaXq&MS*&?1Z`7Ojw7(tpi& z3o-LG1*jvCG=TzEr)lz$5(k~dz87xC)b z6-=~3w1|_y;BS75>Af!#_!+n}CAyCdceH{7xBo`{G}e>B%D*@pnchBPS6D!YV#Wc< zVnDpvNqSH@&`GfdcELtwQ5MNei+{=?GGhj#MNlXKb7c}Vex@}7QfPxg!j3r{FoKa^ zKZhXZWAja)MWUyVbY)h#luuy;PjU*~)AvHAs$I))$gvI|#@Lg)vGJ21B1L%|2k&@@ z&pQ0A3CD^lieE4iQ!b#*374l0Jw5;jD%J;vQayq=n zD8-kHI~f9Ux|32SJUM`>Gp2UGK*4t?cRKi!2he`zI#j0f${I#f-jeT?u_C7S4WsA0 z)ryi-1L0(@%pa^&g5x=e=KW9+Nn(=)1T&S8g_ug%dgk*~l2O-$rGG-zP%<;L#cKS`_=>7H>6-uoDiJ^U=ZnTirTK+qsU5)(Kn zlRJ*0`>ZuE`Ml{BNQf;x{Ss6e!2${Glv6>vK#Y`(K)Hlwf;HX|sB)C)TZ76}B_m^e zh4sT)Cd79rLMe1axqp=vQGX@M7#8$Ftw@b)&3e_)w2dhdZe+F)*hUpTF%VYd6f(fFYpzDT zy+>J02}|KkQNV0cCR9TH+AL{jcE5=7=r~ z^|RM2(DuCbG7`W}Rg(xdYC>C~;1KJGLN&$cRxSZunjXcntykmpFJ7;dk>shY(DdK& z3K_JDJ6R%D`e~6Qv67@Rwu+q9*|NG{r}4F8f{DfztA8j)UPb5mXOnUEse6_~uB&F7-)!p$sa-FdEbvfh<$ESQ*j zzMmAuMI@0{!1szS@yX;HcHhkAAIuRG6XGt0j!+hPOkwD7jq~Ej&+bR(IaF@Z(mHi% z;J}*aQh!<@4SI`7Fh9_b(%~^Y|A{YP;DP&?H^|c@DOkpF_-NRscA9jrxx6{2!5n(G*|Xs0EVAc>>@{Y#Ae?opD$3z#!jqcA*(C0D=e#3rJI zR)Rbr&crn()JigxQ}~%lMG6DMO47<$9y>mDBY&+VtTw92v9I$-O_{)G*hYn95twvj zeA|9x&s_4FFMxaRM|#aFWH+Dl ziak+{4^tIgI){i-x~WlO!d2i+P~noVf`%FLBqhBW=BOZK4s~4&^@vzyX75pY$RwYu zD1W}CC(xLWky?vLimM~!$3fgu!dR>p?L?!8z z>6v$|MsLb&dU?ob)Zd!B)!a*Z2eTE7KCzP&e}XO>CT%=o(v+WUY`Az*`9inbTG&_J1lBrctM1hIWsphMW3q84ZQ%QOrbXbOfGT zR*FfUQHk1UQp7;L4~--#$sBopZN_}k_~eQ{y4LzXtz!^MD^{{dCpP}eKjRHIe+_BY zE(rTr2#ZJ+ILt-|-l!>LhCx~QRl-7QMY|%GiZ1aqk9RFUY|Yx#GQ(M%nJ&SV`hU(+ zoob|4tVE)#_qFywLfqJ_F5iZ8{^MInEoYrUms0|nMyNCY+D82vYMI5-UHaIf6r7HP z%IHE+>z1sAUjdg90zOS8Vss0asXt$G)vO6EXkEAVwYPGd7+)C0zFTg>$hL==n-)=# z6{_Q+D@W9=U;A9ciVCrT{+?RdrhjJKWe(BS(9Z_*8+42)e7aRAhukMFX9=!WMj68v zMNY@-Ig-7-82ssdOl-RtG|p5M#U^faZ^Ee4k|3N|3CTtX4&MzB>4+k_fQ4U))n-|G z$3`6=m=}I|CI}!$7Ihe1B%2ne=8#WY$o6(4o?Y;|6p1eAKqQ@3L15ysr+-usu%gkh z^;%mTGMc)UwRINVD~K;`Rl!5@hhGg;y>5qjq|u-Yf0q_~Y+Mbivkkfa0nAOzB1acn zytogsj_m7FB(-FjihMek#GAU4M!iXCgdK8ajoKm?*|iz7;dHm4$^hh(`Ufl>yb>$h zjIA-;>{>C}G0Di%b(30vy*DYAH_vVd1Ep}Bf8YUNaD z1tUbRR*c_VA5KpSCS~)5U$J(QRWhH~-9qSIwWuZIwlEGx+tWz)^s)vh5--%4NvASC ziISDT>ph%I2JyvRx*5>~WF2-5RaNV7Ya;9zX=*|loUSAlk`*jZEq^e1Jbiwy5W^}| z8@l$RHB7|$MRG+n-9q29Sc=A2f=;74Jcc=%vKqWTMeJk>Ez4Fai})3uuB*H1b)`au zOwHX8(sR3wwN5IEDy`v#N_gd}Qpn9!7{T6D~^xbxKkvf-R0-c%mX+o{?&jZZ%RxFeav8Y0gkwtdtrwUb-i0 zEgd2C=ADu%w122zG=`)6UDPci@!~$Tc6Haw%Rf1nw09wv?ZVD4ej2Uo*CX26$!Hjb zlkK3JO{&D($nunf4BDF@u=B3Wv~EoWL49o?S1c(WDD11^3mC_A@p!Ixc4oFD=qYxGN%1iO$bU+lfo*dj$SMu&Kxd_SOA00vnfRNyLDESn3s;M?7~1(XMi1;pTi;T2t=@pl z!XCcY{)37LgYMq)CJfwtHz%2{!`b&{tEztmH)vqpFdCiC+WwVrTZbqq6QUaAWf@mMg)G94jH+GD9539|X6IK^@3E>5egi5Q4Y zNj8>FCNs5)_ii|}q-E=*>-GV`9(awVZ-42?SEgoAn3=?~%icmf6>#vEzfu;rkN>en zLF}#;q-4<&sBa`H&g95#7_$>8WjUopsSK+%f>>Jzg|}2BsZ7qGI$efCJW03YP*A~K zI)M$XakLajL`f^mn1x7ZtC}3YP-cFZ)2`Jto1RyO-I;*hlG1ym0!=8V#`=-JbALYu zANU^_vH(P0DE0e1MP#c|W^p&Re)l%CvWgQvByJ;Zo3TR&vFp}bP=1J6*mUSB6=csp z6{lSHakQ>pSI5Ehf&JL|^_y68?8G6{Mdti1`1q~2G9#C;`^#U(;B9xK<-GMc`#ZNX zA$H;5op<1cfBZU`M6$k=;hRBq>MWX-AfB&NE;C62@=-0le`E6-Cur zMKjoIy)BuUmhMGJb}pPx!@GLWMT+wH2R?wA=MEy)o57~feFp8PY@YXAyt4<1FD<|i zw{FGQu~GEI<4C64)V*QiVk+VzOV^9GWf4ir#DYCNe)A^ee!J$`WV^09fMClfwpCEB^`{~ju}5uF>)Mr=_ptQAY(3?G9P_;tT^{VEPIl6T8Q)^^q%zeR-C+t#mBN>ob) z9Ju{ED7-YF7Hb2R#-lrSGJjAxx|d+gYl)qVsp`9X@4p8>e&1i?iCezeXspVjj$S#} z(S*mLJAZ_2eD3gn-Cb|eIXolM25NeRT$AW`#6-O;IO$fM&|TzRsU=I0Ic2Tta^{DJ zF!A(my0)p?UPfa{!anI>p;eZ?`C`27D-N=2)`d?od`?fP1)Anv5r2_%D-tZokZh@6 z6SK>%HmeE5k^@8;y#yY-VyAL?-(Hn)Wj9{m$;Wrl%+9>$H+=khtp4DK7-2H?0W6iI^a^in?zM7asm5A} z1Q>~ao~09;EO1UfwtpQvKlfQI-Fl7M?-c~HnW0;C;+MbUY8?FToy;A+s&Nc7VZ=Of z+e!G6s#+S5WBU)kgQq_I1@!uH74GJ-+O|%0HXm9Mqlvp|j%0`T>fr9^K;qo>XdwZW z<>%tTA+<(1^6(>=-2N;hRgBnjvEjN;VbKMbFg--WrGy|XEPtCUVxh4`w;3bP|MbVm zu2_SKnVPl58Ut%sDI4mkY3n_i*EV`TFzLZ_E5?4m&LkXj$L=&iJx8jVeJ3K&%;qIwcu|_ z#x?D_8WECDlQR}!7?xeA3SX>uVi^g=txT+4>bfMs))l8By?h;W)Tzj2Z$W+XE07=L_nI}ZPTC+_;_N3inrjfhkD zSZf9aso{sF@YJo}Ml_wl^q!ZIVv#iZ>U7nK^fCVIGnjak?nd_tTfP`A zyE4W$S)mDi zkfmokO4q2A)hRVZBq2-5q&XC>%HOLkOYxZ66(s86?=0s4z5xbiOV)}L-&6b)qf`Nye0zXFgyF5PpwPDZriDf~7sl&XC$ zf=gQBCE4%;e4p3vQ_%35Hdi+9>unAIQaz5+DhUqlo$$XW7)?)yQia<%P^-b~t2KVp z=V3;pq5fTWgfQw@XmP1X6R?GK7dSa%w8W&V3iu!J`p0TfYpTCcu~6R%{K|(c$>ERq yKPUb_j^O0W)l!2=A^$WZ-)+42v)ZHoC%^!{0hpXE>$9E!0000*Kb1c*%TL?A5;e_3`-c>E5=jzfn)up>mW*NU}07&W&N}%*LcVHM&Ma zvMx8pa!l;m)Zev}`+xWKsTCf?W?iaDJ@4Gf^5D~?Tv+AAp}%27zgtzkSU%>%y8iwA zoG>u1B`p2=_u9k4v1Mud`1+qvOZoHg#bITJ9U`qBAek?40RR96!AV3xRCwBy*IQ$v zN(=yC9IhRft9V64L`77pqF_Cx@c;kSNoGK)`?Ps*cP(EtGk=7H6)2_K;h%qqg+S?0 zbX`?dT{l1cj#Ve{U%4(xk}3)yR0%`Xm8`#E(dTjIk!ASVKP!Ue*|sDKUraz2^`HpZ zc{BR0WGyw%oBkOXkbsd-SK=gBlnkOj!q_ZLE=MIDz;8i=q(D-sJO?CUBs-6m%jM}# zW0afG+?>Oo{eOOz8G;2X10ptLr6{m4BhNA@P>J#ndriWlxeTzq0iErl#%Q4NZ+8c#=a) z1Ww}dDL###3!A2Cs!b@p$w9%1yHYq2&SpP@duR4e5PxypOYd;qHl8nKvXss6MhVa2 z>PkzlG#yz58TWb(IvvySn#OZeCffLHTn)_PK9eW{q0@mc8Al|{oKBPl8^Gh9eoi!w8m;hK%}W zVTFVpaDQZ3foB&*l9+?zkr_a-5*v&p*?c}HOGtyHg6r{WFYpQ=#z0Hc7VWLx$>M3| zb0|Gn+5t#z6*ffSVc6DjpmB2?AAR@@vB!wCK?9Yl;33;Q7^%(401QW|k=R8b!OwtL zJPjjmO9Ia;qCq)rOq!1Ia*6#A%#xb}yDx1P*ng2j%jvX1nwd!UGbANuOItljZ8|g0 zo0a!TS)u_nFi4cVh&PA2S#B6XQ(F_da|)B*@4E>%gX2E!S+6|O9@DTBb6wa?LZDuK z3rhEP-|bkU={4~0q?5*qA|aO{fG90lL0g+me)WdQe(TRz6+O`g>ar!SE(n(K)=%~! zokqnA+1Bz!U{*jH=ZzSb>&++vuSND5s(-Q}I9+l<2;YcYd;5zQG{!3e*5I=zQLU_e zBPP^oz=9J2=SV};!{^H889 zL;|#GY{B@5i52XoC?xsoorJKxsliugF#z38MKl?q*K=!7@$AQw3 zUgYZgIB7d%>qEDgAtAL4q(V})B;ti6CtZSDk!vL7pzIO?hYqK54Z{IVi!OlLgE%Lh_-h=21%%S(d9AAWVo4PrLKiF2o+&E8-|w-R+&=AV*Iq9nqj zg@+LcMZynv#t(V=1N%}dMyk)xg}8Y9M78&LtklEfk?X6+!Sm?s pE4Xk-sj&E$|A-9nP56HS1^^A-61FoN)nxzx002ovPDHLkV1hqwQw;zB diff --git a/public/index.html b/public/index.html new file mode 100644 index 00000000..75d5edd0 --- /dev/null +++ b/public/index.html @@ -0,0 +1,239 @@ + + + + Ruby on Rails: Welcome aboard + + + + +
+ + +
+ + + + +
+

Getting started

+

Here’s how to get rolling:

+ +
    +
  1. +

    Use rails generate to create your models and controllers

    +

    To see all available options, run it without parameters.

    +
    2. + +
  2. +

    Set up a default route and remove or rename this file

    +

    Routes are set up in config/routes.rb.

    +
    3. + +
  3. +

    Create your database

    +

    Run rake db:migrate to create your database. If you're not using SQLite (the default), edit config/database.yml with your username and password.

    +
    4. +
+
+
+ + +
+ + diff --git a/public/javascripts/controls.js b/public/javascripts/controls.js index ca29aefd..7392fb66 100644 --- a/public/javascripts/controls.js +++ b/public/javascripts/controls.js @@ -1,6 +1,8 @@ -// Copyright (c) 2005-2008 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) -// (c) 2005-2008 Ivan Krstic (http://blogs.law.harvard.edu/ivan) -// (c) 2005-2008 Jon Tirsen (http://www.tirsen.com) +// script.aculo.us controls.js v1.8.3, Thu Oct 08 11:23:33 +0200 2009 + +// Copyright (c) 2005-2009 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) +// (c) 2005-2009 Ivan Krstic (http://blogs.law.harvard.edu/ivan) +// (c) 2005-2009 Jon Tirsen (http://www.tirsen.com) // Contributors: // Richard Livsey // Rahul Bhargava diff --git a/public/javascripts/dragdrop.js b/public/javascripts/dragdrop.js index 07229f98..15c6dbca 100644 --- a/public/javascripts/dragdrop.js +++ b/public/javascripts/dragdrop.js @@ -1,5 +1,6 @@ -// Copyright (c) 2005-2008 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) -// (c) 2005-2008 Sammi Williams (http://www.oriontransfer.co.nz, sammi@oriontransfer.co.nz) +// script.aculo.us dragdrop.js v1.8.3, Thu Oct 08 11:23:33 +0200 2009 + +// Copyright (c) 2005-2009 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) // // script.aculo.us is freely distributable under the terms of an MIT-style license. // For details, see the script.aculo.us web site: http://script.aculo.us/ @@ -311,7 +312,7 @@ var Draggable = Class.create({ tag_name=='TEXTAREA')) return; var pointer = [Event.pointerX(event), Event.pointerY(event)]; - var pos = Position.cumulativeOffset(this.element); + var pos = this.element.cumulativeOffset(); this.offset = [0,1].map( function(i) { return (pointer[i] - pos[i]) }); Draggables.activate(this); @@ -454,7 +455,7 @@ var Draggable = Class.create({ }, draw: function(point) { - var pos = Position.cumulativeOffset(this.element); + var pos = this.element.cumulativeOffset(); if(this.options.ghosting) { var r = Position.realOffset(this.element); pos[0] += r[0] - Position.deltaX; pos[1] += r[1] - Position.deltaY; @@ -730,7 +731,7 @@ var Sortable = { } // keep reference - this.sortables[element.id] = options; + this.sortables[element.identify()] = options; // for onupdate Draggables.addObserver(new SortableObserver(element, options.onUpdate)); @@ -825,7 +826,7 @@ var Sortable = { hide().addClassName('dropmarker').setStyle({position:'absolute'}); document.getElementsByTagName("body").item(0).appendChild(Sortable._marker); } - var offsets = Position.cumulativeOffset(dropon); + var offsets = dropon.cumulativeOffset(); Sortable._marker.setStyle({left: offsets[0]+'px', top: offsets[1] + 'px'}); if(position=='after') diff --git a/public/javascripts/effects.js b/public/javascripts/effects.js index 5a639d2d..c81e6c7d 100644 --- a/public/javascripts/effects.js +++ b/public/javascripts/effects.js @@ -1,4 +1,6 @@ -// Copyright (c) 2005-2008 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) +// script.aculo.us effects.js v1.8.3, Thu Oct 08 11:23:33 +0200 2009 + +// Copyright (c) 2005-2009 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) // Contributors: // Justin Palmer (http://encytemedia.com/) // Mark Pilgrim (http://diveintomark.org/) @@ -145,14 +147,13 @@ var Effect = { 'blind': ['BlindDown','BlindUp'], 'appear': ['Appear','Fade'] }, - toggle: function(element, effect) { + toggle: function(element, effect, options) { element = $(element); - effect = (effect || 'appear').toLowerCase(); - var options = Object.extend({ + effect = (effect || 'appear').toLowerCase(); + + return Effect[ Effect.PAIRS[ effect ][ element.visible() ? 1 : 0 ] ](element, Object.extend({ queue: { position:'end', scope:(element.id || 'global'), limit: 1 } - }, arguments[2] || { }); - Effect[element.visible() ? - Effect.PAIRS[effect][1] : Effect.PAIRS[effect][0]](element, options); + }, options || {})); } }; @@ -228,12 +229,6 @@ Effect.Queue = Effect.Queues.get('global'); Effect.Base = Class.create({ position: null, start: function(options) { - function codeForEvent(options,eventName){ - return ( - (options[eventName+'Internal'] ? 'this.options.'+eventName+'Internal(this);' : '') + - (options[eventName] ? 'this.options.'+eventName+'(this);' : '') - ); - } if (options && options.transition === false) options.transition = Effect.Transitions.linear; this.options = Object.extend(Object.extend({ },Effect.DefaultOptions), options || { }); this.currentFrame = 0; diff --git a/public/javascripts/prototype.js b/public/javascripts/prototype.js index dfe8ab4e..06249a6a 100644 --- a/public/javascripts/prototype.js +++ b/public/javascripts/prototype.js @@ -1,5 +1,5 @@ -/* Prototype JavaScript framework, version 1.6.0.3 - * (c) 2005-2008 Sam Stephenson +/* Prototype JavaScript framework, version 1.7_rc2 + * (c) 2005-2010 Sam Stephenson * * Prototype is freely distributable under the terms of an MIT-style license. * For details, see the Prototype web site: http://www.prototypejs.org/ @@ -7,32 +7,53 @@ *--------------------------------------------------------------------------*/ var Prototype = { - Version: '1.6.0.3', - Browser: { - IE: !!(window.attachEvent && - navigator.userAgent.indexOf('Opera') === -1), - Opera: navigator.userAgent.indexOf('Opera') > -1, - WebKit: navigator.userAgent.indexOf('AppleWebKit/') > -1, - Gecko: navigator.userAgent.indexOf('Gecko') > -1 && - navigator.userAgent.indexOf('KHTML') === -1, - MobileSafari: !!navigator.userAgent.match(/Apple.*Mobile.*Safari/) - }, + Version: '1.7_rc2', + + Browser: (function(){ + var ua = navigator.userAgent; + var isOpera = Object.prototype.toString.call(window.opera) == '[object Opera]'; + return { + IE: !!window.attachEvent && !isOpera, + Opera: isOpera, + WebKit: ua.indexOf('AppleWebKit/') > -1, + Gecko: ua.indexOf('Gecko') > -1 && ua.indexOf('KHTML') === -1, + MobileSafari: /Apple.*Mobile/.test(ua) + } + })(), BrowserFeatures: { XPath: !!document.evaluate, + SelectorsAPI: !!document.querySelector, - ElementExtensions: !!window.HTMLElement, - SpecificElementExtensions: - document.createElement('div')['__proto__'] && - document.createElement('div')['__proto__'] !== - document.createElement('form')['__proto__'] + + ElementExtensions: (function() { + var constructor = window.Element || window.HTMLElement; + return !!(constructor && constructor.prototype); + })(), + SpecificElementExtensions: (function() { + if (typeof window.HTMLDivElement !== 'undefined') + return true; + + var div = document.createElement('div'), + form = document.createElement('form'), + isSupported = false; + + if (div['__proto__'] && (div['__proto__'] !== form['__proto__'])) { + isSupported = true; + } + + div = form = null; + + return isSupported; + })() }, ScriptFragment: ']*>([\\S\\s]*?)<\/script>', JSONFilter: /^\/\*-secure-([\s\S]*)\*\/\s*$/, emptyFunction: function() { }, + K: function(x) { return x } }; @@ -40,232 +61,8 @@ if (Prototype.Browser.MobileSafari) Prototype.BrowserFeatures.SpecificElementExtensions = false; -/* Based on Alex Arnell's inheritance implementation. */ -var Class = { - create: function() { - var parent = null, properties = $A(arguments); - if (Object.isFunction(properties[0])) - parent = properties.shift(); - - function klass() { - this.initialize.apply(this, arguments); - } - - Object.extend(klass, Class.Methods); - klass.superclass = parent; - klass.subclasses = []; - - if (parent) { - var subclass = function() { }; - subclass.prototype = parent.prototype; - klass.prototype = new subclass; - parent.subclasses.push(klass); - } - - for (var i = 0; i < properties.length; i++) - klass.addMethods(properties[i]); - - if (!klass.prototype.initialize) - klass.prototype.initialize = Prototype.emptyFunction; - - klass.prototype.constructor = klass; - - return klass; - } -}; - -Class.Methods = { - addMethods: function(source) { - var ancestor = this.superclass && this.superclass.prototype; - var properties = Object.keys(source); - - if (!Object.keys({ toString: true }).length) - properties.push("toString", "valueOf"); - - for (var i = 0, length = properties.length; i < length; i++) { - var property = properties[i], value = source[property]; - if (ancestor && Object.isFunction(value) && - value.argumentNames().first() == "$super") { - var method = value; - value = (function(m) { - return function() { return ancestor[m].apply(this, arguments) }; - })(property).wrap(method); - - value.valueOf = method.valueOf.bind(method); - value.toString = method.toString.bind(method); - } - this.prototype[property] = value; - } - - return this; - } -}; - var Abstract = { }; -Object.extend = function(destination, source) { - for (var property in source) - destination[property] = source[property]; - return destination; -}; - -Object.extend(Object, { - inspect: function(object) { - try { - if (Object.isUndefined(object)) return 'undefined'; - if (object === null) return 'null'; - return object.inspect ? object.inspect() : String(object); - } catch (e) { - if (e instanceof RangeError) return '...'; - throw e; - } - }, - - toJSON: function(object) { - var type = typeof object; - switch (type) { - case 'undefined': - case 'function': - case 'unknown': return; - case 'boolean': return object.toString(); - } - - if (object === null) return 'null'; - if (object.toJSON) return object.toJSON(); - if (Object.isElement(object)) return; - - var results = []; - for (var property in object) { - var value = Object.toJSON(object[property]); - if (!Object.isUndefined(value)) - results.push(property.toJSON() + ': ' + value); - } - - return '{' + results.join(', ') + '}'; - }, - - toQueryString: function(object) { - return $H(object).toQueryString(); - }, - - toHTML: function(object) { - return object && object.toHTML ? object.toHTML() : String.interpret(object); - }, - - keys: function(object) { - var keys = []; - for (var property in object) - keys.push(property); - return keys; - }, - - values: function(object) { - var values = []; - for (var property in object) - values.push(object[property]); - return values; - }, - - clone: function(object) { - return Object.extend({ }, object); - }, - - isElement: function(object) { - return !!(object && object.nodeType == 1); - }, - - isArray: function(object) { - return object != null && typeof object == "object" && - 'splice' in object && 'join' in object; - }, - - isHash: function(object) { - return object instanceof Hash; - }, - - isFunction: function(object) { - return typeof object == "function"; - }, - - isString: function(object) { - return typeof object == "string"; - }, - - isNumber: function(object) { - return typeof object == "number"; - }, - - isUndefined: function(object) { - return typeof object == "undefined"; - } -}); - -Object.extend(Function.prototype, { - argumentNames: function() { - var names = this.toString().match(/^[\s\(]*function[^(]*\(([^\)]*)\)/)[1] - .replace(/\s+/g, '').split(','); - return names.length == 1 && !names[0] ? [] : names; - }, - - bind: function() { - if (arguments.length < 2 && Object.isUndefined(arguments[0])) return this; - var __method = this, args = $A(arguments), object = args.shift(); - return function() { - return __method.apply(object, args.concat($A(arguments))); - } - }, - - bindAsEventListener: function() { - var __method = this, args = $A(arguments), object = args.shift(); - return function(event) { - return __method.apply(object, [event || window.event].concat(args)); - } - }, - - curry: function() { - if (!arguments.length) return this; - var __method = this, args = $A(arguments); - return function() { - return __method.apply(this, args.concat($A(arguments))); - } - }, - - delay: function() { - var __method = this, args = $A(arguments), timeout = args.shift() * 1000; - return window.setTimeout(function() { - return __method.apply(__method, args); - }, timeout); - }, - - defer: function() { - var args = [0.01].concat($A(arguments)); - return this.delay.apply(this, args); - }, - - wrap: function(wrapper) { - var __method = this; - return function() { - return wrapper.apply(this, [__method.bind(this)].concat($A(arguments))); - } - }, - - methodize: function() { - if (this._methodized) return this._methodized; - var __method = this; - return this._methodized = function() { - return __method.apply(null, [this].concat($A(arguments))); - }; - } -}); - -Date.prototype.toJSON = function() { - return '"' + this.getUTCFullYear() + '-' + - (this.getUTCMonth() + 1).toPaddedString(2) + '-' + - this.getUTCDate().toPaddedString(2) + 'T' + - this.getUTCHours().toPaddedString(2) + ':' + - this.getUTCMinutes().toPaddedString(2) + ':' + - this.getUTCSeconds().toPaddedString(2) + 'Z"'; -}; var Try = { these: function() { @@ -283,14 +80,400 @@ var Try = { } }; +/* Based on Alex Arnell's inheritance implementation. */ + +var Class = (function() { + + var IS_DONTENUM_BUGGY = (function(){ + for (var p in { toString: 1 }) { + if (p === 'toString') return false; + } + return true; + })(); + + function subclass() {}; + function create() { + var parent = null, properties = $A(arguments); + if (Object.isFunction(properties[0])) + parent = properties.shift(); + + function klass() { + this.initialize.apply(this, arguments); + } + + Object.extend(klass, Class.Methods); + klass.superclass = parent; + klass.subclasses = []; + + if (parent) { + subclass.prototype = parent.prototype; + klass.prototype = new subclass; + parent.subclasses.push(klass); + } + + for (var i = 0, length = properties.length; i < length; i++) + klass.addMethods(properties[i]); + + if (!klass.prototype.initialize) + klass.prototype.initialize = Prototype.emptyFunction; + + klass.prototype.constructor = klass; + return klass; + } + + function addMethods(source) { + var ancestor = this.superclass && this.superclass.prototype, + properties = Object.keys(source); + + if (IS_DONTENUM_BUGGY) { + if (source.toString != Object.prototype.toString) + properties.push("toString"); + if (source.valueOf != Object.prototype.valueOf) + properties.push("valueOf"); + } + + for (var i = 0, length = properties.length; i < length; i++) { + var property = properties[i], value = source[property]; + if (ancestor && Object.isFunction(value) && + value.argumentNames()[0] == "$super") { + var method = value; + value = (function(m) { + return function() { return ancestor[m].apply(this, arguments); }; + })(property).wrap(method); + + value.valueOf = method.valueOf.bind(method); + value.toString = method.toString.bind(method); + } + this.prototype[property] = value; + } + + return this; + } + + return { + create: create, + Methods: { + addMethods: addMethods + } + }; +})(); +(function() { + + var _toString = Object.prototype.toString, + NULL_TYPE = 'Null', + UNDEFINED_TYPE = 'Undefined', + BOOLEAN_TYPE = 'Boolean', + NUMBER_TYPE = 'Number', + STRING_TYPE = 'String', + OBJECT_TYPE = 'Object', + BOOLEAN_CLASS = '[object Boolean]', + NUMBER_CLASS = '[object Number]', + STRING_CLASS = '[object String]', + ARRAY_CLASS = '[object Array]', + NATIVE_JSON_STRINGIFY_SUPPORT = window.JSON && + typeof JSON.stringify === 'function' && + JSON.stringify(0) === '0' && + typeof JSON.stringify(Prototype.K) === 'undefined'; + + function Type(o) { + switch(o) { + case null: return NULL_TYPE; + case (void 0): return UNDEFINED_TYPE; + } + var type = typeof o; + switch(type) { + case 'boolean': return BOOLEAN_TYPE; + case 'number': return NUMBER_TYPE; + case 'string': return STRING_TYPE; + } + return OBJECT_TYPE; + } + + function extend(destination, source) { + for (var property in source) + destination[property] = source[property]; + return destination; + } + + function inspect(object) { + try { + if (isUndefined(object)) return 'undefined'; + if (object === null) return 'null'; + return object.inspect ? object.inspect() : String(object); + } catch (e) { + if (e instanceof RangeError) return '...'; + throw e; + } + } + + function toJSON(value) { + return Str('', { '': value }, []); + } + + function Str(key, holder, stack) { + var value = holder[key], + type = typeof value; + + if (Type(value) === OBJECT_TYPE && typeof value.toJSON === 'function') { + value = value.toJSON(key); + } + + var _class = _toString.call(value); + + switch (_class) { + case NUMBER_CLASS: + case BOOLEAN_CLASS: + case STRING_CLASS: + value = value.valueOf(); + } + + switch (value) { + case null: return 'null'; + case true: return 'true'; + case false: return 'false'; + } + + type = typeof value; + switch (type) { + case 'string': + return value.inspect(true); + case 'number': + return isFinite(value) ? String(value) : 'null'; + case 'object': + + for (var i = 0, length = stack.length; i < length; i++) { + if (stack[i] === value) { throw new TypeError(); } + } + stack.push(value); + + var partial = []; + if (_class === ARRAY_CLASS) { + for (var i = 0, length = value.length; i < length; i++) { + var str = Str(i, value, stack); + partial.push(typeof str === 'undefined' ? 'null' : str); + } + partial = '[' + partial.join(',') + ']'; + } else { + var keys = Object.keys(value); + for (var i = 0, length = keys.length; i < length; i++) { + var key = keys[i], str = Str(key, value, stack); + if (typeof str !== "undefined") { + partial.push(key.inspect(true)+ ':' + str); + } + } + partial = '{' + partial.join(',') + '}'; + } + stack.pop(); + return partial; + } + } + + function stringify(object) { + return JSON.stringify(object); + } + + function toQueryString(object) { + return $H(object).toQueryString(); + } + + function toHTML(object) { + return object && object.toHTML ? object.toHTML() : String.interpret(object); + } + + function keys(object) { + if (Type(object) !== OBJECT_TYPE) { throw new TypeError(); } + var results = []; + for (var property in object) { + if (object.hasOwnProperty(property)) { + results.push(property); + } + } + return results; + } + + function values(object) { + var results = []; + for (var property in object) + results.push(object[property]); + return results; + } + + function clone(object) { + return extend({ }, object); + } + + function isElement(object) { + return !!(object && object.nodeType == 1); + } + + function isArray(object) { + return _toString.call(object) === ARRAY_CLASS; + } + + var hasNativeIsArray = (typeof Array.isArray == 'function') + && Array.isArray([]) && !Array.isArray({}); + + if (hasNativeIsArray) { + isArray = Array.isArray; + } + + function isHash(object) { + return object instanceof Hash; + } + + function isFunction(object) { + return typeof object === "function"; + } + + function isString(object) { + return _toString.call(object) === STRING_CLASS; + } + + function isNumber(object) { + return _toString.call(object) === NUMBER_CLASS; + } + + function isUndefined(object) { + return typeof object === "undefined"; + } + + extend(Object, { + extend: extend, + inspect: inspect, + toJSON: NATIVE_JSON_STRINGIFY_SUPPORT ? stringify : toJSON, + toQueryString: toQueryString, + toHTML: toHTML, + keys: Object.keys || keys, + values: values, + clone: clone, + isElement: isElement, + isArray: isArray, + isHash: isHash, + isFunction: isFunction, + isString: isString, + isNumber: isNumber, + isUndefined: isUndefined + }); +})(); +Object.extend(Function.prototype, (function() { + var slice = Array.prototype.slice; + + function update(array, args) { + var arrayLength = array.length, length = args.length; + while (length--) array[arrayLength + length] = args[length]; + return array; + } + + function merge(array, args) { + array = slice.call(array, 0); + return update(array, args); + } + + function argumentNames() { + var names = this.toString().match(/^[\s\(]*function[^(]*\(([^)]*)\)/)[1] + .replace(/\/\/.*?[\r\n]|\/\*(?:.|[\r\n])*?\*\//g, '') + .replace(/\s+/g, '').split(','); + return names.length == 1 && !names[0] ? [] : names; + } + + function bind(context) { + if (arguments.length < 2 && Object.isUndefined(arguments[0])) return this; + var __method = this, args = slice.call(arguments, 1); + return function() { + var a = merge(args, arguments); + return __method.apply(context, a); + } + } + + function bindAsEventListener(context) { + var __method = this, args = slice.call(arguments, 1); + return function(event) { + var a = update([event || window.event], args); + return __method.apply(context, a); + } + } + + function curry() { + if (!arguments.length) return this; + var __method = this, args = slice.call(arguments, 0); + return function() { + var a = merge(args, arguments); + return __method.apply(this, a); + } + } + + function delay(timeout) { + var __method = this, args = slice.call(arguments, 1); + timeout = timeout * 1000; + return window.setTimeout(function() { + return __method.apply(__method, args); + }, timeout); + } + + function defer() { + var args = update([0.01], arguments); + return this.delay.apply(this, args); + } + + function wrap(wrapper) { + var __method = this; + return function() { + var a = update([__method.bind(this)], arguments); + return wrapper.apply(this, a); + } + } + + function methodize() { + if (this._methodized) return this._methodized; + var __method = this; + return this._methodized = function() { + var a = update([this], arguments); + return __method.apply(null, a); + }; + } + + return { + argumentNames: argumentNames, + bind: bind, + bindAsEventListener: bindAsEventListener, + curry: curry, + delay: delay, + defer: defer, + wrap: wrap, + methodize: methodize + } +})()); + + + +(function(proto) { + + + function toISOString() { + return this.getUTCFullYear() + '-' + + (this.getUTCMonth() + 1).toPaddedString(2) + '-' + + this.getUTCDate().toPaddedString(2) + 'T' + + this.getUTCHours().toPaddedString(2) + ':' + + this.getUTCMinutes().toPaddedString(2) + ':' + + this.getUTCSeconds().toPaddedString(2) + 'Z'; + } + + + function toJSON() { + return this.toISOString(); + } + + if (!proto.toISOString) proto.toISOString = toISOString; + if (!proto.toJSON) proto.toJSON = toJSON; + +})(Date.prototype); + + RegExp.prototype.match = RegExp.prototype.test; RegExp.escape = function(str) { return String(str).replace(/([.*+?^=!:${}()|[\]\/\\])/g, '\\$1'); }; - -/*--------------------------------------------------------------------------*/ - var PeriodicalExecuter = Class.create({ initialize: function(callback, frequency) { this.callback = callback; @@ -319,8 +502,10 @@ var PeriodicalExecuter = Class.create({ try { this.currentlyExecuting = true; this.execute(); - } finally { this.currentlyExecuting = false; + } catch(e) { + this.currentlyExecuting = false; + throw e; } } } @@ -339,10 +524,28 @@ Object.extend(String, { } }); -Object.extend(String.prototype, { - gsub: function(pattern, replacement) { +Object.extend(String.prototype, (function() { + var NATIVE_JSON_PARSE_SUPPORT = window.JSON && + typeof JSON.parse === 'function' && + JSON.parse('{"test": true}').test; + + function prepareReplacement(replacement) { + if (Object.isFunction(replacement)) return replacement; + var template = new Template(replacement); + return function(match) { return template.evaluate(match) }; + } + + function gsub(pattern, replacement) { var result = '', source = this, match; - replacement = arguments.callee.prepareReplacement(replacement); + replacement = prepareReplacement(replacement); + + if (Object.isString(pattern)) + pattern = RegExp.escape(pattern); + + if (!(pattern.length || pattern.source)) { + replacement = replacement(''); + return replacement + source.split('').join(replacement) + replacement; + } while (source.length > 0) { if (match = source.match(pattern)) { @@ -354,76 +557,72 @@ Object.extend(String.prototype, { } } return result; - }, + } - sub: function(pattern, replacement, count) { - replacement = this.gsub.prepareReplacement(replacement); + function sub(pattern, replacement, count) { + replacement = prepareReplacement(replacement); count = Object.isUndefined(count) ? 1 : count; return this.gsub(pattern, function(match) { if (--count < 0) return match[0]; return replacement(match); }); - }, + } - scan: function(pattern, iterator) { + function scan(pattern, iterator) { this.gsub(pattern, iterator); return String(this); - }, + } - truncate: function(length, truncation) { + function truncate(length, truncation) { length = length || 30; truncation = Object.isUndefined(truncation) ? '...' : truncation; return this.length > length ? this.slice(0, length - truncation.length) + truncation : String(this); - }, + } - strip: function() { + function strip() { return this.replace(/^\s+/, '').replace(/\s+$/, ''); - }, + } - stripTags: function() { - return this.replace(/<\/?[^>]+>/gi, ''); - }, + function stripTags() { + return this.replace(/<\w+(\s+("[^"]*"|'[^']*'|[^>])+)?>|<\/\w+>/gi, ''); + } - stripScripts: function() { + function stripScripts() { return this.replace(new RegExp(Prototype.ScriptFragment, 'img'), ''); - }, + } - extractScripts: function() { - var matchAll = new RegExp(Prototype.ScriptFragment, 'img'); - var matchOne = new RegExp(Prototype.ScriptFragment, 'im'); + function extractScripts() { + var matchAll = new RegExp(Prototype.ScriptFragment, 'img'), + matchOne = new RegExp(Prototype.ScriptFragment, 'im'); return (this.match(matchAll) || []).map(function(scriptTag) { return (scriptTag.match(matchOne) || ['', ''])[1]; }); - }, + } - evalScripts: function() { + function evalScripts() { return this.extractScripts().map(function(script) { return eval(script) }); - }, + } - escapeHTML: function() { - var self = arguments.callee; - self.text.data = this; - return self.div.innerHTML; - }, + function escapeHTML() { + return this.replace(/&/g,'&').replace(//g,'>'); + } - unescapeHTML: function() { - var div = new Element('div'); - div.innerHTML = this.stripTags(); - return div.childNodes[0] ? (div.childNodes.length > 1 ? - $A(div.childNodes).inject('', function(memo, node) { return memo+node.nodeValue }) : - div.childNodes[0].nodeValue) : ''; - }, + function unescapeHTML() { + return this.stripTags().replace(/</g,'<').replace(/>/g,'>').replace(/&/g,'&'); + } - toQueryParams: function(separator) { + + function toQueryParams(separator) { var match = this.strip().match(/([^?#]*)(#.*)?$/); if (!match) return { }; return match[1].split(separator || '&').inject({ }, function(hash, pair) { if ((pair = pair.split('='))[0]) { - var key = decodeURIComponent(pair.shift()); - var value = pair.length > 1 ? pair.join('=') : pair[0]; + var key = decodeURIComponent(pair.shift()), + value = pair.length > 1 ? pair.join('=') : pair[0]; + if (value != undefined) value = decodeURIComponent(value); if (key in hash) { @@ -434,128 +633,144 @@ Object.extend(String.prototype, { } return hash; }); - }, + } - toArray: function() { + function toArray() { return this.split(''); - }, + } - succ: function() { + function succ() { return this.slice(0, this.length - 1) + String.fromCharCode(this.charCodeAt(this.length - 1) + 1); - }, + } - times: function(count) { + function times(count) { return count < 1 ? '' : new Array(count + 1).join(this); - }, + } - camelize: function() { - var parts = this.split('-'), len = parts.length; - if (len == 1) return parts[0]; + function camelize() { + return this.replace(/-+(.)?/g, function(match, chr) { + return chr ? chr.toUpperCase() : ''; + }); + } - var camelized = this.charAt(0) == '-' - ? parts[0].charAt(0).toUpperCase() + parts[0].substring(1) - : parts[0]; - - for (var i = 1; i < len; i++) - camelized += parts[i].charAt(0).toUpperCase() + parts[i].substring(1); - - return camelized; - }, - - capitalize: function() { + function capitalize() { return this.charAt(0).toUpperCase() + this.substring(1).toLowerCase(); - }, + } - underscore: function() { - return this.gsub(/::/, '/').gsub(/([A-Z]+)([A-Z][a-z])/,'#{1}_#{2}').gsub(/([a-z\d])([A-Z])/,'#{1}_#{2}').gsub(/-/,'_').toLowerCase(); - }, + function underscore() { + return this.replace(/::/g, '/') + .replace(/([A-Z]+)([A-Z][a-z])/g, '$1_$2') + .replace(/([a-z\d])([A-Z])/g, '$1_$2') + .replace(/-/g, '_') + .toLowerCase(); + } - dasherize: function() { - return this.gsub(/_/,'-'); - }, + function dasherize() { + return this.replace(/_/g, '-'); + } - inspect: function(useDoubleQuotes) { - var escapedString = this.gsub(/[\x00-\x1f\\]/, function(match) { - var character = String.specialChar[match[0]]; - return character ? character : '\\u00' + match[0].charCodeAt().toPaddedString(2, 16); + function inspect(useDoubleQuotes) { + var escapedString = this.replace(/[\x00-\x1f\\]/g, function(character) { + if (character in String.specialChar) { + return String.specialChar[character]; + } + return '\\u00' + character.charCodeAt().toPaddedString(2, 16); }); if (useDoubleQuotes) return '"' + escapedString.replace(/"/g, '\\"') + '"'; return "'" + escapedString.replace(/'/g, '\\\'') + "'"; - }, + } - toJSON: function() { - return this.inspect(true); - }, + function unfilterJSON(filter) { + return this.replace(filter || Prototype.JSONFilter, '$1'); + } - unfilterJSON: function(filter) { - return this.sub(filter || Prototype.JSONFilter, '#{1}'); - }, - - isJSON: function() { + function isJSON() { var str = this; if (str.blank()) return false; - str = this.replace(/\\./g, '@').replace(/"[^"\\\n\r]*"/g, ''); - return (/^[,:{}\[\]0-9.\-+Eaeflnr-u \n\r\t]*$/).test(str); - }, + str = str.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@'); + str = str.replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']'); + str = str.replace(/(?:^|:|,)(?:\s*\[)+/g, ''); + return (/^[\],:{}\s]*$/).test(str); + } - evalJSON: function(sanitize) { - var json = this.unfilterJSON(); + function evalJSON(sanitize) { + var json = this.unfilterJSON(), + cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g; + if (cx.test(json)) { + json = json.replace(cx, function (a) { + return '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }); + } try { if (!sanitize || json.isJSON()) return eval('(' + json + ')'); } catch (e) { } throw new SyntaxError('Badly formed JSON string: ' + this.inspect()); - }, + } - include: function(pattern) { + function parseJSON() { + var json = this.unfilterJSON(); + return JSON.parse(json); + } + + function include(pattern) { return this.indexOf(pattern) > -1; - }, + } - startsWith: function(pattern) { - return this.indexOf(pattern) === 0; - }, + function startsWith(pattern) { + return this.lastIndexOf(pattern, 0) === 0; + } - endsWith: function(pattern) { + function endsWith(pattern) { var d = this.length - pattern.length; - return d >= 0 && this.lastIndexOf(pattern) === d; - }, + return d >= 0 && this.indexOf(pattern, d) === d; + } - empty: function() { + function empty() { return this == ''; - }, + } - blank: function() { + function blank() { return /^\s*$/.test(this); - }, + } - interpolate: function(object, pattern) { + function interpolate(object, pattern) { return new Template(this, pattern).evaluate(object); } -}); -if (Prototype.Browser.WebKit || Prototype.Browser.IE) Object.extend(String.prototype, { - escapeHTML: function() { - return this.replace(/&/g,'&').replace(//g,'>'); - }, - unescapeHTML: function() { - return this.stripTags().replace(/&/g,'&').replace(/</g,'<').replace(/>/g,'>'); - } -}); - -String.prototype.gsub.prepareReplacement = function(replacement) { - if (Object.isFunction(replacement)) return replacement; - var template = new Template(replacement); - return function(match) { return template.evaluate(match) }; -}; - -String.prototype.parseQuery = String.prototype.toQueryParams; - -Object.extend(String.prototype.escapeHTML, { - div: document.createElement('div'), - text: document.createTextNode('') -}); - -String.prototype.escapeHTML.div.appendChild(String.prototype.escapeHTML.text); + return { + gsub: gsub, + sub: sub, + scan: scan, + truncate: truncate, + strip: String.prototype.trim || strip, + stripTags: stripTags, + stripScripts: stripScripts, + extractScripts: extractScripts, + evalScripts: evalScripts, + escapeHTML: escapeHTML, + unescapeHTML: unescapeHTML, + toQueryParams: toQueryParams, + parseQuery: toQueryParams, + toArray: toArray, + succ: succ, + times: times, + camelize: camelize, + capitalize: capitalize, + underscore: underscore, + dasherize: dasherize, + inspect: inspect, + unfilterJSON: unfilterJSON, + isJSON: isJSON, + evalJSON: NATIVE_JSON_PARSE_SUPPORT ? parseJSON : evalJSON, + include: include, + startsWith: startsWith, + endsWith: endsWith, + empty: empty, + blank: blank, + interpolate: interpolate + }; +})()); var Template = Class.create({ initialize: function(template, pattern) { @@ -564,22 +779,23 @@ var Template = Class.create({ }, evaluate: function(object) { - if (Object.isFunction(object.toTemplateReplacements)) + if (object && Object.isFunction(object.toTemplateReplacements)) object = object.toTemplateReplacements(); return this.template.gsub(this.pattern, function(match) { - if (object == null) return ''; + if (object == null) return (match[1] + ''); var before = match[1] || ''; if (before == '\\') return match[2]; - var ctx = object, expr = match[3]; - var pattern = /^([^.[]+|\[((?:.*?[^\\])?)\])(\.|\[|$)/; + var ctx = object, expr = match[3], + pattern = /^([^.[]+|\[((?:.*?[^\\])?)\])(\.|\[|$)/; + match = pattern.exec(expr); if (match == null) return before; while (match != null) { - var comp = match[1].startsWith('[') ? match[2].gsub('\\\\]', ']') : match[1]; + var comp = match[1].startsWith('[') ? match[2].replace(/\\\\]/g, ']') : match[1]; ctx = ctx[comp]; if (null == ctx || '' == match[3]) break; expr = expr.substring('[' == match[3] ? match[1].length : match[0].length); @@ -594,8 +810,8 @@ Template.Pattern = /(^|.|\r|\n)(#\{(.*?)\})/; var $break = { }; -var Enumerable = { - each: function(iterator, context) { +var Enumerable = (function() { + function each(iterator, context) { var index = 0; try { this._each(function(value) { @@ -605,17 +821,17 @@ var Enumerable = { if (e != $break) throw e; } return this; - }, + } - eachSlice: function(number, iterator, context) { + function eachSlice(number, iterator, context) { var index = -number, slices = [], array = this.toArray(); if (number < 1) return array; while ((index += number) < array.length) slices.push(array.slice(index, index+number)); return slices.collect(iterator, context); - }, + } - all: function(iterator, context) { + function all(iterator, context) { iterator = iterator || Prototype.K; var result = true; this.each(function(value, index) { @@ -623,9 +839,9 @@ var Enumerable = { if (!result) throw $break; }); return result; - }, + } - any: function(iterator, context) { + function any(iterator, context) { iterator = iterator || Prototype.K; var result = false; this.each(function(value, index) { @@ -633,18 +849,18 @@ var Enumerable = { throw $break; }); return result; - }, + } - collect: function(iterator, context) { + function collect(iterator, context) { iterator = iterator || Prototype.K; var results = []; this.each(function(value, index) { results.push(iterator.call(context, value, index)); }); return results; - }, + } - detect: function(iterator, context) { + function detect(iterator, context) { var result; this.each(function(value, index) { if (iterator.call(context, value, index)) { @@ -653,32 +869,32 @@ var Enumerable = { } }); return result; - }, + } - findAll: function(iterator, context) { + function findAll(iterator, context) { var results = []; this.each(function(value, index) { if (iterator.call(context, value, index)) results.push(value); }); return results; - }, + } - grep: function(filter, iterator, context) { + function grep(filter, iterator, context) { iterator = iterator || Prototype.K; var results = []; if (Object.isString(filter)) - filter = new RegExp(filter); + filter = new RegExp(RegExp.escape(filter)); this.each(function(value, index) { if (filter.match(value)) results.push(iterator.call(context, value, index)); }); return results; - }, + } - include: function(object) { + function include(object) { if (Object.isFunction(this.indexOf)) if (this.indexOf(object) != -1) return true; @@ -690,31 +906,31 @@ var Enumerable = { } }); return found; - }, + } - inGroupsOf: function(number, fillWith) { + function inGroupsOf(number, fillWith) { fillWith = Object.isUndefined(fillWith) ? null : fillWith; return this.eachSlice(number, function(slice) { while(slice.length < number) slice.push(fillWith); return slice; }); - }, + } - inject: function(memo, iterator, context) { + function inject(memo, iterator, context) { this.each(function(value, index) { memo = iterator.call(context, memo, value, index); }); return memo; - }, + } - invoke: function(method) { + function invoke(method) { var args = $A(arguments).slice(1); return this.map(function(value) { return value[method].apply(value, args); }); - }, + } - max: function(iterator, context) { + function max(iterator, context) { iterator = iterator || Prototype.K; var result; this.each(function(value, index) { @@ -723,9 +939,9 @@ var Enumerable = { result = value; }); return result; - }, + } - min: function(iterator, context) { + function min(iterator, context) { iterator = iterator || Prototype.K; var result; this.each(function(value, index) { @@ -734,9 +950,9 @@ var Enumerable = { result = value; }); return result; - }, + } - partition: function(iterator, context) { + function partition(iterator, context) { iterator = iterator || Prototype.K; var trues = [], falses = []; this.each(function(value, index) { @@ -744,26 +960,26 @@ var Enumerable = { trues : falses).push(value); }); return [trues, falses]; - }, + } - pluck: function(property) { + function pluck(property) { var results = []; this.each(function(value) { results.push(value[property]); }); return results; - }, + } - reject: function(iterator, context) { + function reject(iterator, context) { var results = []; this.each(function(value, index) { if (!iterator.call(context, value, index)) results.push(value); }); return results; - }, + } - sortBy: function(iterator, context) { + function sortBy(iterator, context) { return this.map(function(value, index) { return { value: value, @@ -773,13 +989,13 @@ var Enumerable = { var a = left.criteria, b = right.criteria; return a < b ? -1 : a > b ? 1 : 0; }).pluck('value'); - }, + } - toArray: function() { + function toArray() { return this.map(); - }, + } - zip: function() { + function zip() { var iterator = Prototype.K, args = $A(arguments); if (Object.isFunction(args.last())) iterator = args.pop(); @@ -788,159 +1004,66 @@ var Enumerable = { return this.map(function(value, index) { return iterator(collections.pluck(index)); }); - }, + } - size: function() { + function size() { return this.toArray().length; - }, + } - inspect: function() { + function inspect() { return '#'; } -}; -Object.extend(Enumerable, { - map: Enumerable.collect, - find: Enumerable.detect, - select: Enumerable.findAll, - filter: Enumerable.findAll, - member: Enumerable.include, - entries: Enumerable.toArray, - every: Enumerable.all, - some: Enumerable.any -}); + + + + + + + + + return { + each: each, + eachSlice: eachSlice, + all: all, + every: all, + any: any, + some: any, + collect: collect, + map: collect, + detect: detect, + findAll: findAll, + select: findAll, + filter: findAll, + grep: grep, + include: include, + member: include, + inGroupsOf: inGroupsOf, + inject: inject, + invoke: invoke, + max: max, + min: min, + partition: partition, + pluck: pluck, + reject: reject, + sortBy: sortBy, + toArray: toArray, + entries: toArray, + zip: zip, + size: size, + inspect: inspect, + find: detect + }; +})(); + function $A(iterable) { if (!iterable) return []; - if (iterable.toArray) return iterable.toArray(); + if ('toArray' in Object(iterable)) return iterable.toArray(); var length = iterable.length || 0, results = new Array(length); while (length--) results[length] = iterable[length]; return results; } -if (Prototype.Browser.WebKit) { - $A = function(iterable) { - if (!iterable) return []; - // In Safari, only use the `toArray` method if it's not a NodeList. - // A NodeList is a function, has an function `item` property, and a numeric - // `length` property. Adapted from Google Doctype. - if (!(typeof iterable === 'function' && typeof iterable.length === - 'number' && typeof iterable.item === 'function') && iterable.toArray) - return iterable.toArray(); - var length = iterable.length || 0, results = new Array(length); - while (length--) results[length] = iterable[length]; - return results; - }; -} - -Array.from = $A; - -Object.extend(Array.prototype, Enumerable); - -if (!Array.prototype._reverse) Array.prototype._reverse = Array.prototype.reverse; - -Object.extend(Array.prototype, { - _each: function(iterator) { - for (var i = 0, length = this.length; i < length; i++) - iterator(this[i]); - }, - - clear: function() { - this.length = 0; - return this; - }, - - first: function() { - return this[0]; - }, - - last: function() { - return this[this.length - 1]; - }, - - compact: function() { - return this.select(function(value) { - return value != null; - }); - }, - - flatten: function() { - return this.inject([], function(array, value) { - return array.concat(Object.isArray(value) ? - value.flatten() : [value]); - }); - }, - - without: function() { - var values = $A(arguments); - return this.select(function(value) { - return !values.include(value); - }); - }, - - reverse: function(inline) { - return (inline !== false ? this : this.toArray())._reverse(); - }, - - reduce: function() { - return this.length > 1 ? this : this[0]; - }, - - uniq: function(sorted) { - return this.inject([], function(array, value, index) { - if (0 == index || (sorted ? array.last() != value : !array.include(value))) - array.push(value); - return array; - }); - }, - - intersect: function(array) { - return this.uniq().findAll(function(item) { - return array.detect(function(value) { return item === value }); - }); - }, - - clone: function() { - return [].concat(this); - }, - - size: function() { - return this.length; - }, - - inspect: function() { - return '[' + this.map(Object.inspect).join(', ') + ']'; - }, - - toJSON: function() { - var results = []; - this.each(function(object) { - var value = Object.toJSON(object); - if (!Object.isUndefined(value)) results.push(value); - }); - return '[' + results.join(', ') + ']'; - } -}); - -// use native browser JS 1.6 implementation if available -if (Object.isFunction(Array.prototype.forEach)) - Array.prototype._each = Array.prototype.forEach; - -if (!Array.prototype.indexOf) Array.prototype.indexOf = function(item, i) { - i || (i = 0); - var length = this.length; - if (i < 0) i = length + i; - for (; i < length; i++) - if (this[i] === item) return i; - return -1; -}; - -if (!Array.prototype.lastIndexOf) Array.prototype.lastIndexOf = function(item, i) { - i = isNaN(i) ? this.length : (i < 0 ? this.length + i : i) + 1; - var n = this.slice(0, i).reverse().indexOf(item); - return (n < 0) ? n : i - n - 1; -}; - -Array.prototype.toArray = Array.prototype.clone; function $w(string) { if (!Object.isString(string)) return []; @@ -948,176 +1071,342 @@ function $w(string) { return string ? string.split(/\s+/) : []; } -if (Prototype.Browser.Opera){ - Array.prototype.concat = function() { - var array = []; - for (var i = 0, length = this.length; i < length; i++) array.push(this[i]); +Array.from = $A; + + +(function() { + var arrayProto = Array.prototype, + slice = arrayProto.slice, + _each = arrayProto.forEach; // use native browser JS 1.6 implementation if available + + function each(iterator) { + for (var i = 0, length = this.length; i < length; i++) + iterator(this[i]); + } + if (!_each) _each = each; + + function clear() { + this.length = 0; + return this; + } + + function first() { + return this[0]; + } + + function last() { + return this[this.length - 1]; + } + + function compact() { + return this.select(function(value) { + return value != null; + }); + } + + function flatten() { + return this.inject([], function(array, value) { + if (Object.isArray(value)) + return array.concat(value.flatten()); + array.push(value); + return array; + }); + } + + function without() { + var values = slice.call(arguments, 0); + return this.select(function(value) { + return !values.include(value); + }); + } + + function reverse(inline) { + return (inline === false ? this.toArray() : this)._reverse(); + } + + function uniq(sorted) { + return this.inject([], function(array, value, index) { + if (0 == index || (sorted ? array.last() != value : !array.include(value))) + array.push(value); + return array; + }); + } + + function intersect(array) { + return this.uniq().findAll(function(item) { + return array.detect(function(value) { return item === value }); + }); + } + + + function clone() { + return slice.call(this, 0); + } + + function size() { + return this.length; + } + + function inspect() { + return '[' + this.map(Object.inspect).join(', ') + ']'; + } + + function indexOf(item, i) { + i || (i = 0); + var length = this.length; + if (i < 0) i = length + i; + for (; i < length; i++) + if (this[i] === item) return i; + return -1; + } + + function lastIndexOf(item, i) { + i = isNaN(i) ? this.length : (i < 0 ? this.length + i : i) + 1; + var n = this.slice(0, i).reverse().indexOf(item); + return (n < 0) ? n : i - n - 1; + } + + function concat() { + var array = slice.call(this, 0), item; for (var i = 0, length = arguments.length; i < length; i++) { - if (Object.isArray(arguments[i])) { - for (var j = 0, arrayLength = arguments[i].length; j < arrayLength; j++) - array.push(arguments[i][j]); + item = arguments[i]; + if (Object.isArray(item) && !('callee' in item)) { + for (var j = 0, arrayLength = item.length; j < arrayLength; j++) + array.push(item[j]); } else { - array.push(arguments[i]); + array.push(item); } } return array; - }; -} -Object.extend(Number.prototype, { - toColorPart: function() { - return this.toPaddedString(2, 16); - }, - - succ: function() { - return this + 1; - }, - - times: function(iterator, context) { - $R(0, this, true).each(iterator, context); - return this; - }, - - toPaddedString: function(length, radix) { - var string = this.toString(radix || 10); - return '0'.times(length - string.length) + string; - }, - - toJSON: function() { - return isFinite(this) ? this.toString() : 'null'; } -}); -$w('abs round ceil floor').each(function(method){ - Number.prototype[method] = Math[method].methodize(); -}); + Object.extend(arrayProto, Enumerable); + + if (!arrayProto._reverse) + arrayProto._reverse = arrayProto.reverse; + + Object.extend(arrayProto, { + _each: _each, + clear: clear, + first: first, + last: last, + compact: compact, + flatten: flatten, + without: without, + reverse: reverse, + uniq: uniq, + intersect: intersect, + clone: clone, + toArray: clone, + size: size, + inspect: inspect + }); + + var CONCAT_ARGUMENTS_BUGGY = (function() { + return [].concat(arguments)[0][0] !== 1; + })(1,2) + + if (CONCAT_ARGUMENTS_BUGGY) arrayProto.concat = concat; + + if (!arrayProto.indexOf) arrayProto.indexOf = indexOf; + if (!arrayProto.lastIndexOf) arrayProto.lastIndexOf = lastIndexOf; +})(); function $H(object) { return new Hash(object); }; var Hash = Class.create(Enumerable, (function() { + function initialize(object) { + this._object = Object.isHash(object) ? object.toObject() : Object.clone(object); + } + + + function _each(iterator) { + for (var key in this._object) { + var value = this._object[key], pair = [key, value]; + pair.key = key; + pair.value = value; + iterator(pair); + } + } + + function set(key, value) { + return this._object[key] = value; + } + + function get(key) { + if (this._object[key] !== Object.prototype[key]) + return this._object[key]; + } + + function unset(key) { + var value = this._object[key]; + delete this._object[key]; + return value; + } + + function toObject() { + return Object.clone(this._object); + } + + + + function keys() { + return this.pluck('key'); + } + + function values() { + return this.pluck('value'); + } + + function index(value) { + var match = this.detect(function(pair) { + return pair.value === value; + }); + return match && match.key; + } + + function merge(object) { + return this.clone().update(object); + } + + function update(object) { + return new Hash(object).inject(this, function(result, pair) { + result.set(pair.key, pair.value); + return result; + }); + } function toQueryPair(key, value) { if (Object.isUndefined(value)) return key; return key + '=' + encodeURIComponent(String.interpret(value)); } - return { - initialize: function(object) { - this._object = Object.isHash(object) ? object.toObject() : Object.clone(object); - }, + function toQueryString() { + return this.inject([], function(results, pair) { + var key = encodeURIComponent(pair.key), values = pair.value; - _each: function(iterator) { - for (var key in this._object) { - var value = this._object[key], pair = [key, value]; - pair.key = key; - pair.value = value; - iterator(pair); - } - }, - - set: function(key, value) { - return this._object[key] = value; - }, - - get: function(key) { - // simulating poorly supported hasOwnProperty - if (this._object[key] !== Object.prototype[key]) - return this._object[key]; - }, - - unset: function(key) { - var value = this._object[key]; - delete this._object[key]; - return value; - }, - - toObject: function() { - return Object.clone(this._object); - }, - - keys: function() { - return this.pluck('key'); - }, - - values: function() { - return this.pluck('value'); - }, - - index: function(value) { - var match = this.detect(function(pair) { - return pair.value === value; - }); - return match && match.key; - }, - - merge: function(object) { - return this.clone().update(object); - }, - - update: function(object) { - return new Hash(object).inject(this, function(result, pair) { - result.set(pair.key, pair.value); - return result; - }); - }, - - toQueryString: function() { - return this.inject([], function(results, pair) { - var key = encodeURIComponent(pair.key), values = pair.value; - - if (values && typeof values == 'object') { - if (Object.isArray(values)) - return results.concat(values.map(toQueryPair.curry(key))); - } else results.push(toQueryPair(key, values)); - return results; - }).join('&'); - }, - - inspect: function() { - return '#'; - }, - - toJSON: function() { - return Object.toJSON(this.toObject()); - }, - - clone: function() { - return new Hash(this); - } + if (values && typeof values == 'object') { + if (Object.isArray(values)) + return results.concat(values.map(toQueryPair.curry(key))); + } else results.push(toQueryPair(key, values)); + return results; + }).join('&'); } + + function inspect() { + return '#'; + } + + function clone() { + return new Hash(this); + } + + return { + initialize: initialize, + _each: _each, + set: set, + get: get, + unset: unset, + toObject: toObject, + toTemplateReplacements: toObject, + keys: keys, + values: values, + index: index, + merge: merge, + update: update, + toQueryString: toQueryString, + inspect: inspect, + toJSON: toObject, + clone: clone + }; })()); -Hash.prototype.toTemplateReplacements = Hash.prototype.toObject; Hash.from = $H; -var ObjectRange = Class.create(Enumerable, { - initialize: function(start, end, exclusive) { +Object.extend(Number.prototype, (function() { + function toColorPart() { + return this.toPaddedString(2, 16); + } + + function succ() { + return this + 1; + } + + function times(iterator, context) { + $R(0, this, true).each(iterator, context); + return this; + } + + function toPaddedString(length, radix) { + var string = this.toString(radix || 10); + return '0'.times(length - string.length) + string; + } + + function abs() { + return Math.abs(this); + } + + function round() { + return Math.round(this); + } + + function ceil() { + return Math.ceil(this); + } + + function floor() { + return Math.floor(this); + } + + return { + toColorPart: toColorPart, + succ: succ, + times: times, + toPaddedString: toPaddedString, + abs: abs, + round: round, + ceil: ceil, + floor: floor + }; +})()); + +function $R(start, end, exclusive) { + return new ObjectRange(start, end, exclusive); +} + +var ObjectRange = Class.create(Enumerable, (function() { + function initialize(start, end, exclusive) { this.start = start; this.end = end; this.exclusive = exclusive; - }, + } - _each: function(iterator) { + function _each(iterator) { var value = this.start; while (this.include(value)) { iterator(value); value = value.succ(); } - }, + } - include: function(value) { + function include(value) { if (value < this.start) return false; if (this.exclusive) return value < this.end; return value <= this.end; } -}); -var $R = function(start, end, exclusive) { - return new ObjectRange(start, end, exclusive); -}; + return { + initialize: initialize, + _each: _each, + include: include + }; +})()); + + var Ajax = { getTransport: function() { @@ -1164,7 +1453,6 @@ Ajax.Responders.register({ onCreate: function() { Ajax.activeRequestCount++ }, onComplete: function() { Ajax.activeRequestCount-- } }); - Ajax.Base = Class.create({ initialize: function(options) { this.options = { @@ -1186,7 +1474,6 @@ Ajax.Base = Class.create({ this.options.parameters = this.options.parameters.toObject(); } }); - Ajax.Request = Class.create(Ajax.Base, { _complete: false, @@ -1202,7 +1489,6 @@ Ajax.Request = Class.create(Ajax.Base, { var params = Object.clone(this.options.parameters); if (!['get', 'post'].include(this.method)) { - // simulate other verbs over post params['_method'] = this.method; this.method = 'post'; } @@ -1210,7 +1496,6 @@ Ajax.Request = Class.create(Ajax.Base, { this.parameters = params; if (params = Object.toQueryString(params)) { - // when GET, append parameters to URL if (this.method == 'get') this.url += (this.url.include('?') ? '&' : '?') + params; else if (/Konqueror|Safari|KHTML/.test(navigator.userAgent)) @@ -1269,7 +1554,6 @@ Ajax.Request = Class.create(Ajax.Base, { headers['Connection'] = 'close'; } - // user-defined headers if (typeof this.options.requestHeaders == 'object') { var extras = this.options.requestHeaders; @@ -1323,7 +1607,6 @@ Ajax.Request = Class.create(Ajax.Base, { } if (state == 'Complete') { - // avoid memory leak in MSIE: clean up this.transport.onreadystatechange = Prototype.emptyFunction; } }, @@ -1340,7 +1623,7 @@ Ajax.Request = Class.create(Ajax.Base, { getHeader: function(name) { try { return this.transport.getResponseHeader(name) || null; - } catch (e) { return null } + } catch (e) { return null; } }, evalResponse: function() { @@ -1360,20 +1643,27 @@ Ajax.Request = Class.create(Ajax.Base, { Ajax.Request.Events = ['Uninitialized', 'Loading', 'Loaded', 'Interactive', 'Complete']; + + + + + + + Ajax.Response = Class.create({ initialize: function(request){ this.request = request; var transport = this.transport = request.transport, readyState = this.readyState = transport.readyState; - if((readyState > 2 && !Prototype.Browser.IE) || readyState == 4) { + if ((readyState > 2 && !Prototype.Browser.IE) || readyState == 4) { this.status = this.getStatus(); this.statusText = this.getStatusText(); this.responseText = String.interpret(transport.responseText); this.headerJSON = this._getHeaderJSON(); } - if(readyState == 4) { + if (readyState == 4) { var xml = transport.responseXML; this.responseXML = Object.isUndefined(xml) ? null : xml; this.responseJSON = this._getResponseJSON(); @@ -1381,6 +1671,7 @@ Ajax.Response = Class.create({ }, status: 0, + statusText: '', getStatus: Ajax.Request.prototype.getStatus, @@ -1510,6 +1801,8 @@ Ajax.PeriodicalUpdater = Class.create(Ajax.Base, { this.updater = new Ajax.Updater(this.container, this.url, this.options); } }); + + function $(element) { if (arguments.length > 1) { for (var i = 0, elements = [], length = arguments.length; i < length; i++) @@ -1534,10 +1827,9 @@ if (Prototype.BrowserFeatures.XPath) { /*--------------------------------------------------------------------------*/ -if (!window.Node) var Node = { }; +if (!Node) var Node = { }; if (!Node.ELEMENT_NODE) { - // DOM level 2 ECMAScript Language Binding Object.extend(Node, { ELEMENT_NODE: 1, ATTRIBUTE_NODE: 2, @@ -1554,13 +1846,27 @@ if (!Node.ELEMENT_NODE) { }); } -(function() { - var element = this.Element; - this.Element = function(tagName, attributes) { + + +(function(global) { + + var HAS_EXTENDED_CREATE_ELEMENT_SYNTAX = (function(){ + try { + var el = document.createElement(''); + return el.tagName.toLowerCase() === 'input' && el.name === 'x'; + } + catch(err) { + return false; + } + })(); + + var element = global.Element; + + global.Element = function(tagName, attributes) { attributes = attributes || { }; tagName = tagName.toLowerCase(); var cache = Element.cache; - if (Prototype.Browser.IE && attributes.name) { + if (HAS_EXTENDED_CREATE_ELEMENT_SYNTAX && attributes.name) { tagName = '<' + tagName + ' name="' + attributes.name + '">'; delete attributes.name; return Element.writeAttribute(document.createElement(tagName), attributes); @@ -1568,12 +1874,24 @@ if (!Node.ELEMENT_NODE) { if (!cache[tagName]) cache[tagName] = Element.extend(document.createElement(tagName)); return Element.writeAttribute(cache[tagName].cloneNode(false), attributes); }; - Object.extend(this.Element, element || { }); - if (element) this.Element.prototype = element.prototype; -}).call(window); + Object.extend(global.Element, element || { }); + if (element) global.Element.prototype = element.prototype; + +})(this); + +Element.idCounter = 1; Element.cache = { }; +function purgeElement(element) { + var uid = element._prototypeUID; + if (uid) { + Element.stopObserving(element); + element._prototypeUID = void 0; + delete Element.Storage[uid]; + } +} + Element.Methods = { visible: function(element) { return $(element).style.display != 'none'; @@ -1603,15 +1921,93 @@ Element.Methods = { return element; }, - update: function(element, content) { - element = $(element); - if (content && content.toElement) content = content.toElement(); - if (Object.isElement(content)) return element.update().insert(content); - content = Object.toHTML(content); - element.innerHTML = content.stripScripts(); - content.evalScripts.bind(content).defer(); - return element; - }, + update: (function(){ + + var SELECT_ELEMENT_INNERHTML_BUGGY = (function(){ + var el = document.createElement("select"), + isBuggy = true; + el.innerHTML = ""; + if (el.options && el.options[0]) { + isBuggy = el.options[0].nodeName.toUpperCase() !== "OPTION"; + } + el = null; + return isBuggy; + })(); + + var TABLE_ELEMENT_INNERHTML_BUGGY = (function(){ + try { + var el = document.createElement("table"); + if (el && el.tBodies) { + el.innerHTML = "test"; + var isBuggy = typeof el.tBodies[0] == "undefined"; + el = null; + return isBuggy; + } + } catch (e) { + return true; + } + })(); + + var SCRIPT_ELEMENT_REJECTS_TEXTNODE_APPENDING = (function () { + var s = document.createElement("script"), + isBuggy = false; + try { + s.appendChild(document.createTextNode("")); + isBuggy = !s.firstChild || + s.firstChild && s.firstChild.nodeType !== 3; + } catch (e) { + isBuggy = true; + } + s = null; + return isBuggy; + })(); + + function update(element, content) { + element = $(element); + + var descendants = element.getElementsByTagName('*'), + i = descendants.length; + while (i--) purgeElement(descendants[i]); + + if (content && content.toElement) + content = content.toElement(); + + if (Object.isElement(content)) + return element.update().insert(content); + + content = Object.toHTML(content); + + var tagName = element.tagName.toUpperCase(); + + if (tagName === 'SCRIPT' && SCRIPT_ELEMENT_REJECTS_TEXTNODE_APPENDING) { + element.text = content; + return element; + } + + if (SELECT_ELEMENT_INNERHTML_BUGGY || TABLE_ELEMENT_INNERHTML_BUGGY) { + if (tagName in Element._insertionTranslations.tags) { + while (element.firstChild) { + element.removeChild(element.firstChild); + } + Element._getContentFromAnonymousElement(tagName, content.stripScripts()) + .each(function(node) { + element.appendChild(node) + }); + } + else { + element.innerHTML = content.stripScripts(); + } + } + else { + element.innerHTML = content.stripScripts(); + } + + content.evalScripts.bind(content).defer(); + return element; + } + + return update; + })(), replace: function(element, content) { element = $(element); @@ -1679,28 +2075,35 @@ Element.Methods = { element = $(element); var result = '<' + element.tagName.toLowerCase(); $H({'id': 'id', 'className': 'class'}).each(function(pair) { - var property = pair.first(), attribute = pair.last(); - var value = (element[property] || '').toString(); + var property = pair.first(), + attribute = pair.last(), + value = (element[property] || '').toString(); if (value) result += ' ' + attribute + '=' + value.inspect(true); }); return result + '>'; }, - recursivelyCollect: function(element, property) { + recursivelyCollect: function(element, property, maximumLength) { element = $(element); + maximumLength = maximumLength || -1; var elements = []; - while (element = element[property]) + + while (element = element[property]) { if (element.nodeType == 1) elements.push(Element.extend(element)); + if (elements.length == maximumLength) + break; + } + return elements; }, ancestors: function(element) { - return $(element).recursivelyCollect('parentNode'); + return Element.recursivelyCollect(element, 'parentNode'); }, descendants: function(element) { - return $(element).select("*"); + return Element.select(element, "*"); }, firstDescendant: function(element) { @@ -1710,78 +2113,96 @@ Element.Methods = { }, immediateDescendants: function(element) { - if (!(element = $(element).firstChild)) return []; - while (element && element.nodeType != 1) element = element.nextSibling; - if (element) return [element].concat($(element).nextSiblings()); - return []; + var results = [], child = $(element).firstChild; + while (child) { + if (child.nodeType === 1) { + results.push(Element.extend(child)); + } + child = child.nextSibling; + } + return results; }, - previousSiblings: function(element) { - return $(element).recursivelyCollect('previousSibling'); + previousSiblings: function(element, maximumLength) { + return Element.recursivelyCollect(element, 'previousSibling'); }, nextSiblings: function(element) { - return $(element).recursivelyCollect('nextSibling'); + return Element.recursivelyCollect(element, 'nextSibling'); }, siblings: function(element) { element = $(element); - return element.previousSiblings().reverse().concat(element.nextSiblings()); + return Element.previousSiblings(element).reverse() + .concat(Element.nextSiblings(element)); }, match: function(element, selector) { + element = $(element); if (Object.isString(selector)) - selector = new Selector(selector); - return selector.match($(element)); + return Prototype.Selector.match(element, selector); + return selector.match(element); }, up: function(element, expression, index) { element = $(element); if (arguments.length == 1) return $(element.parentNode); - var ancestors = element.ancestors(); + var ancestors = Element.ancestors(element); return Object.isNumber(expression) ? ancestors[expression] : - Selector.findElement(ancestors, expression, index); + Prototype.Selector.find(ancestors, expression, index); }, down: function(element, expression, index) { element = $(element); - if (arguments.length == 1) return element.firstDescendant(); - return Object.isNumber(expression) ? element.descendants()[expression] : + if (arguments.length == 1) return Element.firstDescendant(element); + return Object.isNumber(expression) ? Element.descendants(element)[expression] : Element.select(element, expression)[index || 0]; }, previous: function(element, expression, index) { element = $(element); - if (arguments.length == 1) return $(Selector.handlers.previousElementSibling(element)); - var previousSiblings = element.previousSiblings(); - return Object.isNumber(expression) ? previousSiblings[expression] : - Selector.findElement(previousSiblings, expression, index); + if (Object.isNumber(expression)) index = expression, expression = false; + if (!Object.isNumber(index)) index = 0; + + if (expression) { + return Prototype.Selector.find(element.previousSiblings(), expression, index); + } else { + return element.recursivelyCollect("previousSibling", index + 1)[index]; + } }, next: function(element, expression, index) { element = $(element); - if (arguments.length == 1) return $(Selector.handlers.nextElementSibling(element)); - var nextSiblings = element.nextSiblings(); - return Object.isNumber(expression) ? nextSiblings[expression] : - Selector.findElement(nextSiblings, expression, index); + if (Object.isNumber(expression)) index = expression, expression = false; + if (!Object.isNumber(index)) index = 0; + + if (expression) { + return Prototype.Selector.find(element.nextSiblings(), expression, index); + } else { + var maximumLength = Object.isNumber(index) ? index + 1 : 1; + return element.recursivelyCollect("nextSibling", index + 1)[index]; + } }, - select: function() { - var args = $A(arguments), element = $(args.shift()); - return Selector.findChildElements(element, args); + + select: function(element) { + element = $(element); + var expressions = Array.prototype.slice.call(arguments, 1).join(', '); + return Prototype.Selector.select(expressions, element); }, - adjacent: function() { - var args = $A(arguments), element = $(args.shift()); - return Selector.findChildElements(element.parentNode, args).without(element); + adjacent: function(element) { + element = $(element); + var expressions = Array.prototype.slice.call(arguments, 1).join(', '); + return Prototype.Selector.select(expressions, element.parentNode).without(element); }, identify: function(element) { element = $(element); - var id = element.readAttribute('id'), self = arguments.callee; + var id = Element.readAttribute(element, 'id'); if (id) return id; - do { id = 'anonymous_element_' + self.counter++ } while ($(id)); - element.writeAttribute('id', id); + do { id = 'anonymous_element_' + Element.idCounter++ } while ($(id)); + Element.writeAttribute(element, 'id', id); return id; }, @@ -1820,11 +2241,11 @@ Element.Methods = { }, getHeight: function(element) { - return $(element).getDimensions().height; + return Element.getDimensions(element).height; }, getWidth: function(element) { - return $(element).getDimensions().width; + return Element.getDimensions(element).width; }, classNames: function(element) { @@ -1840,7 +2261,7 @@ Element.Methods = { addClassName: function(element, className) { if (!(element = $(element))) return; - if (!element.hasClassName(className)) + if (!Element.hasClassName(element, className)) element.className += (element.className ? ' ' : '') + className; return element; }, @@ -1854,11 +2275,10 @@ Element.Methods = { toggleClassName: function(element, className) { if (!(element = $(element))) return; - return element[element.hasClassName(className) ? - 'removeClassName' : 'addClassName'](className); + return Element[Element.hasClassName(element, className) ? + 'removeClassName' : 'addClassName'](element, className); }, - // removes whitespace-only text node children cleanWhitespace: function(element) { element = $(element); var node = element.firstChild; @@ -1892,7 +2312,7 @@ Element.Methods = { scrollTo: function(element) { element = $(element); - var pos = element.cumulativeOffset(); + var pos = Element.cumulativeOffset(element); window.scrollTo(pos[0], pos[1]); return element; }, @@ -1938,37 +2358,12 @@ Element.Methods = { return element; }, - getDimensions: function(element) { - element = $(element); - var display = element.getStyle('display'); - if (display != 'none' && display != null) // Safari bug - return {width: element.offsetWidth, height: element.offsetHeight}; - - // All *Width and *Height properties give 0 on elements with display none, - // so enable the element temporarily - var els = element.style; - var originalVisibility = els.visibility; - var originalPosition = els.position; - var originalDisplay = els.display; - els.visibility = 'hidden'; - els.position = 'absolute'; - els.display = 'block'; - var originalWidth = element.clientWidth; - var originalHeight = element.clientHeight; - els.display = originalDisplay; - els.position = originalPosition; - els.visibility = originalVisibility; - return {width: originalWidth, height: originalHeight}; - }, - makePositioned: function(element) { element = $(element); var pos = Element.getStyle(element, 'position'); if (pos == 'static' || !pos) { element._madePositioned = true; element.style.position = 'relative'; - // Opera returns the offset relative to the positioning context, when an - // element is position relative but top and left have not been defined if (Prototype.Browser.Opera) { element.style.top = 0; element.style.left = 0; @@ -2009,11 +2404,13 @@ Element.Methods = { cumulativeOffset: function(element) { var valueT = 0, valueL = 0; - do { - valueT += element.offsetTop || 0; - valueL += element.offsetLeft || 0; - element = element.offsetParent; - } while (element); + if (element.parentNode) { + do { + valueT += element.offsetTop || 0; + valueL += element.offsetLeft || 0; + element = element.offsetParent; + } while (element); + } return Element._returnOffset(valueL, valueT); }, @@ -2034,14 +2431,13 @@ Element.Methods = { absolutize: function(element) { element = $(element); - if (element.getStyle('position') == 'absolute') return element; - // Position.prepare(); // To be done manually by Scripty when it needs it. + if (Element.getStyle(element, 'position') == 'absolute') return element; - var offsets = element.positionedOffset(); - var top = offsets[1]; - var left = offsets[0]; - var width = element.clientWidth; - var height = element.clientHeight; + var offsets = Element.positionedOffset(element), + top = offsets[1], + left = offsets[0], + width = element.clientWidth, + height = element.clientHeight; element._originalLeft = left - parseFloat(element.style.left || 0); element._originalTop = top - parseFloat(element.style.top || 0); @@ -2058,12 +2454,11 @@ Element.Methods = { relativize: function(element) { element = $(element); - if (element.getStyle('position') == 'relative') return element; - // Position.prepare(); // To be done manually by Scripty when it needs it. + if (Element.getStyle(element, 'position') == 'relative') return element; element.style.position = 'relative'; - var top = parseFloat(element.style.top || 0) - (element._originalTop || 0); - var left = parseFloat(element.style.left || 0) - (element._originalLeft || 0); + var top = parseFloat(element.style.top || 0) - (element._originalTop || 0), + left = parseFloat(element.style.left || 0) - (element._originalLeft || 0); element.style.top = top + 'px'; element.style.left = left + 'px'; @@ -2094,14 +2489,14 @@ Element.Methods = { }, viewportOffset: function(forElement) { - var valueT = 0, valueL = 0; + var valueT = 0, + valueL = 0, + element = forElement; - var element = forElement; do { valueT += element.offsetTop || 0; valueL += element.offsetLeft || 0; - // Safari fix if (element.offsetParent == document.body && Element.getStyle(element, 'position') == 'absolute') break; @@ -2128,28 +2523,21 @@ Element.Methods = { offsetLeft: 0 }, arguments[2] || { }); - // find page position of source source = $(source); - var p = source.viewportOffset(); + var p = Element.viewportOffset(source), delta = [0, 0], parent = null; - // find coordinate system to use element = $(element); - var delta = [0, 0]; - var parent = null; - // delta [0,0] will do fine with position: fixed elements, - // position:absolute needs offsetParent deltas + if (Element.getStyle(element, 'position') == 'absolute') { - parent = element.getOffsetParent(); - delta = parent.viewportOffset(); + parent = Element.getOffsetParent(element); + delta = Element.viewportOffset(parent); } - // correct by body offsets (fixes Safari) if (parent == document.body) { delta[0] -= document.body.offsetLeft; delta[1] -= document.body.offsetTop; } - // set position if (options.setLeft) element.style.left = (p[0] - delta[0] + options.offsetLeft) + 'px'; if (options.setTop) element.style.top = (p[1] - delta[1] + options.offsetTop) + 'px'; if (options.setWidth) element.style.width = source.offsetWidth + 'px'; @@ -2158,10 +2546,9 @@ Element.Methods = { } }; -Element.Methods.identify.counter = 1; - Object.extend(Element.Methods, { getElementsBySelector: Element.Methods.select, + childElements: Element.Methods.immediateDescendants }); @@ -2182,11 +2569,8 @@ if (Prototype.Browser.Opera) { case 'left': case 'top': case 'right': case 'bottom': if (proceed(element, 'position') === 'static') return null; case 'height': case 'width': - // returns '0px' for hidden elements; we want it to return null if (!Element.visible(element)) return null; - // returns the border-box dimensions rather than the content-box - // dimensions, so we subtract padding and borders from the value var dim = parseInt(proceed(element, style), 10); if (dim !== element['offset' + style.capitalize()]) @@ -2219,14 +2603,10 @@ if (Prototype.Browser.Opera) { } else if (Prototype.Browser.IE) { - // IE doesn't report offsets correctly for static elements, so we change them - // to "relative" to get the values, then change them back. Element.Methods.getOffsetParent = Element.Methods.getOffsetParent.wrap( function(proceed, element) { element = $(element); - // IE throws an error if element is not in document - try { element.offsetParent } - catch(e) { return $(document.body) } + if (!element.parentNode) return $(document.body); var position = element.getStyle('position'); if (position !== 'static') return proceed(element); element.setStyle({ position: 'relative' }); @@ -2240,12 +2620,9 @@ else if (Prototype.Browser.IE) { Element.Methods[method] = Element.Methods[method].wrap( function(proceed, element) { element = $(element); - try { element.offsetParent } - catch(e) { return Element._returnOffset(0,0) } + if (!element.parentNode) return Element._returnOffset(0, 0); var position = element.getStyle('position'); if (position !== 'static') return proceed(element); - // Trigger hasLayout on the offset parent so that IE6 reports - // accurate offsetTop and offsetLeft values for position: fixed. var offsetParent = element.getOffsetParent(); if (offsetParent && offsetParent.getStyle('position') === 'fixed') offsetParent.setStyle({ zoom: 1 }); @@ -2257,14 +2634,6 @@ else if (Prototype.Browser.IE) { ); }); - Element.Methods.cumulativeOffset = Element.Methods.cumulativeOffset.wrap( - function(proceed, element) { - try { element.offsetParent } - catch(e) { return Element._returnOffset(0,0) } - return proceed(element); - } - ); - Element.Methods.getStyle = function(element, style) { element = $(element); style = (style == 'float' || style == 'cssFloat') ? 'styleFloat' : style.camelize(); @@ -2306,36 +2675,90 @@ else if (Prototype.Browser.IE) { return element; }; - Element._attributeTranslations = { - read: { - names: { - 'class': 'className', - 'for': 'htmlFor' - }, - values: { - _getAttr: function(element, attribute) { - return element.getAttribute(attribute, 2); + Element._attributeTranslations = (function(){ + + var classProp = 'className', + forProp = 'for', + el = document.createElement('div'); + + el.setAttribute(classProp, 'x'); + + if (el.className !== 'x') { + el.setAttribute('class', 'x'); + if (el.className === 'x') { + classProp = 'class'; + } + } + el = null; + + el = document.createElement('label'); + el.setAttribute(forProp, 'x'); + if (el.htmlFor !== 'x') { + el.setAttribute('htmlFor', 'x'); + if (el.htmlFor === 'x') { + forProp = 'htmlFor'; + } + } + el = null; + + return { + read: { + names: { + 'class': classProp, + 'className': classProp, + 'for': forProp, + 'htmlFor': forProp }, - _getAttrNode: function(element, attribute) { - var node = element.getAttributeNode(attribute); - return node ? node.value : ""; - }, - _getEv: function(element, attribute) { - attribute = element.getAttribute(attribute); - return attribute ? attribute.toString().slice(23, -2) : null; - }, - _flag: function(element, attribute) { - return $(element).hasAttribute(attribute) ? attribute : null; - }, - style: function(element) { - return element.style.cssText.toLowerCase(); - }, - title: function(element) { - return element.title; + values: { + _getAttr: function(element, attribute) { + return element.getAttribute(attribute); + }, + _getAttr2: function(element, attribute) { + return element.getAttribute(attribute, 2); + }, + _getAttrNode: function(element, attribute) { + var node = element.getAttributeNode(attribute); + return node ? node.value : ""; + }, + _getEv: (function(){ + + var el = document.createElement('div'), f; + el.onclick = Prototype.emptyFunction; + var value = el.getAttribute('onclick'); + + if (String(value).indexOf('{') > -1) { + f = function(element, attribute) { + attribute = element.getAttribute(attribute); + if (!attribute) return null; + attribute = attribute.toString(); + attribute = attribute.split('{')[1]; + attribute = attribute.split('}')[0]; + return attribute.strip(); + }; + } + else if (value === '') { + f = function(element, attribute) { + attribute = element.getAttribute(attribute); + if (!attribute) return null; + return attribute.strip(); + }; + } + el = null; + return f; + })(), + _flag: function(element, attribute) { + return $(element).hasAttribute(attribute) ? attribute : null; + }, + style: function(element) { + return element.style.cssText.toLowerCase(); + }, + title: function(element) { + return element.title; + } } } } - }; + })(); Element._attributeTranslations.write = { names: Object.extend({ @@ -2363,8 +2786,8 @@ else if (Prototype.Browser.IE) { (function(v) { Object.extend(v, { - href: v._getAttr, - src: v._getAttr, + href: v._getAttr2, + src: v._getAttr2, type: v._getAttr, action: v._getAttrNode, disabled: v._flag, @@ -2391,6 +2814,26 @@ else if (Prototype.Browser.IE) { onchange: v._getEv }); })(Element._attributeTranslations.read.values); + + if (Prototype.BrowserFeatures.ElementExtensions) { + (function() { + function _descendants(element) { + var nodes = element.getElementsByTagName('*'), results = []; + for (var i = 0, node; node = nodes[i]; i++) + if (node.tagName !== "!") // Filter out comment nodes. + results.push(node); + return results; + } + + Element.Methods.down = function(element, expression, index) { + element = $(element); + if (arguments.length == 1) return element.firstDescendant(); + return Object.isNumber(expression) ? _descendants(element)[expression] : + Element.select(element, expression)[index || 0]; + } + })(); + } + } else if (Prototype.Browser.Gecko && /rv:1\.8\.0/.test(navigator.userAgent)) { @@ -2409,7 +2852,7 @@ else if (Prototype.Browser.WebKit) { (value < 0.00001) ? 0 : value; if (value == 1) - if(element.tagName.toUpperCase() == 'IMG' && element.width) { + if (element.tagName.toUpperCase() == 'IMG' && element.width) { element.width++; element.width--; } else try { var n = document.createTextNode(' '); @@ -2420,9 +2863,6 @@ else if (Prototype.Browser.WebKit) { return element; }; - // Safari returns margins on body which is incorrect if the child is absolutely - // positioned. For performance reasons, redefine Element#cumulativeOffset for - // KHTML/WebKit only. Element.Methods.cumulativeOffset = function(element) { var valueT = 0, valueL = 0; do { @@ -2438,30 +2878,7 @@ else if (Prototype.Browser.WebKit) { }; } -if (Prototype.Browser.IE || Prototype.Browser.Opera) { - // IE and Opera are missing .innerHTML support for TABLE-related and SELECT elements - Element.Methods.update = function(element, content) { - element = $(element); - - if (content && content.toElement) content = content.toElement(); - if (Object.isElement(content)) return element.update().insert(content); - - content = Object.toHTML(content); - var tagName = element.tagName.toUpperCase(); - - if (tagName in Element._insertionTranslations.tags) { - $A(element.childNodes).each(function(node) { element.removeChild(node) }); - Element._getContentFromAnonymousElement(tagName, content.stripScripts()) - .each(function(node) { element.appendChild(node) }); - } - else element.innerHTML = content.stripScripts(); - - content.evalScripts.bind(content).defer(); - return element; - }; -} - -if ('outerHTML' in document.createElement('div')) { +if ('outerHTML' in document.documentElement) { Element.Methods.replace = function(element, content) { element = $(element); @@ -2475,8 +2892,8 @@ if ('outerHTML' in document.createElement('div')) { var parent = element.parentNode, tagName = parent.tagName.toUpperCase(); if (Element._insertionTranslations.tags[tagName]) { - var nextSibling = element.next(); - var fragments = Element._getContentFromAnonymousElement(tagName, content.stripScripts()); + var nextSibling = element.next(), + fragments = Element._getContentFromAnonymousElement(tagName, content.stripScripts()); parent.removeChild(element); if (nextSibling) fragments.each(function(node) { parent.insertBefore(node, nextSibling) }); @@ -2498,11 +2915,17 @@ Element._returnOffset = function(l, t) { }; Element._getContentFromAnonymousElement = function(tagName, html) { - var div = new Element('div'), t = Element._insertionTranslations.tags[tagName]; + var div = new Element('div'), + t = Element._insertionTranslations.tags[tagName]; if (t) { div.innerHTML = t[0] + html + t[1]; - t[2].times(function() { div = div.firstChild }); - } else div.innerHTML = html; + for (var i = t[2]; i--; ) { + div = div.firstChild; + } + } + else { + div.innerHTML = html; + } return $A(div.childNodes); }; @@ -2529,12 +2952,13 @@ Element._insertionTranslations = { }; (function() { - Object.extend(this.tags, { - THEAD: this.tags.TBODY, - TFOOT: this.tags.TBODY, - TH: this.tags.TD + var tags = Element._insertionTranslations.tags; + Object.extend(tags, { + THEAD: tags.TBODY, + TFOOT: tags.TBODY, + TH: tags.TD }); -}).call(Element._insertionTranslations); +})(); Element.Methods.Simulated = { hasAttribute: function(element, attribute) { @@ -2548,41 +2972,81 @@ Element.Methods.ByTag = { }; Object.extend(Element, Element.Methods); -if (!Prototype.BrowserFeatures.ElementExtensions && - document.createElement('div')['__proto__']) { - window.HTMLElement = { }; - window.HTMLElement.prototype = document.createElement('div')['__proto__']; - Prototype.BrowserFeatures.ElementExtensions = true; -} +(function(div) { + + if (!Prototype.BrowserFeatures.ElementExtensions && div['__proto__']) { + window.HTMLElement = { }; + window.HTMLElement.prototype = div['__proto__']; + Prototype.BrowserFeatures.ElementExtensions = true; + } + + div = null; + +})(document.createElement('div')); Element.extend = (function() { - if (Prototype.BrowserFeatures.SpecificElementExtensions) + + function checkDeficiency(tagName) { + if (typeof window.Element != 'undefined') { + var proto = window.Element.prototype; + if (proto) { + var id = '_' + (Math.random()+'').slice(2), + el = document.createElement(tagName); + proto[id] = 'x'; + var isBuggy = (el[id] !== 'x'); + delete proto[id]; + el = null; + return isBuggy; + } + } + return false; + } + + function extendElementWith(element, methods) { + for (var property in methods) { + var value = methods[property]; + if (Object.isFunction(value) && !(property in element)) + element[property] = value.methodize(); + } + } + + var HTMLOBJECTELEMENT_PROTOTYPE_BUGGY = checkDeficiency('object'); + + if (Prototype.BrowserFeatures.SpecificElementExtensions) { + if (HTMLOBJECTELEMENT_PROTOTYPE_BUGGY) { + return function(element) { + if (element && typeof element._extendedByPrototype == 'undefined') { + var t = element.tagName; + if (t && (/^(?:object|applet|embed)$/i.test(t))) { + extendElementWith(element, Element.Methods); + extendElementWith(element, Element.Methods.Simulated); + extendElementWith(element, Element.Methods.ByTag[t.toUpperCase()]); + } + } + return element; + } + } return Prototype.K; + } var Methods = { }, ByTag = Element.Methods.ByTag; var extend = Object.extend(function(element) { - if (!element || element._extendedByPrototype || + if (!element || typeof element._extendedByPrototype != 'undefined' || element.nodeType != 1 || element == window) return element; var methods = Object.clone(Methods), - tagName = element.tagName.toUpperCase(), property, value; + tagName = element.tagName.toUpperCase(); - // extend methods for specific tags if (ByTag[tagName]) Object.extend(methods, ByTag[tagName]); - for (property in methods) { - value = methods[property]; - if (Object.isFunction(value) && !(property in element)) - element[property] = value.methodize(); - } + extendElementWith(element, methods); element._extendedByPrototype = Prototype.emptyFunction; return element; }, { refresh: function() { - // extend methods for all tags (Safari doesn't need this) if (!Prototype.BrowserFeatures.ElementExtensions) { Object.extend(Methods, Element.Methods); Object.extend(Methods, Element.Methods.Simulated); @@ -2594,10 +3058,14 @@ Element.extend = (function() { return extend; })(); -Element.hasAttribute = function(element, attribute) { - if (element.hasAttribute) return element.hasAttribute(attribute); - return Element.Methods.Simulated.hasAttribute(element, attribute); -}; +if (document.documentElement.hasAttribute) { + Element.hasAttribute = function(element, attribute) { + return element.hasAttribute(attribute); + }; +} +else { + Element.hasAttribute = Element.Methods.Simulated.hasAttribute; +} Element.addMethods = function(methods) { var F = Prototype.BrowserFeatures, T = Element.Methods.ByTag; @@ -2661,14 +3129,19 @@ Element.addMethods = function(methods) { klass = 'HTML' + tagName.capitalize() + 'Element'; if (window[klass]) return window[klass]; - window[klass] = { }; - window[klass].prototype = document.createElement(tagName)['__proto__']; - return window[klass]; + var element = document.createElement(tagName), + proto = element['__proto__'] || element.constructor.prototype; + + element = null; + return proto; } + var elementPrototype = window.HTMLElement ? HTMLElement.prototype : + Element.prototype; + if (F.ElementExtensions) { - copy(Element.Methods, HTMLElement.prototype); - copy(Element.Methods.Simulated, HTMLElement.prototype, true); + copy(Element.Methods, elementPrototype); + copy(Element.Methods.Simulated, elementPrototype, true); } if (F.SpecificElementExtensions) { @@ -2686,766 +3159,1803 @@ Element.addMethods = function(methods) { Element.cache = { }; }; + document.viewport = { + getDimensions: function() { - var dimensions = { }, B = Prototype.Browser; - $w('width height').each(function(d) { - var D = d.capitalize(); - if (B.WebKit && !document.evaluate) { - // Safari <3.0 needs self.innerWidth/Height - dimensions[d] = self['inner' + D]; - } else if (B.Opera && parseFloat(window.opera.version()) < 9.5) { - // Opera <9.5 needs document.body.clientWidth/Height - dimensions[d] = document.body['client' + D] - } else { - dimensions[d] = document.documentElement['client' + D]; - } - }); - return dimensions; - }, - - getWidth: function() { - return this.getDimensions().width; - }, - - getHeight: function() { - return this.getDimensions().height; + return { width: this.getWidth(), height: this.getHeight() }; }, getScrollOffsets: function() { return Element._returnOffset( window.pageXOffset || document.documentElement.scrollLeft || document.body.scrollLeft, - window.pageYOffset || document.documentElement.scrollTop || document.body.scrollTop); + window.pageYOffset || document.documentElement.scrollTop || document.body.scrollTop); } }; -/* Portions of the Selector class are derived from Jack Slocum's DomQuery, - * part of YUI-Ext version 0.40, distributed under the terms of an MIT-style - * license. Please see http://www.yui-ext.com/ for more information. */ -var Selector = Class.create({ - initialize: function(expression) { - this.expression = expression.strip(); +(function(viewport) { + var B = Prototype.Browser, doc = document, element, property = {}; - if (this.shouldUseSelectorsAPI()) { - this.mode = 'selectorsAPI'; - } else if (this.shouldUseXPath()) { - this.mode = 'xpath'; - this.compileXPathMatcher(); + function getRootElement() { + if (B.WebKit && !doc.evaluate) + return document; + + if (B.Opera && window.parseFloat(window.opera.version()) < 9.5) + return document.body; + + return document.documentElement; + } + + function define(D) { + if (!element) element = getRootElement(); + + property[D] = 'client' + D; + + viewport['get' + D] = function() { return element[property[D]] }; + return viewport['get' + D](); + } + + viewport.getWidth = define.curry('Width'); + + viewport.getHeight = define.curry('Height'); +})(document.viewport); + + +Element.Storage = { + UID: 1 +}; + +Element.addMethods({ + getStorage: function(element) { + if (!(element = $(element))) return; + + var uid; + if (element === window) { + uid = 0; } else { - this.mode = "normal"; - this.compileMatcher(); + if (typeof element._prototypeUID === "undefined") + element._prototypeUID = Element.Storage.UID++; + uid = element._prototypeUID; } + if (!Element.Storage[uid]) + Element.Storage[uid] = $H(); + + return Element.Storage[uid]; }, - shouldUseXPath: function() { - if (!Prototype.BrowserFeatures.XPath) return false; + store: function(element, key, value) { + if (!(element = $(element))) return; - var e = this.expression; - - // Safari 3 chokes on :*-of-type and :empty - if (Prototype.Browser.WebKit && - (e.include("-of-type") || e.include(":empty"))) - return false; - - // XPath can't do namespaced attributes, nor can it read - // the "checked" property from DOM nodes - if ((/(\[[\w-]*?:|:checked)/).test(e)) - return false; - - return true; - }, - - shouldUseSelectorsAPI: function() { - if (!Prototype.BrowserFeatures.SelectorsAPI) return false; - - if (!Selector._div) Selector._div = new Element('div'); - - // Make sure the browser treats the selector as valid. Test on an - // isolated element to minimize cost of this check. - try { - Selector._div.querySelector(this.expression); - } catch(e) { - return false; + if (arguments.length === 2) { + Element.getStorage(element).update(key); + } else { + Element.getStorage(element).set(key, value); } - return true; + return element; }, - compileMatcher: function() { - var e = this.expression, ps = Selector.patterns, h = Selector.handlers, - c = Selector.criteria, le, p, m; + retrieve: function(element, key, defaultValue) { + if (!(element = $(element))) return; + var hash = Element.getStorage(element), value = hash.get(key); - if (Selector._cache[e]) { - this.matcher = Selector._cache[e]; - return; + if (Object.isUndefined(value)) { + hash.set(key, defaultValue); + value = defaultValue; } - this.matcher = ["this.matcher = function(root) {", - "var r = root, h = Selector.handlers, c = false, n;"]; + return value; + }, - while (e && le != e && (/\S/).test(e)) { - le = e; - for (var i in ps) { - p = ps[i]; - if (m = e.match(p)) { - this.matcher.push(Object.isFunction(c[i]) ? c[i](m) : - new Template(c[i]).evaluate(m)); - e = e.replace(m[0], ''); - break; - } + clone: function(element, deep) { + if (!(element = $(element))) return; + var clone = element.cloneNode(deep); + clone._prototypeUID = void 0; + if (deep) { + var descendants = Element.select(clone, '*'), + i = descendants.length; + while (i--) { + descendants[i]._prototypeUID = void 0; } } - - this.matcher.push("return h.unique(n);\n}"); - eval(this.matcher.join('\n')); - Selector._cache[this.expression] = this.matcher; + return Element.extend(clone); }, - compileXPathMatcher: function() { - var e = this.expression, ps = Selector.patterns, - x = Selector.xpath, le, m; + purge: function(element) { + if (!(element = $(element))) return; + purgeElement(element); - if (Selector._cache[e]) { - this.xpath = Selector._cache[e]; return; - } + var descendants = element.getElementsByTagName('*'), + i = descendants.length; - this.matcher = ['.//*']; - while (e && le != e && (/\S/).test(e)) { - le = e; - for (var i in ps) { - if (m = e.match(ps[i])) { - this.matcher.push(Object.isFunction(x[i]) ? x[i](m) : - new Template(x[i]).evaluate(m)); - e = e.replace(m[0], ''); - break; - } - } - } + while (i--) purgeElement(descendants[i]); - this.xpath = this.matcher.join(''); - Selector._cache[this.expression] = this.xpath; - }, - - findElements: function(root) { - root = root || document; - var e = this.expression, results; - - switch (this.mode) { - case 'selectorsAPI': - // querySelectorAll queries document-wide, then filters to descendants - // of the context element. That's not what we want. - // Add an explicit context to the selector if necessary. - if (root !== document) { - var oldId = root.id, id = $(root).identify(); - e = "#" + id + " " + e; - } - - results = $A(root.querySelectorAll(e)).map(Element.extend); - root.id = oldId; - - return results; - case 'xpath': - return document._getElementsByXPath(this.xpath, root); - default: - return this.matcher(root); - } - }, - - match: function(element) { - this.tokens = []; - - var e = this.expression, ps = Selector.patterns, as = Selector.assertions; - var le, p, m; - - while (e && le !== e && (/\S/).test(e)) { - le = e; - for (var i in ps) { - p = ps[i]; - if (m = e.match(p)) { - // use the Selector.assertions methods unless the selector - // is too complex. - if (as[i]) { - this.tokens.push([i, Object.clone(m)]); - e = e.replace(m[0], ''); - } else { - // reluctantly do a document-wide search - // and look for a match in the array - return this.findElements(document).include(element); - } - } - } - } - - var match = true, name, matches; - for (var i = 0, token; token = this.tokens[i]; i++) { - name = token[0], matches = token[1]; - if (!Selector.assertions[name](element, matches)) { - match = false; break; - } - } - - return match; - }, - - toString: function() { - return this.expression; - }, - - inspect: function() { - return "#"; + return null; } }); -Object.extend(Selector, { - _cache: { }, +(function() { - xpath: { - descendant: "//*", - child: "/*", - adjacent: "/following-sibling::*[1]", - laterSibling: '/following-sibling::*', - tagName: function(m) { - if (m[1] == '*') return ''; - return "[local-name()='" + m[1].toLowerCase() + - "' or local-name()='" + m[1].toUpperCase() + "']"; - }, - className: "[contains(concat(' ', @class, ' '), ' #{1} ')]", - id: "[@id='#{1}']", - attrPresence: function(m) { - m[1] = m[1].toLowerCase(); - return new Template("[@#{1}]").evaluate(m); - }, - attr: function(m) { - m[1] = m[1].toLowerCase(); - m[3] = m[5] || m[6]; - return new Template(Selector.xpath.operators[m[2]]).evaluate(m); - }, - pseudo: function(m) { - var h = Selector.xpath.pseudos[m[1]]; - if (!h) return ''; - if (Object.isFunction(h)) return h(m); - return new Template(Selector.xpath.pseudos[m[1]]).evaluate(m); - }, - operators: { - '=': "[@#{1}='#{3}']", - '!=': "[@#{1}!='#{3}']", - '^=': "[starts-with(@#{1}, '#{3}')]", - '$=': "[substring(@#{1}, (string-length(@#{1}) - string-length('#{3}') + 1))='#{3}']", - '*=': "[contains(@#{1}, '#{3}')]", - '~=': "[contains(concat(' ', @#{1}, ' '), ' #{3} ')]", - '|=': "[contains(concat('-', @#{1}, '-'), '-#{3}-')]" - }, - pseudos: { - 'first-child': '[not(preceding-sibling::*)]', - 'last-child': '[not(following-sibling::*)]', - 'only-child': '[not(preceding-sibling::* or following-sibling::*)]', - 'empty': "[count(*) = 0 and (count(text()) = 0)]", - 'checked': "[@checked]", - 'disabled': "[(@disabled) and (@type!='hidden')]", - 'enabled': "[not(@disabled) and (@type!='hidden')]", - 'not': function(m) { - var e = m[6], p = Selector.patterns, - x = Selector.xpath, le, v; + function toDecimal(pctString) { + var match = pctString.match(/^(\d+)%?$/i); + if (!match) return null; + return (Number(match[1]) / 100); + } - var exclusion = []; - while (e && le != e && (/\S/).test(e)) { - le = e; - for (var i in p) { - if (m = e.match(p[i])) { - v = Object.isFunction(x[i]) ? x[i](m) : new Template(x[i]).evaluate(m); - exclusion.push("(" + v.substring(1, v.length - 1) + ")"); - e = e.replace(m[0], ''); - break; - } - } - } - return "[not(" + exclusion.join(" and ") + ")]"; - }, - 'nth-child': function(m) { - return Selector.xpath.pseudos.nth("(count(./preceding-sibling::*) + 1) ", m); - }, - 'nth-last-child': function(m) { - return Selector.xpath.pseudos.nth("(count(./following-sibling::*) + 1) ", m); - }, - 'nth-of-type': function(m) { - return Selector.xpath.pseudos.nth("position() ", m); - }, - 'nth-last-of-type': function(m) { - return Selector.xpath.pseudos.nth("(last() + 1 - position()) ", m); - }, - 'first-of-type': function(m) { - m[6] = "1"; return Selector.xpath.pseudos['nth-of-type'](m); - }, - 'last-of-type': function(m) { - m[6] = "1"; return Selector.xpath.pseudos['nth-last-of-type'](m); - }, - 'only-of-type': function(m) { - var p = Selector.xpath.pseudos; return p['first-of-type'](m) + p['last-of-type'](m); - }, - nth: function(fragment, m) { - var mm, formula = m[6], predicate; - if (formula == 'even') formula = '2n+0'; - if (formula == 'odd') formula = '2n+1'; - if (mm = formula.match(/^(\d+)$/)) // digit only - return '[' + fragment + "= " + mm[1] + ']'; - if (mm = formula.match(/^(-?\d*)?n(([+-])(\d+))?/)) { // an+b - if (mm[1] == "-") mm[1] = -1; - var a = mm[1] ? Number(mm[1]) : 1; - var b = mm[2] ? Number(mm[2]) : 0; - predicate = "[((#{fragment} - #{b}) mod #{a} = 0) and " + - "((#{fragment} - #{b}) div #{a} >= 0)]"; - return new Template(predicate).evaluate({ - fragment: fragment, a: a, b: b }); - } - } + function getPixelValue(value, property) { + if (Object.isElement(value)) { + element = value; + value = element.getStyle(property); } - }, - - criteria: { - tagName: 'n = h.tagName(n, r, "#{1}", c); c = false;', - className: 'n = h.className(n, r, "#{1}", c); c = false;', - id: 'n = h.id(n, r, "#{1}", c); c = false;', - attrPresence: 'n = h.attrPresence(n, r, "#{1}", c); c = false;', - attr: function(m) { - m[3] = (m[5] || m[6]); - return new Template('n = h.attr(n, r, "#{1}", "#{3}", "#{2}", c); c = false;').evaluate(m); - }, - pseudo: function(m) { - if (m[6]) m[6] = m[6].replace(/"/g, '\\"'); - return new Template('n = h.pseudo(n, "#{1}", "#{6}", r, c); c = false;').evaluate(m); - }, - descendant: 'c = "descendant";', - child: 'c = "child";', - adjacent: 'c = "adjacent";', - laterSibling: 'c = "laterSibling";' - }, - - patterns: { - // combinators must be listed first - // (and descendant needs to be last combinator) - laterSibling: /^\s*~\s*/, - child: /^\s*>\s*/, - adjacent: /^\s*\+\s*/, - descendant: /^\s/, - - // selectors follow - tagName: /^\s*(\*|[\w\-]+)(\b|$)?/, - id: /^#([\w\-\*]+)(\b|$)/, - className: /^\.([\w\-\*]+)(\b|$)/, - pseudo: -/^:((first|last|nth|nth-last|only)(-child|-of-type)|empty|checked|(en|dis)abled|not)(\((.*?)\))?(\b|$|(?=\s|[:+~>]))/, - attrPresence: /^\[((?:[\w]+:)?[\w]+)\]/, - attr: /\[((?:[\w-]*:)?[\w-]+)\s*(?:([!^$*~|]?=)\s*((['"])([^\4]*?)\4|([^'"][^\]]*?)))?\]/ - }, - - // for Selector.match and Element#match - assertions: { - tagName: function(element, matches) { - return matches[1].toUpperCase() == element.tagName.toUpperCase(); - }, - - className: function(element, matches) { - return Element.hasClassName(element, matches[1]); - }, - - id: function(element, matches) { - return element.id === matches[1]; - }, - - attrPresence: function(element, matches) { - return Element.hasAttribute(element, matches[1]); - }, - - attr: function(element, matches) { - var nodeValue = Element.readAttribute(element, matches[1]); - return nodeValue && Selector.operators[matches[2]](nodeValue, matches[5] || matches[6]); - } - }, - - handlers: { - // UTILITY FUNCTIONS - // joins two collections - concat: function(a, b) { - for (var i = 0, node; node = b[i]; i++) - a.push(node); - return a; - }, - - // marks an array of nodes for counting - mark: function(nodes) { - var _true = Prototype.emptyFunction; - for (var i = 0, node; node = nodes[i]; i++) - node._countedByPrototype = _true; - return nodes; - }, - - unmark: function(nodes) { - for (var i = 0, node; node = nodes[i]; i++) - node._countedByPrototype = undefined; - return nodes; - }, - - // mark each child node with its position (for nth calls) - // "ofType" flag indicates whether we're indexing for nth-of-type - // rather than nth-child - index: function(parentNode, reverse, ofType) { - parentNode._countedByPrototype = Prototype.emptyFunction; - if (reverse) { - for (var nodes = parentNode.childNodes, i = nodes.length - 1, j = 1; i >= 0; i--) { - var node = nodes[i]; - if (node.nodeType == 1 && (!ofType || node._countedByPrototype)) node.nodeIndex = j++; - } - } else { - for (var i = 0, j = 1, nodes = parentNode.childNodes; node = nodes[i]; i++) - if (node.nodeType == 1 && (!ofType || node._countedByPrototype)) node.nodeIndex = j++; - } - }, - - // filters out duplicates and extends all nodes - unique: function(nodes) { - if (nodes.length == 0) return nodes; - var results = [], n; - for (var i = 0, l = nodes.length; i < l; i++) - if (!(n = nodes[i])._countedByPrototype) { - n._countedByPrototype = Prototype.emptyFunction; - results.push(Element.extend(n)); - } - return Selector.handlers.unmark(results); - }, - - // COMBINATOR FUNCTIONS - descendant: function(nodes) { - var h = Selector.handlers; - for (var i = 0, results = [], node; node = nodes[i]; i++) - h.concat(results, node.getElementsByTagName('*')); - return results; - }, - - child: function(nodes) { - var h = Selector.handlers; - for (var i = 0, results = [], node; node = nodes[i]; i++) { - for (var j = 0, child; child = node.childNodes[j]; j++) - if (child.nodeType == 1 && child.tagName != '!') results.push(child); - } - return results; - }, - - adjacent: function(nodes) { - for (var i = 0, results = [], node; node = nodes[i]; i++) { - var next = this.nextElementSibling(node); - if (next) results.push(next); - } - return results; - }, - - laterSibling: function(nodes) { - var h = Selector.handlers; - for (var i = 0, results = [], node; node = nodes[i]; i++) - h.concat(results, Element.nextSiblings(node)); - return results; - }, - - nextElementSibling: function(node) { - while (node = node.nextSibling) - if (node.nodeType == 1) return node; + if (value === null) { return null; - }, - - previousElementSibling: function(node) { - while (node = node.previousSibling) - if (node.nodeType == 1) return node; - return null; - }, - - // TOKEN FUNCTIONS - tagName: function(nodes, root, tagName, combinator) { - var uTagName = tagName.toUpperCase(); - var results = [], h = Selector.handlers; - if (nodes) { - if (combinator) { - // fastlane for ordinary descendant combinators - if (combinator == "descendant") { - for (var i = 0, node; node = nodes[i]; i++) - h.concat(results, node.getElementsByTagName(tagName)); - return results; - } else nodes = this[combinator](nodes); - if (tagName == "*") return nodes; - } - for (var i = 0, node; node = nodes[i]; i++) - if (node.tagName.toUpperCase() === uTagName) results.push(node); - return results; - } else return root.getElementsByTagName(tagName); - }, - - id: function(nodes, root, id, combinator) { - var targetNode = $(id), h = Selector.handlers; - if (!targetNode) return []; - if (!nodes && root == document) return [targetNode]; - if (nodes) { - if (combinator) { - if (combinator == 'child') { - for (var i = 0, node; node = nodes[i]; i++) - if (targetNode.parentNode == node) return [targetNode]; - } else if (combinator == 'descendant') { - for (var i = 0, node; node = nodes[i]; i++) - if (Element.descendantOf(targetNode, node)) return [targetNode]; - } else if (combinator == 'adjacent') { - for (var i = 0, node; node = nodes[i]; i++) - if (Selector.handlers.previousElementSibling(targetNode) == node) - return [targetNode]; - } else nodes = h[combinator](nodes); - } - for (var i = 0, node; node = nodes[i]; i++) - if (node == targetNode) return [targetNode]; - return []; - } - return (targetNode && Element.descendantOf(targetNode, root)) ? [targetNode] : []; - }, - - className: function(nodes, root, className, combinator) { - if (nodes && combinator) nodes = this[combinator](nodes); - return Selector.handlers.byClassName(nodes, root, className); - }, - - byClassName: function(nodes, root, className) { - if (!nodes) nodes = Selector.handlers.descendant([root]); - var needle = ' ' + className + ' '; - for (var i = 0, results = [], node, nodeClassName; node = nodes[i]; i++) { - nodeClassName = node.className; - if (nodeClassName.length == 0) continue; - if (nodeClassName == className || (' ' + nodeClassName + ' ').include(needle)) - results.push(node); - } - return results; - }, - - attrPresence: function(nodes, root, attr, combinator) { - if (!nodes) nodes = root.getElementsByTagName("*"); - if (nodes && combinator) nodes = this[combinator](nodes); - var results = []; - for (var i = 0, node; node = nodes[i]; i++) - if (Element.hasAttribute(node, attr)) results.push(node); - return results; - }, - - attr: function(nodes, root, attr, value, operator, combinator) { - if (!nodes) nodes = root.getElementsByTagName("*"); - if (nodes && combinator) nodes = this[combinator](nodes); - var handler = Selector.operators[operator], results = []; - for (var i = 0, node; node = nodes[i]; i++) { - var nodeValue = Element.readAttribute(node, attr); - if (nodeValue === null) continue; - if (handler(nodeValue, value)) results.push(node); - } - return results; - }, - - pseudo: function(nodes, name, value, root, combinator) { - if (nodes && combinator) nodes = this[combinator](nodes); - if (!nodes) nodes = root.getElementsByTagName("*"); - return Selector.pseudos[name](nodes, value, root); } - }, - pseudos: { - 'first-child': function(nodes, value, root) { - for (var i = 0, results = [], node; node = nodes[i]; i++) { - if (Selector.handlers.previousElementSibling(node)) continue; - results.push(node); + if ((/^(?:-)?\d+(\.\d+)?(px)?$/i).test(value)) { + return window.parseFloat(value); + } + + if (/\d/.test(value) && element.runtimeStyle) { + var style = element.style.left, rStyle = element.runtimeStyle.left; + element.runtimeStyle.left = element.currentStyle.left; + element.style.left = value || 0; + value = element.style.pixelLeft; + element.style.left = style; + element.runtimeStyle.left = rStyle; + + return value; + } + + if (value.include('%')) { + var decimal = toDecimal(value); + var whole; + if (property.include('left') || property.include('right') || + property.include('width')) { + whole = $(element.parentNode).measure('width'); + } else if (property.include('top') || property.include('bottom') || + property.include('height')) { + whole = $(element.parentNode).measure('height'); } - return results; - }, - 'last-child': function(nodes, value, root) { - for (var i = 0, results = [], node; node = nodes[i]; i++) { - if (Selector.handlers.nextElementSibling(node)) continue; - results.push(node); + + return whole * decimal; + } + + return 0; + } + + function toCSSPixels(number) { + if (Object.isString(number) && number.endsWith('px')) { + return number; + } + return number + 'px'; + } + + function isDisplayed(element) { + var originalElement = element; + while (element && element.parentNode) { + var display = element.getStyle('display'); + if (display === 'none') { + return false; + } + element = $(element.parentNode); + } + return true; + } + + var hasLayout = Prototype.K; + if ('currentStyle' in document.documentElement) { + hasLayout = function(element) { + if (!element.currentStyle.hasLayout) { + element.style.zoom = 1; + } + return element; + }; + } + + function cssNameFor(key) { + if (key.include('border')) key = key + '-width'; + return key.camelize(); + } + + Element.Layout = Class.create(Hash, { + initialize: function($super, element, preCompute) { + $super(); + this.element = $(element); + + Element.Layout.PROPERTIES.each( function(property) { + this._set(property, null); + }, this); + + if (preCompute) { + this._preComputing = true; + this._begin(); + Element.Layout.PROPERTIES.each( this._compute, this ); + this._end(); + this._preComputing = false; } - return results; - }, - 'only-child': function(nodes, value, root) { - var h = Selector.handlers; - for (var i = 0, results = [], node; node = nodes[i]; i++) - if (!h.previousElementSibling(node) && !h.nextElementSibling(node)) - results.push(node); - return results; - }, - 'nth-child': function(nodes, formula, root) { - return Selector.pseudos.nth(nodes, formula, root); - }, - 'nth-last-child': function(nodes, formula, root) { - return Selector.pseudos.nth(nodes, formula, root, true); - }, - 'nth-of-type': function(nodes, formula, root) { - return Selector.pseudos.nth(nodes, formula, root, false, true); - }, - 'nth-last-of-type': function(nodes, formula, root) { - return Selector.pseudos.nth(nodes, formula, root, true, true); - }, - 'first-of-type': function(nodes, formula, root) { - return Selector.pseudos.nth(nodes, "1", root, false, true); - }, - 'last-of-type': function(nodes, formula, root) { - return Selector.pseudos.nth(nodes, "1", root, true, true); - }, - 'only-of-type': function(nodes, formula, root) { - var p = Selector.pseudos; - return p['last-of-type'](p['first-of-type'](nodes, formula, root), formula, root); }, - // handles the an+b logic - getIndices: function(a, b, total) { - if (a == 0) return b > 0 ? [b] : []; - return $R(1, total).inject([], function(memo, i) { - if (0 == (i - b) % a && (i - b) / a >= 0) memo.push(i); - return memo; + _set: function(property, value) { + return Hash.prototype.set.call(this, property, value); + }, + + set: function(property, value) { + throw "Properties of Element.Layout are read-only."; + }, + + get: function($super, property) { + var value = $super(property); + return value === null ? this._compute(property) : value; + }, + + _begin: function() { + if (this._prepared) return; + + var element = this.element; + if (isDisplayed(element)) { + this._prepared = true; + return; + } + + var originalStyles = { + position: element.style.position || '', + width: element.style.width || '', + visibility: element.style.visibility || '', + display: element.style.display || '' + }; + + element.store('prototype_original_styles', originalStyles); + + var position = element.getStyle('position'), + width = element.getStyle('width'); + + element.setStyle({ + position: 'absolute', + visibility: 'hidden', + display: 'block' }); - }, - // handles nth(-last)-child, nth(-last)-of-type, and (first|last)-of-type - nth: function(nodes, formula, root, reverse, ofType) { - if (nodes.length == 0) return []; - if (formula == 'even') formula = '2n+0'; - if (formula == 'odd') formula = '2n+1'; - var h = Selector.handlers, results = [], indexed = [], m; - h.mark(nodes); - for (var i = 0, node; node = nodes[i]; i++) { - if (!node.parentNode._countedByPrototype) { - h.index(node.parentNode, reverse, ofType); - indexed.push(node.parentNode); - } + var positionedWidth = element.getStyle('width'); + + var newWidth; + if (width && (positionedWidth === width)) { + newWidth = getPixelValue(width); + } else if (width && (position === 'absolute' || position === 'fixed')) { + newWidth = getPixelValue(width); + } else { + var parent = element.parentNode, pLayout = $(parent).getLayout(); + + newWidth = pLayout.get('width') - + this.get('margin-left') - + this.get('border-left') - + this.get('padding-left') - + this.get('padding-right') - + this.get('border-right') - + this.get('margin-right'); } - if (formula.match(/^\d+$/)) { // just a number - formula = Number(formula); - for (var i = 0, node; node = nodes[i]; i++) - if (node.nodeIndex == formula) results.push(node); - } else if (m = formula.match(/^(-?\d*)?n(([+-])(\d+))?/)) { // an+b - if (m[1] == "-") m[1] = -1; - var a = m[1] ? Number(m[1]) : 1; - var b = m[2] ? Number(m[2]) : 0; - var indices = Selector.pseudos.getIndices(a, b, nodes.length); - for (var i = 0, node, l = indices.length; node = nodes[i]; i++) { - for (var j = 0; j < l; j++) - if (node.nodeIndex == indices[j]) results.push(node); - } + + element.setStyle({ width: newWidth + 'px' }); + + this._prepared = true; + }, + + _end: function() { + var element = this.element; + var originalStyles = element.retrieve('prototype_original_styles'); + element.store('prototype_original_styles', null); + element.setStyle(originalStyles); + this._prepared = false; + }, + + _compute: function(property) { + var COMPUTATIONS = Element.Layout.COMPUTATIONS; + if (!(property in COMPUTATIONS)) { + throw "Property not found."; } - h.unmark(nodes); - h.unmark(indexed); - return results; + return this._set(property, COMPUTATIONS[property].call(this, this.element)); }, - 'empty': function(nodes, value, root) { - for (var i = 0, results = [], node; node = nodes[i]; i++) { - // IE treats comments as element nodes - if (node.tagName == '!' || node.firstChild) continue; - results.push(node); - } - return results; + toObject: function() { + var args = $A(arguments); + var keys = (args.length === 0) ? Element.Layout.PROPERTIES : + args.join(' ').split(' '); + var obj = {}; + keys.each( function(key) { + if (!Element.Layout.PROPERTIES.include(key)) return; + var value = this.get(key); + if (value != null) obj[key] = value; + }, this); + return obj; }, - 'not': function(nodes, selector, root) { - var h = Selector.handlers, selectorType, m; - var exclusions = new Selector(selector).findElements(root); - h.mark(exclusions); - for (var i = 0, results = [], node; node = nodes[i]; i++) - if (!node._countedByPrototype) results.push(node); - h.unmark(exclusions); - return results; + toHash: function() { + var obj = this.toObject.apply(this, arguments); + return new Hash(obj); }, - 'enabled': function(nodes, value, root) { - for (var i = 0, results = [], node; node = nodes[i]; i++) - if (!node.disabled && (!node.type || node.type !== 'hidden')) - results.push(node); - return results; + toCSS: function() { + var args = $A(arguments); + var keys = (args.length === 0) ? Element.Layout.PROPERTIES : + args.join(' ').split(' '); + var css = {}; + + keys.each( function(key) { + if (!Element.Layout.PROPERTIES.include(key)) return; + if (Element.Layout.COMPOSITE_PROPERTIES.include(key)) return; + + var value = this.get(key); + if (value != null) css[cssNameFor(key)] = value + 'px'; + }, this); + return css; }, - 'disabled': function(nodes, value, root) { - for (var i = 0, results = [], node; node = nodes[i]; i++) - if (node.disabled) results.push(node); - return results; - }, - - 'checked': function(nodes, value, root) { - for (var i = 0, results = [], node; node = nodes[i]; i++) - if (node.checked) results.push(node); - return results; - } - }, - - operators: { - '=': function(nv, v) { return nv == v; }, - '!=': function(nv, v) { return nv != v; }, - '^=': function(nv, v) { return nv == v || nv && nv.startsWith(v); }, - '$=': function(nv, v) { return nv == v || nv && nv.endsWith(v); }, - '*=': function(nv, v) { return nv == v || nv && nv.include(v); }, - '$=': function(nv, v) { return nv.endsWith(v); }, - '*=': function(nv, v) { return nv.include(v); }, - '~=': function(nv, v) { return (' ' + nv + ' ').include(' ' + v + ' '); }, - '|=': function(nv, v) { return ('-' + (nv || "").toUpperCase() + - '-').include('-' + (v || "").toUpperCase() + '-'); } - }, - - split: function(expression) { - var expressions = []; - expression.scan(/(([\w#:.~>+()\s-]+|\*|\[.*?\])+)\s*(,|$)/, function(m) { - expressions.push(m[1].strip()); - }); - return expressions; - }, - - matchElements: function(elements, expression) { - var matches = $$(expression), h = Selector.handlers; - h.mark(matches); - for (var i = 0, results = [], element; element = elements[i]; i++) - if (element._countedByPrototype) results.push(element); - h.unmark(matches); - return results; - }, - - findElement: function(elements, expression, index) { - if (Object.isNumber(expression)) { - index = expression; expression = false; - } - return Selector.matchElements(elements, expression || '*')[index || 0]; - }, - - findChildElements: function(element, expressions) { - expressions = Selector.split(expressions.join(',')); - var results = [], h = Selector.handlers; - for (var i = 0, l = expressions.length, selector; i < l; i++) { - selector = new Selector(expressions[i].strip()); - h.concat(results, selector.findElements(element)); - } - return (l > 1) ? h.unique(results) : results; - } -}); - -if (Prototype.Browser.IE) { - Object.extend(Selector.handlers, { - // IE returns comment nodes on getElementsByTagName("*"). - // Filter them out. - concat: function(a, b) { - for (var i = 0, node; node = b[i]; i++) - if (node.tagName !== "!") a.push(node); - return a; - }, - - // IE improperly serializes _countedByPrototype in (inner|outer)HTML. - unmark: function(nodes) { - for (var i = 0, node; node = nodes[i]; i++) - node.removeAttribute('_countedByPrototype'); - return nodes; + inspect: function() { + return "#"; } }); + + Object.extend(Element.Layout, { + PROPERTIES: $w('height width top left right bottom border-left border-right border-top border-bottom padding-left padding-right padding-top padding-bottom margin-top margin-bottom margin-left margin-right padding-box-width padding-box-height border-box-width border-box-height margin-box-width margin-box-height'), + + COMPOSITE_PROPERTIES: $w('padding-box-width padding-box-height margin-box-width margin-box-height border-box-width border-box-height'), + + COMPUTATIONS: { + 'height': function(element) { + if (!this._preComputing) this._begin(); + + var bHeight = this.get('border-box-height'); + if (bHeight <= 0) return 0; + + var bTop = this.get('border-top'), + bBottom = this.get('border-bottom'); + + var pTop = this.get('padding-top'), + pBottom = this.get('padding-bottom'); + + if (!this._preComputing) this._end(); + + return bHeight - bTop - bBottom - pTop - pBottom; + }, + + 'width': function(element) { + if (!this._preComputing) this._begin(); + + var bWidth = this.get('border-box-width'); + if (bWidth <= 0) return 0; + + var bLeft = this.get('border-left'), + bRight = this.get('border-right'); + + var pLeft = this.get('padding-left'), + pRight = this.get('padding-right'); + + if (!this._preComputing) this._end(); + + return bWidth - bLeft - bRight - pLeft - pRight; + }, + + 'padding-box-height': function(element) { + var height = this.get('height'), + pTop = this.get('padding-top'), + pBottom = this.get('padding-bottom'); + + return height + pTop + pBottom; + }, + + 'padding-box-width': function(element) { + var width = this.get('width'), + pLeft = this.get('padding-left'), + pRight = this.get('padding-right'); + + return width + pLeft + pRight; + }, + + 'border-box-height': function(element) { + return element.offsetHeight; + }, + + 'border-box-width': function(element) { + return element.offsetWidth; + }, + + 'margin-box-height': function(element) { + var bHeight = this.get('border-box-height'), + mTop = this.get('margin-top'), + mBottom = this.get('margin-bottom'); + + if (bHeight <= 0) return 0; + + return bHeight + mTop + mBottom; + }, + + 'margin-box-width': function(element) { + var bWidth = this.get('border-box-width'), + mLeft = this.get('margin-left'), + mRight = this.get('margin-right'); + + if (bWidth <= 0) return 0; + + return bWidth + mLeft + mRight; + }, + + 'top': function(element) { + var offset = element.positionedOffset(); + return offset.top; + }, + + 'bottom': function(element) { + var offset = element.positionedOffset(), + parent = element.getOffsetParent(), + pHeight = parent.measure('height'); + + var mHeight = this.get('border-box-height'); + + return pHeight - mHeight - offset.top; + }, + + 'left': function(element) { + var offset = element.positionedOffset(); + return offset.left; + }, + + 'right': function(element) { + var offset = element.positionedOffset(), + parent = element.getOffsetParent(), + pWidth = parent.measure('width'); + + var mWidth = this.get('border-box-width'); + + return pWidth - mWidth - offset.left; + }, + + 'padding-top': function(element) { + return getPixelValue(element, 'paddingTop'); + }, + + 'padding-bottom': function(element) { + return getPixelValue(element, 'paddingBottom'); + }, + + 'padding-left': function(element) { + return getPixelValue(element, 'paddingLeft'); + }, + + 'padding-right': function(element) { + return getPixelValue(element, 'paddingRight'); + }, + + 'border-top': function(element) { + return Object.isNumber(element.clientTop) ? element.clientTop : + getPixelValue(element, 'borderTopWidth'); + }, + + 'border-bottom': function(element) { + return Object.isNumber(element.clientBottom) ? element.clientBottom : + getPixelValue(element, 'borderBottomWidth'); + }, + + 'border-left': function(element) { + return Object.isNumber(element.clientLeft) ? element.clientLeft : + getPixelValue(element, 'borderLeftWidth'); + }, + + 'border-right': function(element) { + return Object.isNumber(element.clientRight) ? element.clientRight : + getPixelValue(element, 'borderRightWidth'); + }, + + 'margin-top': function(element) { + return getPixelValue(element, 'marginTop'); + }, + + 'margin-bottom': function(element) { + return getPixelValue(element, 'marginBottom'); + }, + + 'margin-left': function(element) { + return getPixelValue(element, 'marginLeft'); + }, + + 'margin-right': function(element) { + return getPixelValue(element, 'marginRight'); + } + } + }); + + if ('getBoundingClientRect' in document.documentElement) { + Object.extend(Element.Layout.COMPUTATIONS, { + 'right': function(element) { + var parent = hasLayout(element.getOffsetParent()); + var rect = element.getBoundingClientRect(), + pRect = parent.getBoundingClientRect(); + + return (pRect.right - rect.right).round(); + }, + + 'bottom': function(element) { + var parent = hasLayout(element.getOffsetParent()); + var rect = element.getBoundingClientRect(), + pRect = parent.getBoundingClientRect(); + + return (pRect.bottom - rect.bottom).round(); + } + }); + } + + Element.Offset = Class.create({ + initialize: function(left, top) { + this.left = left.round(); + this.top = top.round(); + + this[0] = this.left; + this[1] = this.top; + }, + + relativeTo: function(offset) { + return new Element.Offset( + this.left - offset.left, + this.top - offset.top + ); + }, + + inspect: function() { + return "#".interpolate(this); + }, + + toString: function() { + return "[#{left}, #{top}]".interpolate(this); + }, + + toArray: function() { + return [this.left, this.top]; + } + }); + + function getLayout(element, preCompute) { + return new Element.Layout(element, preCompute); + } + + function measure(element, property) { + return $(element).getLayout().get(property); + } + + function getDimensions(element) { + var layout = $(element).getLayout(); + return { + width: layout.get('width'), + height: layout.get('height') + }; + } + + function getOffsetParent(element) { + if (isDetached(element)) return $(document.body); + + var isInline = (Element.getStyle(element, 'display') === 'inline'); + if (!isInline && element.offsetParent) return $(element.offsetParent); + if (element === document.body) return $(element); + + while ((element = element.parentNode) && element !== document.body) { + if (Element.getStyle(element, 'position') !== 'static') { + return (element.nodeName === 'HTML') ? $(document.body) : $(element); + } + } + + return $(document.body); + } + + + function cumulativeOffset(element) { + var valueT = 0, valueL = 0; + do { + valueT += element.offsetTop || 0; + valueL += element.offsetLeft || 0; + element = element.offsetParent; + } while (element); + return new Element.Offset(valueL, valueT); + } + + function positionedOffset(element) { + var layout = element.getLayout(); + + var valueT = 0, valueL = 0; + do { + valueT += element.offsetTop || 0; + valueL += element.offsetLeft || 0; + element = element.offsetParent; + if (element) { + if (isBody(element)) break; + var p = Element.getStyle(element, 'position'); + if (p !== 'static') break; + } + } while (element); + + valueL -= layout.get('margin-top'); + valueT -= layout.get('margin-left'); + + return new Element.Offset(valueL, valueT); + } + + function cumulativeScrollOffset(element) { + var valueT = 0, valueL = 0; + do { + valueT += element.scrollTop || 0; + valueL += element.scrollLeft || 0; + element = element.parentNode; + } while (element); + return new Element.Offset(valueL, valueT); + } + + function viewportOffset(forElement) { + var valueT = 0, valueL = 0, docBody = document.body; + + var element = forElement; + do { + valueT += element.offsetTop || 0; + valueL += element.offsetLeft || 0; + if (element.offsetParent == docBody && + Element.getStyle(element, 'position') == 'absolute') break; + } while (element = element.offsetParent); + + element = forElement; + do { + if (element != docBody) { + valueT -= element.scrollTop || 0; + valueL -= element.scrollLeft || 0; + } + } while (element = element.parentNode); + return new Element.Offset(valueL, valueT); + } + + function absolutize(element) { + element = $(element); + + if (Element.getStyle(element, 'position') === 'absolute') { + return element; + } + + var offsetParent = getOffsetParent(element); + var eOffset = element.viewportOffset(), + pOffset = offsetParent.viewportOffset(); + + var offset = eOffset.relativeTo(pOffset); + var layout = element.getLayout(); + + element.store('prototype_absolutize_original_styles', { + left: element.getStyle('left'), + top: element.getStyle('top'), + width: element.getStyle('width'), + height: element.getStyle('height') + }); + + element.setStyle({ + position: 'absolute', + top: offset.top + 'px', + left: offset.left + 'px', + width: layout.get('width') + 'px', + height: layout.get('height') + 'px' + }); + + return element; + } + + function relativize(element) { + element = $(element); + if (Element.getStyle(element, 'position') === 'relative') { + return element; + } + + var originalStyles = + element.retrieve('prototype_absolutize_original_styles'); + + if (originalStyles) element.setStyle(originalStyles); + return element; + } + + Element.addMethods({ + getLayout: getLayout, + measure: measure, + getDimensions: getDimensions, + getOffsetParent: getOffsetParent, + cumulativeOffset: cumulativeOffset, + positionedOffset: positionedOffset, + cumulativeScrollOffset: cumulativeScrollOffset, + viewportOffset: viewportOffset, + absolutize: absolutize, + relativize: relativize + }); + + function isBody(element) { + return element.nodeName.toUpperCase() === 'BODY'; + } + + function isDetached(element) { + return element !== document.body && + !Element.descendantOf(element, document.body); + } + + if ('getBoundingClientRect' in document.documentElement) { + Element.addMethods({ + viewportOffset: function(element) { + element = $(element); + if (isDetached(element)) return new Element.Offset(0, 0); + + var rect = element.getBoundingClientRect(), + docEl = document.documentElement; + return new Element.Offset(rect.left - docEl.clientLeft, + rect.top - docEl.clientTop); + }, + + positionedOffset: function(element) { + element = $(element); + var parent = element.getOffsetParent(); + if (isDetached(element)) return new Element.Offset(0, 0); + + if (element.offsetParent && + element.offsetParent.nodeName.toUpperCase() === 'HTML') { + return positionedOffset(element); + } + + var eOffset = element.viewportOffset(), + pOffset = isBody(parent) ? viewportOffset(parent) : + parent.viewportOffset(); + var retOffset = eOffset.relativeTo(pOffset); + + var layout = element.getLayout(); + var top = retOffset.top - layout.get('margin-top'); + var left = retOffset.left - layout.get('margin-left'); + + return new Element.Offset(left, top); + } + }); + } +})(); +window.$$ = function() { + var expression = $A(arguments).join(', '); + return Prototype.Selector.select(expression, document); +}; + +Prototype.Selector = (function() { + + function select() { + throw new Error('Method "Prototype.Selector.select" must be defined.'); + } + + function match() { + throw new Error('Method "Prototype.Selector.match" must be defined.'); + } + + function find(elements, expression, index) { + index = index || 0; + var match = Prototype.Selector.match, length = elements.length, matchIndex = 0, i; + + for (i = 0; i < length; i++) { + if (match(elements[i], expression) && index == matchIndex++) { + return Element.extend(elements[i]); + } + } + } + + function extendElements(elements) { + for (var i = 0, length = elements.length; i < length; i++) { + Element.extend(elements[i]); + } + return elements; + } + + + var K = Prototype.K; + + return { + select: select, + match: match, + find: find, + extendElements: (Element.extend === K) ? K : extendElements, + extendElement: Element.extend + }; +})(); +Prototype._original_property = window.Sizzle; +/*! + * Sizzle CSS Selector Engine - v1.0 + * Copyright 2009, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true; + +[0, 0].sort(function(){ + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function(selector, context, results, seed) { + results = results || []; + var origContext = context = context || document; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var parts = [], m, set, checkSet, check, mode, extra, prune = true, contextXML = isXML(context), + soFar = selector; + + while ( (chunker.exec(""), m = chunker.exec(soFar)) !== null ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) + selector += parts.shift(); + + set = posProcess( selector, set ); + } + } + } else { + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + var ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? Sizzle.filter( ret.expr, ret.set )[0] : ret.set[0]; + } + + if ( context ) { + var ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + set = ret.expr ? Sizzle.filter( ret.expr, ret.set ) : ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray(set); + } else { + prune = false; + } + + while ( parts.length ) { + var cur = parts.pop(), pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + throw "Syntax error, unrecognized expression: " + (cur || selector); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + } else if ( context && context.nodeType === 1 ) { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + } else { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function(results){ + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort(sortOrder); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[i-1] ) { + results.splice(i--, 1); + } + } + } + } + + return results; +}; + +Sizzle.matches = function(expr, set){ + return Sizzle(expr, null, null, set); +}; + +Sizzle.find = function(expr, context, isXML){ + var set, match; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var type = Expr.order[i], match; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + var left = match[1]; + match.splice(1,1); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace(/\\/g, ""); + set = Expr.find[ type ]( match, context, isXML ); + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = context.getElementsByTagName("*"); + } + + return {set: set, expr: expr}; +}; + +Sizzle.filter = function(expr, set, inplace, not){ + var old = expr, result = [], curLoop = set, match, anyFound, + isXMLFilter = set && set[0] && isXML(set[0]); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.match[ type ].exec( expr )) != null ) { + var filter = Expr.filter[ type ], found, item; + anyFound = false; + + if ( curLoop == result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + } else { + curLoop[i] = false; + } + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + if ( expr == old ) { + if ( anyFound == null ) { + throw "Syntax error, unrecognized expression: " + expr; + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + match: { + ID: /#((?:[\w\u00c0-\uFFFF-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/ + }, + leftMatch: {}, + attrMap: { + "class": "className", + "for": "htmlFor" + }, + attrHandle: { + href: function(elem){ + return elem.getAttribute("href"); + } + }, + relative: { + "+": function(checkSet, part, isXML){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !/\W/.test(part), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag && !isXML ) { + part = part.toUpperCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + ">": function(checkSet, part, isXML){ + var isPartStr = typeof part === "string"; + + if ( isPartStr && !/\W/.test(part) ) { + part = isXML ? part : part.toUpperCase(); + + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName === part ? parent : false; + } + } + } else { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + "": function(checkSet, part, isXML){ + var doneName = done++, checkFn = dirCheck; + + if ( !/\W/.test(part) ) { + var nodeCheck = part = isXML ? part : part.toUpperCase(); + checkFn = dirNodeCheck; + } + + checkFn("parentNode", part, doneName, checkSet, nodeCheck, isXML); + }, + "~": function(checkSet, part, isXML){ + var doneName = done++, checkFn = dirCheck; + + if ( typeof part === "string" && !/\W/.test(part) ) { + var nodeCheck = part = isXML ? part : part.toUpperCase(); + checkFn = dirNodeCheck; + } + + checkFn("previousSibling", part, doneName, checkSet, nodeCheck, isXML); + } + }, + find: { + ID: function(match, context, isXML){ + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + return m ? [m] : []; + } + }, + NAME: function(match, context, isXML){ + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], results = context.getElementsByName(match[1]); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + TAG: function(match, context){ + return context.getElementsByTagName(match[1]); + } + }, + preFilter: { + CLASS: function(match, curLoop, inplace, result, not, isXML){ + match = " " + match[1].replace(/\\/g, "") + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").indexOf(match) >= 0) ) { + if ( !inplace ) + result.push( elem ); + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + ID: function(match){ + return match[1].replace(/\\/g, ""); + }, + TAG: function(match, curLoop){ + for ( var i = 0; curLoop[i] === false; i++ ){} + return curLoop[i] && isXML(curLoop[i]) ? match[1] : match[1].toUpperCase(); + }, + CHILD: function(match){ + if ( match[1] == "nth" ) { + var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec( + match[2] == "even" && "2n" || match[2] == "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + + match[0] = done++; + + return match; + }, + ATTR: function(match, curLoop, inplace, result, not, isXML){ + var name = match[1].replace(/\\/g, ""); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + PSEUDO: function(match, curLoop, inplace, result, not){ + if ( match[1] === "not" ) { + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + if ( !inplace ) { + result.push.apply( result, ret ); + } + return false; + } + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + POS: function(match){ + match.unshift( true ); + return match; + } + }, + filters: { + enabled: function(elem){ + return elem.disabled === false && elem.type !== "hidden"; + }, + disabled: function(elem){ + return elem.disabled === true; + }, + checked: function(elem){ + return elem.checked === true; + }, + selected: function(elem){ + elem.parentNode.selectedIndex; + return elem.selected === true; + }, + parent: function(elem){ + return !!elem.firstChild; + }, + empty: function(elem){ + return !elem.firstChild; + }, + has: function(elem, i, match){ + return !!Sizzle( match[3], elem ).length; + }, + header: function(elem){ + return /h\d/i.test( elem.nodeName ); + }, + text: function(elem){ + return "text" === elem.type; + }, + radio: function(elem){ + return "radio" === elem.type; + }, + checkbox: function(elem){ + return "checkbox" === elem.type; + }, + file: function(elem){ + return "file" === elem.type; + }, + password: function(elem){ + return "password" === elem.type; + }, + submit: function(elem){ + return "submit" === elem.type; + }, + image: function(elem){ + return "image" === elem.type; + }, + reset: function(elem){ + return "reset" === elem.type; + }, + button: function(elem){ + return "button" === elem.type || elem.nodeName.toUpperCase() === "BUTTON"; + }, + input: function(elem){ + return /input|select|textarea|button/i.test(elem.nodeName); + } + }, + setFilters: { + first: function(elem, i){ + return i === 0; + }, + last: function(elem, i, match, array){ + return i === array.length - 1; + }, + even: function(elem, i){ + return i % 2 === 0; + }, + odd: function(elem, i){ + return i % 2 === 1; + }, + lt: function(elem, i, match){ + return i < match[3] - 0; + }, + gt: function(elem, i, match){ + return i > match[3] - 0; + }, + nth: function(elem, i, match){ + return match[3] - 0 == i; + }, + eq: function(elem, i, match){ + return match[3] - 0 == i; + } + }, + filter: { + PSEUDO: function(elem, match, i, array){ + var name = match[1], filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || "").indexOf(match[3]) >= 0; + } else if ( name === "not" ) { + var not = match[3]; + + for ( var i = 0, l = not.length; i < l; i++ ) { + if ( not[i] === elem ) { + return false; + } + } + + return true; + } + }, + CHILD: function(elem, match){ + var type = match[1], node = elem; + switch (type) { + case 'only': + case 'first': + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) return false; + } + if ( type == 'first') return true; + node = elem; + case 'last': + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) return false; + } + return true; + case 'nth': + var first = match[2], last = match[3]; + + if ( first == 1 && last == 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + if ( first == 0 ) { + return diff == 0; + } else { + return ( diff % first == 0 && diff / first >= 0 ); + } + } + }, + ID: function(elem, match){ + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + TAG: function(elem, match){ + return (match === "*" && elem.nodeType === 1) || elem.nodeName === match; + }, + CLASS: function(elem, match){ + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + ATTR: function(elem, match){ + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value != check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + POS: function(elem, match, i, array){ + var name = match[2], filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source ); } -function $$() { - return Selector.findChildElements(document, $A(arguments)); +var makeArray = function(array, results) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 ); + +} catch(e){ + makeArray = function(array, results) { + var ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + } else { + if ( typeof array.length === "number" ) { + for ( var i = 0, l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + } else { + for ( var i = 0; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; } + +var sortOrder; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + if ( a == b ) { + hasDuplicate = true; + } + return 0; + } + + var ret = a.compareDocumentPosition(b) & 4 ? -1 : a === b ? 0 : 1; + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} else if ( "sourceIndex" in document.documentElement ) { + sortOrder = function( a, b ) { + if ( !a.sourceIndex || !b.sourceIndex ) { + if ( a == b ) { + hasDuplicate = true; + } + return 0; + } + + var ret = a.sourceIndex - b.sourceIndex; + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} else if ( document.createRange ) { + sortOrder = function( a, b ) { + if ( !a.ownerDocument || !b.ownerDocument ) { + if ( a == b ) { + hasDuplicate = true; + } + return 0; + } + + var aRange = a.ownerDocument.createRange(), bRange = b.ownerDocument.createRange(); + aRange.setStart(a, 0); + aRange.setEnd(a, 0); + bRange.setStart(b, 0); + bRange.setEnd(b, 0); + var ret = aRange.compareBoundaryPoints(Range.START_TO_END, bRange); + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} + +(function(){ + var form = document.createElement("div"), + id = "script" + (new Date).getTime(); + form.innerHTML = ""; + + var root = document.documentElement; + root.insertBefore( form, root.firstChild ); + + if ( !!document.getElementById( id ) ) { + Expr.find.ID = function(match, context, isXML){ + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + return m ? m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? [m] : undefined : []; + } + }; + + Expr.filter.ID = function(elem, match){ + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + root = form = null; // release memory in IE +})(); + +(function(){ + + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function(match, context){ + var results = context.getElementsByTagName(match[1]); + + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + div.innerHTML = ""; + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + Expr.attrHandle.href = function(elem){ + return elem.getAttribute("href", 2); + }; + } + + div = null; // release memory in IE +})(); + +if ( document.querySelectorAll ) (function(){ + var oldSizzle = Sizzle, div = document.createElement("div"); + div.innerHTML = "

"; + + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function(query, context, extra, seed){ + context = context || document; + + if ( !seed && context.nodeType === 9 && !isXML(context) ) { + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(e){} + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + div = null; // release memory in IE +})(); + +if ( document.getElementsByClassName && document.documentElement.getElementsByClassName ) (function(){ + var div = document.createElement("div"); + div.innerHTML = "
"; + + if ( div.getElementsByClassName("e").length === 0 ) + return; + + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) + return; + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function(match, context, isXML) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + div = null; // release memory in IE +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + var sibDir = dir == "previousSibling" && !isXML; + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + if ( sibDir && elem.nodeType === 1 ){ + elem.sizcache = doneName; + elem.sizset = i; + } + elem = elem[dir]; + var match = false; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + var sibDir = dir == "previousSibling" && !isXML; + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + if ( sibDir && elem.nodeType === 1 ) { + elem.sizcache = doneName; + elem.sizset = i; + } + elem = elem[dir]; + var match = false; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +var contains = document.compareDocumentPosition ? function(a, b){ + return a.compareDocumentPosition(b) & 16; +} : function(a, b){ + return a !== b && (a.contains ? a.contains(b) : true); +}; + +var isXML = function(elem){ + return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" || + !!elem.ownerDocument && elem.ownerDocument.documentElement.nodeName !== "HTML"; +}; + +var posProcess = function(selector, context){ + var tmpSet = [], later = "", match, + root = context.nodeType ? [context] : context; + + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + + +window.Sizzle = Sizzle; + +})(); + +;(function(engine) { + var extendElements = Prototype.Selector.extendElements; + + function select(selector, scope) { + return extendElements(engine(selector, scope || document)); + } + + function match(element, selector) { + return engine.matches(selector, [element]).length == 1; + } + + Prototype.Selector.engine = engine; + Prototype.Selector.select = select; + Prototype.Selector.match = match; +})(Sizzle); + +window.Sizzle = Prototype._original_property; +delete Prototype._original_property; + var Form = { reset: function(form) { - $(form).reset(); + form = $(form); + form.reset(); return form; }, @@ -3460,7 +4970,6 @@ var Form = { if (value != null && element.type != 'file' && (element.type != 'submit' || (!submitted && submit !== false && (!submit || key == submit) && (submitted = true)))) { if (key in result) { - // a key is already present; construct an array of values if (!Object.isArray(result[key])) result[key] = [result[key]]; result[key].push(value); } @@ -3480,13 +4989,18 @@ Form.Methods = { }, getElements: function(form) { - return $A($(form).getElementsByTagName('*')).inject([], - function(elements, child) { - if (Form.Element.Serializers[child.tagName.toLowerCase()]) - elements.push(Element.extend(child)); - return elements; - } - ); + var elements = $(form).getElementsByTagName('*'), + element, + arr = [ ], + serializers = Form.Element.Serializers; + for (var i = 0; element = elements[i]; i++) { + arr.push(element); + } + return arr.inject([], function(elements, child) { + if (serializers[child.tagName.toLowerCase()]) + elements.push(Element.extend(child)); + return elements; + }) }, getInputs: function(form, typeName, name) { @@ -3526,7 +5040,7 @@ Form.Methods = { }).sortBy(function(element) { return element.tabIndex }).first(); return firstByIndex ? firstByIndex : elements.find(function(element) { - return ['input', 'select', 'textarea'].include(element.tagName.toLowerCase()); + return /^(?:input|select|textarea)$/i.test(element.tagName); }); }, @@ -3557,6 +5071,7 @@ Form.Methods = { /*--------------------------------------------------------------------------*/ + Form.Element = { focus: function(element) { $(element).focus(); @@ -3570,6 +5085,7 @@ Form.Element = { }; Form.Element.Methods = { + serialize: function(element) { element = $(element); if (!element.disabled && element.name) { @@ -3610,7 +5126,7 @@ Form.Element.Methods = { try { element.focus(); if (element.select && (element.tagName.toLowerCase() != 'input' || - !['button', 'reset', 'submit'].include(element.type))) + !(/^(?:button|reset|submit)$/i.test(element.type)))) element.select(); } catch (e) { } return element; @@ -3632,6 +5148,7 @@ Form.Element.Methods = { /*--------------------------------------------------------------------------*/ var Field = Form.Element; + var $F = Form.Element.Methods.getValue; /*--------------------------------------------------------------------------*/ @@ -3694,13 +5211,13 @@ Form.Element.Serializers = { }, optionValue: function(opt) { - // extend element because hasAttribute may not be native return Element.extend(opt).hasAttribute('value') ? opt.value : opt.text; } }; /*--------------------------------------------------------------------------*/ + Abstract.TimedObserver = Class.create(PeriodicalExecuter, { initialize: function($super, element, frequency, callback) { $super(callback, frequency); @@ -3782,354 +5299,475 @@ Form.EventObserver = Class.create(Abstract.EventObserver, { return Form.serialize(this.element); } }); -if (!window.Event) var Event = { }; +(function() { -Object.extend(Event, { - KEY_BACKSPACE: 8, - KEY_TAB: 9, - KEY_RETURN: 13, - KEY_ESC: 27, - KEY_LEFT: 37, - KEY_UP: 38, - KEY_RIGHT: 39, - KEY_DOWN: 40, - KEY_DELETE: 46, - KEY_HOME: 36, - KEY_END: 35, - KEY_PAGEUP: 33, - KEY_PAGEDOWN: 34, - KEY_INSERT: 45, + var Event = { + KEY_BACKSPACE: 8, + KEY_TAB: 9, + KEY_RETURN: 13, + KEY_ESC: 27, + KEY_LEFT: 37, + KEY_UP: 38, + KEY_RIGHT: 39, + KEY_DOWN: 40, + KEY_DELETE: 46, + KEY_HOME: 36, + KEY_END: 35, + KEY_PAGEUP: 33, + KEY_PAGEDOWN: 34, + KEY_INSERT: 45, - cache: { }, + cache: {} + }; - relatedTarget: function(event) { - var element; - switch(event.type) { - case 'mouseover': element = event.fromElement; break; - case 'mouseout': element = event.toElement; break; - default: return null; - } - return Element.extend(element); - } -}); - -Event.Methods = (function() { - var isButton; + var docEl = document.documentElement; + var MOUSEENTER_MOUSELEAVE_EVENTS_SUPPORTED = 'onmouseenter' in docEl + && 'onmouseleave' in docEl; + var _isButton; if (Prototype.Browser.IE) { var buttonMap = { 0: 1, 1: 4, 2: 2 }; - isButton = function(event, code) { - return event.button == buttonMap[code]; + _isButton = function(event, code) { + return event.button === buttonMap[code]; }; - } else if (Prototype.Browser.WebKit) { - isButton = function(event, code) { + _isButton = function(event, code) { switch (code) { case 0: return event.which == 1 && !event.metaKey; case 1: return event.which == 1 && event.metaKey; default: return false; } }; - } else { - isButton = function(event, code) { + _isButton = function(event, code) { return event.which ? (event.which === code + 1) : (event.button === code); }; } - return { - isLeftClick: function(event) { return isButton(event, 0) }, - isMiddleClick: function(event) { return isButton(event, 1) }, - isRightClick: function(event) { return isButton(event, 2) }, + function isLeftClick(event) { return _isButton(event, 0) } - element: function(event) { - event = Event.extend(event); + function isMiddleClick(event) { return _isButton(event, 1) } - var node = event.target, - type = event.type, - currentTarget = event.currentTarget; + function isRightClick(event) { return _isButton(event, 2) } - if (currentTarget && currentTarget.tagName) { - // Firefox screws up the "click" event when moving between radio buttons - // via arrow keys. It also screws up the "load" and "error" events on images, - // reporting the document as the target instead of the original image. - if (type === 'load' || type === 'error' || - (type === 'click' && currentTarget.tagName.toLowerCase() === 'input' - && currentTarget.type === 'radio')) - node = currentTarget; - } - if (node.nodeType == Node.TEXT_NODE) node = node.parentNode; - return Element.extend(node); - }, + function element(event) { + event = Event.extend(event); - findElement: function(event, expression) { - var element = Event.element(event); - if (!expression) return element; - var elements = [element].concat(element.ancestors()); - return Selector.findElement(elements, expression, 0); - }, + var node = event.target, type = event.type, + currentTarget = event.currentTarget; - pointer: function(event) { - var docElement = document.documentElement, - body = document.body || { scrollLeft: 0, scrollTop: 0 }; - return { - x: event.pageX || (event.clientX + - (docElement.scrollLeft || body.scrollLeft) - - (docElement.clientLeft || 0)), - y: event.pageY || (event.clientY + - (docElement.scrollTop || body.scrollTop) - - (docElement.clientTop || 0)) - }; - }, - - pointerX: function(event) { return Event.pointer(event).x }, - pointerY: function(event) { return Event.pointer(event).y }, - - stop: function(event) { - Event.extend(event); - event.preventDefault(); - event.stopPropagation(); - event.stopped = true; + if (currentTarget && currentTarget.tagName) { + if (type === 'load' || type === 'error' || + (type === 'click' && currentTarget.tagName.toLowerCase() === 'input' + && currentTarget.type === 'radio')) + node = currentTarget; } - }; -})(); -Event.extend = (function() { + if (node.nodeType == Node.TEXT_NODE) + node = node.parentNode; + + return Element.extend(node); + } + + function findElement(event, expression) { + var element = Event.element(event); + if (!expression) return element; + while (element) { + if (Object.isElement(element) && Prototype.Selector.match(element, expression)) { + return Element.extend(element); + } + element = element.parentNode; + } + } + + function pointer(event) { + return { x: pointerX(event), y: pointerY(event) }; + } + + function pointerX(event) { + var docElement = document.documentElement, + body = document.body || { scrollLeft: 0 }; + + return event.pageX || (event.clientX + + (docElement.scrollLeft || body.scrollLeft) - + (docElement.clientLeft || 0)); + } + + function pointerY(event) { + var docElement = document.documentElement, + body = document.body || { scrollTop: 0 }; + + return event.pageY || (event.clientY + + (docElement.scrollTop || body.scrollTop) - + (docElement.clientTop || 0)); + } + + + function stop(event) { + Event.extend(event); + event.preventDefault(); + event.stopPropagation(); + + event.stopped = true; + } + + Event.Methods = { + isLeftClick: isLeftClick, + isMiddleClick: isMiddleClick, + isRightClick: isRightClick, + + element: element, + findElement: findElement, + + pointer: pointer, + pointerX: pointerX, + pointerY: pointerY, + + stop: stop + }; + + var methods = Object.keys(Event.Methods).inject({ }, function(m, name) { m[name] = Event.Methods[name].methodize(); return m; }); if (Prototype.Browser.IE) { + function _relatedTarget(event) { + var element; + switch (event.type) { + case 'mouseover': element = event.fromElement; break; + case 'mouseout': element = event.toElement; break; + default: return null; + } + return Element.extend(element); + } + Object.extend(methods, { stopPropagation: function() { this.cancelBubble = true }, preventDefault: function() { this.returnValue = false }, - inspect: function() { return "[object Event]" } + inspect: function() { return '[object Event]' } }); - return function(event) { + Event.extend = function(event, element) { if (!event) return false; if (event._extendedByPrototype) return event; event._extendedByPrototype = Prototype.emptyFunction; var pointer = Event.pointer(event); + Object.extend(event, { - target: event.srcElement, - relatedTarget: Event.relatedTarget(event), + target: event.srcElement || element, + relatedTarget: _relatedTarget(event), pageX: pointer.x, pageY: pointer.y }); + return Object.extend(event, methods); }; - } else { - Event.prototype = Event.prototype || document.createEvent("HTMLEvents")['__proto__']; + Event.prototype = window.Event.prototype || document.createEvent('HTMLEvents').__proto__; Object.extend(Event.prototype, methods); - return Prototype.K; - } -})(); - -Object.extend(Event, (function() { - var cache = Event.cache; - - function getEventID(element) { - if (element._prototypeEventID) return element._prototypeEventID[0]; - arguments.callee.id = arguments.callee.id || 1; - return element._prototypeEventID = [++arguments.callee.id]; + Event.extend = Prototype.K; } - function getDOMEventName(eventName) { - if (eventName && eventName.include(':')) return "dataavailable"; - return eventName; - } + function _createResponder(element, eventName, handler) { + var registry = Element.retrieve(element, 'prototype_event_registry'); - function getCacheForID(id) { - return cache[id] = cache[id] || { }; - } + if (Object.isUndefined(registry)) { + CACHE.push(element); + registry = Element.retrieve(element, 'prototype_event_registry', $H()); + } - function getWrappersForEventName(id, eventName) { - var c = getCacheForID(id); - return c[eventName] = c[eventName] || []; - } + var respondersForEvent = registry.get(eventName); + if (Object.isUndefined(respondersForEvent)) { + respondersForEvent = []; + registry.set(eventName, respondersForEvent); + } - function createWrapper(element, eventName, handler) { - var id = getEventID(element); - var c = getWrappersForEventName(id, eventName); - if (c.pluck("handler").include(handler)) return false; + if (respondersForEvent.pluck('handler').include(handler)) return false; - var wrapper = function(event) { - if (!Event || !Event.extend || - (event.eventName && event.eventName != eventName)) + var responder; + if (eventName.include(":")) { + responder = function(event) { + if (Object.isUndefined(event.eventName)) return false; - Event.extend(event); - handler.call(element, event); - }; + if (event.eventName !== eventName) + return false; - wrapper.handler = handler; - c.push(wrapper); - return wrapper; - } + Event.extend(event, element); + handler.call(element, event); + }; + } else { + if (!MOUSEENTER_MOUSELEAVE_EVENTS_SUPPORTED && + (eventName === "mouseenter" || eventName === "mouseleave")) { + if (eventName === "mouseenter" || eventName === "mouseleave") { + responder = function(event) { + Event.extend(event, element); - function findWrapper(id, eventName, handler) { - var c = getWrappersForEventName(id, eventName); - return c.find(function(wrapper) { return wrapper.handler == handler }); - } + var parent = event.relatedTarget; + while (parent && parent !== element) { + try { parent = parent.parentNode; } + catch(e) { parent = element; } + } - function destroyWrapper(id, eventName, handler) { - var c = getCacheForID(id); - if (!c[eventName]) return false; - c[eventName] = c[eventName].without(findWrapper(id, eventName, handler)); - } + if (parent === element) return; - function destroyCache() { - for (var id in cache) - for (var eventName in cache[id]) - cache[id][eventName] = null; - } - - - // Internet Explorer needs to remove event handlers on page unload - // in order to avoid memory leaks. - if (window.attachEvent) { - window.attachEvent("onunload", destroyCache); - } - - // Safari has a dummy event handler on page unload so that it won't - // use its bfcache. Safari <= 3.1 has an issue with restoring the "document" - // object when page is returned to via the back button using its bfcache. - if (Prototype.Browser.WebKit) { - window.addEventListener('unload', Prototype.emptyFunction, false); - } - - return { - observe: function(element, eventName, handler) { - element = $(element); - var name = getDOMEventName(eventName); - - var wrapper = createWrapper(element, eventName, handler); - if (!wrapper) return element; - - if (element.addEventListener) { - element.addEventListener(name, wrapper, false); + handler.call(element, event); + }; + } } else { - element.attachEvent("on" + name, wrapper); + responder = function(event) { + Event.extend(event, element); + handler.call(element, event); + }; } - - return element; - }, - - stopObserving: function(element, eventName, handler) { - element = $(element); - var id = getEventID(element), name = getDOMEventName(eventName); - - if (!handler && eventName) { - getWrappersForEventName(id, eventName).each(function(wrapper) { - element.stopObserving(eventName, wrapper.handler); - }); - return element; - - } else if (!eventName) { - Object.keys(getCacheForID(id)).each(function(eventName) { - element.stopObserving(eventName); - }); - return element; - } - - var wrapper = findWrapper(id, eventName, handler); - if (!wrapper) return element; - - if (element.removeEventListener) { - element.removeEventListener(name, wrapper, false); - } else { - element.detachEvent("on" + name, wrapper); - } - - destroyWrapper(id, eventName, handler); - - return element; - }, - - fire: function(element, eventName, memo) { - element = $(element); - if (element == document && document.createEvent && !element.dispatchEvent) - element = document.documentElement; - - var event; - if (document.createEvent) { - event = document.createEvent("HTMLEvents"); - event.initEvent("dataavailable", true, true); - } else { - event = document.createEventObject(); - event.eventType = "ondataavailable"; - } - - event.eventName = eventName; - event.memo = memo || { }; - - if (document.createEvent) { - element.dispatchEvent(event); - } else { - element.fireEvent(event.eventType, event); - } - - return Event.extend(event); } - }; -})()); -Object.extend(Event, Event.Methods); + responder.handler = handler; + respondersForEvent.push(responder); + return responder; + } -Element.addMethods({ - fire: Event.fire, - observe: Event.observe, - stopObserving: Event.stopObserving -}); + function _destroyCache() { + for (var i = 0, length = CACHE.length; i < length; i++) { + Event.stopObserving(CACHE[i]); + CACHE[i] = null; + } + } -Object.extend(document, { - fire: Element.Methods.fire.methodize(), - observe: Element.Methods.observe.methodize(), - stopObserving: Element.Methods.stopObserving.methodize(), - loaded: false -}); + var CACHE = []; + + if (Prototype.Browser.IE) + window.attachEvent('onunload', _destroyCache); + + if (Prototype.Browser.WebKit) + window.addEventListener('unload', Prototype.emptyFunction, false); + + + var _getDOMEventName = Prototype.K, + translations = { mouseenter: "mouseover", mouseleave: "mouseout" }; + + if (!MOUSEENTER_MOUSELEAVE_EVENTS_SUPPORTED) { + _getDOMEventName = function(eventName) { + return (translations[eventName] || eventName); + }; + } + + function observe(element, eventName, handler) { + element = $(element); + + var responder = _createResponder(element, eventName, handler); + + if (!responder) return element; + + if (eventName.include(':')) { + if (element.addEventListener) + element.addEventListener("dataavailable", responder, false); + else { + element.attachEvent("ondataavailable", responder); + element.attachEvent("onfilterchange", responder); + } + } else { + var actualEventName = _getDOMEventName(eventName); + + if (element.addEventListener) + element.addEventListener(actualEventName, responder, false); + else + element.attachEvent("on" + actualEventName, responder); + } + + return element; + } + + function stopObserving(element, eventName, handler) { + element = $(element); + + var registry = Element.retrieve(element, 'prototype_event_registry'); + if (!registry) return element; + + if (!eventName) { + registry.each( function(pair) { + var eventName = pair.key; + stopObserving(element, eventName); + }); + return element; + } + + var responders = registry.get(eventName); + if (!responders) return element; + + if (!handler) { + responders.each(function(r) { + stopObserving(element, eventName, r.handler); + }); + return element; + } + + var responder = responders.find( function(r) { return r.handler === handler; }); + if (!responder) return element; + + if (eventName.include(':')) { + if (element.removeEventListener) + element.removeEventListener("dataavailable", responder, false); + else { + element.detachEvent("ondataavailable", responder); + element.detachEvent("onfilterchange", responder); + } + } else { + var actualEventName = _getDOMEventName(eventName); + if (element.removeEventListener) + element.removeEventListener(actualEventName, responder, false); + else + element.detachEvent('on' + actualEventName, responder); + } + + registry.set(eventName, responders.without(responder)); + + return element; + } + + function fire(element, eventName, memo, bubble) { + element = $(element); + + if (Object.isUndefined(bubble)) + bubble = true; + + if (element == document && document.createEvent && !element.dispatchEvent) + element = document.documentElement; + + var event; + if (document.createEvent) { + event = document.createEvent('HTMLEvents'); + event.initEvent('dataavailable', true, true); + } else { + event = document.createEventObject(); + event.eventType = bubble ? 'ondataavailable' : 'onfilterchange'; + } + + event.eventName = eventName; + event.memo = memo || { }; + + if (document.createEvent) + element.dispatchEvent(event); + else + element.fireEvent(event.eventType, event); + + return Event.extend(event); + } + + Event.Handler = Class.create({ + initialize: function(element, eventName, selector, callback) { + this.element = $(element); + this.eventName = eventName; + this.selector = selector; + this.callback = callback; + this.handler = this.handleEvent.bind(this); + }, + + start: function() { + Event.observe(this.element, this.eventName, this.handler); + return this; + }, + + stop: function() { + Event.stopObserving(this.element, this.eventName, this.handler); + return this; + }, + + handleEvent: function(event) { + var element = event.findElement(this.selector); + if (element) this.callback.call(this.element, event, element); + } + }); + + function on(element, eventName, selector, callback) { + element = $(element); + if (Object.isFunction(selector) && Object.isUndefined(callback)) { + callback = selector, selector = null; + } + + return new Event.Handler(element, eventName, selector, callback).start(); + } + + Object.extend(Event, Event.Methods); + + Object.extend(Event, { + fire: fire, + observe: observe, + stopObserving: stopObserving, + on: on + }); + + Element.addMethods({ + fire: fire, + + observe: observe, + + stopObserving: stopObserving, + + on: on + }); + + Object.extend(document, { + fire: fire.methodize(), + + observe: observe.methodize(), + + stopObserving: stopObserving.methodize(), + + on: on.methodize(), + + loaded: false + }); + + if (window.Event) Object.extend(window.Event, Event); + else window.Event = Event; +})(); (function() { /* Support for the DOMContentLoaded event is based on work by Dan Webb, - Matthias Miller, Dean Edwards and John Resig. */ + Matthias Miller, Dean Edwards, John Resig, and Diego Perini. */ var timer; function fireContentLoadedEvent() { if (document.loaded) return; - if (timer) window.clearInterval(timer); - document.fire("dom:loaded"); + if (timer) window.clearTimeout(timer); document.loaded = true; + document.fire('dom:loaded'); + } + + function checkReadyState() { + if (document.readyState === 'complete') { + document.stopObserving('readystatechange', checkReadyState); + fireContentLoadedEvent(); + } + } + + function pollDoScroll() { + try { document.documentElement.doScroll('left'); } + catch(e) { + timer = pollDoScroll.defer(); + return; + } + fireContentLoadedEvent(); } if (document.addEventListener) { - if (Prototype.Browser.WebKit) { - timer = window.setInterval(function() { - if (/loaded|complete/.test(document.readyState)) - fireContentLoadedEvent(); - }, 0); - - Event.observe(window, "load", fireContentLoadedEvent); - - } else { - document.addEventListener("DOMContentLoaded", - fireContentLoadedEvent, false); - } - + document.addEventListener('DOMContentLoaded', fireContentLoadedEvent, false); } else { - document.write(" - - -
- - -
- - - - -
-

Getting started

-

Here’s how to get rolling:

- -
    -
  1. -

    Use rails generate to create your models and controllers

    -

    To see all available options, run it without parameters.

    -
    2. - -
  2. -

    Set up a default route and remove or rename this file

    -

    Routes are set up in config/routes.rb.

    -
    3. - -
  3. -

    Create your database

    -

    Run rake db:migrate to create your database. If you're not using SQLite (the default), edit config/database.yml with your username and password.

    -
    4. -
-
-
- - -
- - diff --git a/test/functional/sessions_controller_test.rb b/test/functional/sessions_controller_test.rb new file mode 100644 index 00000000..75db9687 --- /dev/null +++ b/test/functional/sessions_controller_test.rb @@ -0,0 +1,9 @@ +require 'test_helper' + +class SessionsControllerTest < ActionController::TestCase + test "should get new" do + get :new + assert_response :success + end + +end diff --git a/test/unit/helpers/sessions_helper_test.rb b/test/unit/helpers/sessions_helper_test.rb new file mode 100644 index 00000000..7d44e096 --- /dev/null +++ b/test/unit/helpers/sessions_helper_test.rb @@ -0,0 +1,4 @@ +require 'test_helper' + +class SessionsHelperTest < ActionView::TestCase +end From bdb177dfa6bc42181816ff12c521d21f537c7099 Mon Sep 17 00:00:00 2001 From: benni Date: Wed, 11 May 2011 14:21:06 +0200 Subject: [PATCH 011/335] Fixed bug in routes.rb --- config/routes.rb | 42 +++++++++++++++++++++--------------------- 1 file changed, 21 insertions(+), 21 deletions(-) diff --git a/config/routes.rb b/config/routes.rb index ccc7e8ce..532efbf9 100644 --- a/config/routes.rb +++ b/config/routes.rb @@ -115,39 +115,39 @@ Foodsoft::Application.routes.draw do post :sync end end + end - resources :article_categories + resources :article_categories - ########### Finance + ########### Finance - namespace :finance do - root :to => 'balancing#index' - match 'balancing/list' => 'balancing#list', :as => 'balancing' + namespace :finance do + root :to => 'balancing#index' + match 'balancing/list' => 'balancing#list', :as => 'balancing' - resources :invoices + resources :invoices - resources :transactions do - collection do - get :new_collection - post :create_collection - end + resources :transactions do + collection do + get :new_collection + post :create_collection end end + end - ########### Administration + ########### Administration - namespace :admin do - root :to => 'base#index' + namespace :admin do + root :to => 'base#index' - resources :users + resources :users - resources :workgroups do - get :memberships, :on => :member - end + resources :workgroups do + get :memberships, :on => :member + end - resources :ordergroups do - get :memberships, :on => :member - end + resources :ordergroups do + get :memberships, :on => :member end end From 2a72263bd33e7a0c5b7deb95e35f0c56af9b4b2b Mon Sep 17 00:00:00 2001 From: benni Date: Wed, 11 May 2011 15:14:39 +0200 Subject: [PATCH 012/335] Replaced protoype with jquery. Some fixes in mailer class. --- Gemfile | 1 + Gemfile.lock | 4 + app/controllers/feedback_controller.rb | 11 +- app/mailers/mailer.rb | 6 +- app/models/message.rb | 2 +- app/views/feedback/_new.html.haml | 8 - app/views/feedback/_success.html.haml | 4 - app/views/feedback/new.html.haml | 6 + app/views/layouts/application.haml | 13 +- app/views/layouts/application.html.erb | 14 - app/views/mailer/feedback.erb | 2 +- app/views/shared/_loginInfo.haml | 3 +- config/routes.rb | 6 +- public/javascripts/builder.js | 136 - public/javascripts/controls.js | 965 -- public/javascripts/dragdrop.js | 974 -- public/javascripts/effects.js | 1123 --- public/javascripts/jquery-ui.js | 11603 +++++++++++++++++++++++ public/javascripts/jquery-ui.min.js | 406 + public/javascripts/jquery.js | 8865 +++++++++++++++++ public/javascripts/jquery.min.js | 16 + public/javascripts/jquery_ujs.js | 289 + public/javascripts/prototype.js | 6001 ------------ public/javascripts/rails.js | 191 - public/javascripts/scriptaculous.js | 58 - public/javascripts/slider.js | 275 - public/javascripts/sound.js | 55 - public/javascripts/unittest.js | 568 -- 28 files changed, 21207 insertions(+), 10398 deletions(-) delete mode 100644 app/views/feedback/_new.html.haml delete mode 100644 app/views/feedback/_success.html.haml create mode 100644 app/views/feedback/new.html.haml delete mode 100644 app/views/layouts/application.html.erb delete mode 100644 public/javascripts/builder.js delete mode 100644 public/javascripts/controls.js delete mode 100644 public/javascripts/dragdrop.js delete mode 100644 public/javascripts/effects.js create mode 100644 public/javascripts/jquery-ui.js create mode 100644 public/javascripts/jquery-ui.min.js create mode 100644 public/javascripts/jquery.js create mode 100644 public/javascripts/jquery.min.js create mode 100644 public/javascripts/jquery_ujs.js delete mode 100644 public/javascripts/prototype.js delete mode 100644 public/javascripts/rails.js delete mode 100644 public/javascripts/scriptaculous.js delete mode 100644 public/javascripts/slider.js delete mode 100644 public/javascripts/sound.js delete mode 100644 public/javascripts/unittest.js diff --git a/Gemfile b/Gemfile index fb2fe530..d45ed3b3 100644 --- a/Gemfile +++ b/Gemfile @@ -8,6 +8,7 @@ gem "fastercsv" gem "prawn", '<=0.6.3' gem 'haml', '>=2.0.6' gem "will_paginate", "~> 3.0.pre2" +gem 'jquery-rails' group :development do diff --git a/Gemfile.lock b/Gemfile.lock index 58b277d5..14416c9d 100644 --- a/Gemfile.lock +++ b/Gemfile.lock @@ -38,6 +38,9 @@ GEM haml (3.0.25) hirb (0.3.4) i18n (0.5.0) + jquery-rails (1.0.1) + railties (~> 3.0) + thor (~> 0.14) mail (2.2.19) activesupport (>= 2.3.6) i18n (>= 0.4.0) @@ -90,6 +93,7 @@ DEPENDENCIES fastercsv haml (>= 2.0.6) hirb + jquery-rails mysql prawn (<= 0.6.3) rails (= 3.0.7) diff --git a/app/controllers/feedback_controller.rb b/app/controllers/feedback_controller.rb index e6d57dab..cab491a9 100644 --- a/app/controllers/feedback_controller.rb +++ b/app/controllers/feedback_controller.rb @@ -1,19 +1,14 @@ class FeedbackController < ApplicationController def new - render :update do |page| - page.replace_html :ajax_box, :partial => "new" - page.show :ajax_box - end end def create unless params[:message].blank? Mailer.feedback(current_user, params[:message]).deliver - end - - render :update do |page| - page.replace_html :ajax_box, :partial => "success" + redirect_to new_feedback_url, :notice => 'The message was successfully delivered.' + else + render :action => 'new' end end diff --git a/app/mailers/mailer.rb b/app/mailers/mailer.rb index 22a1aa0b..cca07925 100644 --- a/app/mailers/mailer.rb +++ b/app/mailers/mailer.rb @@ -6,7 +6,7 @@ class Mailer < ActionMailer::Base default :from => "FoodSoft <#{Foodsoft.config[:email_sender]}>" # Sends an email copy of the given internal foodsoft message. - def message(message, recipient) + def foodsoft_message(message, recipient) @body = message.body @sender = message.sender.nick @recipients = recipient.nick @@ -67,9 +67,9 @@ class Mailer < ActionMailer::Base :subject => "[#{Foodsoft.config[:name]}] Gruppenkonto im Minus" end - def feedback(user, message) + def feedback(user, feedback) @user = user - @message = message + @feedback = feedback mail :to => Foodsoft.config[:notification]["error_recipients"], :from => "#{user.nick} <#{user.email}>", diff --git a/app/models/message.rb b/app/models/message.rb index 165bc73b..ea0012cd 100644 --- a/app/models/message.rb +++ b/app/models/message.rb @@ -65,7 +65,7 @@ class Message < ActiveRecord::Base for recipient in message.recipients if recipient.settings['messages.sendAsEmail'] == "1" && !recipient.email.blank? begin - Mailer.message(message, recipient).deliver + Mailer.foodsoft_message(message, recipient).deliver rescue logger.warn "Deliver failed for #{recipient.nick}: #{recipient.email}" end diff --git a/app/views/feedback/_new.html.haml b/app/views/feedback/_new.html.haml deleted file mode 100644 index 8d5eb16b..00000000 --- a/app/views/feedback/_new.html.haml +++ /dev/null @@ -1,8 +0,0 @@ -%h2 Fehler gefunden? Vorschlag? Idee? Kritik? - -- form_remote_tag :url => {:action => "create"}, :before => "Element.show('loader')", :success => "Element.hide('loader')" do - %p - = text_area_tag :message, nil, :size => "40x15" - = submit_tag "Absenden" - oder - = link_to_function "Abbrechen", "Element.hide('ajax_box')" \ No newline at end of file diff --git a/app/views/feedback/_success.html.haml b/app/views/feedback/_success.html.haml deleted file mode 100644 index 39c18ae2..00000000 --- a/app/views/feedback/_success.html.haml +++ /dev/null @@ -1,4 +0,0 @@ -%h2 Nachricht wurde verschickt! - -%p Vielen Dank, Deine Nachricht wurde soeben dem Foodcooft Team zugestellt. -%p= link_to_function "Schließen", "Element.hide('ajax_box')" \ No newline at end of file diff --git a/app/views/feedback/new.html.haml b/app/views/feedback/new.html.haml new file mode 100644 index 00000000..a137cc90 --- /dev/null +++ b/app/views/feedback/new.html.haml @@ -0,0 +1,6 @@ +%h2 Fehler gefunden? Vorschlag? Idee? Kritik? + += form_tag feedback_path do + %p + = text_area_tag :message, nil, :size => "40x15" + = submit_tag "Absenden" \ No newline at end of file diff --git a/app/views/layouts/application.haml b/app/views/layouts/application.haml index fc8b52b0..57eaae9f 100644 --- a/app/views/layouts/application.haml +++ b/app/views/layouts/application.haml @@ -8,7 +8,7 @@ - = javascript_include_tag 'prototype', 'effects', 'controls', 'application', 'ordering', :cache => "all_cached" + = javascript_include_tag 'jquery.min', 'jquery-ui.min', 'jquery_ujs', 'application', 'ordering', :cache => "all_cached" = yield(:head) %body #logininfo= render :partial => 'shared/loginInfo' @@ -22,17 +22,10 @@ #main #content - - if flash[:notice] - %h3.notice#flashNotice= flash[:notice] - - if flash[:error] - %h3.error#flashError= flash[:error] + - flash.each do |name, msg| + = content_tag :div, msg, :id => "flash#{name.to_s.camelize}", :class => "flash #{name}" #loader{:style => "display:none;"}= image_tag("loader.gif", :border => 0) - if show_title? %h1= yield(:title) = yield #ajax_box(style="display:none") - - - if flash[:notice] - = javascript_tag("new Effect.Highlight('flashNotice', {delay:0.8, duration:1});") - - if flash[:error] - = javascript_tag("new Effect.Highlight('flashError', {delay:0.8, duration:1});") diff --git a/app/views/layouts/application.html.erb b/app/views/layouts/application.html.erb deleted file mode 100644 index 9a412bb1..00000000 --- a/app/views/layouts/application.html.erb +++ /dev/null @@ -1,14 +0,0 @@ - - - - Foodsoft - <%= stylesheet_link_tag :all %> - <%= javascript_include_tag :defaults %> - <%= csrf_meta_tag %> - - - -<%= yield %> - - - diff --git a/app/views/mailer/feedback.erb b/app/views/mailer/feedback.erb index 97cc7b85..6f01036c 100644 --- a/app/views/mailer/feedback.erb +++ b/app/views/mailer/feedback.erb @@ -1,3 +1,3 @@ <%= @user.nick %> schrieb am <%= I18n.l Time.now, :format => :short %>: -<%= @message %> +<%= @feedback %> diff --git a/app/views/shared/_loginInfo.haml b/app/views/shared/_loginInfo.haml index 83e574a0..692b2398 100644 --- a/app/views/shared/_loginInfo.haml +++ b/app/views/shared/_loginInfo.haml @@ -5,6 +5,5 @@ - if Foodsoft.config[:homepage] %li= link_to Foodsoft.config[:name], Foodsoft.config[:homepage], { :title => _("Go to your FoodCoop-Hompage") } %li= link_to "Hilfe", 'http://dev.foodcoops.net/wiki/FoodsoftDoku' - %li= link_to_remote "Feedback", :url => {:controller => "/feedback", :action => "new"}, | - :method => :get, :html => {:title => "Fehler gefunden? Vorschlag? Idee? Kritik?"} | + %li= link_to "Feedback", new_feedback_path, :title => "Fehler gefunden? Vorschlag? Idee? Kritik?" %li= link_to "Abmelden", logout_path \ No newline at end of file diff --git a/config/routes.rb b/config/routes.rb index 532efbf9..7c55ceb1 100644 --- a/config/routes.rb +++ b/config/routes.rb @@ -87,7 +87,7 @@ Foodsoft::Application.routes.draw do end end - resources :stock_articles, :to => 'stockit', :as => 'stockit' do + resources :stock_articles, :to => 'stockit' do collection do get :auto_complete_for_article_name get :fill_new_stock_article_form @@ -151,6 +151,10 @@ Foodsoft::Application.routes.draw do end end + ############## Feedback + + resource :feedback, :only => [:new, :create], :controller => 'feedback' + ############## The rest match '/:controller(/:action(/:id))' diff --git a/public/javascripts/builder.js b/public/javascripts/builder.js deleted file mode 100644 index 83019994..00000000 --- a/public/javascripts/builder.js +++ /dev/null @@ -1,136 +0,0 @@ -// script.aculo.us builder.js v1.8.1, Thu Jan 03 22:07:12 -0500 2008 - -// Copyright (c) 2005-2007 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) -// -// script.aculo.us is freely distributable under the terms of an MIT-style license. -// For details, see the script.aculo.us web site: http://script.aculo.us/ - -var Builder = { - NODEMAP: { - AREA: 'map', - CAPTION: 'table', - COL: 'table', - COLGROUP: 'table', - LEGEND: 'fieldset', - OPTGROUP: 'select', - OPTION: 'select', - PARAM: 'object', - TBODY: 'table', - TD: 'table', - TFOOT: 'table', - TH: 'table', - THEAD: 'table', - TR: 'table' - }, - // note: For Firefox < 1.5, OPTION and OPTGROUP tags are currently broken, - // due to a Firefox bug - node: function(elementName) { - elementName = elementName.toUpperCase(); - - // try innerHTML approach - var parentTag = this.NODEMAP[elementName] || 'div'; - var parentElement = document.createElement(parentTag); - try { // prevent IE "feature": http://dev.rubyonrails.org/ticket/2707 - parentElement.innerHTML = "<" + elementName + ">"; - } catch(e) {} - var element = parentElement.firstChild || null; - - // see if browser added wrapping tags - if(element && (element.tagName.toUpperCase() != elementName)) - element = element.getElementsByTagName(elementName)[0]; - - // fallback to createElement approach - if(!element) element = document.createElement(elementName); - - // abort if nothing could be created - if(!element) return; - - // attributes (or text) - if(arguments[1]) - if(this._isStringOrNumber(arguments[1]) || - (arguments[1] instanceof Array) || - arguments[1].tagName) { - this._children(element, arguments[1]); - } else { - var attrs = this._attributes(arguments[1]); - if(attrs.length) { - try { // prevent IE "feature": http://dev.rubyonrails.org/ticket/2707 - parentElement.innerHTML = "<" +elementName + " " + - attrs + ">"; - } catch(e) {} - element = parentElement.firstChild || null; - // workaround firefox 1.0.X bug - if(!element) { - element = document.createElement(elementName); - for(attr in arguments[1]) - element[attr == 'class' ? 'className' : attr] = arguments[1][attr]; - } - if(element.tagName.toUpperCase() != elementName) - element = parentElement.getElementsByTagName(elementName)[0]; - } - } - - // text, or array of children - if(arguments[2]) - this._children(element, arguments[2]); - - return element; - }, - _text: function(text) { - return document.createTextNode(text); - }, - - ATTR_MAP: { - 'className': 'class', - 'htmlFor': 'for' - }, - - _attributes: function(attributes) { - var attrs = []; - for(attribute in attributes) - attrs.push((attribute in this.ATTR_MAP ? this.ATTR_MAP[attribute] : attribute) + - '="' + attributes[attribute].toString().escapeHTML().gsub(/"/,'"') + '"'); - return attrs.join(" "); - }, - _children: function(element, children) { - if(children.tagName) { - element.appendChild(children); - return; - } - if(typeof children=='object') { // array can hold nodes and text - children.flatten().each( function(e) { - if(typeof e=='object') - element.appendChild(e) - else - if(Builder._isStringOrNumber(e)) - element.appendChild(Builder._text(e)); - }); - } else - if(Builder._isStringOrNumber(children)) - element.appendChild(Builder._text(children)); - }, - _isStringOrNumber: function(param) { - return(typeof param=='string' || typeof param=='number'); - }, - build: function(html) { - var element = this.node('div'); - $(element).update(html.strip()); - return element.down(); - }, - dump: function(scope) { - if(typeof scope != 'object' && typeof scope != 'function') scope = window; //global scope - - var tags = ("A ABBR ACRONYM ADDRESS APPLET AREA B BASE BASEFONT BDO BIG BLOCKQUOTE BODY " + - "BR BUTTON CAPTION CENTER CITE CODE COL COLGROUP DD DEL DFN DIR DIV DL DT EM FIELDSET " + - "FONT FORM FRAME FRAMESET H1 H2 H3 H4 H5 H6 HEAD HR HTML I IFRAME IMG INPUT INS ISINDEX "+ - "KBD LABEL LEGEND LI LINK MAP MENU META NOFRAMES NOSCRIPT OBJECT OL OPTGROUP OPTION P "+ - "PARAM PRE Q S SAMP SCRIPT SELECT SMALL SPAN STRIKE STRONG STYLE SUB SUP TABLE TBODY TD "+ - "TEXTAREA TFOOT TH THEAD TITLE TR TT U UL VAR").split(/\s+/); - - tags.each( function(tag){ - scope[tag] = function() { - return Builder.node.apply(Builder, [tag].concat($A(arguments))); - } - }); - } -} diff --git a/public/javascripts/controls.js b/public/javascripts/controls.js deleted file mode 100644 index 7392fb66..00000000 --- a/public/javascripts/controls.js +++ /dev/null @@ -1,965 +0,0 @@ -// script.aculo.us controls.js v1.8.3, Thu Oct 08 11:23:33 +0200 2009 - -// Copyright (c) 2005-2009 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) -// (c) 2005-2009 Ivan Krstic (http://blogs.law.harvard.edu/ivan) -// (c) 2005-2009 Jon Tirsen (http://www.tirsen.com) -// Contributors: -// Richard Livsey -// Rahul Bhargava -// Rob Wills -// -// script.aculo.us is freely distributable under the terms of an MIT-style license. -// For details, see the script.aculo.us web site: http://script.aculo.us/ - -// Autocompleter.Base handles all the autocompletion functionality -// that's independent of the data source for autocompletion. This -// includes drawing the autocompletion menu, observing keyboard -// and mouse events, and similar. -// -// Specific autocompleters need to provide, at the very least, -// a getUpdatedChoices function that will be invoked every time -// the text inside the monitored textbox changes. This method -// should get the text for which to provide autocompletion by -// invoking this.getToken(), NOT by directly accessing -// this.element.value. This is to allow incremental tokenized -// autocompletion. Specific auto-completion logic (AJAX, etc) -// belongs in getUpdatedChoices. -// -// Tokenized incremental autocompletion is enabled automatically -// when an autocompleter is instantiated with the 'tokens' option -// in the options parameter, e.g.: -// new Ajax.Autocompleter('id','upd', '/url/', { tokens: ',' }); -// will incrementally autocomplete with a comma as the token. -// Additionally, ',' in the above example can be replaced with -// a token array, e.g. { tokens: [',', '\n'] } which -// enables autocompletion on multiple tokens. This is most -// useful when one of the tokens is \n (a newline), as it -// allows smart autocompletion after linebreaks. - -if(typeof Effect == 'undefined') - throw("controls.js requires including script.aculo.us' effects.js library"); - -var Autocompleter = { }; -Autocompleter.Base = Class.create({ - baseInitialize: function(element, update, options) { - element = $(element); - this.element = element; - this.update = $(update); - this.hasFocus = false; - this.changed = false; - this.active = false; - this.index = 0; - this.entryCount = 0; - this.oldElementValue = this.element.value; - - if(this.setOptions) - this.setOptions(options); - else - this.options = options || { }; - - this.options.paramName = this.options.paramName || this.element.name; - this.options.tokens = this.options.tokens || []; - this.options.frequency = this.options.frequency || 0.4; - this.options.minChars = this.options.minChars || 1; - this.options.onShow = this.options.onShow || - function(element, update){ - if(!update.style.position || update.style.position=='absolute') { - update.style.position = 'absolute'; - Position.clone(element, update, { - setHeight: false, - offsetTop: element.offsetHeight - }); - } - Effect.Appear(update,{duration:0.15}); - }; - this.options.onHide = this.options.onHide || - function(element, update){ new Effect.Fade(update,{duration:0.15}) }; - - if(typeof(this.options.tokens) == 'string') - this.options.tokens = new Array(this.options.tokens); - // Force carriage returns as token delimiters anyway - if (!this.options.tokens.include('\n')) - this.options.tokens.push('\n'); - - this.observer = null; - - this.element.setAttribute('autocomplete','off'); - - Element.hide(this.update); - - Event.observe(this.element, 'blur', this.onBlur.bindAsEventListener(this)); - Event.observe(this.element, 'keydown', this.onKeyPress.bindAsEventListener(this)); - }, - - show: function() { - if(Element.getStyle(this.update, 'display')=='none') this.options.onShow(this.element, this.update); - if(!this.iefix && - (Prototype.Browser.IE) && - (Element.getStyle(this.update, 'position')=='absolute')) { - new Insertion.After(this.update, - ''); - this.iefix = $(this.update.id+'_iefix'); - } - if(this.iefix) setTimeout(this.fixIEOverlapping.bind(this), 50); - }, - - fixIEOverlapping: function() { - Position.clone(this.update, this.iefix, {setTop:(!this.update.style.height)}); - this.iefix.style.zIndex = 1; - this.update.style.zIndex = 2; - Element.show(this.iefix); - }, - - hide: function() { - this.stopIndicator(); - if(Element.getStyle(this.update, 'display')!='none') this.options.onHide(this.element, this.update); - if(this.iefix) Element.hide(this.iefix); - }, - - startIndicator: function() { - if(this.options.indicator) Element.show(this.options.indicator); - }, - - stopIndicator: function() { - if(this.options.indicator) Element.hide(this.options.indicator); - }, - - onKeyPress: function(event) { - if(this.active) - switch(event.keyCode) { - case Event.KEY_TAB: - case Event.KEY_RETURN: - this.selectEntry(); - Event.stop(event); - case Event.KEY_ESC: - this.hide(); - this.active = false; - Event.stop(event); - return; - case Event.KEY_LEFT: - case Event.KEY_RIGHT: - return; - case Event.KEY_UP: - this.markPrevious(); - this.render(); - Event.stop(event); - return; - case Event.KEY_DOWN: - this.markNext(); - this.render(); - Event.stop(event); - return; - } - else - if(event.keyCode==Event.KEY_TAB || event.keyCode==Event.KEY_RETURN || - (Prototype.Browser.WebKit > 0 && event.keyCode == 0)) return; - - this.changed = true; - this.hasFocus = true; - - if(this.observer) clearTimeout(this.observer); - this.observer = - setTimeout(this.onObserverEvent.bind(this), this.options.frequency*1000); - }, - - activate: function() { - this.changed = false; - this.hasFocus = true; - this.getUpdatedChoices(); - }, - - onHover: function(event) { - var element = Event.findElement(event, 'LI'); - if(this.index != element.autocompleteIndex) - { - this.index = element.autocompleteIndex; - this.render(); - } - Event.stop(event); - }, - - onClick: function(event) { - var element = Event.findElement(event, 'LI'); - this.index = element.autocompleteIndex; - this.selectEntry(); - this.hide(); - }, - - onBlur: function(event) { - // needed to make click events working - setTimeout(this.hide.bind(this), 250); - this.hasFocus = false; - this.active = false; - }, - - render: function() { - if(this.entryCount > 0) { - for (var i = 0; i < this.entryCount; i++) - this.index==i ? - Element.addClassName(this.getEntry(i),"selected") : - Element.removeClassName(this.getEntry(i),"selected"); - if(this.hasFocus) { - this.show(); - this.active = true; - } - } else { - this.active = false; - this.hide(); - } - }, - - markPrevious: function() { - if(this.index > 0) this.index--; - else this.index = this.entryCount-1; - this.getEntry(this.index).scrollIntoView(true); - }, - - markNext: function() { - if(this.index < this.entryCount-1) this.index++; - else this.index = 0; - this.getEntry(this.index).scrollIntoView(false); - }, - - getEntry: function(index) { - return this.update.firstChild.childNodes[index]; - }, - - getCurrentEntry: function() { - return this.getEntry(this.index); - }, - - selectEntry: function() { - this.active = false; - this.updateElement(this.getCurrentEntry()); - }, - - updateElement: function(selectedElement) { - if (this.options.updateElement) { - this.options.updateElement(selectedElement); - return; - } - var value = ''; - if (this.options.select) { - var nodes = $(selectedElement).select('.' + this.options.select) || []; - if(nodes.length>0) value = Element.collectTextNodes(nodes[0], this.options.select); - } else - value = Element.collectTextNodesIgnoreClass(selectedElement, 'informal'); - - var bounds = this.getTokenBounds(); - if (bounds[0] != -1) { - var newValue = this.element.value.substr(0, bounds[0]); - var whitespace = this.element.value.substr(bounds[0]).match(/^\s+/); - if (whitespace) - newValue += whitespace[0]; - this.element.value = newValue + value + this.element.value.substr(bounds[1]); - } else { - this.element.value = value; - } - this.oldElementValue = this.element.value; - this.element.focus(); - - if (this.options.afterUpdateElement) - this.options.afterUpdateElement(this.element, selectedElement); - }, - - updateChoices: function(choices) { - if(!this.changed && this.hasFocus) { - this.update.innerHTML = choices; - Element.cleanWhitespace(this.update); - Element.cleanWhitespace(this.update.down()); - - if(this.update.firstChild && this.update.down().childNodes) { - this.entryCount = - this.update.down().childNodes.length; - for (var i = 0; i < this.entryCount; i++) { - var entry = this.getEntry(i); - entry.autocompleteIndex = i; - this.addObservers(entry); - } - } else { - this.entryCount = 0; - } - - this.stopIndicator(); - this.index = 0; - - if(this.entryCount==1 && this.options.autoSelect) { - this.selectEntry(); - this.hide(); - } else { - this.render(); - } - } - }, - - addObservers: function(element) { - Event.observe(element, "mouseover", this.onHover.bindAsEventListener(this)); - Event.observe(element, "click", this.onClick.bindAsEventListener(this)); - }, - - onObserverEvent: function() { - this.changed = false; - this.tokenBounds = null; - if(this.getToken().length>=this.options.minChars) { - this.getUpdatedChoices(); - } else { - this.active = false; - this.hide(); - } - this.oldElementValue = this.element.value; - }, - - getToken: function() { - var bounds = this.getTokenBounds(); - return this.element.value.substring(bounds[0], bounds[1]).strip(); - }, - - getTokenBounds: function() { - if (null != this.tokenBounds) return this.tokenBounds; - var value = this.element.value; - if (value.strip().empty()) return [-1, 0]; - var diff = arguments.callee.getFirstDifferencePos(value, this.oldElementValue); - var offset = (diff == this.oldElementValue.length ? 1 : 0); - var prevTokenPos = -1, nextTokenPos = value.length; - var tp; - for (var index = 0, l = this.options.tokens.length; index < l; ++index) { - tp = value.lastIndexOf(this.options.tokens[index], diff + offset - 1); - if (tp > prevTokenPos) prevTokenPos = tp; - tp = value.indexOf(this.options.tokens[index], diff + offset); - if (-1 != tp && tp < nextTokenPos) nextTokenPos = tp; - } - return (this.tokenBounds = [prevTokenPos + 1, nextTokenPos]); - } -}); - -Autocompleter.Base.prototype.getTokenBounds.getFirstDifferencePos = function(newS, oldS) { - var boundary = Math.min(newS.length, oldS.length); - for (var index = 0; index < boundary; ++index) - if (newS[index] != oldS[index]) - return index; - return boundary; -}; - -Ajax.Autocompleter = Class.create(Autocompleter.Base, { - initialize: function(element, update, url, options) { - this.baseInitialize(element, update, options); - this.options.asynchronous = true; - this.options.onComplete = this.onComplete.bind(this); - this.options.defaultParams = this.options.parameters || null; - this.url = url; - }, - - getUpdatedChoices: function() { - this.startIndicator(); - - var entry = encodeURIComponent(this.options.paramName) + '=' + - encodeURIComponent(this.getToken()); - - this.options.parameters = this.options.callback ? - this.options.callback(this.element, entry) : entry; - - if(this.options.defaultParams) - this.options.parameters += '&' + this.options.defaultParams; - - new Ajax.Request(this.url, this.options); - }, - - onComplete: function(request) { - this.updateChoices(request.responseText); - } -}); - -// The local array autocompleter. Used when you'd prefer to -// inject an array of autocompletion options into the page, rather -// than sending out Ajax queries, which can be quite slow sometimes. -// -// The constructor takes four parameters. The first two are, as usual, -// the id of the monitored textbox, and id of the autocompletion menu. -// The third is the array you want to autocomplete from, and the fourth -// is the options block. -// -// Extra local autocompletion options: -// - choices - How many autocompletion choices to offer -// -// - partialSearch - If false, the autocompleter will match entered -// text only at the beginning of strings in the -// autocomplete array. Defaults to true, which will -// match text at the beginning of any *word* in the -// strings in the autocomplete array. If you want to -// search anywhere in the string, additionally set -// the option fullSearch to true (default: off). -// -// - fullSsearch - Search anywhere in autocomplete array strings. -// -// - partialChars - How many characters to enter before triggering -// a partial match (unlike minChars, which defines -// how many characters are required to do any match -// at all). Defaults to 2. -// -// - ignoreCase - Whether to ignore case when autocompleting. -// Defaults to true. -// -// It's possible to pass in a custom function as the 'selector' -// option, if you prefer to write your own autocompletion logic. -// In that case, the other options above will not apply unless -// you support them. - -Autocompleter.Local = Class.create(Autocompleter.Base, { - initialize: function(element, update, array, options) { - this.baseInitialize(element, update, options); - this.options.array = array; - }, - - getUpdatedChoices: function() { - this.updateChoices(this.options.selector(this)); - }, - - setOptions: function(options) { - this.options = Object.extend({ - choices: 10, - partialSearch: true, - partialChars: 2, - ignoreCase: true, - fullSearch: false, - selector: function(instance) { - var ret = []; // Beginning matches - var partial = []; // Inside matches - var entry = instance.getToken(); - var count = 0; - - for (var i = 0; i < instance.options.array.length && - ret.length < instance.options.choices ; i++) { - - var elem = instance.options.array[i]; - var foundPos = instance.options.ignoreCase ? - elem.toLowerCase().indexOf(entry.toLowerCase()) : - elem.indexOf(entry); - - while (foundPos != -1) { - if (foundPos == 0 && elem.length != entry.length) { - ret.push("
  • " + elem.substr(0, entry.length) + "" + - elem.substr(entry.length) + "
    • "); - break; - } else if (entry.length >= instance.options.partialChars && - instance.options.partialSearch && foundPos != -1) { - if (instance.options.fullSearch || /\s/.test(elem.substr(foundPos-1,1))) { - partial.push("
  • " + elem.substr(0, foundPos) + "" + - elem.substr(foundPos, entry.length) + "" + elem.substr( - foundPos + entry.length) + "
    • "); - break; - } - } - - foundPos = instance.options.ignoreCase ? - elem.toLowerCase().indexOf(entry.toLowerCase(), foundPos + 1) : - elem.indexOf(entry, foundPos + 1); - - } - } - if (partial.length) - ret = ret.concat(partial.slice(0, instance.options.choices - ret.length)); - return "
      " + ret.join('') + "
    "; - } - }, options || { }); - } -}); - -// AJAX in-place editor and collection editor -// Full rewrite by Christophe Porteneuve (April 2007). - -// Use this if you notice weird scrolling problems on some browsers, -// the DOM might be a bit confused when this gets called so do this -// waits 1 ms (with setTimeout) until it does the activation -Field.scrollFreeActivate = function(field) { - setTimeout(function() { - Field.activate(field); - }, 1); -}; - -Ajax.InPlaceEditor = Class.create({ - initialize: function(element, url, options) { - this.url = url; - this.element = element = $(element); - this.prepareOptions(); - this._controls = { }; - arguments.callee.dealWithDeprecatedOptions(options); // DEPRECATION LAYER!!! - Object.extend(this.options, options || { }); - if (!this.options.formId && this.element.id) { - this.options.formId = this.element.id + '-inplaceeditor'; - if ($(this.options.formId)) - this.options.formId = ''; - } - if (this.options.externalControl) - this.options.externalControl = $(this.options.externalControl); - if (!this.options.externalControl) - this.options.externalControlOnly = false; - this._originalBackground = this.element.getStyle('background-color') || 'transparent'; - this.element.title = this.options.clickToEditText; - this._boundCancelHandler = this.handleFormCancellation.bind(this); - this._boundComplete = (this.options.onComplete || Prototype.emptyFunction).bind(this); - this._boundFailureHandler = this.handleAJAXFailure.bind(this); - this._boundSubmitHandler = this.handleFormSubmission.bind(this); - this._boundWrapperHandler = this.wrapUp.bind(this); - this.registerListeners(); - }, - checkForEscapeOrReturn: function(e) { - if (!this._editing || e.ctrlKey || e.altKey || e.shiftKey) return; - if (Event.KEY_ESC == e.keyCode) - this.handleFormCancellation(e); - else if (Event.KEY_RETURN == e.keyCode) - this.handleFormSubmission(e); - }, - createControl: function(mode, handler, extraClasses) { - var control = this.options[mode + 'Control']; - var text = this.options[mode + 'Text']; - if ('button' == control) { - var btn = document.createElement('input'); - btn.type = 'submit'; - btn.value = text; - btn.className = 'editor_' + mode + '_button'; - if ('cancel' == mode) - btn.onclick = this._boundCancelHandler; - this._form.appendChild(btn); - this._controls[mode] = btn; - } else if ('link' == control) { - var link = document.createElement('a'); - link.href = '#'; - link.appendChild(document.createTextNode(text)); - link.onclick = 'cancel' == mode ? this._boundCancelHandler : this._boundSubmitHandler; - link.className = 'editor_' + mode + '_link'; - if (extraClasses) - link.className += ' ' + extraClasses; - this._form.appendChild(link); - this._controls[mode] = link; - } - }, - createEditField: function() { - var text = (this.options.loadTextURL ? this.options.loadingText : this.getText()); - var fld; - if (1 >= this.options.rows && !/\r|\n/.test(this.getText())) { - fld = document.createElement('input'); - fld.type = 'text'; - var size = this.options.size || this.options.cols || 0; - if (0 < size) fld.size = size; - } else { - fld = document.createElement('textarea'); - fld.rows = (1 >= this.options.rows ? this.options.autoRows : this.options.rows); - fld.cols = this.options.cols || 40; - } - fld.name = this.options.paramName; - fld.value = text; // No HTML breaks conversion anymore - fld.className = 'editor_field'; - if (this.options.submitOnBlur) - fld.onblur = this._boundSubmitHandler; - this._controls.editor = fld; - if (this.options.loadTextURL) - this.loadExternalText(); - this._form.appendChild(this._controls.editor); - }, - createForm: function() { - var ipe = this; - function addText(mode, condition) { - var text = ipe.options['text' + mode + 'Controls']; - if (!text || condition === false) return; - ipe._form.appendChild(document.createTextNode(text)); - }; - this._form = $(document.createElement('form')); - this._form.id = this.options.formId; - this._form.addClassName(this.options.formClassName); - this._form.onsubmit = this._boundSubmitHandler; - this.createEditField(); - if ('textarea' == this._controls.editor.tagName.toLowerCase()) - this._form.appendChild(document.createElement('br')); - if (this.options.onFormCustomization) - this.options.onFormCustomization(this, this._form); - addText('Before', this.options.okControl || this.options.cancelControl); - this.createControl('ok', this._boundSubmitHandler); - addText('Between', this.options.okControl && this.options.cancelControl); - this.createControl('cancel', this._boundCancelHandler, 'editor_cancel'); - addText('After', this.options.okControl || this.options.cancelControl); - }, - destroy: function() { - if (this._oldInnerHTML) - this.element.innerHTML = this._oldInnerHTML; - this.leaveEditMode(); - this.unregisterListeners(); - }, - enterEditMode: function(e) { - if (this._saving || this._editing) return; - this._editing = true; - this.triggerCallback('onEnterEditMode'); - if (this.options.externalControl) - this.options.externalControl.hide(); - this.element.hide(); - this.createForm(); - this.element.parentNode.insertBefore(this._form, this.element); - if (!this.options.loadTextURL) - this.postProcessEditField(); - if (e) Event.stop(e); - }, - enterHover: function(e) { - if (this.options.hoverClassName) - this.element.addClassName(this.options.hoverClassName); - if (this._saving) return; - this.triggerCallback('onEnterHover'); - }, - getText: function() { - return this.element.innerHTML.unescapeHTML(); - }, - handleAJAXFailure: function(transport) { - this.triggerCallback('onFailure', transport); - if (this._oldInnerHTML) { - this.element.innerHTML = this._oldInnerHTML; - this._oldInnerHTML = null; - } - }, - handleFormCancellation: function(e) { - this.wrapUp(); - if (e) Event.stop(e); - }, - handleFormSubmission: function(e) { - var form = this._form; - var value = $F(this._controls.editor); - this.prepareSubmission(); - var params = this.options.callback(form, value) || ''; - if (Object.isString(params)) - params = params.toQueryParams(); - params.editorId = this.element.id; - if (this.options.htmlResponse) { - var options = Object.extend({ evalScripts: true }, this.options.ajaxOptions); - Object.extend(options, { - parameters: params, - onComplete: this._boundWrapperHandler, - onFailure: this._boundFailureHandler - }); - new Ajax.Updater({ success: this.element }, this.url, options); - } else { - var options = Object.extend({ method: 'get' }, this.options.ajaxOptions); - Object.extend(options, { - parameters: params, - onComplete: this._boundWrapperHandler, - onFailure: this._boundFailureHandler - }); - new Ajax.Request(this.url, options); - } - if (e) Event.stop(e); - }, - leaveEditMode: function() { - this.element.removeClassName(this.options.savingClassName); - this.removeForm(); - this.leaveHover(); - this.element.style.backgroundColor = this._originalBackground; - this.element.show(); - if (this.options.externalControl) - this.options.externalControl.show(); - this._saving = false; - this._editing = false; - this._oldInnerHTML = null; - this.triggerCallback('onLeaveEditMode'); - }, - leaveHover: function(e) { - if (this.options.hoverClassName) - this.element.removeClassName(this.options.hoverClassName); - if (this._saving) return; - this.triggerCallback('onLeaveHover'); - }, - loadExternalText: function() { - this._form.addClassName(this.options.loadingClassName); - this._controls.editor.disabled = true; - var options = Object.extend({ method: 'get' }, this.options.ajaxOptions); - Object.extend(options, { - parameters: 'editorId=' + encodeURIComponent(this.element.id), - onComplete: Prototype.emptyFunction, - onSuccess: function(transport) { - this._form.removeClassName(this.options.loadingClassName); - var text = transport.responseText; - if (this.options.stripLoadedTextTags) - text = text.stripTags(); - this._controls.editor.value = text; - this._controls.editor.disabled = false; - this.postProcessEditField(); - }.bind(this), - onFailure: this._boundFailureHandler - }); - new Ajax.Request(this.options.loadTextURL, options); - }, - postProcessEditField: function() { - var fpc = this.options.fieldPostCreation; - if (fpc) - $(this._controls.editor)['focus' == fpc ? 'focus' : 'activate'](); - }, - prepareOptions: function() { - this.options = Object.clone(Ajax.InPlaceEditor.DefaultOptions); - Object.extend(this.options, Ajax.InPlaceEditor.DefaultCallbacks); - [this._extraDefaultOptions].flatten().compact().each(function(defs) { - Object.extend(this.options, defs); - }.bind(this)); - }, - prepareSubmission: function() { - this._saving = true; - this.removeForm(); - this.leaveHover(); - this.showSaving(); - }, - registerListeners: function() { - this._listeners = { }; - var listener; - $H(Ajax.InPlaceEditor.Listeners).each(function(pair) { - listener = this[pair.value].bind(this); - this._listeners[pair.key] = listener; - if (!this.options.externalControlOnly) - this.element.observe(pair.key, listener); - if (this.options.externalControl) - this.options.externalControl.observe(pair.key, listener); - }.bind(this)); - }, - removeForm: function() { - if (!this._form) return; - this._form.remove(); - this._form = null; - this._controls = { }; - }, - showSaving: function() { - this._oldInnerHTML = this.element.innerHTML; - this.element.innerHTML = this.options.savingText; - this.element.addClassName(this.options.savingClassName); - this.element.style.backgroundColor = this._originalBackground; - this.element.show(); - }, - triggerCallback: function(cbName, arg) { - if ('function' == typeof this.options[cbName]) { - this.options[cbName](this, arg); - } - }, - unregisterListeners: function() { - $H(this._listeners).each(function(pair) { - if (!this.options.externalControlOnly) - this.element.stopObserving(pair.key, pair.value); - if (this.options.externalControl) - this.options.externalControl.stopObserving(pair.key, pair.value); - }.bind(this)); - }, - wrapUp: function(transport) { - this.leaveEditMode(); - // Can't use triggerCallback due to backward compatibility: requires - // binding + direct element - this._boundComplete(transport, this.element); - } -}); - -Object.extend(Ajax.InPlaceEditor.prototype, { - dispose: Ajax.InPlaceEditor.prototype.destroy -}); - -Ajax.InPlaceCollectionEditor = Class.create(Ajax.InPlaceEditor, { - initialize: function($super, element, url, options) { - this._extraDefaultOptions = Ajax.InPlaceCollectionEditor.DefaultOptions; - $super(element, url, options); - }, - - createEditField: function() { - var list = document.createElement('select'); - list.name = this.options.paramName; - list.size = 1; - this._controls.editor = list; - this._collection = this.options.collection || []; - if (this.options.loadCollectionURL) - this.loadCollection(); - else - this.checkForExternalText(); - this._form.appendChild(this._controls.editor); - }, - - loadCollection: function() { - this._form.addClassName(this.options.loadingClassName); - this.showLoadingText(this.options.loadingCollectionText); - var options = Object.extend({ method: 'get' }, this.options.ajaxOptions); - Object.extend(options, { - parameters: 'editorId=' + encodeURIComponent(this.element.id), - onComplete: Prototype.emptyFunction, - onSuccess: function(transport) { - var js = transport.responseText.strip(); - if (!/^\[.*\]$/.test(js)) // TODO: improve sanity check - throw('Server returned an invalid collection representation.'); - this._collection = eval(js); - this.checkForExternalText(); - }.bind(this), - onFailure: this.onFailure - }); - new Ajax.Request(this.options.loadCollectionURL, options); - }, - - showLoadingText: function(text) { - this._controls.editor.disabled = true; - var tempOption = this._controls.editor.firstChild; - if (!tempOption) { - tempOption = document.createElement('option'); - tempOption.value = ''; - this._controls.editor.appendChild(tempOption); - tempOption.selected = true; - } - tempOption.update((text || '').stripScripts().stripTags()); - }, - - checkForExternalText: function() { - this._text = this.getText(); - if (this.options.loadTextURL) - this.loadExternalText(); - else - this.buildOptionList(); - }, - - loadExternalText: function() { - this.showLoadingText(this.options.loadingText); - var options = Object.extend({ method: 'get' }, this.options.ajaxOptions); - Object.extend(options, { - parameters: 'editorId=' + encodeURIComponent(this.element.id), - onComplete: Prototype.emptyFunction, - onSuccess: function(transport) { - this._text = transport.responseText.strip(); - this.buildOptionList(); - }.bind(this), - onFailure: this.onFailure - }); - new Ajax.Request(this.options.loadTextURL, options); - }, - - buildOptionList: function() { - this._form.removeClassName(this.options.loadingClassName); - this._collection = this._collection.map(function(entry) { - return 2 === entry.length ? entry : [entry, entry].flatten(); - }); - var marker = ('value' in this.options) ? this.options.value : this._text; - var textFound = this._collection.any(function(entry) { - return entry[0] == marker; - }.bind(this)); - this._controls.editor.update(''); - var option; - this._collection.each(function(entry, index) { - option = document.createElement('option'); - option.value = entry[0]; - option.selected = textFound ? entry[0] == marker : 0 == index; - option.appendChild(document.createTextNode(entry[1])); - this._controls.editor.appendChild(option); - }.bind(this)); - this._controls.editor.disabled = false; - Field.scrollFreeActivate(this._controls.editor); - } -}); - -//**** DEPRECATION LAYER FOR InPlace[Collection]Editor! **** -//**** This only exists for a while, in order to let **** -//**** users adapt to the new API. Read up on the new **** -//**** API and convert your code to it ASAP! **** - -Ajax.InPlaceEditor.prototype.initialize.dealWithDeprecatedOptions = function(options) { - if (!options) return; - function fallback(name, expr) { - if (name in options || expr === undefined) return; - options[name] = expr; - }; - fallback('cancelControl', (options.cancelLink ? 'link' : (options.cancelButton ? 'button' : - options.cancelLink == options.cancelButton == false ? false : undefined))); - fallback('okControl', (options.okLink ? 'link' : (options.okButton ? 'button' : - options.okLink == options.okButton == false ? false : undefined))); - fallback('highlightColor', options.highlightcolor); - fallback('highlightEndColor', options.highlightendcolor); -}; - -Object.extend(Ajax.InPlaceEditor, { - DefaultOptions: { - ajaxOptions: { }, - autoRows: 3, // Use when multi-line w/ rows == 1 - cancelControl: 'link', // 'link'|'button'|false - cancelText: 'cancel', - clickToEditText: 'Click to edit', - externalControl: null, // id|elt - externalControlOnly: false, - fieldPostCreation: 'activate', // 'activate'|'focus'|false - formClassName: 'inplaceeditor-form', - formId: null, // id|elt - highlightColor: '#ffff99', - highlightEndColor: '#ffffff', - hoverClassName: '', - htmlResponse: true, - loadingClassName: 'inplaceeditor-loading', - loadingText: 'Loading...', - okControl: 'button', // 'link'|'button'|false - okText: 'ok', - paramName: 'value', - rows: 1, // If 1 and multi-line, uses autoRows - savingClassName: 'inplaceeditor-saving', - savingText: 'Saving...', - size: 0, - stripLoadedTextTags: false, - submitOnBlur: false, - textAfterControls: '', - textBeforeControls: '', - textBetweenControls: '' - }, - DefaultCallbacks: { - callback: function(form) { - return Form.serialize(form); - }, - onComplete: function(transport, element) { - // For backward compatibility, this one is bound to the IPE, and passes - // the element directly. It was too often customized, so we don't break it. - new Effect.Highlight(element, { - startcolor: this.options.highlightColor, keepBackgroundImage: true }); - }, - onEnterEditMode: null, - onEnterHover: function(ipe) { - ipe.element.style.backgroundColor = ipe.options.highlightColor; - if (ipe._effect) - ipe._effect.cancel(); - }, - onFailure: function(transport, ipe) { - alert('Error communication with the server: ' + transport.responseText.stripTags()); - }, - onFormCustomization: null, // Takes the IPE and its generated form, after editor, before controls. - onLeaveEditMode: null, - onLeaveHover: function(ipe) { - ipe._effect = new Effect.Highlight(ipe.element, { - startcolor: ipe.options.highlightColor, endcolor: ipe.options.highlightEndColor, - restorecolor: ipe._originalBackground, keepBackgroundImage: true - }); - } - }, - Listeners: { - click: 'enterEditMode', - keydown: 'checkForEscapeOrReturn', - mouseover: 'enterHover', - mouseout: 'leaveHover' - } -}); - -Ajax.InPlaceCollectionEditor.DefaultOptions = { - loadingCollectionText: 'Loading options...' -}; - -// Delayed observer, like Form.Element.Observer, -// but waits for delay after last key input -// Ideal for live-search fields - -Form.Element.DelayedObserver = Class.create({ - initialize: function(element, delay, callback) { - this.delay = delay || 0.5; - this.element = $(element); - this.callback = callback; - this.timer = null; - this.lastValue = $F(this.element); - Event.observe(this.element,'keyup',this.delayedListener.bindAsEventListener(this)); - }, - delayedListener: function(event) { - if(this.lastValue == $F(this.element)) return; - if(this.timer) clearTimeout(this.timer); - this.timer = setTimeout(this.onTimerEvent.bind(this), this.delay * 1000); - this.lastValue = $F(this.element); - }, - onTimerEvent: function() { - this.timer = null; - this.callback(this.element, $F(this.element)); - } -}); \ No newline at end of file diff --git a/public/javascripts/dragdrop.js b/public/javascripts/dragdrop.js deleted file mode 100644 index 15c6dbca..00000000 --- a/public/javascripts/dragdrop.js +++ /dev/null @@ -1,974 +0,0 @@ -// script.aculo.us dragdrop.js v1.8.3, Thu Oct 08 11:23:33 +0200 2009 - -// Copyright (c) 2005-2009 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) -// -// script.aculo.us is freely distributable under the terms of an MIT-style license. -// For details, see the script.aculo.us web site: http://script.aculo.us/ - -if(Object.isUndefined(Effect)) - throw("dragdrop.js requires including script.aculo.us' effects.js library"); - -var Droppables = { - drops: [], - - remove: function(element) { - this.drops = this.drops.reject(function(d) { return d.element==$(element) }); - }, - - add: function(element) { - element = $(element); - var options = Object.extend({ - greedy: true, - hoverclass: null, - tree: false - }, arguments[1] || { }); - - // cache containers - if(options.containment) { - options._containers = []; - var containment = options.containment; - if(Object.isArray(containment)) { - containment.each( function(c) { options._containers.push($(c)) }); - } else { - options._containers.push($(containment)); - } - } - - if(options.accept) options.accept = [options.accept].flatten(); - - Element.makePositioned(element); // fix IE - options.element = element; - - this.drops.push(options); - }, - - findDeepestChild: function(drops) { - deepest = drops[0]; - - for (i = 1; i < drops.length; ++i) - if (Element.isParent(drops[i].element, deepest.element)) - deepest = drops[i]; - - return deepest; - }, - - isContained: function(element, drop) { - var containmentNode; - if(drop.tree) { - containmentNode = element.treeNode; - } else { - containmentNode = element.parentNode; - } - return drop._containers.detect(function(c) { return containmentNode == c }); - }, - - isAffected: function(point, element, drop) { - return ( - (drop.element!=element) && - ((!drop._containers) || - this.isContained(element, drop)) && - ((!drop.accept) || - (Element.classNames(element).detect( - function(v) { return drop.accept.include(v) } ) )) && - Position.within(drop.element, point[0], point[1]) ); - }, - - deactivate: function(drop) { - if(drop.hoverclass) - Element.removeClassName(drop.element, drop.hoverclass); - this.last_active = null; - }, - - activate: function(drop) { - if(drop.hoverclass) - Element.addClassName(drop.element, drop.hoverclass); - this.last_active = drop; - }, - - show: function(point, element) { - if(!this.drops.length) return; - var drop, affected = []; - - this.drops.each( function(drop) { - if(Droppables.isAffected(point, element, drop)) - affected.push(drop); - }); - - if(affected.length>0) - drop = Droppables.findDeepestChild(affected); - - if(this.last_active && this.last_active != drop) this.deactivate(this.last_active); - if (drop) { - Position.within(drop.element, point[0], point[1]); - if(drop.onHover) - drop.onHover(element, drop.element, Position.overlap(drop.overlap, drop.element)); - - if (drop != this.last_active) Droppables.activate(drop); - } - }, - - fire: function(event, element) { - if(!this.last_active) return; - Position.prepare(); - - if (this.isAffected([Event.pointerX(event), Event.pointerY(event)], element, this.last_active)) - if (this.last_active.onDrop) { - this.last_active.onDrop(element, this.last_active.element, event); - return true; - } - }, - - reset: function() { - if(this.last_active) - this.deactivate(this.last_active); - } -}; - -var Draggables = { - drags: [], - observers: [], - - register: function(draggable) { - if(this.drags.length == 0) { - this.eventMouseUp = this.endDrag.bindAsEventListener(this); - this.eventMouseMove = this.updateDrag.bindAsEventListener(this); - this.eventKeypress = this.keyPress.bindAsEventListener(this); - - Event.observe(document, "mouseup", this.eventMouseUp); - Event.observe(document, "mousemove", this.eventMouseMove); - Event.observe(document, "keypress", this.eventKeypress); - } - this.drags.push(draggable); - }, - - unregister: function(draggable) { - this.drags = this.drags.reject(function(d) { return d==draggable }); - if(this.drags.length == 0) { - Event.stopObserving(document, "mouseup", this.eventMouseUp); - Event.stopObserving(document, "mousemove", this.eventMouseMove); - Event.stopObserving(document, "keypress", this.eventKeypress); - } - }, - - activate: function(draggable) { - if(draggable.options.delay) { - this._timeout = setTimeout(function() { - Draggables._timeout = null; - window.focus(); - Draggables.activeDraggable = draggable; - }.bind(this), draggable.options.delay); - } else { - window.focus(); // allows keypress events if window isn't currently focused, fails for Safari - this.activeDraggable = draggable; - } - }, - - deactivate: function() { - this.activeDraggable = null; - }, - - updateDrag: function(event) { - if(!this.activeDraggable) return; - var pointer = [Event.pointerX(event), Event.pointerY(event)]; - // Mozilla-based browsers fire successive mousemove events with - // the same coordinates, prevent needless redrawing (moz bug?) - if(this._lastPointer && (this._lastPointer.inspect() == pointer.inspect())) return; - this._lastPointer = pointer; - - this.activeDraggable.updateDrag(event, pointer); - }, - - endDrag: function(event) { - if(this._timeout) { - clearTimeout(this._timeout); - this._timeout = null; - } - if(!this.activeDraggable) return; - this._lastPointer = null; - this.activeDraggable.endDrag(event); - this.activeDraggable = null; - }, - - keyPress: function(event) { - if(this.activeDraggable) - this.activeDraggable.keyPress(event); - }, - - addObserver: function(observer) { - this.observers.push(observer); - this._cacheObserverCallbacks(); - }, - - removeObserver: function(element) { // element instead of observer fixes mem leaks - this.observers = this.observers.reject( function(o) { return o.element==element }); - this._cacheObserverCallbacks(); - }, - - notify: function(eventName, draggable, event) { // 'onStart', 'onEnd', 'onDrag' - if(this[eventName+'Count'] > 0) - this.observers.each( function(o) { - if(o[eventName]) o[eventName](eventName, draggable, event); - }); - if(draggable.options[eventName]) draggable.options[eventName](draggable, event); - }, - - _cacheObserverCallbacks: function() { - ['onStart','onEnd','onDrag'].each( function(eventName) { - Draggables[eventName+'Count'] = Draggables.observers.select( - function(o) { return o[eventName]; } - ).length; - }); - } -}; - -/*--------------------------------------------------------------------------*/ - -var Draggable = Class.create({ - initialize: function(element) { - var defaults = { - handle: false, - reverteffect: function(element, top_offset, left_offset) { - var dur = Math.sqrt(Math.abs(top_offset^2)+Math.abs(left_offset^2))*0.02; - new Effect.Move(element, { x: -left_offset, y: -top_offset, duration: dur, - queue: {scope:'_draggable', position:'end'} - }); - }, - endeffect: function(element) { - var toOpacity = Object.isNumber(element._opacity) ? element._opacity : 1.0; - new Effect.Opacity(element, {duration:0.2, from:0.7, to:toOpacity, - queue: {scope:'_draggable', position:'end'}, - afterFinish: function(){ - Draggable._dragging[element] = false - } - }); - }, - zindex: 1000, - revert: false, - quiet: false, - scroll: false, - scrollSensitivity: 20, - scrollSpeed: 15, - snap: false, // false, or xy or [x,y] or function(x,y){ return [x,y] } - delay: 0 - }; - - if(!arguments[1] || Object.isUndefined(arguments[1].endeffect)) - Object.extend(defaults, { - starteffect: function(element) { - element._opacity = Element.getOpacity(element); - Draggable._dragging[element] = true; - new Effect.Opacity(element, {duration:0.2, from:element._opacity, to:0.7}); - } - }); - - var options = Object.extend(defaults, arguments[1] || { }); - - this.element = $(element); - - if(options.handle && Object.isString(options.handle)) - this.handle = this.element.down('.'+options.handle, 0); - - if(!this.handle) this.handle = $(options.handle); - if(!this.handle) this.handle = this.element; - - if(options.scroll && !options.scroll.scrollTo && !options.scroll.outerHTML) { - options.scroll = $(options.scroll); - this._isScrollChild = Element.childOf(this.element, options.scroll); - } - - Element.makePositioned(this.element); // fix IE - - this.options = options; - this.dragging = false; - - this.eventMouseDown = this.initDrag.bindAsEventListener(this); - Event.observe(this.handle, "mousedown", this.eventMouseDown); - - Draggables.register(this); - }, - - destroy: function() { - Event.stopObserving(this.handle, "mousedown", this.eventMouseDown); - Draggables.unregister(this); - }, - - currentDelta: function() { - return([ - parseInt(Element.getStyle(this.element,'left') || '0'), - parseInt(Element.getStyle(this.element,'top') || '0')]); - }, - - initDrag: function(event) { - if(!Object.isUndefined(Draggable._dragging[this.element]) && - Draggable._dragging[this.element]) return; - if(Event.isLeftClick(event)) { - // abort on form elements, fixes a Firefox issue - var src = Event.element(event); - if((tag_name = src.tagName.toUpperCase()) && ( - tag_name=='INPUT' || - tag_name=='SELECT' || - tag_name=='OPTION' || - tag_name=='BUTTON' || - tag_name=='TEXTAREA')) return; - - var pointer = [Event.pointerX(event), Event.pointerY(event)]; - var pos = this.element.cumulativeOffset(); - this.offset = [0,1].map( function(i) { return (pointer[i] - pos[i]) }); - - Draggables.activate(this); - Event.stop(event); - } - }, - - startDrag: function(event) { - this.dragging = true; - if(!this.delta) - this.delta = this.currentDelta(); - - if(this.options.zindex) { - this.originalZ = parseInt(Element.getStyle(this.element,'z-index') || 0); - this.element.style.zIndex = this.options.zindex; - } - - if(this.options.ghosting) { - this._clone = this.element.cloneNode(true); - this._originallyAbsolute = (this.element.getStyle('position') == 'absolute'); - if (!this._originallyAbsolute) - Position.absolutize(this.element); - this.element.parentNode.insertBefore(this._clone, this.element); - } - - if(this.options.scroll) { - if (this.options.scroll == window) { - var where = this._getWindowScroll(this.options.scroll); - this.originalScrollLeft = where.left; - this.originalScrollTop = where.top; - } else { - this.originalScrollLeft = this.options.scroll.scrollLeft; - this.originalScrollTop = this.options.scroll.scrollTop; - } - } - - Draggables.notify('onStart', this, event); - - if(this.options.starteffect) this.options.starteffect(this.element); - }, - - updateDrag: function(event, pointer) { - if(!this.dragging) this.startDrag(event); - - if(!this.options.quiet){ - Position.prepare(); - Droppables.show(pointer, this.element); - } - - Draggables.notify('onDrag', this, event); - - this.draw(pointer); - if(this.options.change) this.options.change(this); - - if(this.options.scroll) { - this.stopScrolling(); - - var p; - if (this.options.scroll == window) { - with(this._getWindowScroll(this.options.scroll)) { p = [ left, top, left+width, top+height ]; } - } else { - p = Position.page(this.options.scroll); - p[0] += this.options.scroll.scrollLeft + Position.deltaX; - p[1] += this.options.scroll.scrollTop + Position.deltaY; - p.push(p[0]+this.options.scroll.offsetWidth); - p.push(p[1]+this.options.scroll.offsetHeight); - } - var speed = [0,0]; - if(pointer[0] < (p[0]+this.options.scrollSensitivity)) speed[0] = pointer[0]-(p[0]+this.options.scrollSensitivity); - if(pointer[1] < (p[1]+this.options.scrollSensitivity)) speed[1] = pointer[1]-(p[1]+this.options.scrollSensitivity); - if(pointer[0] > (p[2]-this.options.scrollSensitivity)) speed[0] = pointer[0]-(p[2]-this.options.scrollSensitivity); - if(pointer[1] > (p[3]-this.options.scrollSensitivity)) speed[1] = pointer[1]-(p[3]-this.options.scrollSensitivity); - this.startScrolling(speed); - } - - // fix AppleWebKit rendering - if(Prototype.Browser.WebKit) window.scrollBy(0,0); - - Event.stop(event); - }, - - finishDrag: function(event, success) { - this.dragging = false; - - if(this.options.quiet){ - Position.prepare(); - var pointer = [Event.pointerX(event), Event.pointerY(event)]; - Droppables.show(pointer, this.element); - } - - if(this.options.ghosting) { - if (!this._originallyAbsolute) - Position.relativize(this.element); - delete this._originallyAbsolute; - Element.remove(this._clone); - this._clone = null; - } - - var dropped = false; - if(success) { - dropped = Droppables.fire(event, this.element); - if (!dropped) dropped = false; - } - if(dropped && this.options.onDropped) this.options.onDropped(this.element); - Draggables.notify('onEnd', this, event); - - var revert = this.options.revert; - if(revert && Object.isFunction(revert)) revert = revert(this.element); - - var d = this.currentDelta(); - if(revert && this.options.reverteffect) { - if (dropped == 0 || revert != 'failure') - this.options.reverteffect(this.element, - d[1]-this.delta[1], d[0]-this.delta[0]); - } else { - this.delta = d; - } - - if(this.options.zindex) - this.element.style.zIndex = this.originalZ; - - if(this.options.endeffect) - this.options.endeffect(this.element); - - Draggables.deactivate(this); - Droppables.reset(); - }, - - keyPress: function(event) { - if(event.keyCode!=Event.KEY_ESC) return; - this.finishDrag(event, false); - Event.stop(event); - }, - - endDrag: function(event) { - if(!this.dragging) return; - this.stopScrolling(); - this.finishDrag(event, true); - Event.stop(event); - }, - - draw: function(point) { - var pos = this.element.cumulativeOffset(); - if(this.options.ghosting) { - var r = Position.realOffset(this.element); - pos[0] += r[0] - Position.deltaX; pos[1] += r[1] - Position.deltaY; - } - - var d = this.currentDelta(); - pos[0] -= d[0]; pos[1] -= d[1]; - - if(this.options.scroll && (this.options.scroll != window && this._isScrollChild)) { - pos[0] -= this.options.scroll.scrollLeft-this.originalScrollLeft; - pos[1] -= this.options.scroll.scrollTop-this.originalScrollTop; - } - - var p = [0,1].map(function(i){ - return (point[i]-pos[i]-this.offset[i]) - }.bind(this)); - - if(this.options.snap) { - if(Object.isFunction(this.options.snap)) { - p = this.options.snap(p[0],p[1],this); - } else { - if(Object.isArray(this.options.snap)) { - p = p.map( function(v, i) { - return (v/this.options.snap[i]).round()*this.options.snap[i] }.bind(this)); - } else { - p = p.map( function(v) { - return (v/this.options.snap).round()*this.options.snap }.bind(this)); - } - }} - - var style = this.element.style; - if((!this.options.constraint) || (this.options.constraint=='horizontal')) - style.left = p[0] + "px"; - if((!this.options.constraint) || (this.options.constraint=='vertical')) - style.top = p[1] + "px"; - - if(style.visibility=="hidden") style.visibility = ""; // fix gecko rendering - }, - - stopScrolling: function() { - if(this.scrollInterval) { - clearInterval(this.scrollInterval); - this.scrollInterval = null; - Draggables._lastScrollPointer = null; - } - }, - - startScrolling: function(speed) { - if(!(speed[0] || speed[1])) return; - this.scrollSpeed = [speed[0]*this.options.scrollSpeed,speed[1]*this.options.scrollSpeed]; - this.lastScrolled = new Date(); - this.scrollInterval = setInterval(this.scroll.bind(this), 10); - }, - - scroll: function() { - var current = new Date(); - var delta = current - this.lastScrolled; - this.lastScrolled = current; - if(this.options.scroll == window) { - with (this._getWindowScroll(this.options.scroll)) { - if (this.scrollSpeed[0] || this.scrollSpeed[1]) { - var d = delta / 1000; - this.options.scroll.scrollTo( left + d*this.scrollSpeed[0], top + d*this.scrollSpeed[1] ); - } - } - } else { - this.options.scroll.scrollLeft += this.scrollSpeed[0] * delta / 1000; - this.options.scroll.scrollTop += this.scrollSpeed[1] * delta / 1000; - } - - Position.prepare(); - Droppables.show(Draggables._lastPointer, this.element); - Draggables.notify('onDrag', this); - if (this._isScrollChild) { - Draggables._lastScrollPointer = Draggables._lastScrollPointer || $A(Draggables._lastPointer); - Draggables._lastScrollPointer[0] += this.scrollSpeed[0] * delta / 1000; - Draggables._lastScrollPointer[1] += this.scrollSpeed[1] * delta / 1000; - if (Draggables._lastScrollPointer[0] < 0) - Draggables._lastScrollPointer[0] = 0; - if (Draggables._lastScrollPointer[1] < 0) - Draggables._lastScrollPointer[1] = 0; - this.draw(Draggables._lastScrollPointer); - } - - if(this.options.change) this.options.change(this); - }, - - _getWindowScroll: function(w) { - var T, L, W, H; - with (w.document) { - if (w.document.documentElement && documentElement.scrollTop) { - T = documentElement.scrollTop; - L = documentElement.scrollLeft; - } else if (w.document.body) { - T = body.scrollTop; - L = body.scrollLeft; - } - if (w.innerWidth) { - W = w.innerWidth; - H = w.innerHeight; - } else if (w.document.documentElement && documentElement.clientWidth) { - W = documentElement.clientWidth; - H = documentElement.clientHeight; - } else { - W = body.offsetWidth; - H = body.offsetHeight; - } - } - return { top: T, left: L, width: W, height: H }; - } -}); - -Draggable._dragging = { }; - -/*--------------------------------------------------------------------------*/ - -var SortableObserver = Class.create({ - initialize: function(element, observer) { - this.element = $(element); - this.observer = observer; - this.lastValue = Sortable.serialize(this.element); - }, - - onStart: function() { - this.lastValue = Sortable.serialize(this.element); - }, - - onEnd: function() { - Sortable.unmark(); - if(this.lastValue != Sortable.serialize(this.element)) - this.observer(this.element) - } -}); - -var Sortable = { - SERIALIZE_RULE: /^[^_\-](?:[A-Za-z0-9\-\_]*)[_](.*)$/, - - sortables: { }, - - _findRootElement: function(element) { - while (element.tagName.toUpperCase() != "BODY") { - if(element.id && Sortable.sortables[element.id]) return element; - element = element.parentNode; - } - }, - - options: function(element) { - element = Sortable._findRootElement($(element)); - if(!element) return; - return Sortable.sortables[element.id]; - }, - - destroy: function(element){ - element = $(element); - var s = Sortable.sortables[element.id]; - - if(s) { - Draggables.removeObserver(s.element); - s.droppables.each(function(d){ Droppables.remove(d) }); - s.draggables.invoke('destroy'); - - delete Sortable.sortables[s.element.id]; - } - }, - - create: function(element) { - element = $(element); - var options = Object.extend({ - element: element, - tag: 'li', // assumes li children, override with tag: 'tagname' - dropOnEmpty: false, - tree: false, - treeTag: 'ul', - overlap: 'vertical', // one of 'vertical', 'horizontal' - constraint: 'vertical', // one of 'vertical', 'horizontal', false - containment: element, // also takes array of elements (or id's); or false - handle: false, // or a CSS class - only: false, - delay: 0, - hoverclass: null, - ghosting: false, - quiet: false, - scroll: false, - scrollSensitivity: 20, - scrollSpeed: 15, - format: this.SERIALIZE_RULE, - - // these take arrays of elements or ids and can be - // used for better initialization performance - elements: false, - handles: false, - - onChange: Prototype.emptyFunction, - onUpdate: Prototype.emptyFunction - }, arguments[1] || { }); - - // clear any old sortable with same element - this.destroy(element); - - // build options for the draggables - var options_for_draggable = { - revert: true, - quiet: options.quiet, - scroll: options.scroll, - scrollSpeed: options.scrollSpeed, - scrollSensitivity: options.scrollSensitivity, - delay: options.delay, - ghosting: options.ghosting, - constraint: options.constraint, - handle: options.handle }; - - if(options.starteffect) - options_for_draggable.starteffect = options.starteffect; - - if(options.reverteffect) - options_for_draggable.reverteffect = options.reverteffect; - else - if(options.ghosting) options_for_draggable.reverteffect = function(element) { - element.style.top = 0; - element.style.left = 0; - }; - - if(options.endeffect) - options_for_draggable.endeffect = options.endeffect; - - if(options.zindex) - options_for_draggable.zindex = options.zindex; - - // build options for the droppables - var options_for_droppable = { - overlap: options.overlap, - containment: options.containment, - tree: options.tree, - hoverclass: options.hoverclass, - onHover: Sortable.onHover - }; - - var options_for_tree = { - onHover: Sortable.onEmptyHover, - overlap: options.overlap, - containment: options.containment, - hoverclass: options.hoverclass - }; - - // fix for gecko engine - Element.cleanWhitespace(element); - - options.draggables = []; - options.droppables = []; - - // drop on empty handling - if(options.dropOnEmpty || options.tree) { - Droppables.add(element, options_for_tree); - options.droppables.push(element); - } - - (options.elements || this.findElements(element, options) || []).each( function(e,i) { - var handle = options.handles ? $(options.handles[i]) : - (options.handle ? $(e).select('.' + options.handle)[0] : e); - options.draggables.push( - new Draggable(e, Object.extend(options_for_draggable, { handle: handle }))); - Droppables.add(e, options_for_droppable); - if(options.tree) e.treeNode = element; - options.droppables.push(e); - }); - - if(options.tree) { - (Sortable.findTreeElements(element, options) || []).each( function(e) { - Droppables.add(e, options_for_tree); - e.treeNode = element; - options.droppables.push(e); - }); - } - - // keep reference - this.sortables[element.identify()] = options; - - // for onupdate - Draggables.addObserver(new SortableObserver(element, options.onUpdate)); - - }, - - // return all suitable-for-sortable elements in a guaranteed order - findElements: function(element, options) { - return Element.findChildren( - element, options.only, options.tree ? true : false, options.tag); - }, - - findTreeElements: function(element, options) { - return Element.findChildren( - element, options.only, options.tree ? true : false, options.treeTag); - }, - - onHover: function(element, dropon, overlap) { - if(Element.isParent(dropon, element)) return; - - if(overlap > .33 && overlap < .66 && Sortable.options(dropon).tree) { - return; - } else if(overlap>0.5) { - Sortable.mark(dropon, 'before'); - if(dropon.previousSibling != element) { - var oldParentNode = element.parentNode; - element.style.visibility = "hidden"; // fix gecko rendering - dropon.parentNode.insertBefore(element, dropon); - if(dropon.parentNode!=oldParentNode) - Sortable.options(oldParentNode).onChange(element); - Sortable.options(dropon.parentNode).onChange(element); - } - } else { - Sortable.mark(dropon, 'after'); - var nextElement = dropon.nextSibling || null; - if(nextElement != element) { - var oldParentNode = element.parentNode; - element.style.visibility = "hidden"; // fix gecko rendering - dropon.parentNode.insertBefore(element, nextElement); - if(dropon.parentNode!=oldParentNode) - Sortable.options(oldParentNode).onChange(element); - Sortable.options(dropon.parentNode).onChange(element); - } - } - }, - - onEmptyHover: function(element, dropon, overlap) { - var oldParentNode = element.parentNode; - var droponOptions = Sortable.options(dropon); - - if(!Element.isParent(dropon, element)) { - var index; - - var children = Sortable.findElements(dropon, {tag: droponOptions.tag, only: droponOptions.only}); - var child = null; - - if(children) { - var offset = Element.offsetSize(dropon, droponOptions.overlap) * (1.0 - overlap); - - for (index = 0; index < children.length; index += 1) { - if (offset - Element.offsetSize (children[index], droponOptions.overlap) >= 0) { - offset -= Element.offsetSize (children[index], droponOptions.overlap); - } else if (offset - (Element.offsetSize (children[index], droponOptions.overlap) / 2) >= 0) { - child = index + 1 < children.length ? children[index + 1] : null; - break; - } else { - child = children[index]; - break; - } - } - } - - dropon.insertBefore(element, child); - - Sortable.options(oldParentNode).onChange(element); - droponOptions.onChange(element); - } - }, - - unmark: function() { - if(Sortable._marker) Sortable._marker.hide(); - }, - - mark: function(dropon, position) { - // mark on ghosting only - var sortable = Sortable.options(dropon.parentNode); - if(sortable && !sortable.ghosting) return; - - if(!Sortable._marker) { - Sortable._marker = - ($('dropmarker') || Element.extend(document.createElement('DIV'))). - hide().addClassName('dropmarker').setStyle({position:'absolute'}); - document.getElementsByTagName("body").item(0).appendChild(Sortable._marker); - } - var offsets = dropon.cumulativeOffset(); - Sortable._marker.setStyle({left: offsets[0]+'px', top: offsets[1] + 'px'}); - - if(position=='after') - if(sortable.overlap == 'horizontal') - Sortable._marker.setStyle({left: (offsets[0]+dropon.clientWidth) + 'px'}); - else - Sortable._marker.setStyle({top: (offsets[1]+dropon.clientHeight) + 'px'}); - - Sortable._marker.show(); - }, - - _tree: function(element, options, parent) { - var children = Sortable.findElements(element, options) || []; - - for (var i = 0; i < children.length; ++i) { - var match = children[i].id.match(options.format); - - if (!match) continue; - - var child = { - id: encodeURIComponent(match ? match[1] : null), - element: element, - parent: parent, - children: [], - position: parent.children.length, - container: $(children[i]).down(options.treeTag) - }; - - /* Get the element containing the children and recurse over it */ - if (child.container) - this._tree(child.container, options, child); - - parent.children.push (child); - } - - return parent; - }, - - tree: function(element) { - element = $(element); - var sortableOptions = this.options(element); - var options = Object.extend({ - tag: sortableOptions.tag, - treeTag: sortableOptions.treeTag, - only: sortableOptions.only, - name: element.id, - format: sortableOptions.format - }, arguments[1] || { }); - - var root = { - id: null, - parent: null, - children: [], - container: element, - position: 0 - }; - - return Sortable._tree(element, options, root); - }, - - /* Construct a [i] index for a particular node */ - _constructIndex: function(node) { - var index = ''; - do { - if (node.id) index = '[' + node.position + ']' + index; - } while ((node = node.parent) != null); - return index; - }, - - sequence: function(element) { - element = $(element); - var options = Object.extend(this.options(element), arguments[1] || { }); - - return $(this.findElements(element, options) || []).map( function(item) { - return item.id.match(options.format) ? item.id.match(options.format)[1] : ''; - }); - }, - - setSequence: function(element, new_sequence) { - element = $(element); - var options = Object.extend(this.options(element), arguments[2] || { }); - - var nodeMap = { }; - this.findElements(element, options).each( function(n) { - if (n.id.match(options.format)) - nodeMap[n.id.match(options.format)[1]] = [n, n.parentNode]; - n.parentNode.removeChild(n); - }); - - new_sequence.each(function(ident) { - var n = nodeMap[ident]; - if (n) { - n[1].appendChild(n[0]); - delete nodeMap[ident]; - } - }); - }, - - serialize: function(element) { - element = $(element); - var options = Object.extend(Sortable.options(element), arguments[1] || { }); - var name = encodeURIComponent( - (arguments[1] && arguments[1].name) ? arguments[1].name : element.id); - - if (options.tree) { - return Sortable.tree(element, arguments[1]).children.map( function (item) { - return [name + Sortable._constructIndex(item) + "[id]=" + - encodeURIComponent(item.id)].concat(item.children.map(arguments.callee)); - }).flatten().join('&'); - } else { - return Sortable.sequence(element, arguments[1]).map( function(item) { - return name + "[]=" + encodeURIComponent(item); - }).join('&'); - } - } -}; - -// Returns true if child is contained within element -Element.isParent = function(child, element) { - if (!child.parentNode || child == element) return false; - if (child.parentNode == element) return true; - return Element.isParent(child.parentNode, element); -}; - -Element.findChildren = function(element, only, recursive, tagName) { - if(!element.hasChildNodes()) return null; - tagName = tagName.toUpperCase(); - if(only) only = [only].flatten(); - var elements = []; - $A(element.childNodes).each( function(e) { - if(e.tagName && e.tagName.toUpperCase()==tagName && - (!only || (Element.classNames(e).detect(function(v) { return only.include(v) })))) - elements.push(e); - if(recursive) { - var grandchildren = Element.findChildren(e, only, recursive, tagName); - if(grandchildren) elements.push(grandchildren); - } - }); - - return (elements.length>0 ? elements.flatten() : []); -}; - -Element.offsetSize = function (element, type) { - return element['offset' + ((type=='vertical' || type=='height') ? 'Height' : 'Width')]; -}; \ No newline at end of file diff --git a/public/javascripts/effects.js b/public/javascripts/effects.js deleted file mode 100644 index c81e6c7d..00000000 --- a/public/javascripts/effects.js +++ /dev/null @@ -1,1123 +0,0 @@ -// script.aculo.us effects.js v1.8.3, Thu Oct 08 11:23:33 +0200 2009 - -// Copyright (c) 2005-2009 Thomas Fuchs (http://script.aculo.us, http://mir.aculo.us) -// Contributors: -// Justin Palmer (http://encytemedia.com/) -// Mark Pilgrim (http://diveintomark.org/) -// Martin Bialasinki -// -// script.aculo.us is freely distributable under the terms of an MIT-style license. -// For details, see the script.aculo.us web site: http://script.aculo.us/ - -// converts rgb() and #xxx to #xxxxxx format, -// returns self (or first argument) if not convertable -String.prototype.parseColor = function() { - var color = '#'; - if (this.slice(0,4) == 'rgb(') { - var cols = this.slice(4,this.length-1).split(','); - var i=0; do { color += parseInt(cols[i]).toColorPart() } while (++i<3); - } else { - if (this.slice(0,1) == '#') { - if (this.length==4) for(var i=1;i<4;i++) color += (this.charAt(i) + this.charAt(i)).toLowerCase(); - if (this.length==7) color = this.toLowerCase(); - } - } - return (color.length==7 ? color : (arguments[0] || this)); -}; - -/*--------------------------------------------------------------------------*/ - -Element.collectTextNodes = function(element) { - return $A($(element).childNodes).collect( function(node) { - return (node.nodeType==3 ? node.nodeValue : - (node.hasChildNodes() ? Element.collectTextNodes(node) : '')); - }).flatten().join(''); -}; - -Element.collectTextNodesIgnoreClass = function(element, className) { - return $A($(element).childNodes).collect( function(node) { - return (node.nodeType==3 ? node.nodeValue : - ((node.hasChildNodes() && !Element.hasClassName(node,className)) ? - Element.collectTextNodesIgnoreClass(node, className) : '')); - }).flatten().join(''); -}; - -Element.setContentZoom = function(element, percent) { - element = $(element); - element.setStyle({fontSize: (percent/100) + 'em'}); - if (Prototype.Browser.WebKit) window.scrollBy(0,0); - return element; -}; - -Element.getInlineOpacity = function(element){ - return $(element).style.opacity || ''; -}; - -Element.forceRerendering = function(element) { - try { - element = $(element); - var n = document.createTextNode(' '); - element.appendChild(n); - element.removeChild(n); - } catch(e) { } -}; - -/*--------------------------------------------------------------------------*/ - -var Effect = { - _elementDoesNotExistError: { - name: 'ElementDoesNotExistError', - message: 'The specified DOM element does not exist, but is required for this effect to operate' - }, - Transitions: { - linear: Prototype.K, - sinoidal: function(pos) { - return (-Math.cos(pos*Math.PI)/2) + .5; - }, - reverse: function(pos) { - return 1-pos; - }, - flicker: function(pos) { - var pos = ((-Math.cos(pos*Math.PI)/4) + .75) + Math.random()/4; - return pos > 1 ? 1 : pos; - }, - wobble: function(pos) { - return (-Math.cos(pos*Math.PI*(9*pos))/2) + .5; - }, - pulse: function(pos, pulses) { - return (-Math.cos((pos*((pulses||5)-.5)*2)*Math.PI)/2) + .5; - }, - spring: function(pos) { - return 1 - (Math.cos(pos * 4.5 * Math.PI) * Math.exp(-pos * 6)); - }, - none: function(pos) { - return 0; - }, - full: function(pos) { - return 1; - } - }, - DefaultOptions: { - duration: 1.0, // seconds - fps: 100, // 100= assume 66fps max. - sync: false, // true for combining - from: 0.0, - to: 1.0, - delay: 0.0, - queue: 'parallel' - }, - tagifyText: function(element) { - var tagifyStyle = 'position:relative'; - if (Prototype.Browser.IE) tagifyStyle += ';zoom:1'; - - element = $(element); - $A(element.childNodes).each( function(child) { - if (child.nodeType==3) { - child.nodeValue.toArray().each( function(character) { - element.insertBefore( - new Element('span', {style: tagifyStyle}).update( - character == ' ' ? String.fromCharCode(160) : character), - child); - }); - Element.remove(child); - } - }); - }, - multiple: function(element, effect) { - var elements; - if (((typeof element == 'object') || - Object.isFunction(element)) && - (element.length)) - elements = element; - else - elements = $(element).childNodes; - - var options = Object.extend({ - speed: 0.1, - delay: 0.0 - }, arguments[2] || { }); - var masterDelay = options.delay; - - $A(elements).each( function(element, index) { - new effect(element, Object.extend(options, { delay: index * options.speed + masterDelay })); - }); - }, - PAIRS: { - 'slide': ['SlideDown','SlideUp'], - 'blind': ['BlindDown','BlindUp'], - 'appear': ['Appear','Fade'] - }, - toggle: function(element, effect, options) { - element = $(element); - effect = (effect || 'appear').toLowerCase(); - - return Effect[ Effect.PAIRS[ effect ][ element.visible() ? 1 : 0 ] ](element, Object.extend({ - queue: { position:'end', scope:(element.id || 'global'), limit: 1 } - }, options || {})); - } -}; - -Effect.DefaultOptions.transition = Effect.Transitions.sinoidal; - -/* ------------- core effects ------------- */ - -Effect.ScopedQueue = Class.create(Enumerable, { - initialize: function() { - this.effects = []; - this.interval = null; - }, - _each: function(iterator) { - this.effects._each(iterator); - }, - add: function(effect) { - var timestamp = new Date().getTime(); - - var position = Object.isString(effect.options.queue) ? - effect.options.queue : effect.options.queue.position; - - switch(position) { - case 'front': - // move unstarted effects after this effect - this.effects.findAll(function(e){ return e.state=='idle' }).each( function(e) { - e.startOn += effect.finishOn; - e.finishOn += effect.finishOn; - }); - break; - case 'with-last': - timestamp = this.effects.pluck('startOn').max() || timestamp; - break; - case 'end': - // start effect after last queued effect has finished - timestamp = this.effects.pluck('finishOn').max() || timestamp; - break; - } - - effect.startOn += timestamp; - effect.finishOn += timestamp; - - if (!effect.options.queue.limit || (this.effects.length < effect.options.queue.limit)) - this.effects.push(effect); - - if (!this.interval) - this.interval = setInterval(this.loop.bind(this), 15); - }, - remove: function(effect) { - this.effects = this.effects.reject(function(e) { return e==effect }); - if (this.effects.length == 0) { - clearInterval(this.interval); - this.interval = null; - } - }, - loop: function() { - var timePos = new Date().getTime(); - for(var i=0, len=this.effects.length;i= this.startOn) { - if (timePos >= this.finishOn) { - this.render(1.0); - this.cancel(); - this.event('beforeFinish'); - if (this.finish) this.finish(); - this.event('afterFinish'); - return; - } - var pos = (timePos - this.startOn) / this.totalTime, - frame = (pos * this.totalFrames).round(); - if (frame > this.currentFrame) { - this.render(pos); - this.currentFrame = frame; - } - } - }, - cancel: function() { - if (!this.options.sync) - Effect.Queues.get(Object.isString(this.options.queue) ? - 'global' : this.options.queue.scope).remove(this); - this.state = 'finished'; - }, - event: function(eventName) { - if (this.options[eventName + 'Internal']) this.options[eventName + 'Internal'](this); - if (this.options[eventName]) this.options[eventName](this); - }, - inspect: function() { - var data = $H(); - for(property in this) - if (!Object.isFunction(this[property])) data.set(property, this[property]); - return '#'; - } -}); - -Effect.Parallel = Class.create(Effect.Base, { - initialize: function(effects) { - this.effects = effects || []; - this.start(arguments[1]); - }, - update: function(position) { - this.effects.invoke('render', position); - }, - finish: function(position) { - this.effects.each( function(effect) { - effect.render(1.0); - effect.cancel(); - effect.event('beforeFinish'); - if (effect.finish) effect.finish(position); - effect.event('afterFinish'); - }); - } -}); - -Effect.Tween = Class.create(Effect.Base, { - initialize: function(object, from, to) { - object = Object.isString(object) ? $(object) : object; - var args = $A(arguments), method = args.last(), - options = args.length == 5 ? args[3] : null; - this.method = Object.isFunction(method) ? method.bind(object) : - Object.isFunction(object[method]) ? object[method].bind(object) : - function(value) { object[method] = value }; - this.start(Object.extend({ from: from, to: to }, options || { })); - }, - update: function(position) { - this.method(position); - } -}); - -Effect.Event = Class.create(Effect.Base, { - initialize: function() { - this.start(Object.extend({ duration: 0 }, arguments[0] || { })); - }, - update: Prototype.emptyFunction -}); - -Effect.Opacity = Class.create(Effect.Base, { - initialize: function(element) { - this.element = $(element); - if (!this.element) throw(Effect._elementDoesNotExistError); - // make this work on IE on elements without 'layout' - if (Prototype.Browser.IE && (!this.element.currentStyle.hasLayout)) - this.element.setStyle({zoom: 1}); - var options = Object.extend({ - from: this.element.getOpacity() || 0.0, - to: 1.0 - }, arguments[1] || { }); - this.start(options); - }, - update: function(position) { - this.element.setOpacity(position); - } -}); - -Effect.Move = Class.create(Effect.Base, { - initialize: function(element) { - this.element = $(element); - if (!this.element) throw(Effect._elementDoesNotExistError); - var options = Object.extend({ - x: 0, - y: 0, - mode: 'relative' - }, arguments[1] || { }); - this.start(options); - }, - setup: function() { - this.element.makePositioned(); - this.originalLeft = parseFloat(this.element.getStyle('left') || '0'); - this.originalTop = parseFloat(this.element.getStyle('top') || '0'); - if (this.options.mode == 'absolute') { - this.options.x = this.options.x - this.originalLeft; - this.options.y = this.options.y - this.originalTop; - } - }, - update: function(position) { - this.element.setStyle({ - left: (this.options.x * position + this.originalLeft).round() + 'px', - top: (this.options.y * position + this.originalTop).round() + 'px' - }); - } -}); - -// for backwards compatibility -Effect.MoveBy = function(element, toTop, toLeft) { - return new Effect.Move(element, - Object.extend({ x: toLeft, y: toTop }, arguments[3] || { })); -}; - -Effect.Scale = Class.create(Effect.Base, { - initialize: function(element, percent) { - this.element = $(element); - if (!this.element) throw(Effect._elementDoesNotExistError); - var options = Object.extend({ - scaleX: true, - scaleY: true, - scaleContent: true, - scaleFromCenter: false, - scaleMode: 'box', // 'box' or 'contents' or { } with provided values - scaleFrom: 100.0, - scaleTo: percent - }, arguments[2] || { }); - this.start(options); - }, - setup: function() { - this.restoreAfterFinish = this.options.restoreAfterFinish || false; - this.elementPositioning = this.element.getStyle('position'); - - this.originalStyle = { }; - ['top','left','width','height','fontSize'].each( function(k) { - this.originalStyle[k] = this.element.style[k]; - }.bind(this)); - - this.originalTop = this.element.offsetTop; - this.originalLeft = this.element.offsetLeft; - - var fontSize = this.element.getStyle('font-size') || '100%'; - ['em','px','%','pt'].each( function(fontSizeType) { - if (fontSize.indexOf(fontSizeType)>0) { - this.fontSize = parseFloat(fontSize); - this.fontSizeType = fontSizeType; - } - }.bind(this)); - - this.factor = (this.options.scaleTo - this.options.scaleFrom)/100; - - this.dims = null; - if (this.options.scaleMode=='box') - this.dims = [this.element.offsetHeight, this.element.offsetWidth]; - if (/^content/.test(this.options.scaleMode)) - this.dims = [this.element.scrollHeight, this.element.scrollWidth]; - if (!this.dims) - this.dims = [this.options.scaleMode.originalHeight, - this.options.scaleMode.originalWidth]; - }, - update: function(position) { - var currentScale = (this.options.scaleFrom/100.0) + (this.factor * position); - if (this.options.scaleContent && this.fontSize) - this.element.setStyle({fontSize: this.fontSize * currentScale + this.fontSizeType }); - this.setDimensions(this.dims[0] * currentScale, this.dims[1] * currentScale); - }, - finish: function(position) { - if (this.restoreAfterFinish) this.element.setStyle(this.originalStyle); - }, - setDimensions: function(height, width) { - var d = { }; - if (this.options.scaleX) d.width = width.round() + 'px'; - if (this.options.scaleY) d.height = height.round() + 'px'; - if (this.options.scaleFromCenter) { - var topd = (height - this.dims[0])/2; - var leftd = (width - this.dims[1])/2; - if (this.elementPositioning == 'absolute') { - if (this.options.scaleY) d.top = this.originalTop-topd + 'px'; - if (this.options.scaleX) d.left = this.originalLeft-leftd + 'px'; - } else { - if (this.options.scaleY) d.top = -topd + 'px'; - if (this.options.scaleX) d.left = -leftd + 'px'; - } - } - this.element.setStyle(d); - } -}); - -Effect.Highlight = Class.create(Effect.Base, { - initialize: function(element) { - this.element = $(element); - if (!this.element) throw(Effect._elementDoesNotExistError); - var options = Object.extend({ startcolor: '#ffff99' }, arguments[1] || { }); - this.start(options); - }, - setup: function() { - // Prevent executing on elements not in the layout flow - if (this.element.getStyle('display')=='none') { this.cancel(); return; } - // Disable background image during the effect - this.oldStyle = { }; - if (!this.options.keepBackgroundImage) { - this.oldStyle.backgroundImage = this.element.getStyle('background-image'); - this.element.setStyle({backgroundImage: 'none'}); - } - if (!this.options.endcolor) - this.options.endcolor = this.element.getStyle('background-color').parseColor('#ffffff'); - if (!this.options.restorecolor) - this.options.restorecolor = this.element.getStyle('background-color'); - // init color calculations - this._base = $R(0,2).map(function(i){ return parseInt(this.options.startcolor.slice(i*2+1,i*2+3),16) }.bind(this)); - this._delta = $R(0,2).map(function(i){ return parseInt(this.options.endcolor.slice(i*2+1,i*2+3),16)-this._base[i] }.bind(this)); - }, - update: function(position) { - this.element.setStyle({backgroundColor: $R(0,2).inject('#',function(m,v,i){ - return m+((this._base[i]+(this._delta[i]*position)).round().toColorPart()); }.bind(this)) }); - }, - finish: function() { - this.element.setStyle(Object.extend(this.oldStyle, { - backgroundColor: this.options.restorecolor - })); - } -}); - -Effect.ScrollTo = function(element) { - var options = arguments[1] || { }, - scrollOffsets = document.viewport.getScrollOffsets(), - elementOffsets = $(element).cumulativeOffset(); - - if (options.offset) elementOffsets[1] += options.offset; - - return new Effect.Tween(null, - scrollOffsets.top, - elementOffsets[1], - options, - function(p){ scrollTo(scrollOffsets.left, p.round()); } - ); -}; - -/* ------------- combination effects ------------- */ - -Effect.Fade = function(element) { - element = $(element); - var oldOpacity = element.getInlineOpacity(); - var options = Object.extend({ - from: element.getOpacity() || 1.0, - to: 0.0, - afterFinishInternal: function(effect) { - if (effect.options.to!=0) return; - effect.element.hide().setStyle({opacity: oldOpacity}); - } - }, arguments[1] || { }); - return new Effect.Opacity(element,options); -}; - -Effect.Appear = function(element) { - element = $(element); - var options = Object.extend({ - from: (element.getStyle('display') == 'none' ? 0.0 : element.getOpacity() || 0.0), - to: 1.0, - // force Safari to render floated elements properly - afterFinishInternal: function(effect) { - effect.element.forceRerendering(); - }, - beforeSetup: function(effect) { - effect.element.setOpacity(effect.options.from).show(); - }}, arguments[1] || { }); - return new Effect.Opacity(element,options); -}; - -Effect.Puff = function(element) { - element = $(element); - var oldStyle = { - opacity: element.getInlineOpacity(), - position: element.getStyle('position'), - top: element.style.top, - left: element.style.left, - width: element.style.width, - height: element.style.height - }; - return new Effect.Parallel( - [ new Effect.Scale(element, 200, - { sync: true, scaleFromCenter: true, scaleContent: true, restoreAfterFinish: true }), - new Effect.Opacity(element, { sync: true, to: 0.0 } ) ], - Object.extend({ duration: 1.0, - beforeSetupInternal: function(effect) { - Position.absolutize(effect.effects[0].element); - }, - afterFinishInternal: function(effect) { - effect.effects[0].element.hide().setStyle(oldStyle); } - }, arguments[1] || { }) - ); -}; - -Effect.BlindUp = function(element) { - element = $(element); - element.makeClipping(); - return new Effect.Scale(element, 0, - Object.extend({ scaleContent: false, - scaleX: false, - restoreAfterFinish: true, - afterFinishInternal: function(effect) { - effect.element.hide().undoClipping(); - } - }, arguments[1] || { }) - ); -}; - -Effect.BlindDown = function(element) { - element = $(element); - var elementDimensions = element.getDimensions(); - return new Effect.Scale(element, 100, Object.extend({ - scaleContent: false, - scaleX: false, - scaleFrom: 0, - scaleMode: {originalHeight: elementDimensions.height, originalWidth: elementDimensions.width}, - restoreAfterFinish: true, - afterSetup: function(effect) { - effect.element.makeClipping().setStyle({height: '0px'}).show(); - }, - afterFinishInternal: function(effect) { - effect.element.undoClipping(); - } - }, arguments[1] || { })); -}; - -Effect.SwitchOff = function(element) { - element = $(element); - var oldOpacity = element.getInlineOpacity(); - return new Effect.Appear(element, Object.extend({ - duration: 0.4, - from: 0, - transition: Effect.Transitions.flicker, - afterFinishInternal: function(effect) { - new Effect.Scale(effect.element, 1, { - duration: 0.3, scaleFromCenter: true, - scaleX: false, scaleContent: false, restoreAfterFinish: true, - beforeSetup: function(effect) { - effect.element.makePositioned().makeClipping(); - }, - afterFinishInternal: function(effect) { - effect.element.hide().undoClipping().undoPositioned().setStyle({opacity: oldOpacity}); - } - }); - } - }, arguments[1] || { })); -}; - -Effect.DropOut = function(element) { - element = $(element); - var oldStyle = { - top: element.getStyle('top'), - left: element.getStyle('left'), - opacity: element.getInlineOpacity() }; - return new Effect.Parallel( - [ new Effect.Move(element, {x: 0, y: 100, sync: true }), - new Effect.Opacity(element, { sync: true, to: 0.0 }) ], - Object.extend( - { duration: 0.5, - beforeSetup: function(effect) { - effect.effects[0].element.makePositioned(); - }, - afterFinishInternal: function(effect) { - effect.effects[0].element.hide().undoPositioned().setStyle(oldStyle); - } - }, arguments[1] || { })); -}; - -Effect.Shake = function(element) { - element = $(element); - var options = Object.extend({ - distance: 20, - duration: 0.5 - }, arguments[1] || {}); - var distance = parseFloat(options.distance); - var split = parseFloat(options.duration) / 10.0; - var oldStyle = { - top: element.getStyle('top'), - left: element.getStyle('left') }; - return new Effect.Move(element, - { x: distance, y: 0, duration: split, afterFinishInternal: function(effect) { - new Effect.Move(effect.element, - { x: -distance*2, y: 0, duration: split*2, afterFinishInternal: function(effect) { - new Effect.Move(effect.element, - { x: distance*2, y: 0, duration: split*2, afterFinishInternal: function(effect) { - new Effect.Move(effect.element, - { x: -distance*2, y: 0, duration: split*2, afterFinishInternal: function(effect) { - new Effect.Move(effect.element, - { x: distance*2, y: 0, duration: split*2, afterFinishInternal: function(effect) { - new Effect.Move(effect.element, - { x: -distance, y: 0, duration: split, afterFinishInternal: function(effect) { - effect.element.undoPositioned().setStyle(oldStyle); - }}); }}); }}); }}); }}); }}); -}; - -Effect.SlideDown = function(element) { - element = $(element).cleanWhitespace(); - // SlideDown need to have the content of the element wrapped in a container element with fixed height! - var oldInnerBottom = element.down().getStyle('bottom'); - var elementDimensions = element.getDimensions(); - return new Effect.Scale(element, 100, Object.extend({ - scaleContent: false, - scaleX: false, - scaleFrom: window.opera ? 0 : 1, - scaleMode: {originalHeight: elementDimensions.height, originalWidth: elementDimensions.width}, - restoreAfterFinish: true, - afterSetup: function(effect) { - effect.element.makePositioned(); - effect.element.down().makePositioned(); - if (window.opera) effect.element.setStyle({top: ''}); - effect.element.makeClipping().setStyle({height: '0px'}).show(); - }, - afterUpdateInternal: function(effect) { - effect.element.down().setStyle({bottom: - (effect.dims[0] - effect.element.clientHeight) + 'px' }); - }, - afterFinishInternal: function(effect) { - effect.element.undoClipping().undoPositioned(); - effect.element.down().undoPositioned().setStyle({bottom: oldInnerBottom}); } - }, arguments[1] || { }) - ); -}; - -Effect.SlideUp = function(element) { - element = $(element).cleanWhitespace(); - var oldInnerBottom = element.down().getStyle('bottom'); - var elementDimensions = element.getDimensions(); - return new Effect.Scale(element, window.opera ? 0 : 1, - Object.extend({ scaleContent: false, - scaleX: false, - scaleMode: 'box', - scaleFrom: 100, - scaleMode: {originalHeight: elementDimensions.height, originalWidth: elementDimensions.width}, - restoreAfterFinish: true, - afterSetup: function(effect) { - effect.element.makePositioned(); - effect.element.down().makePositioned(); - if (window.opera) effect.element.setStyle({top: ''}); - effect.element.makeClipping().show(); - }, - afterUpdateInternal: function(effect) { - effect.element.down().setStyle({bottom: - (effect.dims[0] - effect.element.clientHeight) + 'px' }); - }, - afterFinishInternal: function(effect) { - effect.element.hide().undoClipping().undoPositioned(); - effect.element.down().undoPositioned().setStyle({bottom: oldInnerBottom}); - } - }, arguments[1] || { }) - ); -}; - -// Bug in opera makes the TD containing this element expand for a instance after finish -Effect.Squish = function(element) { - return new Effect.Scale(element, window.opera ? 1 : 0, { - restoreAfterFinish: true, - beforeSetup: function(effect) { - effect.element.makeClipping(); - }, - afterFinishInternal: function(effect) { - effect.element.hide().undoClipping(); - } - }); -}; - -Effect.Grow = function(element) { - element = $(element); - var options = Object.extend({ - direction: 'center', - moveTransition: Effect.Transitions.sinoidal, - scaleTransition: Effect.Transitions.sinoidal, - opacityTransition: Effect.Transitions.full - }, arguments[1] || { }); - var oldStyle = { - top: element.style.top, - left: element.style.left, - height: element.style.height, - width: element.style.width, - opacity: element.getInlineOpacity() }; - - var dims = element.getDimensions(); - var initialMoveX, initialMoveY; - var moveX, moveY; - - switch (options.direction) { - case 'top-left': - initialMoveX = initialMoveY = moveX = moveY = 0; - break; - case 'top-right': - initialMoveX = dims.width; - initialMoveY = moveY = 0; - moveX = -dims.width; - break; - case 'bottom-left': - initialMoveX = moveX = 0; - initialMoveY = dims.height; - moveY = -dims.height; - break; - case 'bottom-right': - initialMoveX = dims.width; - initialMoveY = dims.height; - moveX = -dims.width; - moveY = -dims.height; - break; - case 'center': - initialMoveX = dims.width / 2; - initialMoveY = dims.height / 2; - moveX = -dims.width / 2; - moveY = -dims.height / 2; - break; - } - - return new Effect.Move(element, { - x: initialMoveX, - y: initialMoveY, - duration: 0.01, - beforeSetup: function(effect) { - effect.element.hide().makeClipping().makePositioned(); - }, - afterFinishInternal: function(effect) { - new Effect.Parallel( - [ new Effect.Opacity(effect.element, { sync: true, to: 1.0, from: 0.0, transition: options.opacityTransition }), - new Effect.Move(effect.element, { x: moveX, y: moveY, sync: true, transition: options.moveTransition }), - new Effect.Scale(effect.element, 100, { - scaleMode: { originalHeight: dims.height, originalWidth: dims.width }, - sync: true, scaleFrom: window.opera ? 1 : 0, transition: options.scaleTransition, restoreAfterFinish: true}) - ], Object.extend({ - beforeSetup: function(effect) { - effect.effects[0].element.setStyle({height: '0px'}).show(); - }, - afterFinishInternal: function(effect) { - effect.effects[0].element.undoClipping().undoPositioned().setStyle(oldStyle); - } - }, options) - ); - } - }); -}; - -Effect.Shrink = function(element) { - element = $(element); - var options = Object.extend({ - direction: 'center', - moveTransition: Effect.Transitions.sinoidal, - scaleTransition: Effect.Transitions.sinoidal, - opacityTransition: Effect.Transitions.none - }, arguments[1] || { }); - var oldStyle = { - top: element.style.top, - left: element.style.left, - height: element.style.height, - width: element.style.width, - opacity: element.getInlineOpacity() }; - - var dims = element.getDimensions(); - var moveX, moveY; - - switch (options.direction) { - case 'top-left': - moveX = moveY = 0; - break; - case 'top-right': - moveX = dims.width; - moveY = 0; - break; - case 'bottom-left': - moveX = 0; - moveY = dims.height; - break; - case 'bottom-right': - moveX = dims.width; - moveY = dims.height; - break; - case 'center': - moveX = dims.width / 2; - moveY = dims.height / 2; - break; - } - - return new Effect.Parallel( - [ new Effect.Opacity(element, { sync: true, to: 0.0, from: 1.0, transition: options.opacityTransition }), - new Effect.Scale(element, window.opera ? 1 : 0, { sync: true, transition: options.scaleTransition, restoreAfterFinish: true}), - new Effect.Move(element, { x: moveX, y: moveY, sync: true, transition: options.moveTransition }) - ], Object.extend({ - beforeStartInternal: function(effect) { - effect.effects[0].element.makePositioned().makeClipping(); - }, - afterFinishInternal: function(effect) { - effect.effects[0].element.hide().undoClipping().undoPositioned().setStyle(oldStyle); } - }, options) - ); -}; - -Effect.Pulsate = function(element) { - element = $(element); - var options = arguments[1] || { }, - oldOpacity = element.getInlineOpacity(), - transition = options.transition || Effect.Transitions.linear, - reverser = function(pos){ - return 1 - transition((-Math.cos((pos*(options.pulses||5)*2)*Math.PI)/2) + .5); - }; - - return new Effect.Opacity(element, - Object.extend(Object.extend({ duration: 2.0, from: 0, - afterFinishInternal: function(effect) { effect.element.setStyle({opacity: oldOpacity}); } - }, options), {transition: reverser})); -}; - -Effect.Fold = function(element) { - element = $(element); - var oldStyle = { - top: element.style.top, - left: element.style.left, - width: element.style.width, - height: element.style.height }; - element.makeClipping(); - return new Effect.Scale(element, 5, Object.extend({ - scaleContent: false, - scaleX: false, - afterFinishInternal: function(effect) { - new Effect.Scale(element, 1, { - scaleContent: false, - scaleY: false, - afterFinishInternal: function(effect) { - effect.element.hide().undoClipping().setStyle(oldStyle); - } }); - }}, arguments[1] || { })); -}; - -Effect.Morph = Class.create(Effect.Base, { - initialize: function(element) { - this.element = $(element); - if (!this.element) throw(Effect._elementDoesNotExistError); - var options = Object.extend({ - style: { } - }, arguments[1] || { }); - - if (!Object.isString(options.style)) this.style = $H(options.style); - else { - if (options.style.include(':')) - this.style = options.style.parseStyle(); - else { - this.element.addClassName(options.style); - this.style = $H(this.element.getStyles()); - this.element.removeClassName(options.style); - var css = this.element.getStyles(); - this.style = this.style.reject(function(style) { - return style.value == css[style.key]; - }); - options.afterFinishInternal = function(effect) { - effect.element.addClassName(effect.options.style); - effect.transforms.each(function(transform) { - effect.element.style[transform.style] = ''; - }); - }; - } - } - this.start(options); - }, - - setup: function(){ - function parseColor(color){ - if (!color || ['rgba(0, 0, 0, 0)','transparent'].include(color)) color = '#ffffff'; - color = color.parseColor(); - return $R(0,2).map(function(i){ - return parseInt( color.slice(i*2+1,i*2+3), 16 ); - }); - } - this.transforms = this.style.map(function(pair){ - var property = pair[0], value = pair[1], unit = null; - - if (value.parseColor('#zzzzzz') != '#zzzzzz') { - value = value.parseColor(); - unit = 'color'; - } else if (property == 'opacity') { - value = parseFloat(value); - if (Prototype.Browser.IE && (!this.element.currentStyle.hasLayout)) - this.element.setStyle({zoom: 1}); - } else if (Element.CSS_LENGTH.test(value)) { - var components = value.match(/^([\+\-]?[0-9\.]+)(.*)$/); - value = parseFloat(components[1]); - unit = (components.length == 3) ? components[2] : null; - } - - var originalValue = this.element.getStyle(property); - return { - style: property.camelize(), - originalValue: unit=='color' ? parseColor(originalValue) : parseFloat(originalValue || 0), - targetValue: unit=='color' ? parseColor(value) : value, - unit: unit - }; - }.bind(this)).reject(function(transform){ - return ( - (transform.originalValue == transform.targetValue) || - ( - transform.unit != 'color' && - (isNaN(transform.originalValue) || isNaN(transform.targetValue)) - ) - ); - }); - }, - update: function(position) { - var style = { }, transform, i = this.transforms.length; - while(i--) - style[(transform = this.transforms[i]).style] = - transform.unit=='color' ? '#'+ - (Math.round(transform.originalValue[0]+ - (transform.targetValue[0]-transform.originalValue[0])*position)).toColorPart() + - (Math.round(transform.originalValue[1]+ - (transform.targetValue[1]-transform.originalValue[1])*position)).toColorPart() + - (Math.round(transform.originalValue[2]+ - (transform.targetValue[2]-transform.originalValue[2])*position)).toColorPart() : - (transform.originalValue + - (transform.targetValue - transform.originalValue) * position).toFixed(3) + - (transform.unit === null ? '' : transform.unit); - this.element.setStyle(style, true); - } -}); - -Effect.Transform = Class.create({ - initialize: function(tracks){ - this.tracks = []; - this.options = arguments[1] || { }; - this.addTracks(tracks); - }, - addTracks: function(tracks){ - tracks.each(function(track){ - track = $H(track); - var data = track.values().first(); - this.tracks.push($H({ - ids: track.keys().first(), - effect: Effect.Morph, - options: { style: data } - })); - }.bind(this)); - return this; - }, - play: function(){ - return new Effect.Parallel( - this.tracks.map(function(track){ - var ids = track.get('ids'), effect = track.get('effect'), options = track.get('options'); - var elements = [$(ids) || $$(ids)].flatten(); - return elements.map(function(e){ return new effect(e, Object.extend({ sync:true }, options)) }); - }).flatten(), - this.options - ); - } -}); - -Element.CSS_PROPERTIES = $w( - 'backgroundColor backgroundPosition borderBottomColor borderBottomStyle ' + - 'borderBottomWidth borderLeftColor borderLeftStyle borderLeftWidth ' + - 'borderRightColor borderRightStyle borderRightWidth borderSpacing ' + - 'borderTopColor borderTopStyle borderTopWidth bottom clip color ' + - 'fontSize fontWeight height left letterSpacing lineHeight ' + - 'marginBottom marginLeft marginRight marginTop markerOffset maxHeight '+ - 'maxWidth minHeight minWidth opacity outlineColor outlineOffset ' + - 'outlineWidth paddingBottom paddingLeft paddingRight paddingTop ' + - 'right textIndent top width wordSpacing zIndex'); - -Element.CSS_LENGTH = /^(([\+\-]?[0-9\.]+)(em|ex|px|in|cm|mm|pt|pc|\%))|0$/; - -String.__parseStyleElement = document.createElement('div'); -String.prototype.parseStyle = function(){ - var style, styleRules = $H(); - if (Prototype.Browser.WebKit) - style = new Element('div',{style:this}).style; - else { - String.__parseStyleElement.innerHTML = '
    '; - style = String.__parseStyleElement.childNodes[0].style; - } - - Element.CSS_PROPERTIES.each(function(property){ - if (style[property]) styleRules.set(property, style[property]); - }); - - if (Prototype.Browser.IE && this.include('opacity')) - styleRules.set('opacity', this.match(/opacity:\s*((?:0|1)?(?:\.\d*)?)/)[1]); - - return styleRules; -}; - -if (document.defaultView && document.defaultView.getComputedStyle) { - Element.getStyles = function(element) { - var css = document.defaultView.getComputedStyle($(element), null); - return Element.CSS_PROPERTIES.inject({ }, function(styles, property) { - styles[property] = css[property]; - return styles; - }); - }; -} else { - Element.getStyles = function(element) { - element = $(element); - var css = element.currentStyle, styles; - styles = Element.CSS_PROPERTIES.inject({ }, function(results, property) { - results[property] = css[property]; - return results; - }); - if (!styles.opacity) styles.opacity = element.getOpacity(); - return styles; - }; -} - -Effect.Methods = { - morph: function(element, style) { - element = $(element); - new Effect.Morph(element, Object.extend({ style: style }, arguments[2] || { })); - return element; - }, - visualEffect: function(element, effect, options) { - element = $(element); - var s = effect.dasherize().camelize(), klass = s.charAt(0).toUpperCase() + s.substring(1); - new Effect[klass](element, options); - return element; - }, - highlight: function(element, options) { - element = $(element); - new Effect.Highlight(element, options); - return element; - } -}; - -$w('fade appear grow shrink fold blindUp blindDown slideUp slideDown '+ - 'pulsate shake puff squish switchOff dropOut').each( - function(effect) { - Effect.Methods[effect] = function(element, options){ - element = $(element); - Effect[effect.charAt(0).toUpperCase() + effect.substring(1)](element, options); - return element; - }; - } -); - -$w('getInlineOpacity forceRerendering setContentZoom collectTextNodes collectTextNodesIgnoreClass getStyles').each( - function(f) { Effect.Methods[f] = Element[f]; } -); - -Element.addMethods(Effect.Methods); \ No newline at end of file diff --git a/public/javascripts/jquery-ui.js b/public/javascripts/jquery-ui.js new file mode 100644 index 00000000..dcf3731c --- /dev/null +++ b/public/javascripts/jquery-ui.js @@ -0,0 +1,11603 @@ +/*! + * jQuery UI 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.12", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + //
    + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + var nodeName = element.nodeName.toLowerCase(), + tabIndex = $.attr( element, "tabindex" ); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || !isNaN( tabIndex ) + : !isNaN( tabIndex )) + // the element and all of its ancestors must be visible + && visible( element ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ); + return ( isNaN( tabIndex ) || tabIndex >= 0 ) && $( element ).is( ":focusable" ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * jQuery UI Widget 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + $( elem ).triggerHandler( "remove" ); + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + $( this ).triggerHandler( "remove" ); + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * jQuery UI Mouse 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + // TODO: figure out why we have to use originalEvent + event.originalEvent = event.originalEvent || {}; + if (event.originalEvent.mouseHandled) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + event.originalEvent.mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/* + * jQuery UI Draggable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is removed, don't bother to continue if helper is set to "original" + if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original") + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + (o.containment == 'document' ? 0 : $(window).scrollLeft()) - this.offset.relative.left - this.offset.parent.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.12" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
    ') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/* + * jQuery UI Droppable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.12" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = dropped || this._drop.call(this, event); + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + } +}; + +})(jQuery); +/* + * jQuery UI Resizable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('
    ').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('
    '); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (data.height) data.width = (csize.height * this.aspectRatio); + else if (data.width) data.height = (csize.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('
    '); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.12" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10), + position: el.css('position') // to reset Opera on stop() + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + // Opera fixing relative position + if ($.browser.opera && /relative/.test(el.css('position'))) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _reset = function (exp) { + $(exp).each(function() { + var el = $(this); + // reset position for Opera - no need to verify it was changed + el.css({ position: el.data("resizable-alsoresize").position }); + }); + }; + + if (self._revertToRelativePosition) { + self._revertToRelativePosition = false; + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp) { _reset(exp); }); + }else{ + _reset(o.alsoResize); + } + } + + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/* + * jQuery UI Selectable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("
    "); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if (event.metaKey && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.12" +}); + +})(jQuery); +/* + * jQuery UI Sortable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled") + .removeData("sortable") + .unbind(".sortable"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData("sortable-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, 'sortable-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(sortable-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data('sortable-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.12" +}); + +})(jQuery); +/* + * jQuery UI Effects 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.queue('fx', function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('className'); + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('className', className); + + that.animate(styleDifference(originalStyle, newStyle), duration, easing, function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + }); + + // $.animate adds a function to the end of the queue + // but we want it at the front + var queue = $.queue(this), + anim = queue.splice(queue.length - 1, 1)[0]; + queue.splice(1, 0, anim); + $.dequeue(this); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.12", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('
    ') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }); + + element.wrap(wrapper); + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + if (element.parent().is('.ui-effects-wrapper')) + return element.parent().replaceWith(element); + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); +/* + * jQuery UI Effects Blind 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Bounce 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Clip 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Drop 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Explode 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Fade 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Fold 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Highlight 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Pulsate 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'); + times = ((o.options.times || 5) * 2) - 1; + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Scale 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Shake 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Slide 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Transfer 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('
    ') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Accordion 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; + } + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.12", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt( s.parent().width(), 10 ) + - parseInt( s.css( "paddingLeft" ), 10 ) + - parseInt( s.css( "paddingRight" ), 10 ) + - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 ) + - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); +/* + * jQuery UI Autocomplete 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + + pending: 0, + + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.attr( "readonly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._move( "previous", event ); + // prevent moving cursor to beginning of text field in some browsers + event.preventDefault(); + break; + case keyCode.DOWN: + self._move( "next", event ); + // prevent moving cursor to end of text field in some browsers + event.preventDefault(); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.response = function() { + return self._response.apply( self, arguments ); + }; + this.menu = $( "
      " ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( self.xhr ) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + autocompleteRequest: ++requestIndex, + success: function( data, status ) { + if ( this.autocompleteRequest === requestIndex ) { + response( data ); + } + }, + error: function() { + if ( this.autocompleteRequest === requestIndex ) { + response( [] ); + } + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this.response ); + }, + + _response: function( content ) { + if ( !this.options.disabled && content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + this.pending--; + if ( !this.pending ) { + this.element.removeClass( "ui-autocomplete-loading" ); + } + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next( new $.Event("mouseover") ); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + ul.width( "" ).outerWidth(), + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "
    • " ) + .data( "item.autocomplete", item ) + .append( $( "" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.attr("scrollTop"), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.attr("scrollTop", scroll + offset); + } else if (offset >= elementHeight) { + this.element.attr("scrollTop", scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(); + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element.attr("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); +/* + * jQuery UI Button 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function( event ) { + $( ":ui-button", event.target.form ).each(function() { + var inst = $( this ).data( "button" ); + setTimeout(function() { + inst.refresh(); + }, 1 ); + }); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = this.element.attr( "disabled" ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + if ( this.element.is( ":disabled" ) ) { + options.disabled = true; + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + $( this ).addClass( focusClass ); + }) + .bind( "blur.button", function() { + $( this ).removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + self.refresh(); + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", true ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for=" + this.element.attr("id") + "]"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.attr( "disabled", true ); + } else { + this.element.removeAttr( "disabled" ); + } + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "" ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "" ); + } + + if ( icons.secondary ) { + buttonElement.append( "" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); +/* + * jQuery UI Datepicker 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.12" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false // True to size the input for the date format, false to leave as is + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = $('
      '); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + $('
      '))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('' + appendText + ''); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + inst.dpDiv.show(); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $(''); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDateDatepicker(target, date); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (event) { + $.datepicker.log(event); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {})); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._datepickerShowing = true; + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + var borders = $.datepicker._getBorders(inst.dpDiv); + inst.dpDiv.empty().append(this._generateHTML(inst)); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a') + .bind('mouseout', function(){ + $(this).removeClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover'); + }) + .bind('mouseover', function(){ + if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) { + $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + $(this).addClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover'); + } + }) + .end() + .find('.' + this._dayOverClass + ' a') + .trigger('mouseover') + .end(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + else + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + this._curInst = null; + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if ($target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst._selectingMonthYear = false; + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Restore input focus after not changing month/year. */ + _clickMonthYear: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (inst.input && inst._selectingMonthYear) { + setTimeout(function() { + inst.input.focus(); + }, 0); + } + inst._selectingMonthYear = !inst._selectingMonthYear; + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = (lookAhead(match) ? longNames : shortNames); + for (var i = 0; i < names.length; i++) { + if (value.substr(iValue, names[i].length).toLowerCase() == names[i].toLowerCase()) { + iValue += names[i].length; + return i + 1; + } + } + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + (date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
      ' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
      ' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
      '; + } + calender += '
      ' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
      ' + + ''; + var thead = (showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = (!showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
      ' + this._get(inst, 'weekHeader') + '
      ' + + this._get(inst, 'calculateWeek')(printDate) + '' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
      ' + (isMultiMonth ? '
      ' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
      ' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
      '; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ''; + //when showing there is no need for later update + if( ! $.browser.mozilla ){ + html += inst.yearshtml; + inst.yearshtml = null; + } else { + // will be replaced later with inst.yearshtml + html += ''; + } + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '
      '; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.12"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); +/* + * jQuery UI Dialog 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('
      ')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('
      ')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if (options.modal) { + uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode !== $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
      ') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "
      " ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.12", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('
      ').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); +/* + * jQuery UI Position 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions (see #5280) + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +}( jQuery )); +/* + * jQuery UI Progressbar 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "
      " ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.12" +}); + +})( jQuery ); +/* + * jQuery UI Slider 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ); + + if ( o.disabled ) { + this.element.addClass( "ui-slider-disabled ui-disabled" ); + } + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + this.range = $( "
      " ); + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } else { + this.range = $( "
      " ); + } + + this.range + .appendTo( this.element ) + .addClass( "ui-slider-range" ); + + if ( o.range === "min" || o.range === "max" ) { + this.range.addClass( "ui-slider-range-" + o.range ); + } + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + this.range.addClass( "ui-widget-header" ); + } + + if ( $( ".ui-slider-handle", this.element ).length === 0 ) { + $( "" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + + if ( o.values && o.values.length ) { + while ( $(".ui-slider-handle", this.element).length < o.values.length ) { + $( "" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + } + + this.handles = $( ".ui-slider-handle", this.element ) + .addClass( "ui-state-default" + + " ui-corner-all" ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var ret = true, + index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + + return ret; + + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.attr( "disabled", "disabled" ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.removeAttr( "disabled" ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step; + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.12" +}); + +}(jQuery)); +/* + * jQuery UI Tabs 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "
      ", + remove: null, + select: null, + show: null, + spinner: "Loading…", + tabTemplate: "
    • #{label}
      • " + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
    • + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.12" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + t = o.selected; + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); diff --git a/public/javascripts/jquery-ui.min.js b/public/javascripts/jquery-ui.min.js new file mode 100644 index 00000000..33f5bfa2 --- /dev/null +++ b/public/javascripts/jquery-ui.min.js @@ -0,0 +1,406 @@ +/*! + * jQuery UI 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(b,d){function e(f){return!b(f).parents().andSelf().filter(function(){return b.curCSS(this,"visibility")==="hidden"||b.expr.filters.hidden(this)}).length}b.ui=b.ui||{};if(!b.ui.version){b.extend(b.ui,{version:"1.8.12",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106, +NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});b.fn.extend({_focus:b.fn.focus,focus:function(f,g){return typeof f==="number"?this.each(function(){var a=this;setTimeout(function(){b(a).focus();g&&g.call(a)},f)}):this._focus.apply(this,arguments)},scrollParent:function(){var f;f=b.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(b.curCSS(this, +"position",1))&&/(auto|scroll)/.test(b.curCSS(this,"overflow",1)+b.curCSS(this,"overflow-y",1)+b.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(b.curCSS(this,"overflow",1)+b.curCSS(this,"overflow-y",1)+b.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!f.length?b(document):f},zIndex:function(f){if(f!==d)return this.css("zIndex",f);if(this.length){f=b(this[0]);for(var g;f.length&&f[0]!==document;){g=f.css("position"); +if(g==="absolute"||g==="relative"||g==="fixed"){g=parseInt(f.css("zIndex"),10);if(!isNaN(g)&&g!==0)return g}f=f.parent()}}return 0},disableSelection:function(){return this.bind((b.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(f){f.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});b.each(["Width","Height"],function(f,g){function a(j,n,o,l){b.each(c,function(){n-=parseFloat(b.curCSS(j,"padding"+this,true))||0;if(o)n-=parseFloat(b.curCSS(j, +"border"+this+"Width",true))||0;if(l)n-=parseFloat(b.curCSS(j,"margin"+this,true))||0});return n}var c=g==="Width"?["Left","Right"]:["Top","Bottom"],h=g.toLowerCase(),i={innerWidth:b.fn.innerWidth,innerHeight:b.fn.innerHeight,outerWidth:b.fn.outerWidth,outerHeight:b.fn.outerHeight};b.fn["inner"+g]=function(j){if(j===d)return i["inner"+g].call(this);return this.each(function(){b(this).css(h,a(this,j)+"px")})};b.fn["outer"+g]=function(j,n){if(typeof j!=="number")return i["outer"+g].call(this,j);return this.each(function(){b(this).css(h, +a(this,j,true,n)+"px")})}});b.extend(b.expr[":"],{data:function(f,g,a){return!!b.data(f,a[3])},focusable:function(f){var g=f.nodeName.toLowerCase(),a=b.attr(f,"tabindex");if("area"===g){g=f.parentNode;a=g.name;if(!f.href||!a||g.nodeName.toLowerCase()!=="map")return false;f=b("img[usemap=#"+a+"]")[0];return!!f&&e(f)}return(/input|select|textarea|button|object/.test(g)?!f.disabled:"a"==g?f.href||!isNaN(a):!isNaN(a))&&e(f)},tabbable:function(f){var g=b.attr(f,"tabindex");return(isNaN(g)||g>=0)&&b(f).is(":focusable")}}); +b(function(){var f=document.body,g=f.appendChild(g=document.createElement("div"));b.extend(g.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});b.support.minHeight=g.offsetHeight===100;b.support.selectstart="onselectstart"in g;f.removeChild(g).style.display="none"});b.extend(b.ui,{plugin:{add:function(f,g,a){f=b.ui[f].prototype;for(var c in a){f.plugins[c]=f.plugins[c]||[];f.plugins[c].push([g,a[c]])}},call:function(f,g,a){if((g=f.plugins[g])&&f.element[0].parentNode)for(var c=0;c0)return true;f[g]=1;a=f[g]>0;f[g]=0;return a},isOverAxis:function(f,g,a){return f>g&&f=9)&&!d.button)return this._mouseUp(d);if(this._mouseStarted){this._mouseDrag(d);return d.preventDefault()}if(this._mouseDistanceMet(d)&&this._mouseDelayMet(d))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,d)!==false)?this._mouseDrag(d):this._mouseUp(d);return!this._mouseStarted},_mouseUp:function(d){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate); +if(this._mouseStarted){this._mouseStarted=false;d.target==this._mouseDownEvent.target&&b.data(d.target,this.widgetName+".preventClickEvent",true);this._mouseStop(d)}return false},_mouseDistanceMet:function(d){return Math.max(Math.abs(this._mouseDownEvent.pageX-d.pageX),Math.abs(this._mouseDownEvent.pageY-d.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +(function(b){b.widget("ui.draggable",b.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(d){var e= +this.options;if(this.helper||e.disabled||b(d.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(d);if(!this.handle)return false;return true},_mouseStart:function(d){var e=this.options;this.helper=this._createHelper(d);this._cacheHelperProportions();if(b.ui.ddmanager)b.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top- +this.margins.top,left:this.offset.left-this.margins.left};b.extend(this.offset,{click:{left:d.pageX-this.offset.left,top:d.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(d);this.originalPageX=d.pageX;this.originalPageY=d.pageY;e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt);e.containment&&this._setContainment();if(this._trigger("start",d)===false){this._clear();return false}this._cacheHelperProportions(); +b.ui.ddmanager&&!e.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,d);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(d,true);return true},_mouseDrag:function(d,e){this.position=this._generatePosition(d);this.positionAbs=this._convertPositionTo("absolute");if(!e){e=this._uiHash();if(this._trigger("drag",d,e)===false){this._mouseUp({});return false}this.position=e.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis|| +this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";b.ui.ddmanager&&b.ui.ddmanager.drag(this,d);return false},_mouseStop:function(d){var e=false;if(b.ui.ddmanager&&!this.options.dropBehaviour)e=b.ui.ddmanager.drop(this,d);if(this.dropped){e=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!e||this.options.revert=="valid"&&e||this.options.revert===true||b.isFunction(this.options.revert)&& +this.options.revert.call(this.element,e)){var f=this;b(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){f._trigger("stop",d)!==false&&f._clear()})}else this._trigger("stop",d)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(d){var e=!this.options.handle||!b(this.options.handle,this.element).length?true:false;b(this.options.handle,this.element).find("*").andSelf().each(function(){if(this== +d.target)e=true});return e},_createHelper:function(d){var e=this.options;d=b.isFunction(e.helper)?b(e.helper.apply(this.element[0],[d])):e.helper=="clone"?this.element.clone():this.element;d.parents("body").length||d.appendTo(e.appendTo=="parent"?this.element[0].parentNode:e.appendTo);d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&&d.css("position","absolute");return d},_adjustOffsetFromHelper:function(d){if(typeof d=="string")d=d.split(" ");if(b.isArray(d))d={left:+d[0],top:+d[1]|| +0};if("left"in d)this.offset.click.left=d.left+this.margins.left;if("right"in d)this.offset.click.left=this.helperProportions.width-d.right+this.margins.left;if("top"in d)this.offset.click.top=d.top+this.margins.top;if("bottom"in d)this.offset.click.top=this.helperProportions.height-d.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var d=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0], +this.offsetParent[0])){d.left+=this.scrollParent.scrollLeft();d.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&b.browser.msie)d={top:0,left:0};return{top:d.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:d.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var d=this.element.position();return{top:d.top- +(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:d.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(), +height:this.helper.outerHeight()}},_setContainment:function(){var d=this.options;if(d.containment=="parent")d.containment=this.helper[0].parentNode;if(d.containment=="document"||d.containment=="window")this.containment=[(d.containment=="document"?0:b(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(d.containment=="document"?0:b(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(d.containment=="document"?0:b(window).scrollLeft())+b(d.containment=="document"? +document:window).width()-this.helperProportions.width-this.margins.left,(d.containment=="document"?0:b(window).scrollTop())+(b(d.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(d.containment)&&d.containment.constructor!=Array){var e=b(d.containment)[0];if(e){d=b(d.containment).offset();var f=b(e).css("overflow")!="hidden";this.containment=[d.left+(parseInt(b(e).css("borderLeftWidth"), +10)||0)+(parseInt(b(e).css("paddingLeft"),10)||0),d.top+(parseInt(b(e).css("borderTopWidth"),10)||0)+(parseInt(b(e).css("paddingTop"),10)||0),d.left+(f?Math.max(e.scrollWidth,e.offsetWidth):e.offsetWidth)-(parseInt(b(e).css("borderLeftWidth"),10)||0)-(parseInt(b(e).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,d.top+(f?Math.max(e.scrollHeight,e.offsetHeight):e.offsetHeight)-(parseInt(b(e).css("borderTopWidth"),10)||0)-(parseInt(b(e).css("paddingBottom"), +10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom]}}else if(d.containment.constructor==Array)this.containment=d.containment},_convertPositionTo:function(d,e){if(!e)e=this.position;d=d=="absolute"?1:-1;var f=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:e.top+this.offset.relative.top*d+this.offset.parent.top*d-(b.browser.safari&& +b.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:e.left+this.offset.relative.left*d+this.offset.parent.left*d-(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(d){var e=this.options,f=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0], +this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName),a=d.pageX,c=d.pageY;if(this.originalPosition){if(this.containment){if(d.pageX-this.offset.click.leftthis.containment[2])a=this.containment[2]+this.offset.click.left;if(d.pageY-this.offset.click.top>this.containment[3])c= +this.containment[3]+this.offset.click.top}if(e.grid){c=this.originalPageY+Math.round((c-this.originalPageY)/e.grid[1])*e.grid[1];c=this.containment?!(c-this.offset.click.topthis.containment[3])?c:!(c-this.offset.click.topthis.containment[2])? +a:!(a-this.offset.click.left').css({width:this.offsetWidth+ +"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(b(this).offset()).appendTo("body")})},stop:function(){b("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});b.ui.plugin.add("draggable","opacity",{start:function(d,e){d=b(e.helper);e=b(this).data("draggable").options;if(d.css("opacity"))e._opacity=d.css("opacity");d.css("opacity",e.opacity)},stop:function(d,e){d=b(this).data("draggable").options;d._opacity&&b(e.helper).css("opacity", +d._opacity)}});b.ui.plugin.add("draggable","scroll",{start:function(){var d=b(this).data("draggable");if(d.scrollParent[0]!=document&&d.scrollParent[0].tagName!="HTML")d.overflowOffset=d.scrollParent.offset()},drag:function(d){var e=b(this).data("draggable"),f=e.options,g=false;if(e.scrollParent[0]!=document&&e.scrollParent[0].tagName!="HTML"){if(!f.axis||f.axis!="x")if(e.overflowOffset.top+e.scrollParent[0].offsetHeight-d.pageY=0;n--){var o=f.snapElements[n].left,l=o+f.snapElements[n].width,k=f.snapElements[n].top,m=k+f.snapElements[n].height;if(o-a=n&&c<=o||h>=n&&h<=o||co)&&(g>= +i&&g<=j||a>=i&&a<=j||gj);default:return false}};b.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(d,e){var f=b.ui.ddmanager.droppables[d.options.scope]||[],g=e?e.type:null,a=(d.currentItem||d.element).find(":data(droppable)").andSelf(),c=0;a:for(;c').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=g.handles||(!b(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var a=this.handles.split(",");this.handles={};for(var c=0;c');/sw|se|ne|nw/.test(h)&&i.css({zIndex:++g.zIndex});"se"==h&&i.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[h]=".ui-resizable-"+h;this.element.append(i)}}this._renderAxis=function(j){j=j||this.element;for(var n in this.handles){if(this.handles[n].constructor== +String)this.handles[n]=b(this.handles[n],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=b(this.handles[n],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(n)?o.outerHeight():o.outerWidth();o=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");j.css(o,l);this._proportionallyResize()}b(this.handles[n])}};this._renderAxis(this.element);this._handles=b(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!f.resizing){if(this.className)var j=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);f.axis=j&&j[1]?j[1]:"se"}});if(g.autoHide){this._handles.hide();b(this.element).addClass("ui-resizable-autohide").hover(function(){b(this).removeClass("ui-resizable-autohide");f._handles.show()},function(){if(!f.resizing){b(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var f=function(a){b(a).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()}; +if(this.elementIsWrapper){f(this.element);var g=this.element;g.after(this.originalElement.css({position:g.css("position"),width:g.outerWidth(),height:g.outerHeight(),top:g.css("top"),left:g.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);f(this.originalElement);return this},_mouseCapture:function(f){var g=false;for(var a in this.handles)if(b(this.handles[a])[0]==f.target)g=true;return!this.options.disabled&&g},_mouseStart:function(f){var g=this.options,a=this.element.position(), +c=this.element;this.resizing=true;this.documentScroll={top:b(document).scrollTop(),left:b(document).scrollLeft()};if(c.is(".ui-draggable")||/absolute/.test(c.css("position")))c.css({position:"absolute",top:a.top,left:a.left});b.browser.opera&&/relative/.test(c.css("position"))&&c.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();a=d(this.helper.css("left"));var h=d(this.helper.css("top"));if(g.containment){a+=b(g.containment).scrollLeft()||0;h+=b(g.containment).scrollTop()||0}this.offset= +this.helper.offset();this.position={left:a,top:h};this.size=this._helper?{width:c.outerWidth(),height:c.outerHeight()}:{width:c.width(),height:c.height()};this.originalSize=this._helper?{width:c.outerWidth(),height:c.outerHeight()}:{width:c.width(),height:c.height()};this.originalPosition={left:a,top:h};this.sizeDiff={width:c.outerWidth()-c.width(),height:c.outerHeight()-c.height()};this.originalMousePosition={left:f.pageX,top:f.pageY};this.aspectRatio=typeof g.aspectRatio=="number"?g.aspectRatio: +this.originalSize.width/this.originalSize.height||1;g=b(".ui-resizable-"+this.axis).css("cursor");b("body").css("cursor",g=="auto"?this.axis+"-resize":g);c.addClass("ui-resizable-resizing");this._propagate("start",f);return true},_mouseDrag:function(f){var g=this.helper,a=this.originalMousePosition,c=this._change[this.axis];if(!c)return false;a=c.apply(this,[f,f.pageX-a.left||0,f.pageY-a.top||0]);if(this._aspectRatio||f.shiftKey)a=this._updateRatio(a,f);a=this._respectSize(a,f);this._propagate("resize", +f);g.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(a);this._trigger("resize",f,this.ui());return false},_mouseStop:function(f){this.resizing=false;var g=this.options,a=this;if(this._helper){var c=this._proportionallyResizeElements,h=c.length&&/textarea/i.test(c[0].nodeName);c=h&&b.ui.hasScroll(c[0],"left")?0:a.sizeDiff.height; +h=h?0:a.sizeDiff.width;h={width:a.helper.width()-h,height:a.helper.height()-c};c=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var i=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;g.animate||this.element.css(b.extend(h,{top:i,left:c}));a.helper.height(a.size.height);a.helper.width(a.size.width);this._helper&&!g.animate&&this._proportionallyResize()}b("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing"); +this._propagate("stop",f);this._helper&&this.helper.remove();return false},_updateCache:function(f){this.offset=this.helper.offset();if(e(f.left))this.position.left=f.left;if(e(f.top))this.position.top=f.top;if(e(f.height))this.size.height=f.height;if(e(f.width))this.size.width=f.width},_updateRatio:function(f){var g=this.position,a=this.size,c=this.axis;if(f.height)f.width=a.height*this.aspectRatio;else if(f.width)f.height=a.width/this.aspectRatio;if(c=="sw"){f.left=g.left+(a.width-f.width);f.top= +null}if(c=="nw"){f.top=g.top+(a.height-f.height);f.left=g.left+(a.width-f.width)}return f},_respectSize:function(f){var g=this.options,a=this.axis,c=e(f.width)&&g.maxWidth&&g.maxWidthf.width,j=e(f.height)&&g.minHeight&&g.minHeight>f.height;if(i)f.width=g.minWidth;if(j)f.height=g.minHeight;if(c)f.width=g.maxWidth;if(h)f.height=g.maxHeight;var n=this.originalPosition.left+this.originalSize.width,o=this.position.top+ +this.size.height,l=/sw|nw|w/.test(a);a=/nw|ne|n/.test(a);if(i&&l)f.left=n-g.minWidth;if(c&&l)f.left=n-g.maxWidth;if(j&&a)f.top=o-g.minHeight;if(h&&a)f.top=o-g.maxHeight;if((g=!f.width&&!f.height)&&!f.left&&f.top)f.top=null;else if(g&&!f.top&&f.left)f.left=null;return f},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var f=this.helper||this.element,g=0;g');var g=b.browser.msie&&b.browser.version<7,a=g?1:0;g=g?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+g,height:this.element.outerHeight()+g,position:"absolute",left:this.elementOffset.left-a+"px",top:this.elementOffset.top-a+"px",zIndex:++f.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(f, +g){return{width:this.originalSize.width+g}},w:function(f,g){return{left:this.originalPosition.left+g,width:this.originalSize.width-g}},n:function(f,g,a){return{top:this.originalPosition.top+a,height:this.originalSize.height-a}},s:function(f,g,a){return{height:this.originalSize.height+a}},se:function(f,g,a){return b.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[f,g,a]))},sw:function(f,g,a){return b.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[f,g, +a]))},ne:function(f,g,a){return b.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[f,g,a]))},nw:function(f,g,a){return b.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[f,g,a]))}},_propagate:function(f,g){b.ui.plugin.call(this,f,[g,this.ui()]);f!="resize"&&this._trigger(f,g,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize, +originalPosition:this.originalPosition}}});b.extend(b.ui.resizable,{version:"1.8.12"});b.ui.plugin.add("resizable","alsoResize",{start:function(){var f=b(this).data("resizable").options,g=function(a){b(a).each(function(){var c=b(this);c.data("resizable-alsoresize",{width:parseInt(c.width(),10),height:parseInt(c.height(),10),left:parseInt(c.css("left"),10),top:parseInt(c.css("top"),10),position:c.css("position")})})};if(typeof f.alsoResize=="object"&&!f.alsoResize.parentNode)if(f.alsoResize.length){f.alsoResize= +f.alsoResize[0];g(f.alsoResize)}else b.each(f.alsoResize,function(a){g(a)});else g(f.alsoResize)},resize:function(f,g){var a=b(this).data("resizable");f=a.options;var c=a.originalSize,h=a.originalPosition,i={height:a.size.height-c.height||0,width:a.size.width-c.width||0,top:a.position.top-h.top||0,left:a.position.left-h.left||0},j=function(n,o){b(n).each(function(){var l=b(this),k=b(this).data("resizable-alsoresize"),m={},p=o&&o.length?o:l.parents(g.originalElement[0]).length?["width","height"]:["width", +"height","top","left"];b.each(p,function(q,s){if((q=(k[s]||0)+(i[s]||0))&&q>=0)m[s]=q||null});if(b.browser.opera&&/relative/.test(l.css("position"))){a._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(m)})};typeof f.alsoResize=="object"&&!f.alsoResize.nodeType?b.each(f.alsoResize,function(n,o){j(n,o)}):j(f.alsoResize)},stop:function(){var f=b(this).data("resizable"),g=f.options,a=function(c){b(c).each(function(){var h=b(this);h.css({position:h.data("resizable-alsoresize").position})})}; +if(f._revertToRelativePosition){f._revertToRelativePosition=false;typeof g.alsoResize=="object"&&!g.alsoResize.nodeType?b.each(g.alsoResize,function(c){a(c)}):a(g.alsoResize)}b(this).removeData("resizable-alsoresize")}});b.ui.plugin.add("resizable","animate",{stop:function(f){var g=b(this).data("resizable"),a=g.options,c=g._proportionallyResizeElements,h=c.length&&/textarea/i.test(c[0].nodeName),i=h&&b.ui.hasScroll(c[0],"left")?0:g.sizeDiff.height;h={width:g.size.width-(h?0:g.sizeDiff.width),height:g.size.height- +i};i=parseInt(g.element.css("left"),10)+(g.position.left-g.originalPosition.left)||null;var j=parseInt(g.element.css("top"),10)+(g.position.top-g.originalPosition.top)||null;g.element.animate(b.extend(h,j&&i?{top:j,left:i}:{}),{duration:a.animateDuration,easing:a.animateEasing,step:function(){var n={width:parseInt(g.element.css("width"),10),height:parseInt(g.element.css("height"),10),top:parseInt(g.element.css("top"),10),left:parseInt(g.element.css("left"),10)};c&&c.length&&b(c[0]).css({width:n.width, +height:n.height});g._updateCache(n);g._propagate("resize",f)}})}});b.ui.plugin.add("resizable","containment",{start:function(){var f=b(this).data("resizable"),g=f.element,a=f.options.containment;if(g=a instanceof b?a.get(0):/parent/.test(a)?g.parent().get(0):a){f.containerElement=b(g);if(/document/.test(a)||a==document){f.containerOffset={left:0,top:0};f.containerPosition={left:0,top:0};f.parentData={element:b(document),left:0,top:0,width:b(document).width(),height:b(document).height()||document.body.parentNode.scrollHeight}}else{var c= +b(g),h=[];b(["Top","Right","Left","Bottom"]).each(function(n,o){h[n]=d(c.css("padding"+o))});f.containerOffset=c.offset();f.containerPosition=c.position();f.containerSize={height:c.innerHeight()-h[3],width:c.innerWidth()-h[1]};a=f.containerOffset;var i=f.containerSize.height,j=f.containerSize.width;j=b.ui.hasScroll(g,"left")?g.scrollWidth:j;i=b.ui.hasScroll(g)?g.scrollHeight:i;f.parentData={element:g,left:a.left,top:a.top,width:j,height:i}}}},resize:function(f){var g=b(this).data("resizable"),a=g.options, +c=g.containerOffset,h=g.position;f=g._aspectRatio||f.shiftKey;var i={top:0,left:0},j=g.containerElement;if(j[0]!=document&&/static/.test(j.css("position")))i=c;if(h.left<(g._helper?c.left:0)){g.size.width+=g._helper?g.position.left-c.left:g.position.left-i.left;if(f)g.size.height=g.size.width/a.aspectRatio;g.position.left=a.helper?c.left:0}if(h.top<(g._helper?c.top:0)){g.size.height+=g._helper?g.position.top-c.top:g.position.top;if(f)g.size.width=g.size.height*a.aspectRatio;g.position.top=g._helper? +c.top:0}g.offset.left=g.parentData.left+g.position.left;g.offset.top=g.parentData.top+g.position.top;a=Math.abs((g._helper?g.offset.left-i.left:g.offset.left-i.left)+g.sizeDiff.width);c=Math.abs((g._helper?g.offset.top-i.top:g.offset.top-c.top)+g.sizeDiff.height);h=g.containerElement.get(0)==g.element.parent().get(0);i=/relative|absolute/.test(g.containerElement.css("position"));if(h&&i)a-=g.parentData.left;if(a+g.size.width>=g.parentData.width){g.size.width=g.parentData.width-a;if(f)g.size.height= +g.size.width/g.aspectRatio}if(c+g.size.height>=g.parentData.height){g.size.height=g.parentData.height-c;if(f)g.size.width=g.size.height*g.aspectRatio}},stop:function(){var f=b(this).data("resizable"),g=f.options,a=f.containerOffset,c=f.containerPosition,h=f.containerElement,i=b(f.helper),j=i.offset(),n=i.outerWidth()-f.sizeDiff.width;i=i.outerHeight()-f.sizeDiff.height;f._helper&&!g.animate&&/relative/.test(h.css("position"))&&b(this).css({left:j.left-c.left-a.left,width:n,height:i});f._helper&&!g.animate&& +/static/.test(h.css("position"))&&b(this).css({left:j.left-c.left-a.left,width:n,height:i})}});b.ui.plugin.add("resizable","ghost",{start:function(){var f=b(this).data("resizable"),g=f.options,a=f.size;f.ghost=f.originalElement.clone();f.ghost.css({opacity:0.25,display:"block",position:"relative",height:a.height,width:a.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof g.ghost=="string"?g.ghost:"");f.ghost.appendTo(f.helper)},resize:function(){var f=b(this).data("resizable"); +f.ghost&&f.ghost.css({position:"relative",height:f.size.height,width:f.size.width})},stop:function(){var f=b(this).data("resizable");f.ghost&&f.helper&&f.helper.get(0).removeChild(f.ghost.get(0))}});b.ui.plugin.add("resizable","grid",{resize:function(){var f=b(this).data("resizable"),g=f.options,a=f.size,c=f.originalSize,h=f.originalPosition,i=f.axis;g.grid=typeof g.grid=="number"?[g.grid,g.grid]:g.grid;var j=Math.round((a.width-c.width)/(g.grid[0]||1))*(g.grid[0]||1);g=Math.round((a.height-c.height)/ +(g.grid[1]||1))*(g.grid[1]||1);if(/^(se|s|e)$/.test(i)){f.size.width=c.width+j;f.size.height=c.height+g}else if(/^(ne)$/.test(i)){f.size.width=c.width+j;f.size.height=c.height+g;f.position.top=h.top-g}else{if(/^(sw)$/.test(i)){f.size.width=c.width+j;f.size.height=c.height+g}else{f.size.width=c.width+j;f.size.height=c.height+g;f.position.top=h.top-g}f.position.left=h.left-j}}});var d=function(f){return parseInt(f,10)||0},e=function(f){return!isNaN(parseInt(f,10))}})(jQuery); +(function(b){b.widget("ui.selectable",b.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var d=this;this.element.addClass("ui-selectable");this.dragged=false;var e;this.refresh=function(){e=b(d.options.filter,d.element[0]);e.each(function(){var f=b(this),g=f.offset();b.data(this,"selectable-item",{element:this,$element:f,left:g.left,top:g.top,right:g.left+f.outerWidth(),bottom:g.top+f.outerHeight(),startselected:false,selected:f.hasClass("ui-selected"), +selecting:f.hasClass("ui-selecting"),unselecting:f.hasClass("ui-unselecting")})})};this.refresh();this.selectees=e.addClass("ui-selectee");this._mouseInit();this.helper=b("
      ")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(d){var e=this;this.opos=[d.pageX, +d.pageY];if(!this.options.disabled){var f=this.options;this.selectees=b(f.filter,this.element[0]);this._trigger("start",d);b(f.appendTo).append(this.helper);this.helper.css({left:d.clientX,top:d.clientY,width:0,height:0});f.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var g=b.data(this,"selectable-item");g.startselected=true;if(!d.metaKey){g.$element.removeClass("ui-selected");g.selected=false;g.$element.addClass("ui-unselecting");g.unselecting=true;e._trigger("unselecting", +d,{unselecting:g.element})}});b(d.target).parents().andSelf().each(function(){var g=b.data(this,"selectable-item");if(g){var a=!d.metaKey||!g.$element.hasClass("ui-selected");g.$element.removeClass(a?"ui-unselecting":"ui-selected").addClass(a?"ui-selecting":"ui-unselecting");g.unselecting=!a;g.selecting=a;(g.selected=a)?e._trigger("selecting",d,{selecting:g.element}):e._trigger("unselecting",d,{unselecting:g.element});return false}})}},_mouseDrag:function(d){var e=this;this.dragged=true;if(!this.options.disabled){var f= +this.options,g=this.opos[0],a=this.opos[1],c=d.pageX,h=d.pageY;if(g>c){var i=c;c=g;g=i}if(a>h){i=h;h=a;a=i}this.helper.css({left:g,top:a,width:c-g,height:h-a});this.selectees.each(function(){var j=b.data(this,"selectable-item");if(!(!j||j.element==e.element[0])){var n=false;if(f.tolerance=="touch")n=!(j.left>c||j.righth||j.bottomg&&j.righta&&j.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var d=this.items.length-1;d>=0;d--)this.items[d].item.removeData("sortable-item");return this},_setOption:function(d,e){if(d==="disabled"){this.options[d]= +e;this.widget()[e?"addClass":"removeClass"]("ui-sortable-disabled")}else b.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(d,e){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(d);var f=null,g=this;b(d.target).parents().each(function(){if(b.data(this,"sortable-item")==g){f=b(this);return false}});if(b.data(d.target,"sortable-item")==g)f=b(d.target);if(!f)return false;if(this.options.handle&&!e){var a=false; +b(this.options.handle,f).find("*").andSelf().each(function(){if(this==d.target)a=true});if(!a)return false}this.currentItem=f;this._removeCurrentsFromItems();return true},_mouseStart:function(d,e,f){e=this.options;var g=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(d);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left- +this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");b.extend(this.offset,{click:{left:d.pageX-this.offset.left,top:d.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(d);this.originalPageX=d.pageX;this.originalPageY=d.pageY;e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();e.containment&&this._setContainment();if(e.cursor){if(b("body").css("cursor"))this._storedCursor=b("body").css("cursor");b("body").css("cursor",e.cursor)}if(e.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",e.opacity)}if(e.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",e.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",d,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!f)for(f=this.containers.length-1;f>=0;f--)this.containers[f]._trigger("activate",d,g._uiHash(this));if(b.ui.ddmanager)b.ui.ddmanager.current=this;b.ui.ddmanager&&!e.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,d);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(d); +return true},_mouseDrag:function(d){this.position=this._generatePosition(d);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var e=this.options,f=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-d.pageY=0;e--){f=this.items[e];var g=f.item[0],a=this._intersectsWithPointer(f);if(a)if(g!=this.currentItem[0]&&this.placeholder[a==1?"next":"prev"]()[0]!=g&&!b.ui.contains(this.placeholder[0],g)&&(this.options.type=="semi-dynamic"?!b.ui.contains(this.element[0], +g):true)){this.direction=a==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f))this._rearrange(d,f);else break;this._trigger("change",d,this._uiHash());break}}this._contactContainers(d);b.ui.ddmanager&&b.ui.ddmanager.drag(this,d);this._trigger("sort",d,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(d,e){if(d){b.ui.ddmanager&&!this.options.dropBehaviour&&b.ui.ddmanager.drop(this,d);if(this.options.revert){var f=this;e=f.placeholder.offset(); +f.reverting=true;b(this.helper).animate({left:e.left-this.offset.parent.left-f.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-f.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){f._clear(d)})}else this._clear(d,e);return false}},cancel:function(){var d=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var e=this.containers.length-1;e>=0;e--){this.containers[e]._trigger("deactivate",null,d._uiHash(this));if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",null,d._uiHash(this));this.containers[e].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();b.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?b(this.domPosition.prev).after(this.currentItem):b(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(d){var e=this._getItemsAsjQuery(d&&d.connected),f=[];d=d||{};b(e).each(function(){var g=(b(d.item||this).attr(d.attribute||"id")||"").match(d.expression||/(.+)[-=_](.+)/);if(g)f.push((d.key||g[1]+"[]")+"="+(d.key&&d.expression?g[1]:g[2]))});!f.length&&d.key&&f.push(d.key+"=");return f.join("&")}, +toArray:function(d){var e=this._getItemsAsjQuery(d&&d.connected),f=[];d=d||{};e.each(function(){f.push(b(d.item||this).attr(d.attribute||"id")||"")});return f},_intersectsWith:function(d){var e=this.positionAbs.left,f=e+this.helperProportions.width,g=this.positionAbs.top,a=g+this.helperProportions.height,c=d.left,h=c+d.width,i=d.top,j=i+d.height,n=this.offset.click.top,o=this.offset.click.left;n=g+n>i&&g+nc&&e+od[this.floating?"width":"height"]?n:c0?"down":"up")},_getDragHorizontalDirection:function(){var d=this.positionAbs.left-this.lastPositionAbs.left;return d!=0&&(d>0?"right":"left")},refresh:function(d){this._refreshItems(d);this.refreshPositions();return this},_connectWith:function(){var d=this.options;return d.connectWith.constructor==String?[d.connectWith]:d.connectWith},_getItemsAsjQuery:function(d){var e=[],f=[],g=this._connectWith(); +if(g&&d)for(d=g.length-1;d>=0;d--)for(var a=b(g[d]),c=a.length-1;c>=0;c--){var h=b.data(a[c],"sortable");if(h&&h!=this&&!h.options.disabled)f.push([b.isFunction(h.options.items)?h.options.items.call(h.element):b(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}f.push([b.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):b(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(d=f.length-1;d>=0;d--)f[d][0].each(function(){e.push(this)});return b(e)},_removeCurrentsFromItems:function(){for(var d=this.currentItem.find(":data(sortable-item)"),e=0;e=0;a--)for(var c=b(g[a]),h=c.length-1;h>=0;h--){var i=b.data(c[h],"sortable");if(i&&i!=this&&!i.options.disabled){f.push([b.isFunction(i.options.items)?i.options.items.call(i.element[0],d,{item:this.currentItem}):b(i.options.items,i.element),i]);this.containers.push(i)}}for(a=f.length-1;a>=0;a--){d=f[a][1];g=f[a][0];h=0;for(c=g.length;h=0;e--){var f=this.items[e];if(!(f.instance!=this.currentContainer&&this.currentContainer&&f.item[0]!=this.currentItem[0])){var g=this.options.toleranceElement?b(this.options.toleranceElement,f.item):f.item;if(!d){f.width=g.outerWidth();f.height=g.outerHeight()}g=g.offset();f.left=g.left;f.top=g.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(e= +this.containers.length-1;e>=0;e--){g=this.containers[e].element.offset();this.containers[e].containerCache.left=g.left;this.containers[e].containerCache.top=g.top;this.containers[e].containerCache.width=this.containers[e].element.outerWidth();this.containers[e].containerCache.height=this.containers[e].element.outerHeight()}return this},_createPlaceholder:function(d){var e=d||this,f=e.options;if(!f.placeholder||f.placeholder.constructor==String){var g=f.placeholder;f.placeholder={element:function(){var a= +b(document.createElement(e.currentItem[0].nodeName)).addClass(g||e.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!g)a.style.visibility="hidden";return a},update:function(a,c){if(!(g&&!f.forcePlaceholderSize)){c.height()||c.height(e.currentItem.innerHeight()-parseInt(e.currentItem.css("paddingTop")||0,10)-parseInt(e.currentItem.css("paddingBottom")||0,10));c.width()||c.width(e.currentItem.innerWidth()-parseInt(e.currentItem.css("paddingLeft")||0,10)-parseInt(e.currentItem.css("paddingRight")|| +0,10))}}}}e.placeholder=b(f.placeholder.element.call(e.element,e.currentItem));e.currentItem.after(e.placeholder);f.placeholder.update(e,e.placeholder)},_contactContainers:function(d){for(var e=null,f=null,g=this.containers.length-1;g>=0;g--)if(!b.ui.contains(this.currentItem[0],this.containers[g].element[0]))if(this._intersectsWith(this.containers[g].containerCache)){if(!(e&&b.ui.contains(this.containers[g].element[0],e.element[0]))){e=this.containers[g];f=g}}else if(this.containers[g].containerCache.over){this.containers[g]._trigger("out", +d,this._uiHash(this));this.containers[g].containerCache.over=0}if(e)if(this.containers.length===1){this.containers[f]._trigger("over",d,this._uiHash(this));this.containers[f].containerCache.over=1}else if(this.currentContainer!=this.containers[f]){e=1E4;g=null;for(var a=this.positionAbs[this.containers[f].floating?"left":"top"],c=this.items.length-1;c>=0;c--)if(b.ui.contains(this.containers[f].element[0],this.items[c].item[0])){var h=this.items[c][this.containers[f].floating?"left":"top"];if(Math.abs(h- +a)this.containment[2])a=this.containment[2]+this.offset.click.left;if(d.pageY-this.offset.click.top>this.containment[3])c=this.containment[3]+this.offset.click.top}if(e.grid){c=this.originalPageY+Math.round((c- +this.originalPageY)/e.grid[1])*e.grid[1];c=this.containment?!(c-this.offset.click.topthis.containment[3])?c:!(c-this.offset.click.topthis.containment[2])?a:!(a-this.offset.click.left=0;g--)if(b.ui.contains(this.containers[g].element[0],this.currentItem[0])&&!e){f.push(function(a){return function(c){a._trigger("receive",c,this._uiHash(this))}}.call(this,this.containers[g]));f.push(function(a){return function(c){a._trigger("update",c,this._uiHash(this))}}.call(this,this.containers[g]))}}for(g=this.containers.length-1;g>=0;g--){e||f.push(function(a){return function(c){a._trigger("deactivate",c,this._uiHash(this))}}.call(this, +this.containers[g]));if(this.containers[g].containerCache.over){f.push(function(a){return function(c){a._trigger("out",c,this._uiHash(this))}}.call(this,this.containers[g]));this.containers[g].containerCache.over=0}}this._storedCursor&&b("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!e){this._trigger("beforeStop", +d,this._uiHash());for(g=0;g").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent", +border:"none",margin:0,padding:0});l.wrap(m);m=l.parent();if(l.css("position")=="static"){m.css({position:"relative"});l.css({position:"relative"})}else{b.extend(k,{position:l.css("position"),zIndex:l.css("z-index")});b.each(["top","left","bottom","right"],function(p,q){k[q]=l.css(q);if(isNaN(parseInt(k[q],10)))k[q]="auto"});l.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return m.css(k).show()},removeWrapper:function(l){if(l.parent().is(".ui-effects-wrapper"))return l.parent().replaceWith(l); +return l},setTransition:function(l,k,m,p){p=p||{};b.each(k,function(q,s){unit=l.cssUnit(s);if(unit[0]>0)p[s]=unit[0]*m+unit[1]});return p}});b.fn.extend({effect:function(l){var k=h.apply(this,arguments),m={options:k[1],duration:k[2],callback:k[3]};k=m.options.mode;var p=b.effects[l];if(b.fx.off||!p)return k?this[k](m.duration,m.callback):this.each(function(){m.callback&&m.callback.call(this)});return p.call(this,m)},_show:b.fn.show,show:function(l){if(i(l))return this._show.apply(this,arguments); +else{var k=h.apply(this,arguments);k[1].mode="show";return this.effect.apply(this,k)}},_hide:b.fn.hide,hide:function(l){if(i(l))return this._hide.apply(this,arguments);else{var k=h.apply(this,arguments);k[1].mode="hide";return this.effect.apply(this,k)}},__toggle:b.fn.toggle,toggle:function(l){if(i(l)||typeof l==="boolean"||b.isFunction(l))return this.__toggle.apply(this,arguments);else{var k=h.apply(this,arguments);k[1].mode="toggle";return this.effect.apply(this,k)}},cssUnit:function(l){var k=this.css(l), +m=[];b.each(["em","px","%","pt"],function(p,q){if(k.indexOf(q)>0)m=[parseFloat(k),q]});return m}});b.easing.jswing=b.easing.swing;b.extend(b.easing,{def:"easeOutQuad",swing:function(l,k,m,p,q){return b.easing[b.easing.def](l,k,m,p,q)},easeInQuad:function(l,k,m,p,q){return p*(k/=q)*k+m},easeOutQuad:function(l,k,m,p,q){return-p*(k/=q)*(k-2)+m},easeInOutQuad:function(l,k,m,p,q){if((k/=q/2)<1)return p/2*k*k+m;return-p/2*(--k*(k-2)-1)+m},easeInCubic:function(l,k,m,p,q){return p*(k/=q)*k*k+m},easeOutCubic:function(l, +k,m,p,q){return p*((k=k/q-1)*k*k+1)+m},easeInOutCubic:function(l,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k+m;return p/2*((k-=2)*k*k+2)+m},easeInQuart:function(l,k,m,p,q){return p*(k/=q)*k*k*k+m},easeOutQuart:function(l,k,m,p,q){return-p*((k=k/q-1)*k*k*k-1)+m},easeInOutQuart:function(l,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k*k+m;return-p/2*((k-=2)*k*k*k-2)+m},easeInQuint:function(l,k,m,p,q){return p*(k/=q)*k*k*k*k+m},easeOutQuint:function(l,k,m,p,q){return p*((k=k/q-1)*k*k*k*k+1)+m},easeInOutQuint:function(l, +k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k*k*k+m;return p/2*((k-=2)*k*k*k*k+2)+m},easeInSine:function(l,k,m,p,q){return-p*Math.cos(k/q*(Math.PI/2))+p+m},easeOutSine:function(l,k,m,p,q){return p*Math.sin(k/q*(Math.PI/2))+m},easeInOutSine:function(l,k,m,p,q){return-p/2*(Math.cos(Math.PI*k/q)-1)+m},easeInExpo:function(l,k,m,p,q){return k==0?m:p*Math.pow(2,10*(k/q-1))+m},easeOutExpo:function(l,k,m,p,q){return k==q?m+p:p*(-Math.pow(2,-10*k/q)+1)+m},easeInOutExpo:function(l,k,m,p,q){if(k==0)return m;if(k== +q)return m+p;if((k/=q/2)<1)return p/2*Math.pow(2,10*(k-1))+m;return p/2*(-Math.pow(2,-10*--k)+2)+m},easeInCirc:function(l,k,m,p,q){return-p*(Math.sqrt(1-(k/=q)*k)-1)+m},easeOutCirc:function(l,k,m,p,q){return p*Math.sqrt(1-(k=k/q-1)*k)+m},easeInOutCirc:function(l,k,m,p,q){if((k/=q/2)<1)return-p/2*(Math.sqrt(1-k*k)-1)+m;return p/2*(Math.sqrt(1-(k-=2)*k)+1)+m},easeInElastic:function(l,k,m,p,q){l=1.70158;var s=0,r=p;if(k==0)return m;if((k/=q)==1)return m+p;s||(s=q*0.3);if(r").css({position:"absolute",visibility:"visible",left:-j*(c/f),top:-i*(h/e)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:c/f,height:h/e,left:a.left+j*(c/f)+(d.options.mode=="show"?(j-Math.floor(f/2))*(c/f):0),top:a.top+i*(h/e)+(d.options.mode=="show"?(i-Math.floor(e/2))*(h/e):0),opacity:d.options.mode=="show"?0:1}).animate({left:a.left+j*(c/f)+(d.options.mode=="show"?0:(j-Math.floor(f/2))*(c/f)),top:a.top+ +i*(h/e)+(d.options.mode=="show"?0:(i-Math.floor(e/2))*(h/e)),opacity:d.options.mode=="show"?1:0},d.duration||500);setTimeout(function(){d.options.mode=="show"?g.css({visibility:"visible"}):g.css({visibility:"visible"}).hide();d.callback&&d.callback.apply(g[0]);g.dequeue();b("div.ui-effects-explode").remove()},d.duration||500)})}})(jQuery); +(function(b){b.effects.fade=function(d){return this.queue(function(){var e=b(this),f=b.effects.setMode(e,d.options.mode||"hide");e.animate({opacity:f},{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){d.callback&&d.callback.apply(this,arguments);e.dequeue()}})})}})(jQuery); +(function(b){b.effects.fold=function(d){return this.queue(function(){var e=b(this),f=["position","top","bottom","left","right"],g=b.effects.setMode(e,d.options.mode||"hide"),a=d.options.size||15,c=!!d.options.horizFirst,h=d.duration?d.duration/2:b.fx.speeds._default/2;b.effects.save(e,f);e.show();var i=b.effects.createWrapper(e).css({overflow:"hidden"}),j=g=="show"!=c,n=j?["width","height"]:["height","width"];j=j?[i.width(),i.height()]:[i.height(),i.width()];var o=/([0-9]+)%/.exec(a);if(o)a=parseInt(o[1], +10)/100*j[g=="hide"?0:1];if(g=="show")i.css(c?{height:0,width:a}:{height:a,width:0});c={};o={};c[n[0]]=g=="show"?j[0]:a;o[n[1]]=g=="show"?j[1]:0;i.animate(c,h,d.options.easing).animate(o,h,d.options.easing,function(){g=="hide"&&e.hide();b.effects.restore(e,f);b.effects.removeWrapper(e);d.callback&&d.callback.apply(e[0],arguments);e.dequeue()})})}})(jQuery); +(function(b){b.effects.highlight=function(d){return this.queue(function(){var e=b(this),f=["backgroundImage","backgroundColor","opacity"],g=b.effects.setMode(e,d.options.mode||"show"),a={backgroundColor:e.css("backgroundColor")};if(g=="hide")a.opacity=0;b.effects.save(e,f);e.show().css({backgroundImage:"none",backgroundColor:d.options.color||"#ffff99"}).animate(a,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){g=="hide"&&e.hide();b.effects.restore(e,f);g=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");d.callback&&d.callback.apply(this,arguments);e.dequeue()}})})}})(jQuery); +(function(b){b.effects.pulsate=function(d){return this.queue(function(){var e=b(this),f=b.effects.setMode(e,d.options.mode||"show");times=(d.options.times||5)*2-1;duration=d.duration?d.duration/2:b.fx.speeds._default/2;isVisible=e.is(":visible");animateTo=0;if(!isVisible){e.css("opacity",0).show();animateTo=1}if(f=="hide"&&isVisible||f=="show"&&!isVisible)times--;for(f=0;f').appendTo(document.body).addClass(d.options.className).css({top:g.top,left:g.left,height:e.innerHeight(),width:e.innerWidth(),position:"absolute"}).animate(f,d.duration,d.options.easing,function(){a.remove();d.callback&&d.callback.apply(e[0],arguments); +e.dequeue()})})}})(jQuery); +(function(b){b.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var d=this,e=d.options;d.running=0;d.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");d.headers= +d.element.find(e.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){e.disabled||b(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){e.disabled||b(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){e.disabled||b(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){e.disabled||b(this).removeClass("ui-state-focus")});d.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(e.navigation){var f=d.element.find("a").filter(e.navigationFilter).eq(0);if(f.length){var g=f.closest(".ui-accordion-header");d.active=g.length?g:f.closest(".ui-accordion-content").prev()}}d.active=d._findActive(d.active||e.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");d.active.next().addClass("ui-accordion-content-active");d._createIcons();d.resize();d.element.attr("role","tablist");d.headers.attr("role","tab").bind("keydown.accordion", +function(a){return d._keydown(a)}).next().attr("role","tabpanel");d.headers.not(d.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();d.active.length?d.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):d.headers.eq(0).attr("tabIndex",0);b.browser.safari||d.headers.find("a").attr("tabIndex",-1);e.event&&d.headers.bind(e.event.split(" ").join(".accordion ")+".accordion",function(a){d._clickHandler.call(d,a,this);a.preventDefault()})},_createIcons:function(){var d= +this.options;if(d.icons){b("").addClass("ui-icon "+d.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(d.icons.header).toggleClass(d.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var d=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var e=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(d.autoHeight||d.fillHeight)e.css("height","");return b.Widget.prototype.destroy.call(this)},_setOption:function(d,e){b.Widget.prototype._setOption.apply(this,arguments);d=="active"&&this.activate(e);if(d=="icons"){this._destroyIcons(); +e&&this._createIcons()}if(d=="disabled")this.headers.add(this.headers.next())[e?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(d){if(!(this.options.disabled||d.altKey||d.ctrlKey)){var e=b.ui.keyCode,f=this.headers.length,g=this.headers.index(d.target),a=false;switch(d.keyCode){case e.RIGHT:case e.DOWN:a=this.headers[(g+1)%f];break;case e.LEFT:case e.UP:a=this.headers[(g-1+f)%f];break;case e.SPACE:case e.ENTER:this._clickHandler({target:d.target},d.target); +d.preventDefault()}if(a){b(d.target).attr("tabIndex",-1);b(a).attr("tabIndex",0);a.focus();return false}return true}},resize:function(){var d=this.options,e;if(d.fillSpace){if(b.browser.msie){var f=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}e=this.element.parent().height();b.browser.msie&&this.element.parent().css("overflow",f);this.headers.each(function(){e-=b(this).outerHeight(true)});this.headers.next().each(function(){b(this).height(Math.max(0,e-b(this).innerHeight()+ +b(this).height()))}).css("overflow","auto")}else if(d.autoHeight){e=0;this.headers.next().each(function(){e=Math.max(e,b(this).height("").height())}).height(e)}return this},activate:function(d){this.options.active=d;d=this._findActive(d)[0];this._clickHandler({target:d},d);return this},_findActive:function(d){return d?typeof d==="number"?this.headers.filter(":eq("+d+")"):this.headers.not(this.headers.not(d)):d===false?b([]):this.headers.filter(":eq(0)")},_clickHandler:function(d,e){var f=this.options; +if(!f.disabled)if(d.target){d=b(d.currentTarget||e);e=d[0]===this.active[0];f.active=f.collapsible&&e?false:this.headers.index(d);if(!(this.running||!f.collapsible&&e)){var g=this.active;i=d.next();c=this.active.next();h={options:f,newHeader:e&&f.collapsible?b([]):d,oldHeader:this.active,newContent:e&&f.collapsible?b([]):i,oldContent:c};var a=this.headers.index(this.active[0])>this.headers.index(d[0]);this.active=e?b([]):d;this._toggle(i,c,h,e,a);g.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(f.icons.headerSelected).addClass(f.icons.header); +if(!e){d.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(f.icons.header).addClass(f.icons.headerSelected);d.next().addClass("ui-accordion-content-active")}}}else if(f.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(f.icons.headerSelected).addClass(f.icons.header);this.active.next().addClass("ui-accordion-content-active");var c=this.active.next(), +h={options:f,newHeader:b([]),oldHeader:f.active,newContent:b([]),oldContent:c},i=this.active=b([]);this._toggle(i,c,h)}},_toggle:function(d,e,f,g,a){var c=this,h=c.options;c.toShow=d;c.toHide=e;c.data=f;var i=function(){if(c)return c._completed.apply(c,arguments)};c._trigger("changestart",null,c.data);c.running=e.size()===0?d.size():e.size();if(h.animated){f={};f=h.collapsible&&g?{toShow:b([]),toHide:e,complete:i,down:a,autoHeight:h.autoHeight||h.fillSpace}:{toShow:d,toHide:e,complete:i,down:a,autoHeight:h.autoHeight|| +h.fillSpace};if(!h.proxied)h.proxied=h.animated;if(!h.proxiedDuration)h.proxiedDuration=h.duration;h.animated=b.isFunction(h.proxied)?h.proxied(f):h.proxied;h.duration=b.isFunction(h.proxiedDuration)?h.proxiedDuration(f):h.proxiedDuration;g=b.ui.accordion.animations;var j=h.duration,n=h.animated;if(n&&!g[n]&&!b.easing[n])n="slide";g[n]||(g[n]=function(o){this.slide(o,{easing:n,duration:j||700})});g[n](f)}else{if(h.collapsible&&g)d.toggle();else{e.hide();d.show()}i(true)}e.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();d.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(d){this.running=d?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});b.extend(b.ui.accordion,{version:"1.8.12", +animations:{slide:function(d,e){d=b.extend({easing:"swing",duration:300},d,e);if(d.toHide.size())if(d.toShow.size()){var f=d.toShow.css("overflow"),g=0,a={},c={},h;e=d.toShow;h=e[0].style.width;e.width(parseInt(e.parent().width(),10)-parseInt(e.css("paddingLeft"),10)-parseInt(e.css("paddingRight"),10)-(parseInt(e.css("borderLeftWidth"),10)||0)-(parseInt(e.css("borderRightWidth"),10)||0));b.each(["height","paddingTop","paddingBottom"],function(i,j){c[j]="hide";i=(""+b.css(d.toShow[0],j)).match(/^([\d+-.]+)(.*)$/); +a[j]={value:i[1],unit:i[2]||"px"}});d.toShow.css({height:0,overflow:"hidden"}).show();d.toHide.filter(":hidden").each(d.complete).end().filter(":visible").animate(c,{step:function(i,j){if(j.prop=="height")g=j.end-j.start===0?0:(j.now-j.start)/(j.end-j.start);d.toShow[0].style[j.prop]=g*a[j.prop].value+a[j.prop].unit},duration:d.duration,easing:d.easing,complete:function(){d.autoHeight||d.toShow.css("height","");d.toShow.css({width:h,overflow:f});d.complete()}})}else d.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},d);else d.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},d)},bounceslide:function(d){this.slide(d,{easing:d.down?"easeOutBounce":"swing",duration:d.down?1E3:200})}}})})(jQuery); +(function(b){var d=0;b.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var e=this,f=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(a){if(!(e.options.disabled||e.element.attr("readonly"))){g= +false;var c=b.ui.keyCode;switch(a.keyCode){case c.PAGE_UP:e._move("previousPage",a);break;case c.PAGE_DOWN:e._move("nextPage",a);break;case c.UP:e._move("previous",a);a.preventDefault();break;case c.DOWN:e._move("next",a);a.preventDefault();break;case c.ENTER:case c.NUMPAD_ENTER:if(e.menu.active){g=true;a.preventDefault()}case c.TAB:if(!e.menu.active)return;e.menu.select(a);break;case c.ESCAPE:e.element.val(e.term);e.close(a);break;default:clearTimeout(e.searching);e.searching=setTimeout(function(){if(e.term!= +e.element.val()){e.selectedItem=null;e.search(null,a)}},e.options.delay);break}}}).bind("keypress.autocomplete",function(a){if(g){g=false;a.preventDefault()}}).bind("focus.autocomplete",function(){if(!e.options.disabled){e.selectedItem=null;e.previous=e.element.val()}}).bind("blur.autocomplete",function(a){if(!e.options.disabled){clearTimeout(e.searching);e.closing=setTimeout(function(){e.close(a);e._change(a)},150)}});this._initSource();this.response=function(){return e._response.apply(e,arguments)}; +this.menu=b("
        ").addClass("ui-autocomplete").appendTo(b(this.options.appendTo||"body",f)[0]).mousedown(function(a){var c=e.menu.element[0];b(a.target).closest(".ui-menu-item").length||setTimeout(function(){b(document).one("mousedown",function(h){h.target!==e.element[0]&&h.target!==c&&!b.ui.contains(c,h.target)&&e.close()})},1);setTimeout(function(){clearTimeout(e.closing)},13)}).menu({focus:function(a,c){c=c.item.data("item.autocomplete");false!==e._trigger("focus",a,{item:c})&&/^key/.test(a.originalEvent.type)&& +e.element.val(c.value)},selected:function(a,c){var h=c.item.data("item.autocomplete"),i=e.previous;if(e.element[0]!==f.activeElement){e.element.focus();e.previous=i;setTimeout(function(){e.previous=i;e.selectedItem=h},1)}false!==e._trigger("select",a,{item:h})&&e.element.val(h.value);e.term=e.element.val();e.close(a);e.selectedItem=h},blur:function(){e.menu.element.is(":visible")&&e.element.val()!==e.term&&e.element.val(e.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +b.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();b.Widget.prototype.destroy.call(this)},_setOption:function(e,f){b.Widget.prototype._setOption.apply(this,arguments);e==="source"&&this._initSource();if(e==="appendTo")this.menu.element.appendTo(b(f||"body",this.element[0].ownerDocument)[0]);e==="disabled"&& +f&&this.xhr&&this.xhr.abort()},_initSource:function(){var e=this,f,g;if(b.isArray(this.options.source)){f=this.options.source;this.source=function(a,c){c(b.ui.autocomplete.filter(f,a.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(a,c){e.xhr&&e.xhr.abort();e.xhr=b.ajax({url:g,data:a,dataType:"json",autocompleteRequest:++d,success:function(h){this.autocompleteRequest===d&&c(h)},error:function(){this.autocompleteRequest===d&&c([])}})}}else this.source= +this.options.source},search:function(e,f){e=e!=null?e:this.element.val();this.term=this.element.val();if(e.length
        • ").data("item.autocomplete",f).append(b("").text(f.label)).appendTo(e)},_move:function(e,f){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(e)||this.menu.last()&&/^next/.test(e)){this.element.val(this.term);this.menu.deactivate()}else this.menu[e](f);else this.search(null,f)},widget:function(){return this.menu.element}});b.extend(b.ui.autocomplete,{escapeRegex:function(e){return e.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(e,f){var g=new RegExp(b.ui.autocomplete.escapeRegex(f),"i");return b.grep(e,function(a){return g.test(a.label||a.value||a)})}})})(jQuery); +(function(b){b.widget("ui.menu",{_create:function(){var d=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(e){if(b(e.target).closest(".ui-menu-item a").length){e.preventDefault();d.select(e)}});this.refresh()},refresh:function(){var d=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(e){d.activate(e,b(this).parent())}).mouseleave(function(){d.deactivate()})},activate:function(d,e){this.deactivate();if(this.hasScroll()){var f=e.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),a=this.element.height();if(f<0)this.element.attr("scrollTop",g+f);else f>=a&&this.element.attr("scrollTop",g+f-a+e.height())}this.active=e.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",d,{item:e})}, +deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(d){this.move("next",".ui-menu-item:first",d)},previous:function(d){this.move("prev",".ui-menu-item:last",d)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(d,e,f){if(this.active){d=this.active[d+"All"](".ui-menu-item").eq(0); +d.length?this.activate(f,d):this.activate(f,this.element.children(e))}else this.activate(f,this.element.children(e))},nextPage:function(d){if(this.hasScroll())if(!this.active||this.last())this.activate(d,this.element.children(".ui-menu-item:first"));else{var e=this.active.offset().top,f=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var a=b(this).offset().top-e-f+b(this).height();return a<10&&a>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(d, +g)}else this.activate(d,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(d){if(this.hasScroll())if(!this.active||this.first())this.activate(d,this.element.children(".ui-menu-item:last"));else{var e=this.active.offset().top,f=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=b(this).offset().top-e+f-b(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first")); +this.activate(d,result)}else this.activate(d,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(g.empty()).text(),c=this.options.icons,h=c.primary&&c.secondary,i=[];if(c.primary||c.secondary){if(this.options.text)i.push("ui-button-text-icon"+(h?"s":c.primary?"-primary":"-secondary"));c.primary&&g.prepend("");c.secondary&&g.append("");if(!this.options.text){i.push(h?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||g.attr("title",a)}}else i.push("ui-button-text-only");g.addClass(i.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(g,a){g==="disabled"&&this.buttons.button("option",g,a);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()}, +destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");b.Widget.prototype.destroy.call(this)}})})(jQuery); +(function(b,d){function e(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= +"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", +"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", +minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};b.extend(this._defaults,this.regional[""]);this.dpDiv=b('
        ')}function f(a,c){b.extend(a,c);for(var h in c)if(c[h]== +null||c[h]==d)a[h]=c[h];return a}b.extend(b.ui,{datepicker:{version:"1.8.12"}});var g=(new Date).getTime();b.extend(e.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){f(this._defaults,a||{});return this},_attachDatepicker:function(a,c){var h=null;for(var i in this._defaults){var j=a.getAttribute("date:"+i);if(j){h=h||{};try{h[i]=eval(j)}catch(n){h[i]=j}}}i=a.nodeName.toLowerCase(); +j=i=="div"||i=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var o=this._newInst(b(a),j);o.settings=b.extend({},c||{},h||{});if(i=="input")this._connectDatepicker(a,o);else j&&this._inlineDatepicker(a,o)},_newInst:function(a,c){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:c,dpDiv:!c?this.dpDiv:b('
        ')}}, +_connectDatepicker:function(a,c){var h=b(a);c.append=b([]);c.trigger=b([]);if(!h.hasClass(this.markerClassName)){this._attachments(h,c);h.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(i,j,n){c.settings[j]=n}).bind("getData.datepicker",function(i,j){return this._get(c,j)});this._autoSize(c);b.data(a,"datepicker",c)}},_attachments:function(a,c){var h=this._get(c,"appendText"),i=this._get(c,"isRTL");c.append&& +c.append.remove();if(h){c.append=b(''+h+"");a[i?"before":"after"](c.append)}a.unbind("focus",this._showDatepicker);c.trigger&&c.trigger.remove();h=this._get(c,"showOn");if(h=="focus"||h=="both")a.focus(this._showDatepicker);if(h=="button"||h=="both"){h=this._get(c,"buttonText");var j=this._get(c,"buttonImage");c.trigger=b(this._get(c,"buttonImageOnly")?b("").addClass(this._triggerClass).attr({src:j,alt:h,title:h}):b('').addClass(this._triggerClass).html(j== +""?h:b("").attr({src:j,alt:h,title:h})));a[i?"before":"after"](c.trigger);c.trigger.click(function(){b.datepicker._datepickerShowing&&b.datepicker._lastInput==a[0]?b.datepicker._hideDatepicker():b.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var c=new Date(2009,11,20),h=this._get(a,"dateFormat");if(h.match(/[DM]/)){var i=function(j){for(var n=0,o=0,l=0;ln){n=j[l].length;o=l}return o};c.setMonth(i(this._get(a, +h.match(/MM/)?"monthNames":"monthNamesShort")));c.setDate(i(this._get(a,h.match(/DD/)?"dayNames":"dayNamesShort"))+20-c.getDay())}a.input.attr("size",this._formatDate(a,c).length)}},_inlineDatepicker:function(a,c){var h=b(a);if(!h.hasClass(this.markerClassName)){h.addClass(this.markerClassName).append(c.dpDiv).bind("setData.datepicker",function(i,j,n){c.settings[j]=n}).bind("getData.datepicker",function(i,j){return this._get(c,j)});b.data(a,"datepicker",c);this._setDate(c,this._getDefaultDate(c), +true);this._updateDatepicker(c);this._updateAlternate(c);c.dpDiv.show()}},_dialogDatepicker:function(a,c,h,i,j){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=b('');this._dialogInput.keydown(this._doKeyDown);b("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};b.data(this._dialogInput[0],"datepicker",a)}f(a.settings,i||{}); +c=c&&c.constructor==Date?this._formatDate(a,c):c;this._dialogInput.val(c);this._pos=j?j.length?j:[j.pageX,j.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=h;this._inDialog=true;this.dpDiv.addClass(this._dialogClass); +this._showDatepicker(this._dialogInput[0]);b.blockUI&&b.blockUI(this.dpDiv);b.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var c=b(a),h=b.data(a,"datepicker");if(c.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();b.removeData(a,"datepicker");if(i=="input"){h.append.remove();h.trigger.remove();c.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup", +this._doKeyUp)}else if(i=="div"||i=="span")c.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var c=b(a),h=b.data(a,"datepicker");if(c.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();if(i=="input"){a.disabled=false;h.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(i=="div"||i=="span")c.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=b.map(this._disabledInputs, +function(j){return j==a?null:j})}},_disableDatepicker:function(a){var c=b(a),h=b.data(a,"datepicker");if(c.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();if(i=="input"){a.disabled=true;h.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(i=="div"||i=="span")c.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=b.map(this._disabledInputs,function(j){return j==a?null: +j});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var c=0;c-1}},_doKeyUp:function(a){a=b.datepicker._getInst(a.target); +if(a.input.val()!=a.lastVal)try{if(b.datepicker.parseDate(b.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,b.datepicker._getFormatConfig(a))){b.datepicker._setDateFromField(a);b.datepicker._updateAlternate(a);b.datepicker._updateDatepicker(a)}}catch(c){b.datepicker.log(c)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=b("input",a.parentNode)[0];if(!(b.datepicker._isDisabledDatepicker(a)||b.datepicker._lastInput==a)){var c=b.datepicker._getInst(a); +b.datepicker._curInst&&b.datepicker._curInst!=c&&b.datepicker._curInst.dpDiv.stop(true,true);var h=b.datepicker._get(c,"beforeShow");f(c.settings,h?h.apply(a,[a,c]):{});c.lastVal=null;b.datepicker._lastInput=a;b.datepicker._setDateFromField(c);if(b.datepicker._inDialog)a.value="";if(!b.datepicker._pos){b.datepicker._pos=b.datepicker._findPos(a);b.datepicker._pos[1]+=a.offsetHeight}var i=false;b(a).parents().each(function(){i|=b(this).css("position")=="fixed";return!i});if(i&&b.browser.opera){b.datepicker._pos[0]-= +document.documentElement.scrollLeft;b.datepicker._pos[1]-=document.documentElement.scrollTop}h={left:b.datepicker._pos[0],top:b.datepicker._pos[1]};b.datepicker._pos=null;c.dpDiv.empty();c.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});b.datepicker._updateDatepicker(c);h=b.datepicker._checkOffset(c,h,i);c.dpDiv.css({position:b.datepicker._inDialog&&b.blockUI?"static":i?"fixed":"absolute",display:"none",left:h.left+"px",top:h.top+"px"});if(!c.inline){h=b.datepicker._get(c,"showAnim"); +var j=b.datepicker._get(c,"duration"),n=function(){b.datepicker._datepickerShowing=true;var o=c.dpDiv.find("iframe.ui-datepicker-cover");if(o.length){var l=b.datepicker._getBorders(c.dpDiv);o.css({left:-l[0],top:-l[1],width:c.dpDiv.outerWidth(),height:c.dpDiv.outerHeight()})}};c.dpDiv.zIndex(b(a).zIndex()+1);b.effects&&b.effects[h]?c.dpDiv.show(h,b.datepicker._get(c,"showOptions"),j,n):c.dpDiv[h||"show"](h?j:null,n);if(!h||!j)n();c.input.is(":visible")&&!c.input.is(":disabled")&&c.input.focus();b.datepicker._curInst= +c}}},_updateDatepicker:function(a){var c=this,h=b.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var i=a.dpDiv.find("iframe.ui-datepicker-cover");i.length&&i.css({left:-h[0],top:-h[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){b(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&b(this).removeClass("ui-datepicker-prev-hover"); +this.className.indexOf("ui-datepicker-next")!=-1&&b(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!c._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){b(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&b(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&b(this).addClass("ui-datepicker-next-hover")}}).end().find("."+ +this._dayOverClass+" a").trigger("mouseover").end();h=this._getNumberOfMonths(a);i=h[1];i>1?a.dpDiv.addClass("ui-datepicker-multi-"+i).css("width",17*i+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(h[0]!=1||h[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==b.datepicker._curInst&&b.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&& +a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var j=a.yearshtml;setTimeout(function(){j===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);j=a.yearshtml=null},0)}},_getBorders:function(a){var c=function(h){return{thin:1,medium:2,thick:3}[h]||h};return[parseFloat(c(a.css("border-left-width"))),parseFloat(c(a.css("border-top-width")))]},_checkOffset:function(a,c,h){var i=a.dpDiv.outerWidth(),j=a.dpDiv.outerHeight(),n=a.input?a.input.outerWidth(): +0,o=a.input?a.input.outerHeight():0,l=document.documentElement.clientWidth+b(document).scrollLeft(),k=document.documentElement.clientHeight+b(document).scrollTop();c.left-=this._get(a,"isRTL")?i-n:0;c.left-=h&&c.left==a.input.offset().left?b(document).scrollLeft():0;c.top-=h&&c.top==a.input.offset().top+o?b(document).scrollTop():0;c.left-=Math.min(c.left,c.left+i>l&&l>i?Math.abs(c.left+i-l):0);c.top-=Math.min(c.top,c.top+j>k&&k>j?Math.abs(j+o):0);return c},_findPos:function(a){for(var c=this._get(this._getInst(a), +"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||b.expr.filters.hidden(a));)a=a[c?"previousSibling":"nextSibling"];a=b(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var c=this._curInst;if(!(!c||a&&c!=b.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(c,"showAnim");var h=this._get(c,"duration"),i=function(){b.datepicker._tidyDialog(c);this._curInst=null};b.effects&&b.effects[a]?c.dpDiv.hide(a,b.datepicker._get(c,"showOptions"),h,i):c.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"? +"fadeOut":"hide"](a?h:null,i);a||i();if(a=this._get(c,"onClose"))a.apply(c.input?c.input[0]:null,[c.input?c.input.val():"",c]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(b.blockUI){b.unblockUI();b("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(b.datepicker._curInst){a= +b(a.target);a[0].id!=b.datepicker._mainDivId&&a.parents("#"+b.datepicker._mainDivId).length==0&&!a.hasClass(b.datepicker.markerClassName)&&!a.hasClass(b.datepicker._triggerClass)&&b.datepicker._datepickerShowing&&!(b.datepicker._inDialog&&b.blockUI)&&b.datepicker._hideDatepicker()}},_adjustDate:function(a,c,h){a=b(a);var i=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(i,c+(h=="M"?this._get(i,"showCurrentAtPos"):0),h);this._updateDatepicker(i)}},_gotoToday:function(a){a= +b(a);var c=this._getInst(a[0]);if(this._get(c,"gotoCurrent")&&c.currentDay){c.selectedDay=c.currentDay;c.drawMonth=c.selectedMonth=c.currentMonth;c.drawYear=c.selectedYear=c.currentYear}else{var h=new Date;c.selectedDay=h.getDate();c.drawMonth=c.selectedMonth=h.getMonth();c.drawYear=c.selectedYear=h.getFullYear()}this._notifyChange(c);this._adjustDate(a)},_selectMonthYear:function(a,c,h){a=b(a);var i=this._getInst(a[0]);i._selectingMonthYear=false;i["selected"+(h=="M"?"Month":"Year")]=i["draw"+(h== +"M"?"Month":"Year")]=parseInt(c.options[c.selectedIndex].value,10);this._notifyChange(i);this._adjustDate(a)},_clickMonthYear:function(a){var c=this._getInst(b(a)[0]);c.input&&c._selectingMonthYear&&setTimeout(function(){c.input.focus()},0);c._selectingMonthYear=!c._selectingMonthYear},_selectDay:function(a,c,h,i){var j=b(a);if(!(b(i).hasClass(this._unselectableClass)||this._isDisabledDatepicker(j[0]))){j=this._getInst(j[0]);j.selectedDay=j.currentDay=b("a",i).html();j.selectedMonth=j.currentMonth= +c;j.selectedYear=j.currentYear=h;this._selectDate(a,this._formatDate(j,j.currentDay,j.currentMonth,j.currentYear))}},_clearDate:function(a){a=b(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,c){a=this._getInst(b(a)[0]);c=c!=null?c:this._formatDate(a);a.input&&a.input.val(c);this._updateAlternate(a);var h=this._get(a,"onSelect");if(h)h.apply(a.input?a.input[0]:null,[c,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker(); +this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var c=this._get(a,"altField");if(c){var h=this._get(a,"altFormat")||this._get(a,"dateFormat"),i=this._getDate(a),j=this.formatDate(h,i,this._getFormatConfig(a));b(c).each(function(){b(this).val(j)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var c=a.getTime();a.setMonth(0); +a.setDate(1);return Math.floor(Math.round((c-a)/864E5)/7)+1},parseDate:function(a,c,h){if(a==null||c==null)throw"Invalid arguments";c=typeof c=="object"?c.toString():c+"";if(c=="")return null;var i=(h?h.shortYearCutoff:null)||this._defaults.shortYearCutoff;i=typeof i!="string"?i:(new Date).getFullYear()%100+parseInt(i,10);for(var j=(h?h.dayNamesShort:null)||this._defaults.dayNamesShort,n=(h?h.dayNames:null)||this._defaults.dayNames,o=(h?h.monthNamesShort:null)||this._defaults.monthNamesShort,l=(h? +h.monthNames:null)||this._defaults.monthNames,k=h=-1,m=-1,p=-1,q=false,s=function(x){(x=y+1-1){k=1;m=p;do{i=this._getDaysInMonth(h,k-1);if(m<=i)break;k++;m-=i}while(1)}B=this._daylightSavingAdjust(new Date(h,k-1,m));if(B.getFullYear()!=h||B.getMonth()+1!=k||B.getDate()!=m)throw"Invalid date";return B},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y", +RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,c,h){if(!c)return"";var i=(h?h.dayNamesShort:null)||this._defaults.dayNamesShort,j=(h?h.dayNames:null)||this._defaults.dayNames,n=(h?h.monthNamesShort:null)||this._defaults.monthNamesShort;h=(h?h.monthNames:null)||this._defaults.monthNames;var o=function(s){(s=q+112?a.getHours()+2:0);return a},_setDate:function(a,c,h){var i=!c,j=a.selectedMonth,n=a.selectedYear;c=this._restrictMinMax(a,this._determineDate(a,c,new Date));a.selectedDay= +a.currentDay=c.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=c.getMonth();a.drawYear=a.selectedYear=a.currentYear=c.getFullYear();if((j!=a.selectedMonth||n!=a.selectedYear)&&!h)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(i?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var c=new Date;c=this._daylightSavingAdjust(new Date(c.getFullYear(), +c.getMonth(),c.getDate()));var h=this._get(a,"isRTL"),i=this._get(a,"showButtonPanel"),j=this._get(a,"hideIfNoPrevNext"),n=this._get(a,"navigationAsDateFormat"),o=this._getNumberOfMonths(a),l=this._get(a,"showCurrentAtPos"),k=this._get(a,"stepMonths"),m=o[0]!=1||o[1]!=1,p=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),q=this._getMinMaxDate(a,"min"),s=this._getMinMaxDate(a,"max");l=a.drawMonth-l;var r=a.drawYear;if(l<0){l+=12;r--}if(s){var u= +this._daylightSavingAdjust(new Date(s.getFullYear(),s.getMonth()-o[0]*o[1]+1,s.getDate()));for(u=q&&uu;){l--;if(l<0){l=11;r--}}}a.drawMonth=l;a.drawYear=r;u=this._get(a,"prevText");u=!n?u:this.formatDate(u,this._daylightSavingAdjust(new Date(r,l-k,1)),this._getFormatConfig(a));u=this._canAdjustMonth(a,-1,r,l)?''+u+"":j?"":''+u+"";var v=this._get(a,"nextText");v=!n?v:this.formatDate(v,this._daylightSavingAdjust(new Date(r,l+k,1)),this._getFormatConfig(a));j=this._canAdjustMonth(a,+1,r,l)?''+v+"":j?"":''+v+"";k=this._get(a,"currentText");v=this._get(a,"gotoCurrent")&&a.currentDay?p:c;k=!n?k:this.formatDate(k,v,this._getFormatConfig(a));n=!a.inline?'":"";i=i?'
        '+(h?n:"")+(this._isInRange(a,v)?'":"")+(h?"":n)+"
        ":"";n=parseInt(this._get(a,"firstDay"),10);n=isNaN(n)?0:n;k=this._get(a,"showWeek");v=this._get(a,"dayNames");this._get(a,"dayNamesShort");var w=this._get(a,"dayNamesMin"),y= +this._get(a,"monthNames"),B=this._get(a,"monthNamesShort"),x=this._get(a,"beforeShowDay"),C=this._get(a,"showOtherMonths"),J=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var M=this._getDefaultDate(a),K="",G=0;G1)switch(H){case 0:D+=" ui-datepicker-group-first";A=" ui-corner-"+(h?"right":"left");break;case o[1]- +1:D+=" ui-datepicker-group-last";A=" ui-corner-"+(h?"left":"right");break;default:D+=" ui-datepicker-group-middle";A="";break}D+='">'}D+='
        '+(/all|left/.test(A)&&G==0?h?j:u:"")+(/all|right/.test(A)&&G==0?h?u:j:"")+this._generateMonthYearHeader(a,l,r,q,s,G>0||H>0,y,B)+'
        ';var E=k?'":"";for(A=0;A<7;A++){var z= +(A+n)%7;E+="=5?' class="ui-datepicker-week-end"':"")+'>'+w[z]+""}D+=E+"";E=this._getDaysInMonth(r,l);if(r==a.selectedYear&&l==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,E);A=(this._getFirstDayOfMonth(r,l)-n+7)%7;E=m?6:Math.ceil((A+E)/7);z=this._daylightSavingAdjust(new Date(r,l,1-A));for(var P=0;P";var Q=!k?"":'";for(A=0;A<7;A++){var I= +x?x.apply(a.input?a.input[0]:null,[z]):[true,""],F=z.getMonth()!=l,L=F&&!J||!I[0]||q&&zs;Q+='";z.setDate(z.getDate()+1);z=this._daylightSavingAdjust(z)}D+= +Q+""}l++;if(l>11){l=0;r++}D+="
        '+this._get(a,"weekHeader")+"
        '+this._get(a,"calculateWeek")(z)+""+(F&&!C?" ":L?''+z.getDate()+"":''+z.getDate()+"")+"
        "+(m?""+(o[0]>0&&H==o[1]-1?'
        ':""):"");N+=D}K+=N}K+=i+(b.browser.msie&&parseInt(b.browser.version,10)<7&&!a.inline?'':"");a._keyEvent=false;return K},_generateMonthYearHeader:function(a,c,h,i,j,n,o,l){var k=this._get(a,"changeMonth"),m=this._get(a,"changeYear"),p=this._get(a,"showMonthAfterYear"),q='
        ', +s="";if(n||!k)s+=''+o[c]+"";else{o=i&&i.getFullYear()==h;var r=j&&j.getFullYear()==h;s+='"}p||(q+=s+(n||!(k&& +m)?" ":""));if(!a.yearshtml){a.yearshtml="";if(n||!m)q+=''+h+"";else{l=this._get(a,"yearRange").split(":");var v=(new Date).getFullYear();o=function(w){w=w.match(/c[+-].*/)?h+parseInt(w.substring(1),10):w.match(/[+-].*/)?v+parseInt(w,10):parseInt(w,10);return isNaN(w)?v:w};c=o(l[0]);l=Math.max(c,o(l[1]||""));c=i?Math.max(c,i.getFullYear()):c;l=j?Math.min(l,j.getFullYear()):l;for(a.yearshtml+='";if(b.browser.mozilla)q+='";else{q+=a.yearshtml;a.yearshtml=null}}}q+=this._get(a,"yearSuffix");if(p)q+=(n||!(k&&m)?" ":"")+s;q+="
        ";return q},_adjustInstDate:function(a,c,h){var i= +a.drawYear+(h=="Y"?c:0),j=a.drawMonth+(h=="M"?c:0);c=Math.min(a.selectedDay,this._getDaysInMonth(i,j))+(h=="D"?c:0);i=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(i,j,c)));a.selectedDay=i.getDate();a.drawMonth=a.selectedMonth=i.getMonth();a.drawYear=a.selectedYear=i.getFullYear();if(h=="M"||h=="Y")this._notifyChange(a)},_restrictMinMax:function(a,c){var h=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");c=h&&ca?a:c},_notifyChange:function(a){var c=this._get(a, +"onChangeMonthYear");if(c)c.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,c){return this._determineDate(a,this._get(a,c+"Date"),null)},_getDaysInMonth:function(a,c){return 32-this._daylightSavingAdjust(new Date(a,c,32)).getDate()},_getFirstDayOfMonth:function(a,c){return(new Date(a,c,1)).getDay()},_canAdjustMonth:function(a,c,h,i){var j=this._getNumberOfMonths(a); +h=this._daylightSavingAdjust(new Date(h,i+(c<0?c:j[0]*j[1]),1));c<0&&h.setDate(this._getDaysInMonth(h.getFullYear(),h.getMonth()));return this._isInRange(a,h)},_isInRange:function(a,c){var h=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!h||c.getTime()>=h.getTime())&&(!a||c.getTime()<=a.getTime())},_getFormatConfig:function(a){var c=this._get(a,"shortYearCutoff");c=typeof c!="string"?c:(new Date).getFullYear()%100+parseInt(c,10);return{shortYearCutoff:c,dayNamesShort:this._get(a, +"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,c,h,i){if(!c){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}c=c?typeof c=="object"?c:this._daylightSavingAdjust(new Date(i,h,c)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),c,this._getFormatConfig(a))}});b.fn.datepicker= +function(a){if(!this.length)return this;if(!b.datepicker.initialized){b(document).mousedown(b.datepicker._checkExternalClick).find("body").append(b.datepicker.dpDiv);b.datepicker.initialized=true}var c=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this[0]].concat(c));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return b.datepicker["_"+a+"Datepicker"].apply(b.datepicker, +[this[0]].concat(c));return this.each(function(){typeof a=="string"?b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this].concat(c)):b.datepicker._attachDatepicker(this,a)})};b.datepicker=new e;b.datepicker.initialized=false;b.datepicker.uuid=(new Date).getTime();b.datepicker.version="1.8.12";window["DP_jQuery_"+g]=b})(jQuery); +(function(b,d){var e={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},f={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},g=b.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};b.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, +position:{my:"center",at:"center",collision:"fit",using:function(a){var c=b(this).css(a).offset().top;c<0&&b(this).css("top",a.top-c)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,c=a.options,h=c.title||" ",i=b.ui.dialog.getTitleId(a.element),j=(a.uiDialog=b("
        ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ +c.dialogClass).css({zIndex:c.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(l){if(c.closeOnEscape&&l.keyCode&&l.keyCode===b.ui.keyCode.ESCAPE){a.close(l);l.preventDefault()}}).attr({role:"dialog","aria-labelledby":i}).mousedown(function(l){a.moveToTop(false,l)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(j);var n=(a.uiDialogTitlebar=b("
        ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(j), +o=b('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){o.addClass("ui-state-hover")},function(){o.removeClass("ui-state-hover")}).focus(function(){o.addClass("ui-state-focus")}).blur(function(){o.removeClass("ui-state-focus")}).click(function(l){a.close(l);return false}).appendTo(n);(a.uiDialogTitlebarCloseText=b("")).addClass("ui-icon ui-icon-closethick").text(c.closeText).appendTo(o);b("").addClass("ui-dialog-title").attr("id", +i).html(h).prependTo(n);if(b.isFunction(c.beforeclose)&&!b.isFunction(c.beforeClose))c.beforeClose=c.beforeclose;n.find("*").add(n).disableSelection();c.draggable&&b.fn.draggable&&a._makeDraggable();c.resizable&&b.fn.resizable&&a._makeResizable();a._createButtons(c.buttons);a._isOpen=false;b.fn.bgiframe&&j.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); +a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var c=this,h,i;if(false!==c._trigger("beforeClose",a)){c.overlay&&c.overlay.destroy();c.uiDialog.unbind("keypress.ui-dialog");c._isOpen=false;if(c.options.hide)c.uiDialog.hide(c.options.hide,function(){c._trigger("close",a)});else{c.uiDialog.hide();c._trigger("close",a)}b.ui.dialog.overlay.resize();if(c.options.modal){h=0;b(".ui-dialog").each(function(){if(this!== +c.uiDialog[0]){i=b(this).css("z-index");isNaN(i)||(h=Math.max(h,i))}});b.ui.dialog.maxZ=h}return c}},isOpen:function(){return this._isOpen},moveToTop:function(a,c){var h=this,i=h.options;if(i.modal&&!a||!i.stack&&!i.modal)return h._trigger("focus",c);if(i.zIndex>b.ui.dialog.maxZ)b.ui.dialog.maxZ=i.zIndex;if(h.overlay){b.ui.dialog.maxZ+=1;h.overlay.$el.css("z-index",b.ui.dialog.overlay.maxZ=b.ui.dialog.maxZ)}a={scrollTop:h.element.attr("scrollTop"),scrollLeft:h.element.attr("scrollLeft")};b.ui.dialog.maxZ+= +1;h.uiDialog.css("z-index",b.ui.dialog.maxZ);h.element.attr(a);h._trigger("focus",c);return h},open:function(){if(!this._isOpen){var a=this,c=a.options,h=a.uiDialog;a.overlay=c.modal?new b.ui.dialog.overlay(a):null;a._size();a._position(c.position);h.show(c.show);a.moveToTop(true);c.modal&&h.bind("keypress.ui-dialog",function(i){if(i.keyCode===b.ui.keyCode.TAB){var j=b(":tabbable",this),n=j.filter(":first");j=j.filter(":last");if(i.target===j[0]&&!i.shiftKey){n.focus(1);return false}else if(i.target=== +n[0]&&i.shiftKey){j.focus(1);return false}}});b(a.element.find(":tabbable").get().concat(h.find(".ui-dialog-buttonpane :tabbable").get().concat(h.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var c=this,h=false,i=b("
        ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),j=b("
        ").addClass("ui-dialog-buttonset").appendTo(i);c.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&b.each(a, +function(){return!(h=true)});if(h){b.each(a,function(n,o){o=b.isFunction(o)?{click:o,text:n}:o;var l=b('').click(function(){o.click.apply(c.element[0],arguments)}).appendTo(j);b.each(o,function(k,m){if(k!=="click")k in g?l[k](m):l.attr(k,m)});b.fn.button&&l.button()});i.appendTo(c.uiDialog)}},_makeDraggable:function(){function a(n){return{position:n.position,offset:n.offset}}var c=this,h=c.options,i=b(document),j;c.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", +handle:".ui-dialog-titlebar",containment:"document",start:function(n,o){j=h.height==="auto"?"auto":b(this).height();b(this).height(b(this).height()).addClass("ui-dialog-dragging");c._trigger("dragStart",n,a(o))},drag:function(n,o){c._trigger("drag",n,a(o))},stop:function(n,o){h.position=[o.position.left-i.scrollLeft(),o.position.top-i.scrollTop()];b(this).removeClass("ui-dialog-dragging").height(j);c._trigger("dragStop",n,a(o));b.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function c(n){return{originalPosition:n.originalPosition, +originalSize:n.originalSize,position:n.position,size:n.size}}a=a===d?this.options.resizable:a;var h=this,i=h.options,j=h.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";h.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:h.element,maxWidth:i.maxWidth,maxHeight:i.maxHeight,minWidth:i.minWidth,minHeight:h._minHeight(),handles:a,start:function(n,o){b(this).addClass("ui-dialog-resizing");h._trigger("resizeStart",n,c(o))},resize:function(n,o){h._trigger("resize", +n,c(o))},stop:function(n,o){b(this).removeClass("ui-dialog-resizing");i.height=b(this).height();i.width=b(this).width();h._trigger("resizeStop",n,c(o));b.ui.dialog.overlay.resize()}}).css("position",j).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var c=[],h=[0,0],i;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){c=a.split?a.split(" "): +[a[0],a[1]];if(c.length===1)c[1]=c[0];b.each(["left","top"],function(j,n){if(+c[j]===c[j]){h[j]=c[j];c[j]=n}});a={my:c.join(" "),at:c.join(" "),offset:h.join(" ")}}a=b.extend({},b.ui.dialog.prototype.options.position,a)}else a=b.ui.dialog.prototype.options.position;(i=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(b.extend({of:window},a));i||this.uiDialog.hide()},_setOptions:function(a){var c=this,h={},i=false;b.each(a,function(j,n){c._setOption(j,n); +if(j in e)i=true;if(j in f)h[j]=n});i&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",h)},_setOption:function(a,c){var h=this,i=h.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":h._createButtons(c);break;case "closeText":h.uiDialogTitlebarCloseText.text(""+c);break;case "dialogClass":i.removeClass(h.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+c);break;case "disabled":c?i.addClass("ui-dialog-disabled"): +i.removeClass("ui-dialog-disabled");break;case "draggable":var j=i.is(":data(draggable)");j&&!c&&i.draggable("destroy");!j&&c&&h._makeDraggable();break;case "position":h._position(c);break;case "resizable":(j=i.is(":data(resizable)"))&&!c&&i.resizable("destroy");j&&typeof c==="string"&&i.resizable("option","handles",c);!j&&c!==false&&h._makeResizable(c);break;case "title":b(".ui-dialog-title",h.uiDialogTitlebar).html(""+(c||" "));break}b.Widget.prototype._setOption.apply(h,arguments)},_size:function(){var a= +this.options,c,h,i=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;c=this.uiDialog.css({height:"auto",width:a.width}).height();h=Math.max(0,a.minHeight-c);if(a.height==="auto")if(b.support.minHeight)this.element.css({minHeight:h,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();i||this.uiDialog.hide();this.element.height(Math.max(a,h))}else this.element.height(Math.max(a.height- +c,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});b.extend(b.ui.dialog,{version:"1.8.12",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=b.ui.dialog.overlay.create(a)}});b.extend(b.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:b.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), +create:function(a){if(this.instances.length===0){setTimeout(function(){b.ui.dialog.overlay.instances.length&&b(document).bind(b.ui.dialog.overlay.events,function(h){if(b(h.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});b.fn.bgiframe&&c.bgiframe();this.instances.push(c);return c},destroy:function(a){var c=b.inArray(a,this.instances);c!=-1&&this.oldInstances.push(this.instances.splice(c,1)[0]);this.instances.length===0&&b([document,window]).unbind(".dialog-overlay");a.remove();var h=0;b.each(this.instances,function(){h=Math.max(h,this.css("z-index"))});this.maxZ=h},height:function(){var a,c;if(b.browser.msie&&b.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a0?a.left-h:Math.max(a.left-c.collisionPosition.left,a.left)},top:function(a,c){var h=b(window);h=c.collisionPosition.top+c.collisionHeight-h.height()-h.scrollTop();a.top=h>0?a.top-h:Math.max(a.top-c.collisionPosition.top,a.top)}},flip:{left:function(a,c){if(c.at[0]!=="center"){var h=b(window);h=c.collisionPosition.left+c.collisionWidth-h.width()-h.scrollLeft();var i=c.my[0]==="left"?-c.elemWidth:c.my[0]==="right"?c.elemWidth:0,j=c.at[0]==="left"?c.targetWidth:-c.targetWidth,n=-2*c.offset[0];a.left+= +c.collisionPosition.left<0?i+j+n:h>0?i+j+n:0}},top:function(a,c){if(c.at[1]!=="center"){var h=b(window);h=c.collisionPosition.top+c.collisionHeight-h.height()-h.scrollTop();var i=c.my[1]==="top"?-c.elemHeight:c.my[1]==="bottom"?c.elemHeight:0,j=c.at[1]==="top"?c.targetHeight:-c.targetHeight,n=-2*c.offset[1];a.top+=c.collisionPosition.top<0?i+j+n:h>0?i+j+n:0}}}};if(!b.offset.setOffset){b.offset.setOffset=function(a,c){if(/static/.test(b.curCSS(a,"position")))a.style.position="relative";var h=b(a), +i=h.offset(),j=parseInt(b.curCSS(a,"top",true),10)||0,n=parseInt(b.curCSS(a,"left",true),10)||0;i={top:c.top-i.top+j,left:c.left-i.left+n};"using"in c?c.using.call(a,i):h.css(i)};b.fn.offset=function(a){var c=this[0];if(!c||!c.ownerDocument)return null;if(a)return this.each(function(){b.offset.setOffset(this,a)});return g.call(this)}}})(jQuery); +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
        ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(e){if(e===d)return this._value();this._setOption("value",e);return this},_setOption:function(e,f){if(e==="value"){this.options.value=f;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var e=this.options.value;if(typeof e!=="number")e=0;return Math.min(this.options.max,Math.max(this.min,e))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var e=this.value(),f=this._percentage();if(this.oldValue!==e){this.oldValue=e;this._trigger("change")}this.valueDiv.toggle(e>this.min).toggleClass("ui-corner-right",e===this.options.max).width(f.toFixed(0)+"%");this.element.attr("aria-valuenow",e)}});b.extend(b.ui.progressbar,{version:"1.8.12"})})(jQuery); +(function(b){b.widget("ui.slider",b.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var d=this,e=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");e.disabled&&this.element.addClass("ui-slider-disabled ui-disabled"); +this.range=b([]);if(e.range){if(e.range===true){this.range=b("
        ");if(!e.values)e.values=[this._valueMin(),this._valueMin()];if(e.values.length&&e.values.length!==2)e.values=[e.values[0],e.values[0]]}else this.range=b("
        ");this.range.appendTo(this.element).addClass("ui-slider-range");if(e.range==="min"||e.range==="max")this.range.addClass("ui-slider-range-"+e.range);this.range.addClass("ui-widget-header")}b(".ui-slider-handle",this.element).length===0&&b("").appendTo(this.element).addClass("ui-slider-handle"); +if(e.values&&e.values.length)for(;b(".ui-slider-handle",this.element).length").appendTo(this.element).addClass("ui-slider-handle");this.handles=b(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(f){f.preventDefault()}).hover(function(){e.disabled||b(this).addClass("ui-state-hover")},function(){b(this).removeClass("ui-state-hover")}).focus(function(){if(e.disabled)b(this).blur(); +else{b(".ui-slider .ui-state-focus").removeClass("ui-state-focus");b(this).addClass("ui-state-focus")}}).blur(function(){b(this).removeClass("ui-state-focus")});this.handles.each(function(f){b(this).data("index.ui-slider-handle",f)});this.handles.keydown(function(f){var g=true,a=b(this).data("index.ui-slider-handle"),c,h,i;if(!d.options.disabled){switch(f.keyCode){case b.ui.keyCode.HOME:case b.ui.keyCode.END:case b.ui.keyCode.PAGE_UP:case b.ui.keyCode.PAGE_DOWN:case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:g= +false;if(!d._keySliding){d._keySliding=true;b(this).addClass("ui-state-active");c=d._start(f,a);if(c===false)return}break}i=d.options.step;c=d.options.values&&d.options.values.length?(h=d.values(a)):(h=d.value());switch(f.keyCode){case b.ui.keyCode.HOME:h=d._valueMin();break;case b.ui.keyCode.END:h=d._valueMax();break;case b.ui.keyCode.PAGE_UP:h=d._trimAlignValue(c+(d._valueMax()-d._valueMin())/5);break;case b.ui.keyCode.PAGE_DOWN:h=d._trimAlignValue(c-(d._valueMax()-d._valueMin())/5);break;case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:if(c=== +d._valueMax())return;h=d._trimAlignValue(c+i);break;case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:if(c===d._valueMin())return;h=d._trimAlignValue(c-i);break}d._slide(f,a,h);return g}}).keyup(function(f){var g=b(this).data("index.ui-slider-handle");if(d._keySliding){d._keySliding=false;d._stop(f,g);d._change(f,g);b(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider"); +this._mouseDestroy();return this},_mouseCapture:function(d){var e=this.options,f,g,a,c,h;if(e.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();f=this._normValueFromMouse({x:d.pageX,y:d.pageY});g=this._valueMax()-this._valueMin()+1;c=this;this.handles.each(function(i){var j=Math.abs(f-c.values(i));if(g>j){g=j;a=b(this);h=i}});if(e.range===true&&this.values(1)===e.min){h+=1;a=b(this.handles[h])}if(this._start(d, +h)===false)return false;this._mouseSliding=true;c._handleIndex=h;a.addClass("ui-state-active").focus();e=a.offset();this._clickOffset=!b(d.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:d.pageX-e.left-a.width()/2,top:d.pageY-e.top-a.height()/2-(parseInt(a.css("borderTopWidth"),10)||0)-(parseInt(a.css("borderBottomWidth"),10)||0)+(parseInt(a.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(d,h,f);return this._animateOff=true},_mouseStart:function(){return true}, +_mouseDrag:function(d){var e=this._normValueFromMouse({x:d.pageX,y:d.pageY});this._slide(d,this._handleIndex,e);return false},_mouseStop:function(d){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(d,this._handleIndex);this._change(d,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(d){var e; +if(this.orientation==="horizontal"){e=this.elementSize.width;d=d.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{e=this.elementSize.height;d=d.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}e=d/e;if(e>1)e=1;if(e<0)e=0;if(this.orientation==="vertical")e=1-e;d=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+e*d)},_start:function(d,e){var f={handle:this.handles[e],value:this.value()};if(this.options.values&&this.options.values.length){f.value= +this.values(e);f.values=this.values()}return this._trigger("start",d,f)},_slide:function(d,e,f){var g;if(this.options.values&&this.options.values.length){g=this.values(e?0:1);if(this.options.values.length===2&&this.options.range===true&&(e===0&&f>g||e===1&&f1){this.options.values[d]=this._trimAlignValue(e);this._refreshValue();this._change(null,d)}else if(arguments.length)if(b.isArray(arguments[0])){f=this.options.values;g=arguments[0];for(a=0;a=this._valueMax())return this._valueMax();var e=this.options.step>0?this.options.step:1,f=(d-this._valueMin())%e;alignValue=d-f;if(Math.abs(f)*2>=e)alignValue+=f>0?e:-e;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var d=this.options.range,e=this.options,f=this,g=!this._animateOff?e.animate:false,a,c={},h,i,j,n;if(this.options.values&&this.options.values.length)this.handles.each(function(o){a=(f.values(o)-f._valueMin())/(f._valueMax()-f._valueMin())*100;c[f.orientation==="horizontal"?"left":"bottom"]=a+"%";b(this).stop(1,1)[g?"animate":"css"](c,e.animate);if(f.options.range===true)if(f.orientation==="horizontal"){if(o===0)f.range.stop(1,1)[g?"animate":"css"]({left:a+"%"},e.animate); +if(o===1)f.range[g?"animate":"css"]({width:a-h+"%"},{queue:false,duration:e.animate})}else{if(o===0)f.range.stop(1,1)[g?"animate":"css"]({bottom:a+"%"},e.animate);if(o===1)f.range[g?"animate":"css"]({height:a-h+"%"},{queue:false,duration:e.animate})}h=a});else{i=this.value();j=this._valueMin();n=this._valueMax();a=n!==j?(i-j)/(n-j)*100:0;c[f.orientation==="horizontal"?"left":"bottom"]=a+"%";this.handle.stop(1,1)[g?"animate":"css"](c,e.animate);if(d==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[g?"animate":"css"]({width:a+"%"},e.animate);if(d==="max"&&this.orientation==="horizontal")this.range[g?"animate":"css"]({width:100-a+"%"},{queue:false,duration:e.animate});if(d==="min"&&this.orientation==="vertical")this.range.stop(1,1)[g?"animate":"css"]({height:a+"%"},e.animate);if(d==="max"&&this.orientation==="vertical")this.range[g?"animate":"css"]({height:100-a+"%"},{queue:false,duration:e.animate})}}});b.extend(b.ui.slider,{version:"1.8.12"})})(jQuery); +(function(b,d){function e(){return++g}function f(){return++a}var g=0,a=0;b.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
        ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
      • #{label}
        • "},_create:function(){this._tabify(true)},_setOption:function(c,h){if(c=="selected")this.options.collapsible&& +h==this.options.selected||this.select(h);else{this.options[c]=h;this._tabify()}},_tabId:function(c){return c.title&&c.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+e()},_sanitizeSelector:function(c){return c.replace(/:/g,"\\:")},_cookie:function(){var c=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+f());return b.cookie.apply(null,[c].concat(b.makeArray(arguments)))},_ui:function(c,h){return{tab:c,panel:h,index:this.anchors.index(c)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var c= +b(this);c.html(c.data("label.tabs")).removeData("label.tabs")})},_tabify:function(c){function h(r,u){r.css("display","");!b.support.opacity&&u.opacity&&r[0].style.removeAttribute("filter")}var i=this,j=this.options,n=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=b(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return b("a",this)[0]});this.panels=b([]);this.anchors.each(function(r,u){var v=b(u).attr("href"),w=v.split("#")[0],y;if(w&&(w===location.toString().split("#")[0]|| +(y=b("base")[0])&&w===y.href)){v=u.hash;u.href=v}if(n.test(v))i.panels=i.panels.add(i.element.find(i._sanitizeSelector(v)));else if(v&&v!=="#"){b.data(u,"href.tabs",v);b.data(u,"load.tabs",v.replace(/#.*$/,""));v=i._tabId(u);u.href="#"+v;u=i.element.find("#"+v);if(!u.length){u=b(j.panelTemplate).attr("id",v).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(i.panels[r-1]||i.list);u.data("destroy.tabs",true)}i.panels=i.panels.add(u)}else j.disabled.push(r)});if(c){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===d){location.hash&&this.anchors.each(function(r,u){if(u.hash==location.hash){j.selected=r;return false}});if(typeof j.selected!=="number"&&j.cookie)j.selected=parseInt(i._cookie(),10);if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)j.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));j.selected=j.selected||(this.lis.length?0:-1)}else if(j.selected===null)j.selected=-1;j.selected=j.selected>=0&&this.anchors[j.selected]||j.selected<0?j.selected:0;j.disabled=b.unique(j.disabled.concat(b.map(this.lis.filter(".ui-state-disabled"),function(r){return i.lis.index(r)}))).sort();b.inArray(j.selected,j.disabled)!=-1&&j.disabled.splice(b.inArray(j.selected,j.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(j.selected>=0&&this.anchors.length){i.element.find(i._sanitizeSelector(i.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");i.element.queue("tabs",function(){i._trigger("show",null,i._ui(i.anchors[j.selected],i.element.find(i._sanitizeSelector(i.anchors[j.selected].hash))[0]))});this.load(j.selected)}b(window).bind("unload",function(){i.lis.add(i.anchors).unbind(".tabs");i.lis=i.anchors=i.panels=null})}else j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");j.cookie&&this._cookie(j.selected,j.cookie);c=0;for(var o;o=this.lis[c];c++)b(o)[b.inArray(c,j.disabled)!=-1&&!b(o).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");j.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var l=function(r,u){u.is(":not(.ui-state-disabled)")&&u.addClass("ui-state-"+r)},k=function(r,u){u.removeClass("ui-state-"+ +r)};this.lis.bind("mouseover.tabs",function(){l("hover",b(this))});this.lis.bind("mouseout.tabs",function(){k("hover",b(this))});this.anchors.bind("focus.tabs",function(){l("focus",b(this).closest("li"))});this.anchors.bind("blur.tabs",function(){k("focus",b(this).closest("li"))})}var m,p;if(j.fx)if(b.isArray(j.fx)){m=j.fx[0];p=j.fx[1]}else m=p=j.fx;var q=p?function(r,u){b(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.hide().removeClass("ui-tabs-hide").animate(p,p.duration||"normal", +function(){h(u,p);i._trigger("show",null,i._ui(r,u[0]))})}:function(r,u){b(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.removeClass("ui-tabs-hide");i._trigger("show",null,i._ui(r,u[0]))},s=m?function(r,u){u.animate(m,m.duration||"normal",function(){i.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");h(u,m);i.element.dequeue("tabs")})}:function(r,u){i.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");i.element.dequeue("tabs")}; +this.anchors.bind(j.event+".tabs",function(){var r=this,u=b(r).closest("li"),v=i.panels.filter(":not(.ui-tabs-hide)"),w=i.element.find(i._sanitizeSelector(r.hash));if(u.hasClass("ui-tabs-selected")&&!j.collapsible||u.hasClass("ui-state-disabled")||u.hasClass("ui-state-processing")||i.panels.filter(":animated").length||i._trigger("select",null,i._ui(this,w[0]))===false){this.blur();return false}j.selected=i.anchors.index(this);i.abort();if(j.collapsible)if(u.hasClass("ui-tabs-selected")){j.selected= +-1;j.cookie&&i._cookie(j.selected,j.cookie);i.element.queue("tabs",function(){s(r,v)}).dequeue("tabs");this.blur();return false}else if(!v.length){j.cookie&&i._cookie(j.selected,j.cookie);i.element.queue("tabs",function(){q(r,w)});i.load(i.anchors.index(this));this.blur();return false}j.cookie&&i._cookie(j.selected,j.cookie);if(w.length){v.length&&i.element.queue("tabs",function(){s(r,v)});i.element.queue("tabs",function(){q(r,w)});i.load(i.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +b.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(c){if(typeof c=="string")c=this.anchors.index(this.anchors.filter("[href$="+c+"]"));return c},destroy:function(){var c=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var h= +b.data(this,"href.tabs");if(h)this.href=h;var i=b(this).unbind(".tabs");b.each(["href","load","cache"],function(j,n){i.removeData(n+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){b.data(this,"destroy.tabs")?b(this).remove():b(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});c.cookie&&this._cookie(null,c.cookie);return this},add:function(c, +h,i){if(i===d)i=this.anchors.length;var j=this,n=this.options;h=b(n.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,h));c=!c.indexOf("#")?c.replace("#",""):this._tabId(b("a",h)[0]);h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var o=j.element.find("#"+c);o.length||(o=b(n.panelTemplate).attr("id",c).data("destroy.tabs",true));o.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(i>=this.lis.length){h.appendTo(this.list);o.appendTo(this.list[0].parentNode)}else{h.insertBefore(this.lis[i]); +o.insertBefore(this.panels[i])}n.disabled=b.map(n.disabled,function(l){return l>=i?++l:l});this._tabify();if(this.anchors.length==1){n.selected=0;h.addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){j._trigger("show",null,j._ui(j.anchors[0],j.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[i],this.panels[i]));return this},remove:function(c){c=this._getIndex(c);var h=this.options,i=this.lis.eq(c).remove(),j=this.panels.eq(c).remove(); +if(i.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(c+(c+1=c?--n:n});this._tabify();this._trigger("remove",null,this._ui(i.find("a")[0],j[0]));return this},enable:function(c){c=this._getIndex(c);var h=this.options;if(b.inArray(c,h.disabled)!=-1){this.lis.eq(c).removeClass("ui-state-disabled");h.disabled=b.grep(h.disabled,function(i){return i!=c});this._trigger("enable",null, +this._ui(this.anchors[c],this.panels[c]));return this}},disable:function(c){c=this._getIndex(c);var h=this.options;if(c!=h.selected){this.lis.eq(c).addClass("ui-state-disabled");h.disabled.push(c);h.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[c],this.panels[c]))}return this},select:function(c){c=this._getIndex(c);if(c==-1)if(this.options.collapsible&&this.options.selected!=-1)c=this.options.selected;else return this;this.anchors.eq(c).trigger(this.options.event+".tabs");return this}, +load:function(c){c=this._getIndex(c);var h=this,i=this.options,j=this.anchors.eq(c)[0],n=b.data(j,"load.tabs");this.abort();if(!n||this.element.queue("tabs").length!==0&&b.data(j,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(c).addClass("ui-state-processing");if(i.spinner){var o=b("span",j);o.data("label.tabs",o.html()).html(i.spinner)}this.xhr=b.ajax(b.extend({},i.ajaxOptions,{url:n,success:function(l,k){h.element.find(h._sanitizeSelector(j.hash)).html(l);h._cleanup();i.cache&&b.data(j, +"cache.tabs",true);h._trigger("load",null,h._ui(h.anchors[c],h.panels[c]));try{i.ajaxOptions.success(l,k)}catch(m){}},error:function(l,k){h._cleanup();h._trigger("load",null,h._ui(h.anchors[c],h.panels[c]));try{i.ajaxOptions.error(l,k,c,j)}catch(m){}}}));h.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(c,h){this.anchors.eq(c).removeData("cache.tabs").data("load.tabs",h);return this},length:function(){return this.anchors.length}});b.extend(b.ui.tabs,{version:"1.8.12"});b.extend(b.ui.tabs.prototype,{rotation:null,rotate:function(c,h){var i=this,j=this.options,n=i._rotate||(i._rotate=function(o){clearTimeout(i.rotation);i.rotation=setTimeout(function(){var l=j.selected;i.select(++l)[^>]*$|#([\w\-]*)$)/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Check for digits + rdigit = /\d/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // The deferred used on DOM ready + readyList, + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = quickExpr.exec( selector ); + } + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = (context ? context.ownerDocument || context : document); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return (context || rootjQuery).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if (selector.selector !== undefined) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.6", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = this.constructor(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + (this.selector ? " " : "") + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // Add the callback + readyList.done( fn ); + + return this; + }, + + eq: function( i ) { + return i === -1 ? + this.slice( i ) : + this.slice( i, +i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + // Either a released hold or an DOMready/load event and not yet ready + if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).unbind( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyList ) { + return; + } + + readyList = jQuery._Deferred(); + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNaN: function( obj ) { + return obj == null || !rdigit.test( obj ) || isNaN( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw msg; + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return (new Function( "return " + data ))(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + // (xml & tmp used internally) + parseXML: function( data , xml , tmp ) { + + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + + tmp = xml.documentElement; + + if ( ! tmp || ! tmp.nodeName || tmp.nodeName === "parsererror" ) { + jQuery.error( "Invalid XML: " + data ); + } + + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction( object ); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { + break; + } + } + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // The extra typeof function check is to prevent crashes + // in Safari 2 (See: #3039) + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type( array ); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array ) { + + if ( indexOf ) { + return indexOf.call( array, elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + if ( typeof context === "string" ) { + var tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + var args = slice.call( arguments, 2 ), + proxy = function() { + return fn.apply( context, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can be optionally by executed if its a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return (new Date()).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + sub: function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +// IE doesn't match non-breaking spaces with \s +if ( rnotwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +// Expose jQuery to the global object +return jQuery; + +})(); + + +var // Promise methods + promiseMethods = "done fail isResolved isRejected promise then always pipe".split( " " ), + // Static reference to slice + sliceDeferred = [].slice; + +jQuery.extend({ + // Create a simple deferred (one callbacks list) + _Deferred: function() { + var // callbacks list + callbacks = [], + // stored [ context , args ] + fired, + // to avoid firing when already doing so + firing, + // flag to know if the deferred has been cancelled + cancelled, + // the deferred itself + deferred = { + + // done( f1, f2, ...) + done: function() { + if ( !cancelled ) { + var args = arguments, + i, + length, + elem, + type, + _fired; + if ( fired ) { + _fired = fired; + fired = 0; + } + for ( i = 0, length = args.length; i < length; i++ ) { + elem = args[ i ]; + type = jQuery.type( elem ); + if ( type === "array" ) { + deferred.done.apply( deferred, elem ); + } else if ( type === "function" ) { + callbacks.push( elem ); + } + } + if ( _fired ) { + deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] ); + } + } + return this; + }, + + // resolve with given context and args + resolveWith: function( context, args ) { + if ( !cancelled && !fired && !firing ) { + // make sure args are available (#8421) + args = args || []; + firing = 1; + try { + while( callbacks[ 0 ] ) { + callbacks.shift().apply( context, args ); + } + } + finally { + fired = [ context, args ]; + firing = 0; + } + } + return this; + }, + + // resolve with this as context and given arguments + resolve: function() { + deferred.resolveWith( this, arguments ); + return this; + }, + + // Has this deferred been resolved? + isResolved: function() { + return !!( firing || fired ); + }, + + // Cancel + cancel: function() { + cancelled = 1; + callbacks = []; + return this; + } + }; + + return deferred; + }, + + // Full fledged deferred (two callbacks list) + Deferred: function( func ) { + var deferred = jQuery._Deferred(), + failDeferred = jQuery._Deferred(), + promise; + // Add errorDeferred methods, then and promise + jQuery.extend( deferred, { + then: function( doneCallbacks, failCallbacks ) { + deferred.done( doneCallbacks ).fail( failCallbacks ); + return this; + }, + always: function() { + return deferred.done.apply( deferred, arguments ).fail.apply( this, arguments ); + }, + fail: failDeferred.done, + rejectWith: failDeferred.resolveWith, + reject: failDeferred.resolve, + isRejected: failDeferred.isResolved, + pipe: function( fnDone, fnFail ) { + return jQuery.Deferred(function( newDefer ) { + jQuery.each( { + done: [ fnDone, "resolve" ], + fail: [ fnFail, "reject" ] + }, function( handler, data ) { + var fn = data[ 0 ], + action = data[ 1 ], + returned; + if ( jQuery.isFunction( fn ) ) { + deferred[ handler ](function() { + returned = fn.apply( this, arguments ); + if ( jQuery.isFunction( returned.promise ) ) { + returned.promise().then( newDefer.resolve, newDefer.reject ); + } else { + newDefer[ action ]( returned ); + } + }); + } else { + deferred[ handler ]( newDefer[ action ] ); + } + }); + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + if ( obj == null ) { + if ( promise ) { + return promise; + } + promise = obj = {}; + } + var i = promiseMethods.length; + while( i-- ) { + obj[ promiseMethods[i] ] = deferred[ promiseMethods[i] ]; + } + return obj; + } + }); + // Make sure only one callback list will be used + deferred.done( failDeferred.cancel ).fail( deferred.cancel ); + // Unexpose cancel + delete deferred.cancel; + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + return deferred; + }, + + // Deferred helper + when: function( firstParam ) { + var args = arguments, + i = 0, + length = args.length, + count = length, + deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? + firstParam : + jQuery.Deferred(); + function resolveFunc( i ) { + return function( value ) { + args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + if ( !( --count ) ) { + // Strange bug in FF4: + // Values changed onto the arguments object sometimes end up as undefined values + // outside the $.when method. Cloning the object into a fresh array solves the issue + deferred.resolveWith( deferred, sliceDeferred.call( args, 0 ) ); + } + }; + } + if ( length > 1 ) { + for( ; i < length; i++ ) { + if ( args[ i ] && jQuery.isFunction( args[ i ].promise ) ) { + args[ i ].promise().then( resolveFunc(i), deferred.reject ); + } else { + --count; + } + } + if ( !count ) { + deferred.resolveWith( deferred, args ); + } + } else if ( deferred !== firstParam ) { + deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); + } + return deferred.promise(); + } +}); + + + +jQuery.support = (function() { + + var div = document.createElement( "div" ), + all, + a, + select, + opt, + input, + marginDiv, + support, + fragment, + body, + bodyStyle, + tds, + events, + eventName, + i, + isSupported; + + // Preliminary tests + div.setAttribute("className", "t"); + div.innerHTML = "
        a"; + + all = div.getElementsByTagName( "*" ); + a = div.getElementsByTagName( "a" )[ 0 ]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement( "select" ); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName( "input" )[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName( "tbody" ).length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName( "link" ).length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute( "href" ) === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55$/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", function click() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + div.detachEvent( "onclick", click ); + }); + div.cloneNode( true ).fireEvent( "onclick" ); + } + + // Check if a radio maintains it's value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute("type", "radio"); + support.radioValue = input.value === "t"; + + input.setAttribute("checked", "checked"); + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.firstChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + div.innerHTML = ""; + + // Figure out if the W3C box model works as expected + div.style.width = div.style.paddingLeft = "1px"; + + // We use our own, invisible, body + body = document.createElement( "body" ); + bodyStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + // Set background to avoid IE crashes when removing (#9028) + background: "none" + }; + for ( i in bodyStyle ) { + body.style[ i ] = bodyStyle[ i ]; + } + body.appendChild( div ); + document.documentElement.appendChild( body ); + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + support.boxModel = div.offsetWidth === 2; + + if ( "zoom" in div.style ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "
        "; + support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); + } + + div.innerHTML = "
        t
        "; + tds = div.getElementsByTagName( "td" ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE < 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + div.innerHTML = ""; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + if ( document.defaultView && document.defaultView.getComputedStyle ) { + marginDiv = document.createElement( "div" ); + marginDiv.style.width = "0"; + marginDiv.style.marginRight = "0"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + ( parseInt( document.defaultView.getComputedStyle( marginDiv, null ).marginRight, 10 ) || 0 ) === 0; + } + + // Remove the body element we added + body.innerHTML = ""; + document.documentElement.removeChild( body ); + + // Technique from Juriy Zaytsev + // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for( i in { + submit: 1, + change: 1, + focusin: 1 + } ) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + return support; +})(); + +// Keep track of boxModel +jQuery.boxModel = jQuery.support.boxModel; + + + + +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([a-z])([A-Z])/g; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var internalKey = jQuery.expando, getByName = typeof name === "string", thisCache, + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || (pvt && id && !cache[ id ][ internalKey ])) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ jQuery.expando ] = id = ++jQuery.uuid; + } else { + id = jQuery.expando; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name); + } else { + cache[ id ] = jQuery.extend(cache[ id ], name); + } + } + + thisCache = cache[ id ]; + + // Internal jQuery data is stored in a separate object inside the object's data + // cache in order to avoid key collisions between internal data and user-defined + // data + if ( pvt ) { + if ( !thisCache[ internalKey ] ) { + thisCache[ internalKey ] = {}; + } + + thisCache = thisCache[ internalKey ]; + } + + if ( data !== undefined ) { + thisCache[ name ] = data; + } + + // TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should + // not attempt to inspect the internal events object using jQuery.data, as this + // internal data object is undocumented and subject to change. + if ( name === "events" && !thisCache[name] ) { + return thisCache[ internalKey ] && thisCache[ internalKey ].events; + } + + return getByName ? thisCache[ name ] : thisCache; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var internalKey = jQuery.expando, isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + + // See jQuery.data for more information + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + var thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ]; + + if ( thisCache ) { + delete thisCache[ name ]; + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !isEmptyDataObject(thisCache) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( pvt ) { + delete cache[ id ][ internalKey ]; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject(cache[ id ]) ) { + return; + } + } + + var internalCache = cache[ id ][ internalKey ]; + + // Browsers that fail expando deletion also refuse to delete expandos on + // the window, but it will allow it on all other JS objects; other browsers + // don't care + if ( jQuery.support.deleteExpando || cache != window ) { + delete cache[ id ]; + } else { + cache[ id ] = null; + } + + // We destroyed the entire user cache at once because it's faster than + // iterating through each key, but we need to continue to persist internal + // data if it existed + if ( internalCache ) { + cache[ id ] = {}; + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + + cache[ id ][ internalKey ] = internalCache; + + // Otherwise, we need to eliminate the expando on the node to avoid + // false lookups in the cache for entries that no longer exist + } else if ( isNode ) { + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( jQuery.support.deleteExpando ) { + delete elem[ jQuery.expando ]; + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } else { + elem[ jQuery.expando ] = null; + } + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + data = jQuery.data( this[0] ); + + if ( this[0].nodeType === 1 ) { + var attr = this[0].attributes, name; + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( this[0], name, data[ name ] ); + } + } + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var $this = jQuery( this ), + args = [ parts[0], value ]; + + $this.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + $this.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "$1-$2" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + !jQuery.isNaN( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// TODO: This is a hack for 1.5 ONLY to allow objects with a single toJSON +// property to be considered empty objects; this property always exists in +// order to make sure JSON.stringify does not expose internal metadata +function isEmptyDataObject( obj ) { + for ( var name in obj ) { + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + + + + +function handleQueueMarkDefer( elem, type, src ) { + var deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + defer = jQuery.data( elem, deferDataKey, undefined, true ); + if ( defer && + ( src === "queue" || !jQuery.data( elem, queueDataKey, undefined, true ) ) && + ( src === "mark" || !jQuery.data( elem, markDataKey, undefined, true ) ) ) { + // Give room for hard-coded callbacks to fire first + // and eventually mark/queue something else on the element + setTimeout( function() { + if ( !jQuery.data( elem, queueDataKey, undefined, true ) && + !jQuery.data( elem, markDataKey, undefined, true ) ) { + jQuery.removeData( elem, deferDataKey, true ); + defer.resolve(); + } + }, 0 ); + } +} + +jQuery.extend({ + + _mark: function( elem, type ) { + if ( elem ) { + type = (type || "fx") + "mark"; + jQuery.data( elem, type, (jQuery.data(elem,type,undefined,true) || 0) + 1, true ); + } + }, + + _unmark: function( force, elem, type ) { + if ( force !== true ) { + type = elem; + elem = force; + force = false; + } + if ( elem ) { + type = type || "fx"; + var key = type + "mark", + count = force ? 0 : ( (jQuery.data( elem, key, undefined, true) || 1 ) - 1 ); + if ( count ) { + jQuery.data( elem, key, count, true ); + } else { + jQuery.removeData( elem, key, true ); + handleQueueMarkDefer( elem, type, "mark" ); + } + } + }, + + queue: function( elem, type, data ) { + if ( elem ) { + type = (type || "fx") + "queue"; + var q = jQuery.data( elem, type, undefined, true ); + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !q || jQuery.isArray(data) ) { + q = jQuery.data( elem, type, jQuery.makeArray(data), true ); + } else { + q.push( data ); + } + } + return q || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + defer; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift("inprogress"); + } + + fn.call(elem, function() { + jQuery.dequeue(elem, type); + }); + } + + if ( !queue.length ) { + jQuery.removeData( elem, type + "queue", true ); + handleQueueMarkDefer( elem, type, "queue" ); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function() { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + type = type || "fx"; + + return this.queue( type, function() { + var elem = this; + setTimeout(function() { + jQuery.dequeue( elem, type ); + }, time ); + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, object ) { + if ( typeof type !== "string" ) { + object = type; + type = undefined; + } + type = type || "fx"; + var defer = jQuery.Deferred(), + elements = this, + i = elements.length, + count = 1, + deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark"; + function resolve() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + } + while( i-- ) { + if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || + ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || + jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && + jQuery.data( elements[ i ], deferDataKey, jQuery._Deferred(), true ) )) { + count++; + tmp.done( resolve ); + } + } + resolve(); + return defer.promise(); + } +}); + + + + +var rclass = /[\n\t\r]/g, + rspace = /\s+/, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rspecial = /^(?:data-|aria-)/, + rinvalidChar = /\:/, + formHook; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.prop ); + }, + + removeProp: function( name ) { + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this); + self.addClass( value.call(this, i, self.attr("class") || "") ); + }); + } + + if ( value && typeof value === "string" ) { + var classNames = (value || "").split( rspace ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className ) { + elem.className = value; + + } else { + var className = " " + elem.className + " ", + setClass = elem.className; + + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) { + setClass += " " + classNames[c]; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + self.removeClass( value.call(this, i, self.attr("class")) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + var classNames = (value || "").split( rspace ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + var className = (" " + elem.className + " ").replace(rclass, " "); + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[c] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this); + self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " "; + for ( var i = 0, l = this.length; i < l; i++ ) { + if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + return (elem.value || "").replace(rreturn, ""); + } + + return undefined; + } + + var isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var self = jQuery(this), val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || ("set" in hooks && hooks.set( this, val, "value" ) === undefined) ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attrFix: { + // Always normalize to ensure hook usage + tabindex: "tabIndex", + readonly: "readOnly" + }, + + attr: function( elem, name, value, pass ) { + var nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery( elem )[ name ]( value ); + } + + var ret, hooks, + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // Normalize the name if needed + name = notxml && jQuery.attrFix[ name ] || name; + + // Get the appropriate hook, or the formHook + // if getSetAttribute is not supported and we have form objects in IE6/7 + hooks = jQuery.attrHooks[ name ] || + ( formHook && (jQuery.nodeName( elem, "form" ) || rinvalidChar.test( name )) ? + formHook : + undefined ); + + if ( value !== undefined ) { + + if ( value === null || (value === false && !rspecial.test( name )) ) { + jQuery.removeAttr( elem, name ); + return undefined; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + + // Set boolean attributes to the same name + if ( value === true && !rspecial.test( name ) ) { + value = name; + } + + elem.setAttribute( name, "" + value ); + return value; + } + + } else { + + if ( hooks && "get" in hooks && notxml ) { + return hooks.get( elem, name ); + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + } + }, + + removeAttr: function( elem, name ) { + if ( elem.nodeType === 1 ) { + name = jQuery.attrFix[ name ] || name; + + if ( jQuery.support.getSetAttribute ) { + // Use removeAttribute in browsers that support it + elem.removeAttribute( name ); + } else { + jQuery.attr( elem, name, "" ); + elem.removeAttributeNode( elem.getAttributeNode( name ) ); + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.getAttribute("value"); + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabIndex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + }, + + propFix: {}, + + prop: function( elem, name, value ) { + var nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + var ret, hooks, + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // Try to normalize/fix the name + name = notxml && jQuery.propFix[ name ] || name; + + hooks = jQuery.propHooks[ name ]; + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return (elem[ name ] = value); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== undefined ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: {} +}); + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !jQuery.support.getSetAttribute ) { + jQuery.attrFix = jQuery.extend( jQuery.attrFix, { + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder" + }); + + // Use this for any attribute on a form in IE6/7 + formHook = jQuery.attrHooks.name = jQuery.attrHooks.value = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + if ( name === "value" && !jQuery.nodeName( elem, "button" ) ) { + return elem.getAttribute( name ); + } + ret = elem.getAttributeNode( name ); + // Return undefined if not specified instead of empty string + return ret && ret.specified ? + ret.nodeValue : + undefined; + }, + set: function( elem, value, name ) { + // Check form objects in IE (multiple bugs related) + // Only use nodeValue if the attribute node exists on the form + var ret = elem.getAttributeNode( name ); + if ( ret ) { + ret.nodeValue = value; + return value; + } + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return (elem.style.cssText = "" + value); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }); +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return (elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0); + } + } + }); +}); + + + + +var hasOwn = Object.prototype.hasOwnProperty, + rnamespaces = /\.(.*)$/, + rformElems = /^(?:textarea|input|select)$/i, + rperiod = /\./g, + rspaces = / /g, + rescape = /[^\w\s.|`]/g, + fcleanup = function( nm ) { + return nm.replace(rescape, "\\$&"); + }; + +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function( elem, types, handler, data ) { + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } else if ( !handler ) { + // Fixes bug #7229. Fix recommended by jdalton + return; + } + + var handleObjIn, handleObj; + + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure + var elemData = jQuery._data( elem ); + + // If no elemData is found then we must be trying to bind to one of the + // banned noData elements + if ( !elemData ) { + return; + } + + var events = elemData.events, + eventHandle = elemData.handle; + + if ( !events ) { + elemData.events = events = {}; + } + + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.handle.apply( eventHandle.elem, arguments ) : + undefined; + }; + } + + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native events in IE. + eventHandle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = types.split(" "); + + var type, i = 0, namespaces; + + while ( (type = types[ i++ ]) ) { + handleObj = handleObjIn ? + jQuery.extend({}, handleObjIn) : + { handler: handler, data: data }; + + // Namespaced event handlers + if ( type.indexOf(".") > -1 ) { + namespaces = type.split("."); + type = namespaces.shift(); + handleObj.namespace = namespaces.slice(0).sort().join("."); + + } else { + namespaces = []; + handleObj.namespace = ""; + } + + handleObj.type = type; + if ( !handleObj.guid ) { + handleObj.guid = handler.guid; + } + + // Get the current list of functions bound to this event + var handlers = events[ type ], + special = jQuery.event.special[ type ] || {}; + + // Init the event handler queue + if ( !handlers ) { + handlers = events[ type ] = []; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add the function to the element's handler list + handlers.push( handleObj ); + + // Keep track of which events have been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, pos ) { + // don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } + + var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ), + events = elemData && elemData.events; + + if ( !elemData || !events ) { + return; + } + + // types is actually an event object here + if ( types && types.type ) { + handler = types.handler; + types = types.type; + } + + // Unbind all events for the element + if ( !types || typeof types === "string" && types.charAt(0) === "." ) { + types = types || ""; + + for ( type in events ) { + jQuery.event.remove( elem, type + types ); + } + + return; + } + + // Handle multiple events separated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + types = types.split(" "); + + while ( (type = types[ i++ ]) ) { + origType = type; + handleObj = null; + all = type.indexOf(".") < 0; + namespaces = []; + + if ( !all ) { + // Namespaced event handlers + namespaces = type.split("."); + type = namespaces.shift(); + + namespace = new RegExp("(^|\\.)" + + jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + eventType = events[ type ]; + + if ( !eventType ) { + continue; + } + + if ( !handler ) { + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( all || namespace.test( handleObj.namespace ) ) { + jQuery.event.remove( elem, origType, handleObj.handler, j ); + eventType.splice( j--, 1 ); + } + } + + continue; + } + + special = jQuery.event.special[ type ] || {}; + + for ( j = pos || 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( handler.guid === handleObj.guid ) { + // remove the given handler for the given type + if ( all || namespace.test( handleObj.namespace ) ) { + if ( pos == null ) { + eventType.splice( j--, 1 ); + } + + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + + if ( pos != null ) { + break; + } + } + } + + // remove generic event handler if no more handlers exist + if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + ret = null; + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + var handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + delete elemData.events; + delete elemData.handle; + + if ( jQuery.isEmptyObject( elemData ) ) { + jQuery.removeData( elem, undefined, true ); + } + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Event object or event type + var type = event.type || event, + namespaces = [], + exclusive; + + if ( type.indexOf("!") >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf(".") >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.exclusive = exclusive; + event.namespace = namespaces.join("."); + event.namespace_re = new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)"); + + // triggerHandler() and global events don't bubble or run the default action + if ( onlyHandlers || !elem ) { + event.preventDefault(); + event.stopPropagation(); + } + + // Handle a global trigger + if ( !elem ) { + // TODO: Stop taunting the data cache; remove global events and always attach to document + jQuery.each( jQuery.cache, function() { + // internalKey variable is just used to make it easier to find + // and potentially change this stuff later; currently it just + // points to jQuery.expando + var internalKey = jQuery.expando, + internalCache = this[ internalKey ]; + if ( internalCache && internalCache.events && internalCache.events[ type ] ) { + jQuery.event.trigger( event, data, internalCache.handle.elem ); + } + }); + return; + } + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + event.target = elem; + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + var cur = elem, + // IE doesn't like method names with a colon (#3533, #8272) + ontype = type.indexOf(":") < 0 ? "on" + type : ""; + + // Fire event on the current element, then bubble up the DOM tree + do { + var handle = jQuery._data( cur, "handle" ); + + event.currentTarget = cur; + if ( handle ) { + handle.apply( cur, data ); + } + + // Trigger an inline bound script + if ( ontype && jQuery.acceptData( cur ) && cur[ ontype ] && cur[ ontype ].apply( cur, data ) === false ) { + event.result = false; + event.preventDefault(); + } + + // Bubble up to document, then to window + cur = cur.parentNode || cur.ownerDocument || cur === event.target.ownerDocument && window; + } while ( cur && !event.isPropagationStopped() ); + + // If nobody prevented the default action, do it now + if ( !event.isDefaultPrevented() ) { + var old, + special = jQuery.event.special[ type ] || {}; + + if ( (!special._default || special._default.call( elem.ownerDocument, event ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction)() check here because IE6/7 fails that test. + // IE<9 dies on focus to hidden element (#1486), may want to revisit a try/catch. + try { + if ( ontype && elem[ type ] ) { + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + jQuery.event.triggered = type; + elem[ type ](); + } + } catch ( ieError ) {} + + if ( old ) { + elem[ ontype ] = old; + } + + jQuery.event.triggered = undefined; + } + } + + return event.result; + }, + + handle: function( event ) { + event = jQuery.event.fix( event || window.event ); + // Snapshot the handlers list since a called handler may add/remove events. + var handlers = ((jQuery._data( this, "events" ) || {})[ event.type ] || []).slice(0), + run_all = !event.exclusive && !event.namespace, + args = Array.prototype.slice.call( arguments, 0 ); + + // Use the fix-ed Event rather than the (read-only) native event + args[0] = event; + event.currentTarget = this; + + for ( var j = 0, l = handlers.length; j < l; j++ ) { + var handleObj = handlers[ j ]; + + // Triggered event must 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event. + if ( run_all || event.namespace_re.test( handleObj.namespace ) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handleObj.handler; + event.data = handleObj.data; + event.handleObj = handleObj; + + var ret = handleObj.handler.apply( this, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + return event.result; + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ) { + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) { + // Fixes #1925 where srcElement might not be defined either + event.target = event.srcElement || document; + } + + // check if target is a textnode (safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) { + event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; + } + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var eventDocument = event.target.ownerDocument || document, + doc = eventDocument.documentElement, + body = eventDocument.body; + + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); + } + + // Add which for key events + if ( event.which == null && (event.charCode != null || event.keyCode != null) ) { + event.which = event.charCode != null ? event.charCode : event.keyCode; + } + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) { + event.metaKey = event.ctrlKey; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button !== undefined ) { + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + } + + return event; + }, + + // Deprecated, use jQuery.guid instead + guid: 1E8, + + // Deprecated, use jQuery.proxy instead + proxy: jQuery.proxy, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady, + teardown: jQuery.noop + }, + + live: { + add: function( handleObj ) { + jQuery.event.add( this, + liveConvert( handleObj.origType, handleObj.selector ), + jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) ); + }, + + remove: function( handleObj ) { + jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj ); + } + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + } +}; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !this.preventDefault ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function( event ) { + // Check if mouse(over|out) are still within the same parent element + var parent = event.relatedTarget; + + // Firefox sometimes assigns relatedTarget a XUL element + // which we cannot access the parentNode property of + try { + + // Chrome does something similar, the parentNode property + // can be accessed but is null. + if ( parent && parent !== document && !parent.parentNode ) { + return; + } + // Traverse up the tree + while ( parent && parent !== this ) { + parent = parent.parentNode; + } + + if ( parent !== this ) { + // set the correct event type + event.type = event.data; + + // handle event if we actually just moused on to a non sub-element + jQuery.event.handle.apply( this, arguments ); + } + + // assuming we've left the element since we most likely mousedover a xul element + } catch(e) { } +}, + +// In case of event delegation, we only need to rename the event.type, +// liveHandler will take care of the rest. +delegate = function( event ) { + event.type = event.data; + jQuery.event.handle.apply( this, arguments ); +}; + +// Create mouseenter and mouseleave events +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + setup: function( data ) { + jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); + }, + teardown: function( data ) { + jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); + } + }; +}); + +// submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function( data, namespaces ) { + if ( !jQuery.nodeName( this, "form" ) ) { + jQuery.event.add(this, "click.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { + trigger( "submit", this, arguments ); + } + }); + + jQuery.event.add(this, "keypress.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { + trigger( "submit", this, arguments ); + } + }); + + } else { + return false; + } + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialSubmit" ); + } + }; + +} + +// change delegation, happens here so we have bind. +if ( !jQuery.support.changeBubbles ) { + + var changeFilters, + + getVal = function( elem ) { + var type = elem.type, val = elem.value; + + if ( type === "radio" || type === "checkbox" ) { + val = elem.checked; + + } else if ( type === "select-multiple" ) { + val = elem.selectedIndex > -1 ? + jQuery.map( elem.options, function( elem ) { + return elem.selected; + }).join("-") : + ""; + + } else if ( jQuery.nodeName( elem, "select" ) ) { + val = elem.selectedIndex; + } + + return val; + }, + + testChange = function testChange( e ) { + var elem = e.target, data, val; + + if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) { + return; + } + + data = jQuery._data( elem, "_change_data" ); + val = getVal(elem); + + // the current data will be also retrieved by beforeactivate + if ( e.type !== "focusout" || elem.type !== "radio" ) { + jQuery._data( elem, "_change_data", val ); + } + + if ( data === undefined || val === data ) { + return; + } + + if ( data != null || val ) { + e.type = "change"; + e.liveFired = undefined; + jQuery.event.trigger( e, arguments[1], elem ); + } + }; + + jQuery.event.special.change = { + filters: { + focusout: testChange, + + beforedeactivate: testChange, + + click: function( e ) { + var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( type === "radio" || type === "checkbox" || jQuery.nodeName( elem, "select" ) ) { + testChange.call( this, e ); + } + }, + + // Change has to be called before submit + // Keydown will be called before keypress, which is used in submit-event delegation + keydown: function( e ) { + var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( (e.keyCode === 13 && !jQuery.nodeName( elem, "textarea" ) ) || + (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || + type === "select-multiple" ) { + testChange.call( this, e ); + } + }, + + // Beforeactivate happens also before the previous element is blurred + // with this event you can't trigger a change event, but you can store + // information + beforeactivate: function( e ) { + var elem = e.target; + jQuery._data( elem, "_change_data", getVal(elem) ); + } + }, + + setup: function( data, namespaces ) { + if ( this.type === "file" ) { + return false; + } + + for ( var type in changeFilters ) { + jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); + } + + return rformElems.test( this.nodeName ); + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialChange" ); + + return rformElems.test( this.nodeName ); + } + }; + + changeFilters = jQuery.event.special.change.filters; + + // Handle when the input is .focus()'d + changeFilters.focus = changeFilters.beforeactivate; +} + +function trigger( type, elem, args ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + // Don't pass args or remember liveFired; they apply to the donor event. + var event = jQuery.extend( {}, args[ 0 ] ); + event.type = type; + event.originalEvent = {}; + event.liveFired = undefined; + jQuery.event.handle.call( elem, event ); + if ( event.isDefaultPrevented() ) { + args[ 0 ].preventDefault(); + } +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + + function handler( donor ) { + // Donor event is always a native one; fix it and switch its type. + // Let focusin/out handler cancel the donor focus/blur event. + var e = jQuery.event.fix( donor ); + e.type = fix; + e.originalEvent = {}; + jQuery.event.trigger( e, null, e.target ); + if ( e.isDefaultPrevented() ) { + donor.preventDefault(); + } + } + }); +} + +jQuery.each(["bind", "one"], function( i, name ) { + jQuery.fn[ name ] = function( type, data, fn ) { + var handler; + + // Handle object literals + if ( typeof type === "object" ) { + for ( var key in type ) { + this[ name ](key, data, type[key], fn); + } + return this; + } + + if ( arguments.length === 2 || data === false ) { + fn = data; + data = undefined; + } + + if ( name === "one" ) { + handler = function( event ) { + jQuery( this ).unbind( event, handler ); + return fn.apply( this, arguments ); + }; + handler.guid = fn.guid || jQuery.guid++; + } else { + handler = fn; + } + + if ( type === "unload" && name !== "one" ) { + this.one( type, data, fn ); + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.add( this[i], type, handler, data ); + } + } + + return this; + }; +}); + +jQuery.fn.extend({ + unbind: function( type, fn ) { + // Handle object literals + if ( typeof type === "object" && !type.preventDefault ) { + for ( var key in type ) { + this.unbind(key, type[key]); + } + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.remove( this[i], type, fn ); + } + } + + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.live( types, data, fn, selector ); + }, + + undelegate: function( selector, types, fn ) { + if ( arguments.length === 0 ) { + return this.unbind( "live" ); + + } else { + return this.die( types, null, fn, selector ); + } + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +var liveMap = { + focus: "focusin", + blur: "focusout", + mouseenter: "mouseover", + mouseleave: "mouseout" +}; + +jQuery.each(["live", "die"], function( i, name ) { + jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { + var type, i = 0, match, namespaces, preType, + selector = origSelector || this.selector, + context = origSelector ? this : jQuery( this.context ); + + if ( typeof types === "object" && !types.preventDefault ) { + for ( var key in types ) { + context[ name ]( key, data, types[key], selector ); + } + + return this; + } + + if ( name === "die" && !types && + origSelector && origSelector.charAt(0) === "." ) { + + context.unbind( origSelector ); + + return this; + } + + if ( data === false || jQuery.isFunction( data ) ) { + fn = data || returnFalse; + data = undefined; + } + + types = (types || "").split(" "); + + while ( (type = types[ i++ ]) != null ) { + match = rnamespaces.exec( type ); + namespaces = ""; + + if ( match ) { + namespaces = match[0]; + type = type.replace( rnamespaces, "" ); + } + + if ( type === "hover" ) { + types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); + continue; + } + + preType = type; + + if ( liveMap[ type ] ) { + types.push( liveMap[ type ] + namespaces ); + type = type + namespaces; + + } else { + type = (liveMap[ type ] || type) + namespaces; + } + + if ( name === "live" ) { + // bind live handler + for ( var j = 0, l = context.length; j < l; j++ ) { + jQuery.event.add( context[j], "live." + liveConvert( type, selector ), + { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); + } + + } else { + // unbind live handler + context.unbind( "live." + liveConvert( type, selector ), fn ); + } + } + + return this; + }; +}); + +function liveHandler( event ) { + var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret, + elems = [], + selectors = [], + events = jQuery._data( this, "events" ); + + // Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911) + if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) { + return; + } + + if ( event.namespace ) { + namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.liveFired = this; + + var live = events.live.slice(0); + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { + selectors.push( handleObj.selector ); + + } else { + live.splice( j--, 1 ); + } + } + + match = jQuery( event.target ).closest( selectors, event.currentTarget ); + + for ( i = 0, l = match.length; i < l; i++ ) { + close = match[i]; + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) && !close.elem.disabled ) { + elem = close.elem; + related = null; + + // Those two events require additional checking + if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { + event.type = handleObj.preType; + related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; + + // Make sure not to accidentally match a child element with the same selector + if ( related && jQuery.contains( elem, related ) ) { + related = elem; + } + } + + if ( !related || related !== elem ) { + elems.push({ elem: elem, handleObj: handleObj, level: close.level }); + } + } + } + } + + for ( i = 0, l = elems.length; i < l; i++ ) { + match = elems[i]; + + if ( maxLevel && match.level > maxLevel ) { + break; + } + + event.currentTarget = match.elem; + event.data = match.handleObj.data; + event.handleObj = match.handleObj; + + ret = match.handleObj.origHandler.apply( match.elem, arguments ); + + if ( ret === false || event.isPropagationStopped() ) { + maxLevel = match.level; + + if ( ret === false ) { + stop = false; + } + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + + return stop; +} + +function liveConvert( type, selector ) { + return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspaces, "&"); +} + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.bind( name, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } +}); + + + +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true, + rBackslash = /\\/g, + rNonWord = /\W/; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var match, + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + var left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace( rBackslash, "" ); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( "*" ) : + []; + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + var found, item, + filter = Expr.filter[ type ], + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw "Syntax error, unrecognized expression: " + msg; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + }, + type: function( elem ) { + return elem.getAttribute( "type" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !rNonWord.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( match[1] ); + } + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace( rBackslash, "" ) + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace( rBackslash, "" ); + }, + + TAG: function( match, curLoop ) { + return match[1].replace( rBackslash, "" ).toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + match[2] = match[2].replace(/^\+|\s*/g, ''); + + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1] = match[1].replace( rBackslash, "" ); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + // Handle if an un-quoted value was used + match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + var attr = elem.getAttribute( "type" ), type = elem.type; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); + }, + + radio: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; + }, + + checkbox: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; + }, + + file: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; + }, + + password: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; + }, + + submit: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "submit" === elem.type; + }, + + image: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; + }, + + reset: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "reset" === elem.type; + }, + + button: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && "button" === elem.type || name === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + }, + + focus: function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( name ); + } + }, + + CHILD: function( elem, match ) { + var type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + var first = match[2], + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // If the nodes are siblings (or identical) we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Utility function for retreiving the text value of an array of DOM nodes +Sizzle.getText = function( elems ) { + var ret = "", elem; + + for ( var i = 0; elems[i]; i++ ) { + elem = elems[i]; + + // Get the text from text nodes and CDATA nodes + if ( elem.nodeType === 3 || elem.nodeType === 4 ) { + ret += elem.nodeValue; + + // Traverse everything else, except comment nodes + } else if ( elem.nodeType !== 8 ) { + ret += Sizzle.getText( elem.childNodes ); + } + } + + return ret; +}; + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = ""; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = ""; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "

        "; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + // See if we find a selector to speed up + var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + + if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { + // Speed-up: Sizzle("TAG") + if ( match[1] ) { + return makeArray( context.getElementsByTagName( query ), extra ); + + // Speed-up: Sizzle(".CLASS") + } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { + return makeArray( context.getElementsByClassName( match[2] ), extra ); + } + } + + if ( context.nodeType === 9 ) { + // Speed-up: Sizzle("body") + // The body element only exists once, optimize finding it + if ( query === "body" && context.body ) { + return makeArray( [ context.body ], extra ); + + // Speed-up: Sizzle("#ID") + } else if ( match && match[3] ) { + var elem = context.getElementById( match[3] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id === match[3] ) { + return makeArray( [ elem ], extra ); + } + + } else { + return makeArray( [], extra ); + } + } + + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var oldContext = context, + old = context.getAttribute( "id" ), + nid = old || id, + hasParent = context.parentNode, + relativeHierarchySelector = /^\s*[+~]/.test( query ); + + if ( !old ) { + context.setAttribute( "id", nid ); + } else { + nid = nid.replace( /'/g, "\\$&" ); + } + if ( relativeHierarchySelector && hasParent ) { + context = context.parentNode; + } + + try { + if ( !relativeHierarchySelector || hasParent ) { + return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); + } + + } catch(pseudoError) { + } finally { + if ( !old ) { + oldContext.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; + + if ( matches ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9 fails this) + var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + var ret = matches.call( node, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || !disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9, so check for that + node.document && node.document.nodeType !== 11 ) { + return ret; + } + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "
        "; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self = this, + i, l; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + var ret = this.pushStack( "", "find", selector ), + length, n, r; + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( typeof selector === "string" ? + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + // Array + if ( jQuery.isArray( selectors ) ) { + var match, selector, + matches = {}, + level = 1; + + if ( cur && selectors.length ) { + for ( i = 0, l = selectors.length; i < l; i++ ) { + selector = selectors[i]; + + if ( !matches[ selector ] ) { + matches[ selector ] = POS.test( selector ) ? + jQuery( selector, context || this.context ) : + selector; + } + } + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( selector in matches ) { + match = matches[ selector ]; + + if ( match.jquery ? match.index( cur ) > -1 : jQuery( cur ).is( match ) ) { + ret.push({ selector: selector, elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + } + + return ret; + } + + // String + var pos = POS.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + if ( !elem || typeof elem === "string" ) { + return jQuery.inArray( this[0], + // If it receives a string, the selector is used + // If it receives nothing, the siblings are used + elem ? jQuery( elem ) : this.parent().children() ); + } + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ), + // The variable 'args' was introduced in + // https://github.com/jquery/jquery/commit/52a0238 + // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed. + // http://code.google.com/p/v8/issues/detail?id=1050 + args = slice.call(arguments); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, args.join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return (elem === qualifier) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return (jQuery.inArray( elem, qualifier ) >= 0) === keep; + }); +} + + + + +var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /", "" ], + legend: [ 1, "
        ", "
        " ], + thead: [ 1, "", "
        " ], + tr: [ 2, "", "
        " ], + td: [ 3, "", "
        " ], + col: [ 2, "", "
        " ], + area: [ 1, "", "" ], + _default: [ 0, "", "" ] + }; + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize and +<% end %> + diff --git a/app/views/home/ordergroup.js.erb b/app/views/home/ordergroup.js.erb new file mode 100644 index 00000000..ba71bff1 --- /dev/null +++ b/app/views/home/ordergroup.js.erb @@ -0,0 +1 @@ +$('#transactions').html('<%= escape_javascript(render("finance/transactions/list")) %>'); \ No newline at end of file From 6ac04d5e194374f622f4a1e27c4833476d705363 Mon Sep 17 00:00:00 2001 From: benni Date: Wed, 18 May 2011 11:47:00 +0200 Subject: [PATCH 028/335] Fixed foodcoop/ordergroups view. --- .../foodcoop/ordergroups_controller.rb | 19 +++++--------- .../foodcoop/ordergroups/index.html.haml | 26 +++++++++++-------- app/views/foodcoop/ordergroups/index.js.erb | 1 + 3 files changed, 22 insertions(+), 24 deletions(-) create mode 100644 app/views/foodcoop/ordergroups/index.js.erb diff --git a/app/controllers/foodcoop/ordergroups_controller.rb b/app/controllers/foodcoop/ordergroups_controller.rb index 19ccae3f..62f5ffdb 100644 --- a/app/controllers/foodcoop/ordergroups_controller.rb +++ b/app/controllers/foodcoop/ordergroups_controller.rb @@ -7,23 +7,16 @@ class Foodcoop::OrdergroupsController < ApplicationController @per_page = 20 end - if (params[:only_active].to_i == 1) - if (! params[:query].blank?) - conditions = ["orders.starts >= ? AND name LIKE ?", Time.now.months_ago(3), "%#{params[:query]}%"] - else - conditions = ["orders.starts >= ?", Time.now.months_ago(3)] - end - else - # if somebody uses the search field: - conditions = ["name LIKE ?", "%#{params[:query]}%"] unless params[:query].blank? - end + @ordergroups = Ordergroup.order(:name.desc) + @ordergroups = @ordergroups.where(:name.matches => "%#{params[:query]}%") unless params[:query].blank? # Search by name + @ordergroups = @ordergroups.joins(:orders).where(:orders => {:starts.gte => Time.now.months_ago(3)}) if params[:only_active] # Select only active groups - @total = Ordergroup.count(:conditions => conditions, :include => "orders") - @ordergroups = Ordergroup.paginate(:page => params[:page], :per_page => @per_page, :conditions => conditions, :order => "name", :include => "orders") + @total = @ordergroups.size + @ordergroups = @ordergroups.paginate(:page => params[:page], :per_page => @per_page) respond_to do |format| format.html # index.html.erb - format.js { render :partial => "ordergroups" } + format.js { render :layout => false } end end end diff --git a/app/views/foodcoop/ordergroups/index.html.haml b/app/views/foodcoop/ordergroups/index.html.haml index 94ec4281..b60da1f5 100644 --- a/app/views/foodcoop/ordergroups/index.html.haml +++ b/app/views/foodcoop/ordergroups/index.html.haml @@ -4,20 +4,24 @@ .box_title %h2 Übersicht .column_content - #user_filter{:style => "margin-right:2em;"} - %form{:id=>"sform", :action=>"", :style=>"display:inline;"} + #filter{:style => "margin-right:2em;"} + = form_tag foodcoop_ordergroups_path, :method => :get, :style=>"display:inline;", :id => 'ordergroup_search', :remote => true do %label{:for => 'article_name'} Suche nach Name: - = text_field_tag("query", params['query'], :size => 10 ) + = text_field_tag(:query, params[:query], :size => 10 ) %label{:for => 'only_active'} Nur aktive: = check_box_tag('only_active') %small (mindestens einmal in den letzten 3 Monaten bestellt) - - = observe_form 'sform', :frequency => 2, | - :before => "Element.show('loader')", | - :success => "Element.hide('loader')", | - :url => foodcoop_ordergroups_path, | - :update => :ordergroups, | - :method => :get | #ordergroups - = render :partial => "ordergroups" \ No newline at end of file + = render :partial => "ordergroups" + +- content_for :head do + :javascript + $(function() { + $('#query').observe_field(1, function() { + $('#ordergroup_search').submit(); + }); + $('#only_active').click(function() { + $('#ordergroup_search').submit(); + }); + }); \ No newline at end of file diff --git a/app/views/foodcoop/ordergroups/index.js.erb b/app/views/foodcoop/ordergroups/index.js.erb new file mode 100644 index 00000000..97537932 --- /dev/null +++ b/app/views/foodcoop/ordergroups/index.js.erb @@ -0,0 +1 @@ +$('#ordergroups').html('<%= escape_javascript(render("ordergroups")) %>'); \ No newline at end of file From d5552059ce2673c6d6ff539201721c418f907a26 Mon Sep 17 00:00:00 2001 From: benni Date: Wed, 18 May 2011 14:47:17 +0200 Subject: [PATCH 029/335] Refactored messages modul, but refactoring is still neccessary. --- app/controllers/messages_controller.rb | 59 ++---------- app/helpers/messages_helper.rb | 14 +-- app/models/message.rb | 29 ++++-- app/views/admin/users/show.html.erb | 2 +- .../ordergroups/_ordergroups.html.haml | 2 +- app/views/foodcoop/users/_users.html.haml | 2 +- .../foodcoop/workgroups/_workgroup.html.haml | 2 +- app/views/messages/_messages.html.haml | 2 +- app/views/messages/index.html.haml | 2 +- app/views/messages/new.haml | 91 +++++++------------ app/views/messages/show.haml | 2 +- config/locales/de.yml | 12 +++ config/routes.rb | 8 +- 13 files changed, 81 insertions(+), 146 deletions(-) diff --git a/app/controllers/messages_controller.rb b/app/controllers/messages_controller.rb index 8e5f38e1..1787a2ff 100644 --- a/app/controllers/messages_controller.rb +++ b/app/controllers/messages_controller.rb @@ -1,76 +1,29 @@ class MessagesController < ApplicationController - + # Renders the "inbox" action. def index @messages = Message.public.paginate :page => params[:page], :per_page => 20, :order => 'created_at DESC' end - + # Creates a new message object. def new - @message = Message.new + @message = Message.new(params[:message]) end - + # Creates a new message. def create @message = @current_user.send_messages.new(params[:message]) if @message.save #FIXME: Send Mails wit ID instead of using message.state ... call_rake :send_emails - flash[:notice] = "Nachricht ist gespeichert und wird versendet." - redirect_to messages_path + redirect_to messages_url, :notice => "Nachricht ist gespeichert und wird versendet." else render :action => 'new' end end - + # Shows a single message. def show @message = Message.find(params[:id]) end - - # Replys to the message specified through :id. - def reply - message = Message.find(params[:id]) - @message = Message.new(:recipient => message.sender, :subject => "Re: #{message.subject}") - @message.body = "#{message.sender.nick} schrieb am #{I18n.l(message.created_at.to_date)} um #{I18n.l(message.created_at, :format => :time)}:\n" - message.body.each_line{|l| @message.body += "> #{l}"} - render :action => 'new' - end - - # Shows new-message form with the recipient user specified through :id. - def user - if (recipient = User.find(params[:id])) - @message = Message.new(:recipient => recipient) - render :action => 'new' - else - flash[:error] = 'Unbekannte_r EmpfängerIn.' - redirect_to :action=> 'index' - end - end - - # Shows new-message form with the recipient user specified through :id. - def group - group = Group.find(params[:id], :include => :memberships) - if (group && !group.memberships.empty?) - @message = Message.new(:group_id => group.id) - render :action => 'new' - else - flash[:error] = 'Empfängergruppe ist unbekannt oder hat keine Mitglieder.' - redirect_to :action=> 'index' - end - end - - # Auto-complete for recipient user list. - def auto_complete_for_message_recipients_nicks - @users = User.find(:all, - :conditions => ['LOWER(nick) LIKE ?', '%' + params[:message][:recipients_nicks].downcase + '%'], - :order => :nick, :limit => 8) - render :partial => '/shared/auto_complete_users' - end - - # Returns list of all users as auto-completion hint. - def user_list - @users = User.find(:all, :order => :nick) - render :partial => '/shared/auto_complete_users' - end end diff --git a/app/helpers/messages_helper.rb b/app/helpers/messages_helper.rb index 1ced0806..e672107c 100644 --- a/app/helpers/messages_helper.rb +++ b/app/helpers/messages_helper.rb @@ -1,16 +1,4 @@ module MessagesHelper - def groups_for_select - groups = [[" -- Arbeitsgruppen -- ", ""]] - groups += Workgroup.find(:all, :order => 'name', :include => :memberships).reject{ |g| g.memberships.empty? }.collect do |g| - [g.name, g.id] - end - groups += [[" -- Bestellgruppen -- ", ""]] - groups += Ordergroup.without_deleted(:order => 'name', :include => :memberships).reject{ |g| g.memberships.empty? }.collect do |g| - [g.name, g.id] - end - groups - end - def format_subject(message, length) if message.subject.length > length subject = truncate(message.subject, :length => length) @@ -19,6 +7,6 @@ module MessagesHelper subject = message.subject body = truncate(message.body, :length => length - subject.length) end - "#{link_to(h(subject), message)} #{h(body)}" + "#{link_to(h(subject), message)} #{h(body)}".html_safe end end diff --git a/app/models/message.rb b/app/models/message.rb index ea0012cd..85682ad6 100644 --- a/app/models/message.rb +++ b/app/models/message.rb @@ -2,11 +2,11 @@ class Message < ActiveRecord::Base belongs_to :sender, :class_name => "User", :foreign_key => "sender_id" serialize :recipients_ids, Array - attr_accessor :sent_to_all, :group_id, :recipients_nicks + attr_accessor :sent_to_all, :group_id, :recipient_tokens - scope :pending, :conditions => { :email_state => 0 } - scope :sent, :conditions => { :email_state => 1 } - scope :public, :conditions => {:private => false} + scope :pending, where(:email_state => 0) + scope :sent, where(:email_state => 1) + scope :public, where(:private => false) # Values for the email_state attribute: :none, :pending, :sent, :failed EMAIL_STATE = { @@ -36,15 +36,24 @@ class Message < ActiveRecord::Base add_recipients Group.find(group_id).users unless group_id.blank? end - def recipients_nicks=(nicks) - @recipients_nicks = nicks - add_recipients nicks.split(",").collect { |nick| User.find_by_nick(nick) } + def recipient_tokens=(ids) + @recipient_tokens = ids + add_recipients ids.split(",").collect { |id| User.find(id) } end - def recipient=(user) - @recipients_nicks = user.nick + def reply_to=(message_id) + message = Message.find(message_id) + add_recipients(message.sender.to_a) + self.subject = "Re: #{message.subject}" + self.body = "#{message.sender.nick} schrieb am #{I18n.l(message.created_at.to_date)} um #{I18n.l(message.created_at, :format => :time)}:\n" + message.body.each_line{ |l| self.body += "> #{l}" } end - + + def mail_to=(user_id) + user = User.find(user_id) + add_recipients(user.to_a) + end + # Returns true if this message is a system message, i.e. was sent automatically by the FoodSoft itself. def system_message? self.sender_id.nil? diff --git a/app/views/admin/users/show.html.erb b/app/views/admin/users/show.html.erb index 447b0cca..8af5edc5 100644 --- a/app/views/admin/users/show.html.erb +++ b/app/views/admin/users/show.html.erb @@ -38,7 +38,7 @@

        <%= link_to 'Bearbeiten', edit_admin_user_path(@user) %> | <%= link_to 'Löschen', [:admin, @user], :confirm => "Willst du #{@user.first_name} wirklich rausschmeißen?", :method => :delete %> - | <%= link_to "Nachricht senden", user_message_path(@user.id) %> + | <%= link_to "Nachricht senden", new_message_path(:message => {:mail_to => @user.id}) %>

        Gruppenabos

        diff --git a/app/views/foodcoop/ordergroups/_ordergroups.html.haml b/app/views/foodcoop/ordergroups/_ordergroups.html.haml index 51137299..9e51bc0e 100644 --- a/app/views/foodcoop/ordergroups/_ordergroups.html.haml +++ b/app/views/foodcoop/ordergroups/_ordergroups.html.haml @@ -17,7 +17,7 @@ %tbody - for ordergroup in @ordergroups %tr{:class => cycle('even','odd', :name => 'ordergroup')} - %td= link_to h(ordergroup.name), group_message_path(ordergroup), :title => "Bestellgruppe eine Nachricht schicken" + %td= link_to h(ordergroup.name), new_message_path(:message => {:group_id => ordergroup.id}), :title => "Bestellgruppe eine Nachricht schicken" %td=h ordergroup.users.collect { |u| u.nick }.join(", ") %td - order = ordergroup.orders.first(:order => 'starts DESC') diff --git a/app/views/foodcoop/users/_users.html.haml b/app/views/foodcoop/users/_users.html.haml index ac84c6a1..c814a7c0 100644 --- a/app/views/foodcoop/users/_users.html.haml +++ b/app/views/foodcoop/users/_users.html.haml @@ -20,7 +20,7 @@ - users = params[:sort_by_ordergroups] ? @users.sort { |a,b| a.ordergroup.name <=> b.ordergroup.name } : @users - for user in users %tr{:class => cycle('even','odd', :name => 'users')} - %td= link_to user.nick, user_message_path(user), :title => _('Send user an email') + %td= link_to user.nick, new_message_path(:message => {:mail_to => user.id}), :title => _('Send user an email') %td=h user.name if @current_user.role_admin? || user.settings["profile.nameIsPublic"] == '1' %td=h user.email if @current_user.role_admin? || user.settings["profile.emailIsPublic"] == '1' %td=h user.phone if @current_user.role_admin? || user.settings["profile.phoneIsPublic"] == '1' diff --git a/app/views/foodcoop/workgroups/_workgroup.html.haml b/app/views/foodcoop/workgroups/_workgroup.html.haml index d117fbd7..8f060606 100644 --- a/app/views/foodcoop/workgroups/_workgroup.html.haml +++ b/app/views/foodcoop/workgroups/_workgroup.html.haml @@ -6,7 +6,7 @@ %p = link_to "Alle Aufgaben zeigen", :controller => "/tasks", :action => "workgroup", :id => workgroup | - = link_to "Mitgliedern eine Nachricht schicken", :controller => '/messages', :action => 'group', :id => workgroup + = link_to "Mitgliedern eine Nachricht schicken", new_message_path(:message => {:group_id => workgroup.id}) - if workgroup.member?(@current_user) | = link_to "Gruppe bearbeiten", edit_foodcoop_workgroup_path(workgroup) diff --git a/app/views/messages/_messages.html.haml b/app/views/messages/_messages.html.haml index 5cadd9d4..639972bd 100644 --- a/app/views/messages/_messages.html.haml +++ b/app/views/messages/_messages.html.haml @@ -6,5 +6,5 @@ %td= format_subject(message, subject_length) %td= h(message.sender_name) %td= format_time(message.created_at) - %td= link_to('Antworten', reply_message_path(message)) + %td= link_to('Antworten', new_message_path(:message => {:reply_to => message.id})) \ No newline at end of file diff --git a/app/views/messages/index.html.haml b/app/views/messages/index.html.haml index 3ce8fa1e..74e90918 100644 --- a/app/views/messages/index.html.haml +++ b/app/views/messages/index.html.haml @@ -5,4 +5,4 @@ %div{:style => "text-align:right"}= will_paginate @messages #messages - = render :partial => 'messages', :locals => { :subject_length => 130 } \ No newline at end of file + = render :partial => 'messages', :locals => { :messages => @messages, :subject_length => 130 } \ No newline at end of file diff --git a/app/views/messages/new.haml b/app/views/messages/new.haml index 72939eea..97975cbc 100644 --- a/app/views/messages/new.haml +++ b/app/views/messages/new.haml @@ -1,61 +1,40 @@ -%h1 Neue Nachricht +- content_for :head do + :javascript + $(function() { + $('#message_recipient_tokens').tokenInput("#{users_path(:format => :json)}", { + crossDomain: false, + prePopulate: $('#message_recipient_tokens').data('pre') + }); -- form_for @message do |f| - = f.error_messages + $('#message_sent_to_all').click(function() { + if ($(this).is(':checked')) { + $('#recipients').slideUp(); + } else { + $('#recipients').slideDown(); + } + }); + }); - %p - Empfängerinnen - %fieldset - - if Foodsoft.config[:mailing_list].blank? - = f.check_box :sent_to_all, :onchange => "Element.toggle('recipients')" - gesamte Foodcoop - - else - %b Nachrichten an alle - verschickst Du bitte über den Verteiler: - = mail_to Foodsoft.config[:mailing_list] - %br/ - %small{:style => "color:grey"} - Eventuell musst Du Dich dem Verteiler erst bekannt machen. - %br/ - z.b. mit einer Mail an - = mail_to Foodsoft.config[:mailing_list_subscribe] - %table#recipients - %tr - %td - %b BenutzerInnen: - %br/ - %small{:style => "color:grey"} (Mehrere Benutzerinnen mit Komma trennen) - %br/ - = text_field_with_auto_complete(:message, :recipients_nicks, {:value => @message.recipients_nicks}, {:tokens => ","}) - :javascript - var userListLoaded = false; - function checkUserList() { - if (userListLoaded) { - $('user-list').toggle(); - } - return !userListLoaded; - } - = link_to_remote('Liste', :update => 'user-list', :url => {:action => 'user_list'}, :complete => 'userListLoaded = true', :condition => 'checkUserList()') - #user-list.auto_complete - %tr - %td - %b Gruppe: - %br/ - = f.select :group_id, groups_for_select, :prompt => " -- Gruppe auswählen --" +- title "Neue Nachricht" - %p - Privat - = f.check_box :private - %small{:style => "color:grey"} (Nachricht taucht nicht im Foodsoft-Nachrichteneingang auf) - - %p - Betreff += simple_form_for @message do |f| + - if Foodsoft.config[:mailing_list].blank? + = f.input :sent_to_all, :as => :boolean + - else + %b Nachrichten an alle + verschickst Du bitte über den Verteiler: + = mail_to Foodsoft.config[:mailing_list] %br/ - = f.text_field :subject + %small{:style => "color:grey"} + Eventuell musst Du Dich dem Verteiler erst bekannt machen. + %br/ + z.b. mit einer Mail an + = mail_to Foodsoft.config[:mailing_list_subscribe] - %p - Nachricht - %br/ - ~ f.text_area :body, :cols => '80', :rows => '20' - - = submit_tag "Senden" \ No newline at end of file + #recipients + = f.input :recipient_tokens, :input_html => { 'data-pre' => User.find_all_by_id(@message.recipients_ids).map { |u| u.token_attributes }.to_json } + = f.input :group_id, :as => :select, :collection => Group.order(:type.desc, :name.desc).all.reject { |g| g.memberships.empty? } + = f.input :private + = f.input :subject + = f.input :body + = f.submit \ No newline at end of file diff --git a/app/views/messages/show.haml b/app/views/messages/show.haml index 322d5247..0ca92ab4 100644 --- a/app/views/messages/show.haml +++ b/app/views/messages/show.haml @@ -16,6 +16,6 @@ %p= simple_format(h(@message.body)) %hr/ %p - = link_to('Antworten', reply_message_path(@message)) + = link_to('Antworten', new_message_path(:message => {:reply_to => @message.id})) | = link_to 'Nachricht im Überblick', messages_path \ No newline at end of file diff --git a/config/locales/de.yml b/config/locales/de.yml index 913c8cb3..0d1cbfc3 100644 --- a/config/locales/de.yml +++ b/config/locales/de.yml @@ -1,4 +1,6 @@ de: + groups: + home: index: title: Startseite @@ -156,6 +158,7 @@ de: workgroup: Arbeitsgruppe ordergroup: Bestellgruppe task: Aufgabe + message: Nachricht attributes: article: price: Nettopreis @@ -174,6 +177,8 @@ de: submit: create: "%{model} speichern" update: "Änderungen speichern" + message: + create: 'Nachricht verschicken' # Simple form i18n is used to build the forms simple_form: @@ -215,6 +220,13 @@ de: required_users: 'Anzahl' due_date: 'Wann erledigen?' workgroup: 'Arbeitsgruppe' + message: + sent_to_all: 'An alle Mitglieder schicken' + recipient_tokens: 'Empfänger_innen' + group_id: 'Gruppe' + subject: 'Betreff' + body: 'Inhalt' + private: 'privat verschicken, Nachricht erscheint nicht im Foodsoft Posteingang' hints: task: duration: 'Wie lange dauert die Aufgabe, 1-3 Stunden' diff --git a/config/routes.rb b/config/routes.rb index 86aef29b..ee7df381 100644 --- a/config/routes.rb +++ b/config/routes.rb @@ -57,13 +57,7 @@ Foodsoft::Application.routes.draw do end end - resources :messages, :only => [:index, :show, :new, :create] do - member do - get :reply - get :user - get :group - end - end + resources :messages, :only => [:index, :show, :new, :create] namespace :foodcoop do root :to => 'users#index' From 772cf87c92a9fe3d28d567c00b8f80d7970d044f Mon Sep 17 00:00:00 2001 From: benni Date: Wed, 18 May 2011 15:25:05 +0200 Subject: [PATCH 030/335] Fixed wiki module. --- app/controllers/pages_controller.rb | 15 --------------- app/helpers/pages_helper.rb | 8 ++++---- app/views/pages/_form.html.haml | 17 +++++------------ app/views/pages/_recent_changes.html.haml | 2 +- app/views/pages/_site_map.html.haml | 2 +- app/views/pages/_title_list.html.haml | 2 +- app/views/pages/all.html.haml | 8 ++++---- app/views/pages/show.html.haml | 4 ++-- config/application.rb | 1 + config/locales/de.yml | 3 +++ config/routes.rb | 2 +- public/stylesheets/main.css | 4 ++-- 12 files changed, 25 insertions(+), 43 deletions(-) diff --git a/app/controllers/pages_controller.rb b/app/controllers/pages_controller.rb index 78c65144..a1ccbcc8 100644 --- a/app/controllers/pages_controller.rb +++ b/app/controllers/pages_controller.rb @@ -96,21 +96,6 @@ class PagesController < ApplicationController end def all - @recent_pages = Page.non_redirected.all :order => 'updated_at DESC' - @pages = Page.non_redirected.all :order => 'title' - @top_pages = Page.no_parent.non_redirected.all :order => 'created_at' - - view = params[:view] - params[:view] = nil - - case view - when 'recentChanges' - render :partial => 'recent_changes' and return - when 'siteMap' - render :partial => 'site_map' and return - when 'titleList' - render :partial => 'title_list' and return - end end def version diff --git a/app/helpers/pages_helper.rb b/app/helpers/pages_helper.rb index 51c5a253..4154c461 100644 --- a/app/helpers/pages_helper.rb +++ b/app/helpers/pages_helper.rb @@ -2,14 +2,14 @@ module PagesHelper include WikiCloth def wikified_body(body, title = nil) - WikiCloth.new({:data => body+"\n", :link_handler => Wikilink.new, :params => {:referer => title}}).to_html + WikiCloth.new({:data => body+"\n", :link_handler => Wikilink.new, :params => {:referer => title}}).to_html.html_safe end def link_to_wikipage(page, text = nil) if text == nil - link_to page.title, wiki_page_path(page.permalink) + link_to page.title, wiki_page_path(:permalink => page.permalink) else - link_to text, wiki_page_path(page.permalink) + link_to text, wiki_page_path(:permalink => page.permalink) end end @@ -45,7 +45,7 @@ module PagesHelper toc.gsub(/
      • ([^<>\n]*)/) do section_count += 1 "
      • #{$1}" - end + end.html_safe end end diff --git a/app/views/pages/_form.html.haml b/app/views/pages/_form.html.haml index 40e3a466..2e24adb6 100644 --- a/app/views/pages/_form.html.haml +++ b/app/views/pages/_form.html.haml @@ -79,21 +79,14 @@ Siehe = link_to "Tabellen", "http://www.mediawiki.org/wiki/Help:Tables", :target => '_blank' -- form_for @page do |f| - = f.error_messages +- simple_form_for @page do |f| = f.hidden_field :lock_version + = f.input :title + = f.input :body, :input_html => {:size => "65x30"} %p - %b Titel - %br/ - = f.text_field :title - %p - %b Inhalt - %br/ - = f.text_area :body, :size => "65x30" - %p - = f.submit "Vorschau", :name => 'preview' + = submit_tag "Vorschau", :name => 'preview' | - = f.submit "Speichern" + = submit_tag "Speichern" | = link_to "Abbrechen", @page | Oberseite ändern: diff --git a/app/views/pages/_recent_changes.html.haml b/app/views/pages/_recent_changes.html.haml index 213ca5f8..89613731 100644 --- a/app/views/pages/_recent_changes.html.haml +++ b/app/views/pages/_recent_changes.html.haml @@ -3,5 +3,5 @@ %tr %th Titel %th Zuletzt aktualisiert - - for page in @recent_pages + - for page in Page.non_redirected.order(:updated_at.desc) = render :partial => "page_list_item", :locals => {:page => page, :level => 0, :siteMap => 0} diff --git a/app/views/pages/_site_map.html.haml b/app/views/pages/_site_map.html.haml index dc31505a..d427518a 100644 --- a/app/views/pages/_site_map.html.haml +++ b/app/views/pages/_site_map.html.haml @@ -6,6 +6,6 @@ - homepage = Page.find_by_permalink('Home') - unless homepage.nil? = render :partial => 'page_list_item', :locals => {:page => homepage, :level => 0, :siteMap => 1} - - for page in @top_pages + - for page in Page.no_parent.non_redirected.order(:created_at.desc) - if page.id != homepage.id = render :partial => 'page_list_item', :locals => {:page => page, :level => 0, :siteMap => 1} diff --git a/app/views/pages/_title_list.html.haml b/app/views/pages/_title_list.html.haml index 855a37bf..ab1dcfb2 100644 --- a/app/views/pages/_title_list.html.haml +++ b/app/views/pages/_title_list.html.haml @@ -3,5 +3,5 @@ %tr %th Titel %th Zuletzt aktualisiert - - for page in @pages + - for page in Page.non_redirected.order(:title.desc) = render :partial => "page_list_item", :locals => {:page => page, :level => 0, :siteMap => 0} \ No newline at end of file diff --git a/app/views/pages/all.html.haml b/app/views/pages/all.html.haml index 49f3fd74..ac84ba19 100644 --- a/app/views/pages/all.html.haml +++ b/app/views/pages/all.html.haml @@ -14,8 +14,8 @@ .left_column{:style => "width:100%"} .box_title #editOrderNav - = remote_link_to 'Letzte Änderungen', :update => 'left_column', :url => {:action => 'all', :view => 'recentChanges'} - = remote_link_to 'Seiten-Liste', :update => 'left_column', :url => {:action => 'all', :view => 'titleList'} - = remote_link_to 'Site Map', :update => 'left_column', :url => {:action => 'all', :view => 'siteMap'} + = link_to 'Letzte Änderungen', all_pages_path(:view => 'recent_changes') + = link_to 'Seiten-Liste', all_pages_path(:view => 'title_list') + = link_to 'Site Map', all_pages_path(:view => 'site_map') #left_column - = render :partial => 'recent_changes' \ No newline at end of file + = render :partial => params[:view] || 'recent_changes' \ No newline at end of file diff --git a/app/views/pages/show.html.haml b/app/views/pages/show.html.haml index de3f79cd..58f9de77 100644 --- a/app/views/pages/show.html.haml +++ b/app/views/pages/show.html.haml @@ -16,9 +16,9 @@ #sidebar #sidebar-links = link_to "Bearbeiten", edit_page_path(@page) - = link_to_function "Versionen (#{@page.versions.count})", "Element.toggle('versions')" + = link_to "Versionen (#{@page.versions.count})", "#versions", 'data-toggle_this' => '#versions' - unless @page.children.empty? - = link_to_function "Unterseiten", "Element.toggle('subpages')" + = link_to "Unterseiten", "#subpages", 'data-toggle_this' => '#subpages' #versions{:style => "display:none"} .box_title %h2 Versionen diff --git a/config/application.rb b/config/application.rb index 0aa8f3a0..8338592c 100644 --- a/config/application.rb +++ b/config/application.rb @@ -14,6 +14,7 @@ module Foodsoft # Custom directories with classes and modules you want to be autoloadable. # config.autoload_paths += %W(#{config.root}/extras) + config.autoload_paths += %W(#{config.root}/lib) # Only load the plugins named here, in the order given (default is alphabetical). # :all can be used as a placeholder for all plugins not explicitly named. diff --git a/config/locales/de.yml b/config/locales/de.yml index 0d1cbfc3..52766355 100644 --- a/config/locales/de.yml +++ b/config/locales/de.yml @@ -206,6 +206,7 @@ de: labels: password: 'Passwort' description: 'Beschreibung' + title: 'Titel' workgroup: weekly_task: 'Monatlichen Job definieren?' weekday: 'Wochentag' @@ -227,6 +228,8 @@ de: subject: 'Betreff' body: 'Inhalt' private: 'privat verschicken, Nachricht erscheint nicht im Foodsoft Posteingang' + page: + body: 'Inhalt' hints: task: duration: 'Wie lange dauert die Aufgabe, 1-3 Stunden' diff --git a/config/routes.rb b/config/routes.rb index ee7df381..5e711ada 100644 --- a/config/routes.rb +++ b/config/routes.rb @@ -30,7 +30,7 @@ Foodsoft::Application.routes.draw do get :version, :on => :member get :revert, :on => :member end - match '/wiki/:permalink' => 'pages#show', :constraints => {:permalink => /[^\s]+/}, :as => 'wiki_page' + match '/wiki/:permalink' => 'pages#show', :as => 'wiki_page' # , :constraints => {:permalink => /[^\s]+/} match '/wiki' => 'pages#show', :defaults => {:permalink => 'Home'}, :as => 'wiki' ############ Orders, ordering diff --git a/public/stylesheets/main.css b/public/stylesheets/main.css index 6f073a50..27d6a46e 100644 --- a/public/stylesheets/main.css +++ b/public/stylesheets/main.css @@ -581,8 +581,8 @@ a.new_wiki_link { color: grey; } #breadcrump { - font-size: 0.5em; - margin-bottom: 5px; + font-size: 0.8em; + margin-bottom: 3px; height: 1em; color: #ED0606; } #breadcrump a { From 0b1682af7cf17d3cb2689740ea4b2527d2db83ad Mon Sep 17 00:00:00 2001 From: benni Date: Wed, 18 May 2011 15:52:06 +0200 Subject: [PATCH 031/335] Fixed suppliers module. --- app/controllers/application_controller.rb | 10 +-- app/controllers/ordering_controller.rb | 2 - app/controllers/suppliers_controller.rb | 2 +- app/models/supplier.rb | 12 ++-- app/views/suppliers/_form.haml | 79 ++++++----------------- app/views/suppliers/edit.haml | 9 +-- app/views/suppliers/index.haml | 4 +- app/views/suppliers/new.haml | 10 +-- config/locales/de.yml | 15 +++++ 9 files changed, 56 insertions(+), 87 deletions(-) diff --git a/app/controllers/application_controller.rb b/app/controllers/application_controller.rb index 5cebad4c..19958a51 100644 --- a/app/controllers/application_controller.rb +++ b/app/controllers/application_controller.rb @@ -48,11 +48,11 @@ class ApplicationController < ActionController::Base # We have an authenticated user, now check role... # Roles gets the user through his memberships. hasRole = case role - when "admin" then user.role_admin? - when "finance" then user.role_finance? - when "article_meta" then user.role_article_meta? - when "suppliers" then user.role_suppliers? - when "orders" then user.role_orders? + when "admin" then current_user.role_admin? + when "finance" then current_user.role_finance? + when "article_meta" then current_user.role_article_meta? + when "suppliers" then current_user.role_suppliers? + when "orders" then current_user.role_orders? when "any" then true # no role required else false # any unknown role will always fail end diff --git a/app/controllers/ordering_controller.rb b/app/controllers/ordering_controller.rb index 87283011..b7a4bb81 100644 --- a/app/controllers/ordering_controller.rb +++ b/app/controllers/ordering_controller.rb @@ -5,8 +5,6 @@ class OrderingController < ApplicationController before_filter :ensure_ordergroup_member before_filter :ensure_open_order, :only => [:order, :stock_order, :saveOrder] - verify :method => :post, :only => [:saveOrder], :redirect_to => {:action => :index} - # Index page. def index end diff --git a/app/controllers/suppliers_controller.rb b/app/controllers/suppliers_controller.rb index 59051536..7c74c14f 100644 --- a/app/controllers/suppliers_controller.rb +++ b/app/controllers/suppliers_controller.rb @@ -3,7 +3,7 @@ class SuppliersController < ApplicationController helper :deliveries def index - @suppliers = Supplier.without_deleted :order => 'name' + @suppliers = Supplier.order(:name) @deliveries = Delivery.recent end diff --git a/app/models/supplier.rb b/app/models/supplier.rb index b1768bfe..ae5854cb 100644 --- a/app/models/supplier.rb +++ b/app/models/supplier.rb @@ -9,10 +9,14 @@ class Supplier < ActiveRecord::Base has_many :invoices belongs_to :shared_supplier # for the sharedLists-App - attr_accessible :name, :address, :phone, :phone2, :fax, :email, :url, :contact_person, :customer_number, :delivery_days, :order_howto, :note, :shared_supplier_id, :min_order_quantity - - validates_length_of :name, :in => 4..30 - validates_uniqueness_of :name + attr_accessible :name, :address, :phone, :phone2, :fax, :email, :url, :contact_person, :customer_number, + :delivery_days, :order_howto, :note, :shared_supplier_id, :min_order_quantity + + validates :name, :presence => true, :length => { :in => 4..30 }, :uniqueness => true + validates :phone, :presence => true, :length => { :in => 8..20 } + validates :address, :presence => true, :length => { :in => 8..50 } +# validates_length_of :name, :in => 4..30 +# validates_uniqueness_of :name validates_length_of :phone, :in => 8..20 validates_length_of :address, :in => 8..50 diff --git a/app/views/suppliers/_form.haml b/app/views/suppliers/_form.haml index e3b3a2b7..fe935637 100644 --- a/app/views/suppliers/_form.haml +++ b/app/views/suppliers/_form.haml @@ -1,60 +1,19 @@ -= error_messages_for 'supplier' - -- if @supplier.shared_supplier - %p Lieferantin wird mit externer Datenbank verknüpft. -.edit_form{:style=>"width:30em"} - %table - %tr - %td - %label{:for => "supplier_name"} Name - %td= @f.text_field :name - %tr - %td - %label{:for => "supplier_address"} Adresse - %td= @f.text_field :address - %tr - %td - %label{:for => "supplier_phone"} Telefon - %td= @f.text_field :phone - %tr - %td - %label{:for => "supplier_phone2"} Telefon2 - %td= @f.text_field :phone2 - %tr - %td - %label{:for => "supplier_fax"} Fax - %td= @f.text_field :fax - %tr - %td - %label{:for => "supplier_email"} E-Mail - %td= @f.text_field :email - %tr - %td - %label{:for => "supplier_url"} Hompage - %td= @f.text_field :url - %tr - %td - %label{:for => "supplier_contact_person"} Kotakt Person - %td= @f.text_field :contact_person - %tr - %td - %label{:for => "supplier_customer_number"} Kundennummer - %td= @f.text_field :customer_number - %tr - %td - %label{:for => "supplier_delivery_days"} Liefertage - %td= @f.text_field :delivery_days - %tr - %td - %label{:for => "supplier_order_howto"} BestellHowto - %td= @f.text_field :order_howto - %tr - %td - %label{:for => "supplier_note"} Notiz - %td= @f.text_field :note - %tr - %td - %label{:for => "supplier_min_order_quantity"} Mindestbestellmenge - %td= @f.text_field :min_order_quantity - = @f.hidden_field :shared_supplier_id - +- simple_form_for @supplier do |f| + - if @supplier.shared_supplier + %p Lieferantin wird mit externer Datenbank verknüpft. + = f.hidden_field :shared_supplier_id + = f.input :name + = f.input :address + = f.input :phone + = f.input :phone2 + = f.input :fax + = f.input :email + = f.input :url + = f.input :contact_person + = f.input :customer_number + = f.input :delivery_days + = f.input :order_howto + = f.input :note + = f.input :min_order_quantity + = f.submit + = link_to 'oder abbrechen', suppliers_path \ No newline at end of file diff --git a/app/views/suppliers/edit.haml b/app/views/suppliers/edit.haml index 692f80dd..24a35c12 100644 --- a/app/views/suppliers/edit.haml +++ b/app/views/suppliers/edit.haml @@ -1,6 +1,3 @@ -%h1 Lieferantin bearbeiten -- form_for @supplier do |@f| - = render :partial => 'form' - = submit_tag 'Speichern' - | - = link_to 'Abbrechen', suppliers_path \ No newline at end of file +- title "Lieferantin bearbeiten" + += render "form" \ No newline at end of file diff --git a/app/views/suppliers/index.haml b/app/views/suppliers/index.haml index cb3c5cf1..56079919 100644 --- a/app/views/suppliers/index.haml +++ b/app/views/suppliers/index.haml @@ -26,8 +26,8 @@ %td= link_to h(supplier.name) , supplier %td=h supplier.phone %td=h supplier.customer_number - %td= link_to "Artikel (#{supplier.articles.without_deleted.count})", supplier_articles_path(supplier) - %td= link_to "im Lager (#{supplier.stock_articles.without_deleted.count})", stock_articles_path + %td= link_to "Artikel (#{supplier.articles.count})", supplier_articles_path(supplier) + %td= link_to "im Lager (#{supplier.stock_articles.count})", stock_articles_path %td= link_to "Lieferungen (#{supplier.deliveries.count})", supplier_deliveries_path(supplier) .right_column{:style => "width:37%"} diff --git a/app/views/suppliers/new.haml b/app/views/suppliers/new.haml index c8a4d1a1..07fdb6ef 100644 --- a/app/views/suppliers/new.haml +++ b/app/views/suppliers/new.haml @@ -1,7 +1,3 @@ -%h1 Neue Lieferantinn -- form_for @supplier do |@f| - = render :partial => 'form' - = submit_tag "Speichern" - | - = link_to 'Abbrechen', suppliers_path - \ No newline at end of file +- title "Neue Lieferantin" + += render "form" \ No newline at end of file diff --git a/config/locales/de.yml b/config/locales/de.yml index 52766355..b13f81be 100644 --- a/config/locales/de.yml +++ b/config/locales/de.yml @@ -207,6 +207,7 @@ de: password: 'Passwort' description: 'Beschreibung' title: 'Titel' + email: 'E-Mail' workgroup: weekly_task: 'Monatlichen Job definieren?' weekday: 'Wochentag' @@ -230,7 +231,21 @@ de: private: 'privat verschicken, Nachricht erscheint nicht im Foodsoft Posteingang' page: body: 'Inhalt' + supplier: + address: 'Adresse' + phone: 'Telefon' + phone2: 'Telefon 2' + fax: 'FAX' + url: 'Homepage' + contact_person: 'Ansprechparter_in' + customer_number: 'Kundennummer' + delivery_days: 'Liefertage' + order_howto: 'Howto Bestellen' + note: 'Notiz' + min_order_quantity: 'Mindestbestellmenge' hints: task: duration: 'Wie lange dauert die Aufgabe, 1-3 Stunden' required_users: 'Wieviel Benutzerinnen werden insgesamt benötigt?' + supplier: + min_order_quantity: 'Die Mindestbestellmenge wird während der Bestellung angezeigt und soll motivieren' From 0decbb36e196b712f708c4e46a2460a11670daaa Mon Sep 17 00:00:00 2001 From: benni Date: Wed, 18 May 2011 16:10:30 +0200 Subject: [PATCH 032/335] Refactored article_categories. --- Gemfile | 1 + Gemfile.lock | 6 ++ .../article_categories_controller.rb | 64 ++----------------- app/controllers/articles_controller.rb | 4 +- app/models/article_category.rb | 5 +- app/views/article_categories/_form.html.haml | 4 ++ app/views/article_categories/_form.rhtml | 24 ------- app/views/article_categories/_list.rhtml | 27 -------- app/views/article_categories/edit.html.haml | 3 + app/views/article_categories/index.html.haml | 15 ++++- app/views/article_categories/new.html.haml | 3 + config/locales/de.yml | 1 + 12 files changed, 39 insertions(+), 118 deletions(-) create mode 100644 app/views/article_categories/_form.html.haml delete mode 100644 app/views/article_categories/_form.rhtml delete mode 100644 app/views/article_categories/_list.rhtml create mode 100644 app/views/article_categories/edit.html.haml create mode 100644 app/views/article_categories/new.html.haml diff --git a/Gemfile b/Gemfile index 1cbdb910..0906428c 100644 --- a/Gemfile +++ b/Gemfile @@ -12,6 +12,7 @@ gem 'jquery-rails' gem 'simple_form' gem 'rails3_acts_as_paranoid' gem 'meta_where' +gem 'inherited_resources' group :development do gem 'annotate' diff --git a/Gemfile.lock b/Gemfile.lock index 0c0bbb96..b70016c1 100644 --- a/Gemfile.lock +++ b/Gemfile.lock @@ -36,8 +36,12 @@ GEM exception_notification (2.4.0) fastercsv (1.5.4) haml (3.1.1) + has_scope (0.5.0) hirb (0.3.4) i18n (0.5.0) + inherited_resources (1.2.2) + has_scope (~> 0.5.0) + responders (~> 0.6.0) jquery-rails (1.0.1) railties (~> 3.0) thor (~> 0.14) @@ -84,6 +88,7 @@ GEM rake (>= 0.8.7) thor (~> 0.14.4) rake (0.8.7) + responders (0.6.4) simple_form (1.3.1) thor (0.14.6) treetop (1.4.9) @@ -100,6 +105,7 @@ DEPENDENCIES fastercsv haml hirb + inherited_resources jquery-rails meta_where mysql diff --git a/app/controllers/article_categories_controller.rb b/app/controllers/article_categories_controller.rb index 944c1717..21ee691f 100644 --- a/app/controllers/article_categories_controller.rb +++ b/app/controllers/article_categories_controller.rb @@ -1,71 +1,15 @@ class ArticleCategoriesController < ApplicationController + inherit_resources # Build default REST Actions via plugin + before_filter :authenticate_article_meta - def index - @article_categories = ArticleCategory.all :order => 'name' - end - - def new - @article_category = ArticleCategory.new - - render :update do |page| - page['category_form'].replace_html :partial => 'article_categories/form' - page['category_form'].show - end - end - - def edit - @article_category = ArticleCategory.find(params[:id]) - - render :update do |page| - page['category_form'].replace_html :partial => 'article_categories/form' - page['category_form'].show - end - end - def create - @article_category = ArticleCategory.new(params[:article_category]) - - if @article_category.save - render :update do |page| - page['category_form'].hide - page['category_list'].replace_html :partial => 'article_categories/list' - page['category_'+@article_category.id.to_s].visual_effect(:highlight, - :duration => 2) - end - else - render :update do |page| - page['category_form'].replace_html :partial => 'article_categories/form' - end - end + create!(:notice => "Die Kategorie wurde gespeichert") { article_categories_path } end def update - @article_category = ArticleCategory.find(params[:id]) - - if @article_category.update_attributes(params[:article_category]) - render :update do |page| - page['category_form'].hide - page['category_list'].replace_html :partial => 'article_categories/list' - page['category_'+@article_category.id.to_s].visual_effect(:highlight, - :duration => 2) - end - else - render :update do |page| - page['category_form'].replace_html :partial => 'article_categories/form' - end - end + update!(:notice => "Die Kategorie wurde aktualisiert") { article_categories_path } end - def destroy - @article_category = ArticleCategory.find(params[:id]) - @article_category.destroy - - if @article_category.destroy - render :update do |page| - page['category_'+@article_category.id.to_s].visual_effect :drop_out - end - end - end end diff --git a/app/controllers/articles_controller.rb b/app/controllers/articles_controller.rb index 69da3b76..f1425737 100644 --- a/app/controllers/articles_controller.rb +++ b/app/controllers/articles_controller.rb @@ -28,8 +28,8 @@ class ArticlesController < ApplicationController # if somebody uses the search field: conditions = ["articles.name LIKE ?", "%#{params[:query]}%"] unless params[:query].nil? - @total = @supplier.articles.without_deleted.count(:conditions => conditions) - @articles = @supplier.articles.without_deleted.paginate( + @total = @supplier.articles.count(:conditions => conditions) + @articles = @supplier.articles.paginate( :order => sort, :conditions => conditions, :page => params[:page], diff --git a/app/models/article_category.rb b/app/models/article_category.rb index 2fc39aaf..aa82e719 100644 --- a/app/models/article_category.rb +++ b/app/models/article_category.rb @@ -1,8 +1,7 @@ class ArticleCategory < ActiveRecord::Base has_many :articles - - validates_length_of :name, :in => 2..20 - validates_uniqueness_of :name + + validates :name, :presence => true, :uniqueness => true, :length => { :in => 2..20 } end diff --git a/app/views/article_categories/_form.html.haml b/app/views/article_categories/_form.html.haml new file mode 100644 index 00000000..b0244b2f --- /dev/null +++ b/app/views/article_categories/_form.html.haml @@ -0,0 +1,4 @@ += simple_form_for @article_category do |f| + = f.input :name + = f.input :description + = f.submit \ No newline at end of file diff --git a/app/views/article_categories/_form.rhtml b/app/views/article_categories/_form.rhtml deleted file mode 100644 index 357b7252..00000000 --- a/app/views/article_categories/_form.rhtml +++ /dev/null @@ -1,24 +0,0 @@ -<% remote_form_for @article_category, - :before => "Element.show('loader')", - :success => "Element.hide('loader')" do |@f| %> - - <%= @f.error_messages %> - - - - - - - - - -
        NameBeschreibung
        - <%= @f.text_field :name, :size => 20 %> - - <%= @f.text_field :description, :size => 30 %> -
        - -
        - <%= submit_tag "Speichern" %> | <%= link_to_function("Abbrechen", "Element.hide('category_form')") %> -<% end %> - diff --git a/app/views/article_categories/_list.rhtml b/app/views/article_categories/_list.rhtml deleted file mode 100644 index baa2c7ae..00000000 --- a/app/views/article_categories/_list.rhtml +++ /dev/null @@ -1,27 +0,0 @@ - - - - - - -<% for article_category in ArticleCategory.find(:all) -%> - 'category') -%>" id="category_<%= article_category.id -%>"> - - - - - -<% end -%> -
        NameBeschreibung
        <%=h article_category.name -%><%=h article_category.description -%><%= link_to_remote icon(:edit), - :url => edit_article_category_path(article_category), - :method => :get, - :before => "Element.show('loader')", - :success => "Element.hide('loader')" -%><%= link_to_remote icon(:delete), - :url => article_category, - :method => :delete, - :confirm => 'Are you sure?' -%>
        -
        -<%= link_to_remote 'Neue Kategorie', :url => new_article_category_path, - :method => :get, - :before => "Element.show('loader')", - :success => "Element.hide('loader')" %> diff --git a/app/views/article_categories/edit.html.haml b/app/views/article_categories/edit.html.haml new file mode 100644 index 00000000..3e6ebc25 --- /dev/null +++ b/app/views/article_categories/edit.html.haml @@ -0,0 +1,3 @@ +- title "Kategorie ändern" + += render 'form' \ No newline at end of file diff --git a/app/views/article_categories/index.html.haml b/app/views/article_categories/index.html.haml index 137dfdc5..b907b87b 100644 --- a/app/views/article_categories/index.html.haml +++ b/app/views/article_categories/index.html.haml @@ -4,5 +4,16 @@ .box_title %h2 Artikelkategorien .column_content#categories - #category_form.box.edit_form{:style => "display:none;margin-bottom:1em;"} - #category_list= render :partial => 'article_categories/list' \ No newline at end of file + %table + %tr + %th Name + %th Beschreibung + %th + - for article_category in ArticleCategory.all + %tr{:class => cycle("even","odd", :name => 'category')}[article_category] + %td= article_category.name + %td= article_category.description + %td + = link_to icon(:edit), edit_article_category_path(article_category) + = link_to icon(:delete), article_category, :method => :delete, :confirm => 'Are you sure?' + %p= link_to 'Neue Kategorie anlegen', new_article_category_path diff --git a/app/views/article_categories/new.html.haml b/app/views/article_categories/new.html.haml new file mode 100644 index 00000000..055d656c --- /dev/null +++ b/app/views/article_categories/new.html.haml @@ -0,0 +1,3 @@ +- title "Neue Kategorie anlegen" + += render 'form' \ No newline at end of file diff --git a/config/locales/de.yml b/config/locales/de.yml index b13f81be..65586699 100644 --- a/config/locales/de.yml +++ b/config/locales/de.yml @@ -159,6 +159,7 @@ de: ordergroup: Bestellgruppe task: Aufgabe message: Nachricht + article_category: Artikelkategorie attributes: article: price: Nettopreis From 9388e918a7281b47c071bd495d89e96f5a4a1745 Mon Sep 17 00:00:00 2001 From: benni Date: Wed, 18 May 2011 17:37:10 +0200 Subject: [PATCH 033/335] Implemented fancy box for ajax forms. Refactored articles modul. --- app/controllers/articles_controller.rb | 92 +---- app/views/articles/_article_row.rhtml | 18 +- ...icle.haml => _destroy_active_article.haml} | 2 - app/views/articles/_form.html.haml | 59 +-- app/views/articles/_new.haml | 2 - app/views/articles/_new_article_row.haml | 2 +- app/views/articles/create.js.erb | 2 + app/views/articles/destroy.js.erb | 5 + app/views/articles/index.haml | 37 +- app/views/articles/index.js.erb | 1 + app/views/articles/new.js.erb | 1 + app/views/articles/update.js.erb | 2 + app/views/layouts/application.haml | 5 +- config/locales/de.yml | 14 + .../javascripts/jquery.fancybox-1.3.4.pack.js | 46 +++ public/stylesheets/fancybox/blank.gif | Bin 0 -> 43 bytes public/stylesheets/fancybox/fancy_close.png | Bin 0 -> 1517 bytes public/stylesheets/fancybox/fancy_loading.png | Bin 0 -> 10195 bytes .../stylesheets/fancybox/fancy_nav_left.png | Bin 0 -> 1446 bytes .../stylesheets/fancybox/fancy_nav_right.png | Bin 0 -> 1454 bytes .../stylesheets/fancybox/fancy_shadow_e.png | Bin 0 -> 107 bytes .../stylesheets/fancybox/fancy_shadow_n.png | Bin 0 -> 106 bytes .../stylesheets/fancybox/fancy_shadow_ne.png | Bin 0 -> 347 bytes .../stylesheets/fancybox/fancy_shadow_nw.png | Bin 0 -> 324 bytes .../stylesheets/fancybox/fancy_shadow_s.png | Bin 0 -> 111 bytes .../stylesheets/fancybox/fancy_shadow_se.png | Bin 0 -> 352 bytes .../stylesheets/fancybox/fancy_shadow_sw.png | Bin 0 -> 340 bytes .../stylesheets/fancybox/fancy_shadow_w.png | Bin 0 -> 103 bytes .../stylesheets/fancybox/fancy_title_left.png | Bin 0 -> 503 bytes .../stylesheets/fancybox/fancy_title_main.png | Bin 0 -> 96 bytes .../stylesheets/fancybox/fancy_title_over.png | Bin 0 -> 70 bytes .../fancybox/fancy_title_right.png | Bin 0 -> 506 bytes public/stylesheets/fancybox/fancybox-x.png | Bin 0 -> 203 bytes public/stylesheets/fancybox/fancybox-y.png | Bin 0 -> 176 bytes public/stylesheets/fancybox/fancybox.png | Bin 0 -> 15287 bytes public/stylesheets/jquery.fancybox-1.3.4.css | 359 ++++++++++++++++++ 36 files changed, 490 insertions(+), 157 deletions(-) rename app/views/articles/{_destroyActiveArticle.haml => _destroy_active_article.haml} (76%) delete mode 100644 app/views/articles/_new.haml create mode 100644 app/views/articles/create.js.erb create mode 100644 app/views/articles/destroy.js.erb create mode 100644 app/views/articles/index.js.erb create mode 100644 app/views/articles/new.js.erb create mode 100644 app/views/articles/update.js.erb create mode 100644 public/javascripts/jquery.fancybox-1.3.4.pack.js create mode 100644 public/stylesheets/fancybox/blank.gif create mode 100644 public/stylesheets/fancybox/fancy_close.png create mode 100644 public/stylesheets/fancybox/fancy_loading.png create mode 100644 public/stylesheets/fancybox/fancy_nav_left.png create mode 100644 public/stylesheets/fancybox/fancy_nav_right.png create mode 100644 public/stylesheets/fancybox/fancy_shadow_e.png create mode 100644 public/stylesheets/fancybox/fancy_shadow_n.png create mode 100644 public/stylesheets/fancybox/fancy_shadow_ne.png create mode 100644 public/stylesheets/fancybox/fancy_shadow_nw.png create mode 100644 public/stylesheets/fancybox/fancy_shadow_s.png create mode 100644 public/stylesheets/fancybox/fancy_shadow_se.png create mode 100644 public/stylesheets/fancybox/fancy_shadow_sw.png create mode 100644 public/stylesheets/fancybox/fancy_shadow_w.png create mode 100644 public/stylesheets/fancybox/fancy_title_left.png create mode 100644 public/stylesheets/fancybox/fancy_title_main.png create mode 100644 public/stylesheets/fancybox/fancy_title_over.png create mode 100644 public/stylesheets/fancybox/fancy_title_right.png create mode 100644 public/stylesheets/fancybox/fancybox-x.png create mode 100644 public/stylesheets/fancybox/fancybox-y.png create mode 100644 public/stylesheets/fancybox/fancybox.png create mode 100644 public/stylesheets/jquery.fancybox-1.3.4.css diff --git a/app/controllers/articles_controller.rb b/app/controllers/articles_controller.rb index f1425737..aeed1c88 100644 --- a/app/controllers/articles_controller.rb +++ b/app/controllers/articles_controller.rb @@ -25,68 +25,35 @@ class ArticlesController < ApplicationController sort = "article_categories.name, articles.name" end - # if somebody uses the search field: - conditions = ["articles.name LIKE ?", "%#{params[:query]}%"] unless params[:query].nil? + @articles = @supplier.articles.includes(:article_category).order(sort) + @articles = @articles.where(:name.matches => "%#{params[:query]}%") unless params[:query].nil? - @total = @supplier.articles.count(:conditions => conditions) - @articles = @supplier.articles.paginate( - :order => sort, - :conditions => conditions, - :page => params[:page], - :per_page => @per_page, - :include => :article_category - ) + @total = @articles.size + @articles = @articles.paginate(:page => params[:page], :per_page => @per_page) respond_to do |format| - format.html # list.haml - format.js do - render :update do |page| - page.replace_html 'table', :partial => "articles" - end - end + format.html + format.js { render :layout => false } end end def new @article = @supplier.articles.build(:tax => 7.0) - - render :update do |page| - page["edit_article"].replace_html :partial => 'new' - page["edit_article"].show - end + render :layout => false end def create @article = Article.new(params[:article]) if @article.valid? and @article.save - render :update do |page| - page.Element.hide('edit_article') - page.insert_html :top, 'listbody', :partial => 'new_article_row' - page[@article.id.to_s].visual_effect(:highlight, - :duration => 2) - # highlights article - if !@article.availability - page[@article.id.to_s].addClassName 'unavailable' - else - page[@article.id.to_s].addClassName 'just_updated' - end - end + render :layout => false else - render :update do |page| - page.replace_html 'edit_article', :partial => "new" - end - end + render :action => 'new', :layout => false + end end - # edit an article and its price def edit @article = Article.find(params[:id]) - - render :update do |page| - page["edit_article"].replace_html :partial => 'edit' - page["edit_article"].show - end - #render :partial => "quick_edit", :layout => false + render :action => 'new', :layout => false end # Updates one Article and highlights the line if succeded @@ -94,46 +61,17 @@ class ArticlesController < ApplicationController @article = Article.find(params[:id]) if @article.update_attributes(params[:article]) - render :update do |page| - page["edit_article"].hide - page[@article.id.to_s].replace_html :partial => 'article_row' - - # hilights an updated article if the article ist available - page[@article.id.to_s].addClassName 'just_updated' if @article.availability - - # highlights an available article and de-highlights in other case - if !@article.availability - page[@article.id.to_s].addClassName 'unavailable' - # remove updated-class - page[@article.id.to_s].removeClassName 'just_updated' - else - page[@article.id.to_s].removeClassName 'unavailable' - end - - page[@article.id.to_s].visual_effect(:highlight, :delay => 0.5, :duration => 2) - end + render :layout => false else - render :update do |page| - page["edit_article"].replace_html :partial => "edit" - end + render :action => 'new', :layout => false end end # Deletes article from database. send error msg, if article is used in a current order def destroy @article = Article.find(params[:id]) - - @order = @article.in_open_order # If article is in an active Order, the Order will be returned - if @order - render :update do |page| - page.insert_html :after, @article.id.to_s, :partial => 'destroyActiveArticle' - end - else - @article.destroy - render :update do |page| - page[@article.id.to_s].remove - end - end + @article.destroy unless @order = @article.in_open_order # If article is in an active Order, the Order will be returned + render :layout => false end # Renders a form for editing all articles from a supplier diff --git a/app/views/articles/_article_row.rhtml b/app/views/articles/_article_row.rhtml index 7ad87f48..fc26c2b5 100644 --- a/app/views/articles/_article_row.rhtml +++ b/app/views/articles/_article_row.rhtml @@ -2,11 +2,11 @@ <%= check_box_tag 'selected_articles[]', @article.id.to_s, false, {:id => "checkbox_#{@article.id.to_s}", :onclick => "checkRow('#{@article.id.to_s}')"} %> -<%=h @article.name -%> +<%= @article.name -%> <%= @article.origin -%> -<%=h truncate(@article.article_category.name, :length => 11) if @article.article_category -%> -<%=h @article.unit -%> -<%=h truncate(@article.note, :length => 11) -%> +<%= truncate(@article.article_category.name, :length => 11) if @article.article_category -%> +<%= @article.unit -%> +<%= truncate(@article.note, :length => 11) -%> <%= @article.unit_quantity -%> edit_supplier_article_path(@supplier, @article) %> - <%= remote_link_to icon(:delete, :onclick => "checkRow('#{@article.id.to_s}')"), - :url => [@supplier, @article], - :method => :delete, - :confirm => 'Bist du sicher?' %> + <%= link_to icon(:edit, :onclick => "checkRow('#{@article.id.to_s}')"), edit_supplier_article_path(@supplier, @article), + :remote => true %> + <%= link_to icon(:delete, :onclick => "checkRow('#{@article.id.to_s}')"), [@supplier, @article], + :method => :delete, :confirm => 'Bist du sicher?', :remote => true %> \ No newline at end of file diff --git a/app/views/articles/_destroyActiveArticle.haml b/app/views/articles/_destroy_active_article.haml similarity index 76% rename from app/views/articles/_destroyActiveArticle.haml rename to app/views/articles/_destroy_active_article.haml index c18bde5a..ea742199 100644 --- a/app/views/articles/_destroyActiveArticle.haml +++ b/app/views/articles/_destroy_active_article.haml @@ -4,6 +4,4 @@ wird in laufenden Bestellungen verwendet und kann nicht gelöscht werden. Bitte zuerst den Artikel aus den Bestellungen = link_to "entfernen", :controller => 'orders', :action => 'edit', :id => @order - oder - = link_to_function 'abbrechen', "Element.remove('edit_#{@article.id.to_s}')" \ No newline at end of file diff --git a/app/views/articles/_form.html.haml b/app/views/articles/_form.html.haml index f2430210..be3dc68e 100644 --- a/app/views/articles/_form.html.haml +++ b/app/views/articles/_form.html.haml @@ -1,45 +1,18 @@ -- remote_form_for [@supplier, @article], :before => "Element.show('loader')", | - :success => "Element.hide('loader')" do |form| | += simple_form_for [@supplier, @article], :remote => true do |f| + = f.input :availability + = f.input :name + = f.input :origin + = f.input :manufacturer + = f.input :unit + = f.input :note + = f.association :article_category - = form.error_messages - %p - %b Verfügbar? - = form.check_box :availability - %table{ :style => "width: 20em"} - %tr - %th Name - %th Herkunft - %th Hersteller - %th Einheit - %th Notiz - %th kategorie - %tbody - %tr - %td= form.text_field :name, :size => 15 - %td= form.text_field :origin, :size => 5 - %td= form.text_field :manufacturer, :size => 8 - %td= form.text_field :unit, :size => 5 - %td= form.text_field :note, :size => 15 - %td= form.select :article_category_id, ArticleCategory.find(:all, :order => 'name').collect {|a| [ a.name, a.id ] } - %br/ - %table{ :style=>"width:35em"} - %tr - %th Nettopreis - %th Gebindegröße - %th Bestellnummer - %th MwSt - %th Pfand - %tbody - %tr - %td= form.text_field :price, :size => 5 - %td= form.text_field :unit_quantity, :size => 5 - %td= form.text_field :order_number, :size => 10 - %td= form.text_field :tax, :size => 5 - %td= form.text_field :deposit, :size => 5 - - = form.hidden_field :shared_updated_on - = form.hidden_field :supplier_id + = f.input :price + = f.input :unit_quantity + = f.input :order_number + = f.input :tax + = f.input :deposit + = f.submit - = submit_tag "Speichern" - | - = link_to_function "Abbrechen", "Element.hide('edit_article')" \ No newline at end of file + = f.hidden_field :shared_updated_on + = f.hidden_field :supplier_id \ No newline at end of file diff --git a/app/views/articles/_new.haml b/app/views/articles/_new.haml deleted file mode 100644 index 8b07a58b..00000000 --- a/app/views/articles/_new.haml +++ /dev/null @@ -1,2 +0,0 @@ -%h3 Neuer Artikel -= render :partial => 'form' \ No newline at end of file diff --git a/app/views/articles/_new_article_row.haml b/app/views/articles/_new_article_row.haml index 5fc86275..c236606a 100644 --- a/app/views/articles/_new_article_row.haml +++ b/app/views/articles/_new_article_row.haml @@ -1,2 +1,2 @@ -%tr{:class => cycle('even','odd'), :id => @article.id, :onclick => "checkRow('#{@article.id.to_s}')"} +%tr{:class => row_classes(@article), :id => @article.id, :onclick => "checkRow('#{@article.id.to_s}')"} = render :partial => 'article_row' \ No newline at end of file diff --git a/app/views/articles/create.js.erb b/app/views/articles/create.js.erb new file mode 100644 index 00000000..a06276fd --- /dev/null +++ b/app/views/articles/create.js.erb @@ -0,0 +1,2 @@ +$('#listbody').prepend('<%= escape_javascript(render("new_article_row")) %>'); +$.fancybox.close(); \ No newline at end of file diff --git a/app/views/articles/destroy.js.erb b/app/views/articles/destroy.js.erb new file mode 100644 index 00000000..d59480f9 --- /dev/null +++ b/app/views/articles/destroy.js.erb @@ -0,0 +1,5 @@ +<% if @order %> +$('#<%= @article.id %>').after('<%= escape_javascript(render("destroy_active_article")) %>'); +<% else %> +$('#<%= @article.id %>').remove(); +<% end %> \ No newline at end of file diff --git a/app/views/articles/index.haml b/app/views/articles/index.haml index b368cd82..d8d26897 100644 --- a/app/views/articles/index.haml +++ b/app/views/articles/index.haml @@ -7,19 +7,19 @@ %li Zugriff auf externe Datenbank %ul - %li= link_to_function "Suchen/Importieren", "Element.toggle('import')" + %li= link_to "Suchen/Importieren", "#import", 'data-toggle_this' => '#import' %li= link_to "Synchronisieren", sync_supplier_articles_path(@supplier), :method => :post #change_supplier{:style => "padding:0 0 0.5em 0.7em;"} %span{:style => "float:left"} Lieferantin wechseln: - - form_tag do - = select_tag :switch_supplier, | - options_for_select( Supplier.all(:order => 'name').collect {|s| [s.name, url_for(supplier_articles_path(s))] }, | - url_for(supplier_articles_path(@supplier)) ), | - :onchange => "redirectTo(this)", | - :style => "font-size: 0.9em;margin-left:1em;" | + = form_tag do + = select_tag :switch_supplier, + options_for_select( Supplier.all(:order => 'name').collect {|s| [s.name, url_for(supplier_articles_path(s))] }, + url_for(supplier_articles_path(@supplier)) ), + :onchange => "redirectTo(this)", + :style => "font-size: 0.9em;margin-left:1em;" - unless @supplier.shared_supplier.nil? #import.single_column{:style => "display:none; clear:both"} @@ -27,9 +27,7 @@ %h2 Artikel importieren .column_content #search{:style => "padding-bottom:3em"} - - form_remote_tag :url => shared_supplier_articles_path(@supplier), | - :before => "Element.show('loader')", :success => "Element.hide('loader')", | - :method => :get do | + = form_tag shared_supplier_articles_path(@supplier), :method => :get, :remote => true do = text_field_tag :import_query, params['import_query'], :size => 10 = submit_tag "Suchen" - if @supplier.shared_supplier.lists @@ -42,30 +40,29 @@ = check_box_tag "regional", "1", false #search_results // "import_search_results" will be rendered - = link_to_function "Schließen", "Element.hide('import')" + = link_to "Schließen", "#import", 'data-toggle_this' => '#import' .single_column{:style => 'width:100%; clear:both'} .box_title .column_content #links - %b= remote_link_to "Neuer Artikel", :url => new_supplier_article_path(@supplier) + %b= link_to "Neuer Artikel", new_supplier_article_path(@supplier), :remote => true | = link_to "Alle bearbeiten", edit_all_supplier_articles_path(@supplier) | = link_to "Artikel hochladen", upload_supplier_articles_path(@supplier) - | - = link_to_if @current_user.role_orders?, "Bestellung anlegen", {:controller => 'orders', :action => 'new', :supplier_id => @supplier } + - if current_user.role_orders? + | + = link_to "Bestellung anlegen", new_order_path(:supplier_id => @supplier) #article_filter #article_search_form{:style=>"display:inline;"} - - form_remote_tag :url => supplier_articles_path(@supplier), | - :before => "Element.show('loader')", :success => "Element.hide('loader')", | - :method => :get do | + = form_tag supplier_articles_path(@supplier), :method => :get, :remote => true do %label{:for => 'article_name'} Suche im Artikelnamen: = text_field_tag("query", params['query'], :size => 10 ) = submit_tag "Suchen" - - %form{ :action => url_for(update_selected_supplier_articles_path(@supplier)), :method => "post", :id => "articlesInListForm" } - #table= render :partial => 'articles' + + = form_tag update_selected_supplier_articles_path(@supplier), :id => "articlesInListForm" do + #table= render 'articles' #edit_article{:style => "display:none"} diff --git a/app/views/articles/index.js.erb b/app/views/articles/index.js.erb new file mode 100644 index 00000000..1af9cf9d --- /dev/null +++ b/app/views/articles/index.js.erb @@ -0,0 +1 @@ +$('#table').html('<%= escape_javascript(render("articles")) %>'); \ No newline at end of file diff --git a/app/views/articles/new.js.erb b/app/views/articles/new.js.erb new file mode 100644 index 00000000..3c8d6f34 --- /dev/null +++ b/app/views/articles/new.js.erb @@ -0,0 +1 @@ +$.fancybox('<%= escape_javascript(render("form")) %>'); \ No newline at end of file diff --git a/app/views/articles/update.js.erb b/app/views/articles/update.js.erb new file mode 100644 index 00000000..1f2a3df0 --- /dev/null +++ b/app/views/articles/update.js.erb @@ -0,0 +1,2 @@ +$('#<%= @article.id %>').html('<%= escape_javascript(render("article_row")) %>'); +$.fancybox.close(); \ No newline at end of file diff --git a/app/views/layouts/application.haml b/app/views/layouts/application.haml index 8fe95f04..be33c9b3 100644 --- a/app/views/layouts/application.haml +++ b/app/views/layouts/application.haml @@ -3,13 +3,14 @@ %head %meta{"http-equiv" => "content-type", :content => "text/html;charset=UTF-8"} %title= "FoodSoft - " + (yield(:title) or controller.controller_name) - = stylesheet_link_tag 'main', 'rails_messages', 'nav', 'simple_form', 'token-input', :cache => "all_cached" + = stylesheet_link_tag 'main', 'rails_messages', 'nav', 'simple_form', 'token-input', 'jquery.fancybox-1.3.4', + :cache => "all_cached" = stylesheet_link_tag "print", :media => "print" = javascript_include_tag 'jquery.min', 'jquery-ui.min', 'jquery_ujs', 'jquery.tokeninput', 'jquery.observe_field', - 'application', 'ordering', :cache => "all_cached" + 'application', 'ordering', 'jquery.fancybox-1.3.4.pack', :cache => 'all_cached' = csrf_meta_tag = yield(:head) %body diff --git a/config/locales/de.yml b/config/locales/de.yml index 65586699..5d293998 100644 --- a/config/locales/de.yml +++ b/config/locales/de.yml @@ -244,9 +244,23 @@ de: order_howto: 'Howto Bestellen' note: 'Notiz' min_order_quantity: 'Mindestbestellmenge' + article: + availability: 'Artikel ist verfügbar?' + origin: 'Herkunft' + manufacturer: 'Produzent' + unit: 'Einheit' + note: 'Notiz' + article_category: 'Kategorie' + price: 'Preis (netto)' + unit_quantity: 'Gebindegröße' + order_number: 'Bestellnummer' + tax: 'MwSt' + deposit: 'Pfand' hints: task: duration: 'Wie lange dauert die Aufgabe, 1-3 Stunden' required_users: 'Wieviel Benutzerinnen werden insgesamt benötigt?' supplier: min_order_quantity: 'Die Mindestbestellmenge wird während der Bestellung angezeigt und soll motivieren' + article: + unit: 'z.B. KG oder 1L oder 500g' diff --git a/public/javascripts/jquery.fancybox-1.3.4.pack.js b/public/javascripts/jquery.fancybox-1.3.4.pack.js new file mode 100644 index 00000000..1373ed08 --- /dev/null +++ b/public/javascripts/jquery.fancybox-1.3.4.pack.js @@ -0,0 +1,46 @@ +/* + * FancyBox - jQuery Plugin + * Simple and fancy lightbox alternative + * + * Examples and documentation at: http://fancybox.net + * + * Copyright (c) 2008 - 2010 Janis Skarnelis + * That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated. + * + * Version: 1.3.4 (11/11/2010) + * Requires: jQuery v1.3+ + * + * Dual licensed under the MIT and GPL licenses: + * http://www.opensource.org/licenses/mit-license.php + * http://www.gnu.org/licenses/gpl.html + */ + +;(function(b){var m,t,u,f,D,j,E,n,z,A,q=0,e={},o=[],p=0,d={},l=[],G=null,v=new Image,J=/\.(jpg|gif|png|bmp|jpeg)(.*)?$/i,W=/[^\.]\.(swf)\s*$/i,K,L=1,y=0,s="",r,i,h=false,B=b.extend(b("
        ")[0],{prop:0}),M=b.browser.msie&&b.browser.version<7&&!window.XMLHttpRequest,N=function(){t.hide();v.onerror=v.onload=null;G&&G.abort();m.empty()},O=function(){if(false===e.onError(o,q,e)){t.hide();h=false}else{e.titleShow=false;e.width="auto";e.height="auto";m.html('

        The requested content cannot be loaded.
        Please try again later.

        '); +F()}},I=function(){var a=o[q],c,g,k,C,P,w;N();e=b.extend({},b.fn.fancybox.defaults,typeof b(a).data("fancybox")=="undefined"?e:b(a).data("fancybox"));w=e.onStart(o,q,e);if(w===false)h=false;else{if(typeof w=="object")e=b.extend(e,w);k=e.title||(a.nodeName?b(a).attr("title"):a.title)||"";if(a.nodeName&&!e.orig)e.orig=b(a).children("img:first").length?b(a).children("img:first"):b(a);if(k===""&&e.orig&&e.titleFromAlt)k=e.orig.attr("alt");c=e.href||(a.nodeName?b(a).attr("href"):a.href)||null;if(/^(?:javascript)/i.test(c)|| +c=="#")c=null;if(e.type){g=e.type;if(!c)c=e.content}else if(e.content)g="html";else if(c)g=c.match(J)?"image":c.match(W)?"swf":b(a).hasClass("iframe")?"iframe":c.indexOf("#")===0?"inline":"ajax";if(g){if(g=="inline"){a=c.substr(c.indexOf("#"));g=b(a).length>0?"inline":"ajax"}e.type=g;e.href=c;e.title=k;if(e.autoDimensions)if(e.type=="html"||e.type=="inline"||e.type=="ajax"){e.width="auto";e.height="auto"}else e.autoDimensions=false;if(e.modal){e.overlayShow=true;e.hideOnOverlayClick=false;e.hideOnContentClick= +false;e.enableEscapeButton=false;e.showCloseButton=false}e.padding=parseInt(e.padding,10);e.margin=parseInt(e.margin,10);m.css("padding",e.padding+e.margin);b(".fancybox-inline-tmp").unbind("fancybox-cancel").bind("fancybox-change",function(){b(this).replaceWith(j.children())});switch(g){case "html":m.html(e.content);F();break;case "inline":if(b(a).parent().is("#fancybox-content")===true){h=false;break}b('
        ').hide().insertBefore(b(a)).bind("fancybox-cleanup",function(){b(this).replaceWith(j.children())}).bind("fancybox-cancel", +function(){b(this).replaceWith(m.children())});b(a).appendTo(m);F();break;case "image":h=false;b.fancybox.showActivity();v=new Image;v.onerror=function(){O()};v.onload=function(){h=true;v.onerror=v.onload=null;e.width=v.width;e.height=v.height;b("").attr({id:"fancybox-img",src:v.src,alt:e.title}).appendTo(m);Q()};v.src=c;break;case "swf":e.scrolling="no";C='';P="";b.each(e.swf,function(x,H){C+='';P+=" "+x+'="'+H+'"'});C+='";m.html(C);F();break;case "ajax":h=false;b.fancybox.showActivity();e.ajax.win=e.ajax.success;G=b.ajax(b.extend({},e.ajax,{url:c,data:e.ajax.data||{},error:function(x){x.status>0&&O()},success:function(x,H,R){if((typeof R=="object"?R:G).status==200){if(typeof e.ajax.win== +"function"){w=e.ajax.win(c,x,H,R);if(w===false){t.hide();return}else if(typeof w=="string"||typeof w=="object")x=w}m.html(x);F()}}}));break;case "iframe":Q()}}else O()}},F=function(){var a=e.width,c=e.height;a=a.toString().indexOf("%")>-1?parseInt((b(window).width()-e.margin*2)*parseFloat(a)/100,10)+"px":a=="auto"?"auto":a+"px";c=c.toString().indexOf("%")>-1?parseInt((b(window).height()-e.margin*2)*parseFloat(c)/100,10)+"px":c=="auto"?"auto":c+"px";m.wrapInner('
        ');e.width=m.width();e.height=m.height();Q()},Q=function(){var a,c;t.hide();if(f.is(":visible")&&false===d.onCleanup(l,p,d)){b.event.trigger("fancybox-cancel");h=false}else{h=true;b(j.add(u)).unbind();b(window).unbind("resize.fb scroll.fb");b(document).unbind("keydown.fb");f.is(":visible")&&d.titlePosition!=="outside"&&f.css("height",f.height());l=o;p=q;d=e;if(d.overlayShow){u.css({"background-color":d.overlayColor, +opacity:d.overlayOpacity,cursor:d.hideOnOverlayClick?"pointer":"auto",height:b(document).height()});if(!u.is(":visible")){M&&b("select:not(#fancybox-tmp select)").filter(function(){return this.style.visibility!=="hidden"}).css({visibility:"hidden"}).one("fancybox-cleanup",function(){this.style.visibility="inherit"});u.show()}}else u.hide();i=X();s=d.title||"";y=0;n.empty().removeAttr("style").removeClass();if(d.titleShow!==false){if(b.isFunction(d.titleFormat))a=d.titleFormat(s,l,p,d);else a=s&&s.length? +d.titlePosition=="float"?'
        '+s+'
        ':'
        '+s+"
        ":false;s=a;if(!(!s||s==="")){n.addClass("fancybox-title-"+d.titlePosition).html(s).appendTo("body").show();switch(d.titlePosition){case "inside":n.css({width:i.width-d.padding*2,marginLeft:d.padding,marginRight:d.padding}); +y=n.outerHeight(true);n.appendTo(D);i.height+=y;break;case "over":n.css({marginLeft:d.padding,width:i.width-d.padding*2,bottom:d.padding}).appendTo(D);break;case "float":n.css("left",parseInt((n.width()-i.width-40)/2,10)*-1).appendTo(f);break;default:n.css({width:i.width-d.padding*2,paddingLeft:d.padding,paddingRight:d.padding}).appendTo(f)}}}n.hide();if(f.is(":visible")){b(E.add(z).add(A)).hide();a=f.position();r={top:a.top,left:a.left,width:f.width(),height:f.height()};c=r.width==i.width&&r.height== +i.height;j.fadeTo(d.changeFade,0.3,function(){var g=function(){j.html(m.contents()).fadeTo(d.changeFade,1,S)};b.event.trigger("fancybox-change");j.empty().removeAttr("filter").css({"border-width":d.padding,width:i.width-d.padding*2,height:e.autoDimensions?"auto":i.height-y-d.padding*2});if(c)g();else{B.prop=0;b(B).animate({prop:1},{duration:d.changeSpeed,easing:d.easingChange,step:T,complete:g})}})}else{f.removeAttr("style");j.css("border-width",d.padding);if(d.transitionIn=="elastic"){r=V();j.html(m.contents()); +f.show();if(d.opacity)i.opacity=0;B.prop=0;b(B).animate({prop:1},{duration:d.speedIn,easing:d.easingIn,step:T,complete:S})}else{d.titlePosition=="inside"&&y>0&&n.show();j.css({width:i.width-d.padding*2,height:e.autoDimensions?"auto":i.height-y-d.padding*2}).html(m.contents());f.css(i).fadeIn(d.transitionIn=="none"?0:d.speedIn,S)}}}},Y=function(){if(d.enableEscapeButton||d.enableKeyboardNav)b(document).bind("keydown.fb",function(a){if(a.keyCode==27&&d.enableEscapeButton){a.preventDefault();b.fancybox.close()}else if((a.keyCode== +37||a.keyCode==39)&&d.enableKeyboardNav&&a.target.tagName!=="INPUT"&&a.target.tagName!=="TEXTAREA"&&a.target.tagName!=="SELECT"){a.preventDefault();b.fancybox[a.keyCode==37?"prev":"next"]()}});if(d.showNavArrows){if(d.cyclic&&l.length>1||p!==0)z.show();if(d.cyclic&&l.length>1||p!=l.length-1)A.show()}else{z.hide();A.hide()}},S=function(){if(!b.support.opacity){j.get(0).style.removeAttribute("filter");f.get(0).style.removeAttribute("filter")}e.autoDimensions&&j.css("height","auto");f.css("height","auto"); +s&&s.length&&n.show();d.showCloseButton&&E.show();Y();d.hideOnContentClick&&j.bind("click",b.fancybox.close);d.hideOnOverlayClick&&u.bind("click",b.fancybox.close);b(window).bind("resize.fb",b.fancybox.resize);d.centerOnScroll&&b(window).bind("scroll.fb",b.fancybox.center);if(d.type=="iframe")b('').appendTo(j); +f.show();h=false;b.fancybox.center();d.onComplete(l,p,d);var a,c;if(l.length-1>p){a=l[p+1].href;if(typeof a!=="undefined"&&a.match(J)){c=new Image;c.src=a}}if(p>0){a=l[p-1].href;if(typeof a!=="undefined"&&a.match(J)){c=new Image;c.src=a}}},T=function(a){var c={width:parseInt(r.width+(i.width-r.width)*a,10),height:parseInt(r.height+(i.height-r.height)*a,10),top:parseInt(r.top+(i.top-r.top)*a,10),left:parseInt(r.left+(i.left-r.left)*a,10)};if(typeof i.opacity!=="undefined")c.opacity=a<0.5?0.5:a;f.css(c); +j.css({width:c.width-d.padding*2,height:c.height-y*a-d.padding*2})},U=function(){return[b(window).width()-d.margin*2,b(window).height()-d.margin*2,b(document).scrollLeft()+d.margin,b(document).scrollTop()+d.margin]},X=function(){var a=U(),c={},g=d.autoScale,k=d.padding*2;c.width=d.width.toString().indexOf("%")>-1?parseInt(a[0]*parseFloat(d.width)/100,10):d.width+k;c.height=d.height.toString().indexOf("%")>-1?parseInt(a[1]*parseFloat(d.height)/100,10):d.height+k;if(g&&(c.width>a[0]||c.height>a[1]))if(e.type== +"image"||e.type=="swf"){g=d.width/d.height;if(c.width>a[0]){c.width=a[0];c.height=parseInt((c.width-k)/g+k,10)}if(c.height>a[1]){c.height=a[1];c.width=parseInt((c.height-k)*g+k,10)}}else{c.width=Math.min(c.width,a[0]);c.height=Math.min(c.height,a[1])}c.top=parseInt(Math.max(a[3]-20,a[3]+(a[1]-c.height-40)*0.5),10);c.left=parseInt(Math.max(a[2]-20,a[2]+(a[0]-c.width-40)*0.5),10);return c},V=function(){var a=e.orig?b(e.orig):false,c={};if(a&&a.length){c=a.offset();c.top+=parseInt(a.css("paddingTop"), +10)||0;c.left+=parseInt(a.css("paddingLeft"),10)||0;c.top+=parseInt(a.css("border-top-width"),10)||0;c.left+=parseInt(a.css("border-left-width"),10)||0;c.width=a.width();c.height=a.height();c={width:c.width+d.padding*2,height:c.height+d.padding*2,top:c.top-d.padding-20,left:c.left-d.padding-20}}else{a=U();c={width:d.padding*2,height:d.padding*2,top:parseInt(a[3]+a[1]*0.5,10),left:parseInt(a[2]+a[0]*0.5,10)}}return c},Z=function(){if(t.is(":visible")){b("div",t).css("top",L*-40+"px");L=(L+1)%12}else clearInterval(K)}; +b.fn.fancybox=function(a){if(!b(this).length)return this;b(this).data("fancybox",b.extend({},a,b.metadata?b(this).metadata():{})).unbind("click.fb").bind("click.fb",function(c){c.preventDefault();if(!h){h=true;b(this).blur();o=[];q=0;c=b(this).attr("rel")||"";if(!c||c==""||c==="nofollow")o.push(this);else{o=b("a[rel="+c+"], area[rel="+c+"]");q=o.index(this)}I()}});return this};b.fancybox=function(a,c){var g;if(!h){h=true;g=typeof c!=="undefined"?c:{};o=[];q=parseInt(g.index,10)||0;if(b.isArray(a)){for(var k= +0,C=a.length;ko.length||q<0)q=0;I()}};b.fancybox.showActivity=function(){clearInterval(K);t.show();K=setInterval(Z,66)};b.fancybox.hideActivity=function(){t.hide()};b.fancybox.next=function(){return b.fancybox.pos(p+ +1)};b.fancybox.prev=function(){return b.fancybox.pos(p-1)};b.fancybox.pos=function(a){if(!h){a=parseInt(a);o=l;if(a>-1&&a1){q=a>=l.length?0:l.length-1;I()}}};b.fancybox.cancel=function(){if(!h){h=true;b.event.trigger("fancybox-cancel");N();e.onCancel(o,q,e);h=false}};b.fancybox.close=function(){function a(){u.fadeOut("fast");n.empty().hide();f.hide();b.event.trigger("fancybox-cleanup");j.empty();d.onClosed(l,p,d);l=e=[];p=q=0;d=e={};h=false}if(!(h||f.is(":hidden"))){h= +true;if(d&&false===d.onCleanup(l,p,d))h=false;else{N();b(E.add(z).add(A)).hide();b(j.add(u)).unbind();b(window).unbind("resize.fb scroll.fb");b(document).unbind("keydown.fb");j.find("iframe").attr("src",M&&/^https/i.test(window.location.href||"")?"javascript:void(false)":"about:blank");d.titlePosition!=="inside"&&n.empty();f.stop();if(d.transitionOut=="elastic"){r=V();var c=f.position();i={top:c.top,left:c.left,width:f.width(),height:f.height()};if(d.opacity)i.opacity=1;n.empty().hide();B.prop=1; +b(B).animate({prop:0},{duration:d.speedOut,easing:d.easingOut,step:T,complete:a})}else f.fadeOut(d.transitionOut=="none"?0:d.speedOut,a)}}};b.fancybox.resize=function(){u.is(":visible")&&u.css("height",b(document).height());b.fancybox.center(true)};b.fancybox.center=function(a){var c,g;if(!h){g=a===true?1:0;c=U();!g&&(f.width()>c[0]||f.height()>c[1])||f.stop().animate({top:parseInt(Math.max(c[3]-20,c[3]+(c[1]-j.height()-40)*0.5-d.padding)),left:parseInt(Math.max(c[2]-20,c[2]+(c[0]-j.width()-40)*0.5- +d.padding))},typeof a=="number"?a:200)}};b.fancybox.init=function(){if(!b("#fancybox-wrap").length){b("body").append(m=b('
        '),t=b('
        '),u=b('
        '),f=b('
        '));D=b('
        ').append('
        ').appendTo(f); +D.append(j=b('
        '),E=b(''),n=b('
        '),z=b(''),A=b(''));E.click(b.fancybox.close);t.click(b.fancybox.cancel);z.click(function(a){a.preventDefault();b.fancybox.prev()});A.click(function(a){a.preventDefault();b.fancybox.next()}); +b.fn.mousewheel&&f.bind("mousewheel.fb",function(a,c){if(h)a.preventDefault();else if(b(a.target).get(0).clientHeight==0||b(a.target).get(0).scrollHeight===b(a.target).get(0).clientHeight){a.preventDefault();b.fancybox[c>0?"prev":"next"]()}});b.support.opacity||f.addClass("fancybox-ie");if(M){t.addClass("fancybox-ie6");f.addClass("fancybox-ie6");b('').prependTo(D)}}}; +b.fn.fancybox.defaults={padding:10,margin:40,opacity:false,modal:false,cyclic:false,scrolling:"auto",width:560,height:340,autoScale:true,autoDimensions:true,centerOnScroll:false,ajax:{},swf:{wmode:"transparent"},hideOnOverlayClick:true,hideOnContentClick:false,overlayShow:true,overlayOpacity:0.7,overlayColor:"#777",titleShow:true,titlePosition:"float",titleFormat:null,titleFromAlt:false,transitionIn:"fade",transitionOut:"fade",speedIn:300,speedOut:300,changeSpeed:300,changeFade:"fast",easingIn:"swing", +easingOut:"swing",showCloseButton:true,showNavArrows:true,enableEscapeButton:true,enableKeyboardNav:true,onStart:function(){},onCancel:function(){},onComplete:function(){},onCleanup:function(){},onClosed:function(){},onError:function(){}};b(document).ready(function(){b.fancybox.init()})})(jQuery); \ No newline at end of file diff --git a/public/stylesheets/fancybox/blank.gif b/public/stylesheets/fancybox/blank.gif new file mode 100644 index 0000000000000000000000000000000000000000..35d42e808f0a8017b8d52a06be2f8fec0b466a66 GIT binary patch literal 43 scmZ?wbhEHbWMp7uXkcLY|NlP&1B2pE7Dgb&paUX6G7L;iE{qJ;0LZEa`2YX_ literal 0 HcmV?d00001 diff --git a/public/stylesheets/fancybox/fancy_close.png b/public/stylesheets/fancybox/fancy_close.png new file mode 100644 index 0000000000000000000000000000000000000000..07035307ad435f8f2f8eedf0bce50f7ec8a858c2 GIT binary patch literal 1517 zcmV1To%f)hA(E>uTT$~N#GA0orBqo9-jKM;POccZrXJjTzge4|Sa0ca~7y<+{ z2m7~>41(Jqf9L`mBM6zAjf4;hkjP@@B~d6Xz385|dB5iCM=Ro&JZZmk-uHdZd2i=@ zK0a@Md;u9DFE7t8BO^nxckf<*yC?SckUFGmX^jwM@NV80+eiP zQ*s##s^a3}Ldwd@cHO*r^T5i=%Fj}=Cr_R@78e&C((#usU;YFS>C)2Dw4tG)YO=*P zWt;6ZfL46;=u!R1$jGM-hhvcpVyCa+S}Q!T2ALHx;BHe#M~BsHHos=s2iW})#C?}q ztqvud-gYjKsG$zHm2XhmYPB(Bn>kzw z=gS!w6cG`jJ$?H00VK+=!cMnBDn?IFkCkj7KmNq~hrkZvU@n=EP}|7Gxw*M}1_lPI zNx@_?IS^|%_ok<(o3gXBH^f+@(X7_g)K~%n0$gMM{{Ab=%gZ*hH99)_Eo>!VJd8_C zE)WMoNsBB#u&}W3BMEnPby>y64F-cra9>kX)4DJoA0KZ5fitNn`NTT4wY3%+fA;Lz zZ+K4ucJi+Mg!m%<>Ug8kSg^LX_JD-5va;NEM#+V_H)8UHgaj8UJ?LiZVx92t@KxlB zb1oz#Bo|{kAO!IDVfOII$VfwRad8C+y?XV^;VEu~g@tQka>%(zhlYl1p7P=0!-vj9 zYiMYw3l0uW##jWq+eZ-;6r@4F%{+PXGcz;xx78|Q_F7Eb+}ynGO@4TI*h!27r4#SzfR=K~ zhtpe&%-o-olT$}R&!0cHdm}}wbdd`2lO~)PlarHXnm>2$+(ng2^$EtJ+=vwl#Xg-* zSA%x<9|=lJ3CXuACMEY46&1O~{LGm%7HKm8lhZ|+Pv?nF1LcJswy+L%zshO4HzpR4skij zxq<8a{QPpl!oq4$R(*n7$-q`gsjcF2;NWZ?##l9wBW)lu_Bpk)RJgGO&Ey+2dDr3J z*x2~aJFl#)G^5U)q~qh`_b^ru6q9Xf%arlfse$W(T#z5f?cqE0>k)x`c6QcMUS4jN z#$B996B84z1O(|{7{3S{Bb#j7?T~OCi+pq$fP9eGqJ%Evk~i}B@#8tcAnk_QAg)9f z!qn81MJO5W0n6>}?Q|$y25QL`+uU$0x?KbSI<(UOBavf=wCW!^J3Ie)^yty-8!yk& z($YLG4fjwT{k&5mHL@*_7Xi1c4?x$HT^y5qc2zyPPCG3CUKl!f@Zj&~&!7K?fD>&z zDk^G(=74sN=`q$#Wm{gaK5myi7K~vRQ8s=CoB+NC8j<}iKpXzI(SMmt*2r@wST=`s zW7t-}X4hPqXy3W00000NkvXXu0mjftFGKG literal 0 HcmV?d00001 diff --git a/public/stylesheets/fancybox/fancy_loading.png b/public/stylesheets/fancybox/fancy_loading.png new file mode 100644 index 0000000000000000000000000000000000000000..2503017960b3972499d3aa92f89953935ae40934 GIT binary patch literal 10195 zcmZvCRa6{Z)GRK+A-I#l3GNJT8Egn7KyZS)ySwY)GC**5cXtmOAh^3rfXjE+eY*eu zvb$HWe&}AO&aSFmCtO)c7UKiS2N)O_4A2)TmG>(H3=HfB3ex-CA}8B>rB4S*iGOoj zIbB0`GB%#)yQsNe_Z(XHJVzvTksi>+`6l(%$`7%p5{2L+{tq=VJ?V0JL-5DetdIHF|rZRGiB+~M$cAs!3L4m1WqS5m4Uut{B{sus$nl}9N zp#?4R@YNv8YM{JrwP-Li8Ynr~UO3E8cBsK321T79L4oqq#7><+nH-uo4c3S zzbjdhtN2LE+Wk$ypLztVwTlowGQqng!^I&U`;KFsDxwwAwF4PR(`@g%I}B1@?aN<; z9cJzX7khkNkJG|u_OY88t2=a(9k|tRF|O^~620}B74q3{|Mu}rUKMRU=5i@t4rH}t zWMo)9&m6ObjvNsA;yz~`O>f^l&kjH&j=Aexy0cfmC&I>@QU7`Ql zPU3_q?7Cqi%{r7|wPeZc`_s9mfR2B_K39;>*-yWV=qR41Ls>bqydL@}bse|D>1|L> zSvMFEQ2vnWJKlHRcZAw{ZIfc@+_x^0qqpf`uaLP9OH$Mxyno5YuLvbooxn?EWW9?3 z!YB&gf0xHo{M%6#qA!QwrjFO!Dm~{w(pCL9Z1XeAf)Nj@AQGyB2^*KX+-VJJjiv1` z<4I`VooCdOm?}gf8PD(k+m)s!AE5Z?+0=PkK{!n$OKo*{K2N95Y`L?t*m<`z<@&zR zp~CHRl4dh@$sJ4b-?gm;KP++XcWjfN6N#Qw_o;QATHBKP9&7y-bUDZkt@PRB%5E8d zyIxSjYTf;8+p-~Y-!k=O$;kfFCPu};=7d4N%l)KG@8xK)nb+&}I$Q6pWy;&;g|G86 zI-2s|2J)g^1XG`LO53Wj0gJDEZw-Oyi2)Wft0k{z<}G%H3dQ>?Y(D?CDZ2o#2V1hj zM_=W)_N5IX(aMyXUqh1U_WG#TC%LuB%3bK~)3%|v<)+ah|2DDoR!5Ri1|w~KpZ~C> zj*1KZd%Z~(gdF2RFMx01Wj`AW>Y$yS`Ndy3rPZS*pr6~#`6Q{ z%20=uSgaS;|E%9NE(<&vHm9^dubopg^XZ9&z5b1D ztpelNuc?SSpElb&~gE~4TESBIw z4hXi+ap2YNx8^D{Y~U3Q@Y|(~)|YhqOBukuK1!NNCMG7sGZ6A#)2w8O6Kn zdChi*Bi4O9!Q85-l}W!%4SCss_ceWT5CR9)!>d)k=W(}t8zRG>zPaIpd-bRcl+8}< zyZAFh+)b7i2(xFGQ1NiT*Ss*nf$|V%2{)tO&r?qsL@GB0#g&?RJHuU!w|`-+L=^sL zBkr*m4+?S5Lim?WVQJ4G?3fKVc}Q*JmJmX3?v`M44RD$Chi8S>0a5i2&wbyXSv8dY zyfv7Z{pAwk7MSBUu@ z5G6tLJnE1!1UjyO1R`?s4&aNgugC^{U9o!idxxDc93pcZ7raY)Xn7Pw`)<#e)4& zcN7v?6cRi?#`bl9ECtBz_QVZ0guMA?CDv=_ljYyH*ZV4aa_^g&fXJni?@vAE{G+P77pVW4Tj}s-(;*& z1STX!WHYF!Btlft>2`qz&1ijPaSdm%!UIMua~VRnoET&%1AAf)#vSfWj=q$8;qo|vcK_;z1j(+l2X0@o7C&Rzg8!2h$XZGbenx^q2; zApAgMeMi;{fO?<|f=I--(6#z(IL}cC|D24*dg^rhIE3G^yTJFZF55a-#}tYH=P$~* zb}RzkLIDvK`;ZA4OnYPQQ?;ssg`Ml>vON8NVnk@fl0k&o2W`-r3Bg-8NJYuCo0$rb zAKi(Z+>hRKA>bjOr%LHS@;94B&obY#4yCecQ0pdAnSV&v!vLF&-`Mm?t?}6F z?PaX5mkzFp$i(YKsOTz58Zgc7q)IVxy5hYd;~k@a63_Ja7Z0!ycbH~U&Y;r17f{Z} zwhnd>Xve$Riey{w@OgRi9rKhkQO@>jj2#Py8_PSVvvwxp0HTR7DdE{>K_i9RL= zrPNU6SCAR*HU3BLhMV(aTn;NBJQziUp9-R3QkgnENmN9ZBlJCW?l9$81skWTmD&YK zJ%7bQFP*wlswyu56egGmr!KVx=+KneK+U;f>vSk#hKg0u(yv^fNk=GGdULDg_=itK zp3;*2U!wB8TA$o;k!;o@OA2zx*%c|y0#?BBp?nDDw5rBS_SB_Sbz$6-fYTvnj(ezNfL{$?uz9aa=HGSg$mLTxTf{7e`Oqr?7rp+0`lg6AQpk z9Nsxh5kt+I%$5|50=OZUzms%|OAS{5^$g0~djWjOVxYk^CLD{|njlM2ex}zn9yCa1 zXCSTHoM#Rjq25u6;*Ug2A+S~Y`_kh|<3C=w_~F{9JKTLW^z5D41V2cjL8y+L*0IQ_ z?L+y%E(_`Xj&MzngB*bEt_~znvHKiL&w-ytZ<@L~s{_sdoRaSXOA5{31d;sz#pvvv zgq9-MCupHYRhjX{g`7wlu9(YJkAO)+oP%bGYC{Q>2v4!wD(_QEQe5suxdx(SIXS!9 zV|=hm;s|y$aq8^~zssyzb{|fvQc!Cj#FNH1$?tLP+^0!rIS_gU*h1d?y;X7vm>l>a zwr^N0VzNQ_j$}0!F~;(iG9UmS=QO|XM%w%nK5uQHaLT2-I$_CRCbGr8ymE9J_k{YTcfRFh1nn)R6_X#W#Fg4I=2W=GD|J_UwPwIQsBklSR4`o0$A&X8xn-V`k#d|7nEr9kiD4Dx?q zJBBg6NsFLaJWHtZ+GQr~rb(+STSHpb`9UQ4BbXjmTjDz;@V0H}7=mOf+#fvH-crjF z@uztsU}U)L0`Q{D-mZfkuH|zPNNIKXy+C+QIrQ&23l%VJtwn!M0wNG>wEi_? z``=Fg-bBV*o!jNs*j0n^Sn^x-5T@n{us@koqBnB}HI+tGJ!*iBb=5xNu?gt0oYXmW z8+W9Aca$K535BsvBR3qs~{jn>MoPaD#Aa+9Thdjr^?c!Rm zd+L48(+PM55nZ#`>laDoAVlLUXKyJl;Rm?x@Vv6HMm5<-R6-Z-qq1C{(`EqabpBzG zj;4V!x`7^=;;cYNpRy+iPV>rQAJl)AhcD--7r9MjgEiiV#SR|%E*YZcCryW8uK0m8 zL*X&^7In#HoVp*5gKHN+#O5c>>55A?ba%a_dj$xtqeA|)Js2dMKsh{lLDK@0m9lYa zWh*#0TQ2T27j^N`(t+eEfPUoBbvH_Kxa-u1jcNIe2YA^XT=1{3*Wd)}tKRN&dun&* znJX0Gvn8K!-%j#7%+r_|9qIlzn!o^G{q2MJxsdbiTZx3rG2xVS7HXrp5s;0PD>=hY zBl<_TAVt^N>MxbO(@<=MbHrHR=MZIY*8L>tB_Jja#yQoQZ2U!66gIECXOtndOORap zIR~TG$;oHLIJfQd#!j_3_Qvmx`fn3O*zC1bYC_$3%GfsjXN1z3asw+xTs!lK0I3p~ z7+&tcZUsM&QuO)Rahedf=&&)d1_C6zma`x{C50fHF?zDa=ZblEB;H@x_ z*db{M-tS}6{hx>Au=h4<8bWA8WETt$$|~;BYStwE1pYq48aKuv)4zT2-le|_1FnV@ z&z3AIiy5J{V@~m(2Aps_b7@uMmeTM}Zrs1Cl&)1e*ht|I zj+H9o<}yH3ZLHkB*F?)hWh$+em0HTThaoLx6FA4~msa-#wQzbyJ7ZmQjr#_R2ho^; z^_`?dw}hUR_w8a@8*K8J-lhK2Ot+y`>+{`n0h_lu{26PzN8ov0&f4B@R&y6%I6s2# zaHh%b232N&`aa6F5}eHI$b&SYPEgsOw5r$FS9yGwbRGzrIvbyEgZ9&nFxs0*_O>EKspQWU0tWeX06p%_D|(!O+TmLQ=`cGc+aR*yqXicgOVfS-31*Vth9=M<`>TD z2ecu1@-;8F3cm{pGegNysh5>XjRo{+T&Ak)F?qQ`lGeFVEKm{O*Fh^hd&!`$*H zo5Oc&)hGQS+5HxkD6FQ8nebel#;ty}aAw`K(xh8I_#=)-z$e>p3&-I@Xi7DsewFYp z$O_YrvYr1N$2_XK@wwpD36YvYlkAWY{ImJ=ap?zi$l%xZ*=IqNes{oGZ_d&RUp#M>B0_e>rGRlDA!;QcB^(S{BAOFH9!5r^ucGvwr7zaBu z0nl8=Q**gw{nD9@q{NiDSWk(V7^!=lJ2pWMJjM<6vo&=apq;2<=R}w*8Y1=kz=PCQ z%)%vAD1wFG6WryVg@``Sirh@k%N803_$(=+!8Mvb9?1T!G85NtuNdZnEQyu#A?w`B z)F3b>f5ji+x}KM|Tj2^Y*G*7{b`Tfi5Vo1I10v&)jAXu~zp&^l9_6zJNyTM-8Umo1 z9&95H=Jn67@b=o@EulLxhu9I5NUWA}RT~7aM&6p*w#;#@t_WkoM=N611DP@^AO(5% z_O)wI8+=$Zu|&6GLOI$LM?5!R9z_jmV}oTTbo5w#im;QnduH`c$N zW{BAB52R%1;Rn5cODK_%Sd9)aoctB9zxfjVQ>(H0D(}uy@LHYyAgK3g(>S9( zPtYyFU)v324BQ;?fy(SYzzu)I?S5X)C%oy!_vo35qBl@iLxXeO0=c!$`taf&-nWfH z&;kAR#ny=d^p!J#(|f-;_JYU39P352-lqenf}$VP>n~VNP4fO z7WIbrhM-BLcG@K6C#AME+0)ar)&j3)4d;NqqtG&xvMIB$;{YjyD%@TxXDz(Gn^~Q$ z`{|#$49R1=uT?+cj-swXngY48cUNapbLV7E{z3w$^>d9@EA@w>HM^RNCa!C{AQXMm zpS_ccdl>Gl@TvUqk0?XIXoR{14Qy=kig!<*wYyEI!{IFM!!y{06q1<;ELY*y*mjQT zv-b*OcY}^&CpfUnzo^;VokcN($`aoxgOa2-iM%AbK5g=>;P?fEw9oVMKLygeXnM7D zPtexNCH+(J;~KzQ96%ZTw*j@q*9|u=z0Y-$-X6>%8rAx{yN1?B`D^BfVA-Q>P-Zwe z;|%7ZvMvfrLx6PA)1366l#K`VLUj=^JQGKQr;$;%1P{A3+amuyFpQjUjaj|r5k8@8&dKiV2D0a28K5jva= zscr^-stsDrbQN`~3V1XeM345Wu`L|$V2`1Pl`51 z!sHL}P{WSZ@>@dt0qCwF@)>_sDDUL@v?vgBJUvVtqIV{pdh9z%PiKh$SX?-VD2}@Z6HA6- zt@V4EnoebJo&k^RU@I_2;opR+}*c)nrCI`yn@ErJWz96(SbIVk1>cE!Tka7+3`tF#7q&mOS z`(vja3j^a6Q^nJG3SpdQm0wa<72`6^6xx!7k=(pVAT$qCygHU&2G^*HUT}^RwjJNp zVjsZ-`}x>d3-MAWGZ5r%sw4F*$o{=syLAd8Mu?DV4DF|;2*Jox zqVL%1j1#^%=iX>tz6Qjk3TO);M&rXtl%qgk9grE3>4MXk7Whlg72rmd9g!l$_+3&E z6*h-nCMPb4^T8$kZueK9(P+4T=;!doMXH%k2WDZ$>{4(7lz{?r+!{D2KSt$CV(H_H z09z`;*W-{JA{4V`;ct6^**HAhq-p$yC!Fv{xUAPqWOUMqgwdVO=ShY%=Zt@BDuAe`?$w6~HWQL{`llqWf6s}0s*z#HS;O3a z=ILyMmZ&A@kv(0D+vYjR5o^0XD5avMI0e%)%4(QMuouS5z3U;m`;cPc?0(9-y@U!e z8`cw(kspE<f=vKG@{6#xOuWYLU46A_{#wSGt9nrgw})%Z22yb0fhbwJaqq)%z$PaC_= z3ox7-F_lzT^9!i(CE6 zW<2&Wf2a{(QsxusH!M~2vW)|^uKs)OZ zmI^}fUwIueqDYM}Hp_|Vp>A79nJ8^LR5d1S;Q>w#hmAWb#T`r4AJ~Xv;6gnE-j*Qk zwNw7#)xPg>g$s)62xcF_l*sdm^_NrVX|dvZ&p>qY=srP47z1ewBWITjEe65;a(0E< zsKF5<#?0SAwMHrOG^N5~-08VWNK!`W|E7Jofg`@;V9vxN`V(KMQ7OQ50~f_DqPJi8 z6s(d7BHK|74FG*y=+P~=U{op#TT^k#OBsmpmz7R(n`tLDrm9z&lDKlR$rc{n&Wy_f}H^^xUb{sfU=4ICbJ`(9&;3Z3fCy0rvgB9M zYXJOzI!BVShvjpSRe=NmGVk>cdV`Q015u&=ITQ3#Gp7D;WU9-#Ty@{_tVkMAQNqTD z89X_&nz0hLSxzu+{iZ?fqt!=1tl;^;blU*(sJlZHnmNqp<|A?O8Yqeq>aY}@n1 zBd&ihKHMSw8p9mpUE#S1BM;d0J46}4d<00ZkaWga7oyiz?n2O$_km?HNrL+#l7`D1 zDt>O(bK^#^beJ$Dp;k3Q)+J?E0B-A4flwH2y@}{?;{_nm@P%QMps2J z#`ilc^%ORDrR0HkSAcEzL6MbEuv|s7a0Ar)gMbJT(!}yXkC_|qfJI;E22Fs6`>U2+ zV1&^n-1Dqhq~VvMo!jd|vkg^x@GPMw8SrLWQvGe4@@)xUShf-uDZ8HkE!_>b4{dqT z8096-(q!Ru;Ij<5@|jEX&B4JzS5AqWVG4h+OLc;we*kqEFMhlePe?Xo(mzk0QTAQb zpD2r0t+lznomct39G}wZEMuz0)=dgp3T>?BPsHbx^CB%dqpOboI~ogTn`N9K1hy>{ zDBae4+0e=;4Ed>107Xpg6!O@x>V~|>YdDrp^;g9CF{RNew0I&FVx}{X5%+2=zXe{D z)DMs9SjWl*_A?z_0KcjSCKJ!NP8N(+BX78sW+x%34{ePG(M^UYj%THt zxZ8TL#-|J$Ui@6z9;Yh}Z!tM%V>jJuIJ-?8kmCLBd^|wCgTzGsD_kLyfTJg|Cs%`+8tvvjHT@<@+c88YVruAnGHq;4A%KT z`@dcO=c%}~pTNFPbF|rymrfuW8#gW8GRQQEe8)QF8oAyYmLo%Jv;Y=7EHouB zJQ=5|h)@1}F#B{wX3e#`0jf@ocdnZ;E$5xtwD??6V3z;dPTQBe^HZq-b%{6VCF=FR zL>xf=$+cR=ko_y>!X9j&oZEAcOX#tMNcb;(xuU}kDM|P5mmN<5;map=HhG=w$|}(w z4F*XeZGLzBif3-phMaoKI`4adR)>&}aCKzXy<-RDAU(u_f-$(-Omb^%F>+tQyUWY- z98G`O5ncSRfQ;n3q=LbzbJNk}=XZs1__J63e;DEaOA!A=p#VP2rE}oOH-BMvLgYtc zoAcvckXV;~6fXD|`?DPrCnsupBsl^pc!s>84G60AQrQAUv~pvfJVGH*F3yd1!r-1e zi9&~F;796Dg(Wi1n4+u~#KD>ECTCUiM{t=D!kwPLM7V~k{HGdYq%u(>bX=z9#R zge?YcYjBNZvw0!CXZ)E}yiN$;?-`_vV=weI@%t6E>KQw$qZo?yP7%!-7D}&J;Rd^y z2L}gPL)GDF%_S8P%|t6;LU)8(vhxC{bue%1KQGKL{}`1SxM@5h3BqQW$1UJ=iHVKX z!>q&nVn}oCqRUI42H5o?zjm^4 zhTv#NSZ?tF^7J6}Ds4Id@g55ZMz$AERk7!_lo<;SCuZW33@e=0gl8*tD>!a0k^q_ViXjTmlOQizar{@TPjZ$e(u*)b zl&+l8$FXO3_IyDUh_4-QR3im{;hkU zv{vzd6YBp_9?y3`R?m*xel6XQdQ-D~W%obNJ?_u(^o)Wn2nbCAm5RjF3^UlDjNKOR z{-zm);7^zU^uJ~aeK0&5K7A zk!1|bDtR`F7u}LdQL>XuAiOL)$^!>_q!Rx_qE{et)MEwb@S{@W`+Z4Aw2az8N7*;j z28~WHm*L2qk_1^vZ{qCssnc0&vsCg(7oWohyP@9E!SL}lGkp5Mol&OL@SQWG!*9BR z0qAh(zMth9KCDMQT!@!?YhIMqNDF_IM(>}Gi}a7@vu~0@GO=V5?Pk#Sqt{UE%}PuM{~;(=J78A zSrs-=fTfW`08-7aQ5oi{Ll4And$a}6a7%A+l1f{j62K2!xMxo-1)`o$Id8iOER0N* zxIDeb$xtGU)+USD=qHDg(Y`X~J68tf`TqIO_Tn$%1NaeiYTKadL_2eajT1&)NB+^q2@D9b{MUY_>TNQpZi%SO_bqXjyXHB;Ui$Sf9@s+j;Wb z{id0A9C(t~>E@^vPF(@ScmscJxOc7zNXd^Oh>_aW(3u(xR)buk9$q9y|pmKaV!1QFxCztuHO}!PY}!G@y49mJ z0cZk6!rr+O$%3(;B?-}K84!e8{>9v~L;P_$0eQ4}M1oXBfsT{~ZTR)Ko%2eWMnbKn zb5q1ekkgw_RUy#!uXEEL9eB2&?El4NCZmw3r1hMX#a}lk-dBMCPR4OgqRj$-M;-^< hjOQhwL*8E5RB0mfPrR|R-jC_QfTWeADkby-{tw&r+hqU% literal 0 HcmV?d00001 diff --git a/public/stylesheets/fancybox/fancy_nav_left.png b/public/stylesheets/fancybox/fancy_nav_left.png new file mode 100644 index 0000000000000000000000000000000000000000..ebaa6a4fd34e51575a01da366312c20618985cbc GIT binary patch literal 1446 zcmV;X1zGxuP)R`@usIzf?P{x4#0gFqr~|(;IJySuwjr=+Ar78e&sHZ(Lu;P)*wKU%|U#jmpg5~Q6= zNl8{#mZGz>Q!_F$qJ8n=#Z9x>Jn_n|ZEtTsSzllOW_Wn`!@Rt_=!l4jAl`tKb-5%L zv7js_CMF<1KR>Fcr{|nbr~AR4Y-MG|y0EZdwI6@^^5yrikSZ}TQ5hH*C?{R4Q{?KT zKD6U2SFWfB2M0g0TCEGD5GUP%Y0a>J0W!M1fVuVU?d@ix(YV91PjUK7@OzY8E)OJ~ z&Q30n%8njA8kC)#t?uvd&xMXHQZzI)WQmTB-n1vQM_gQ-{_*3-7UA?*_bJ9=m|W(F zT+IHE$H&L3T3T8zSS*%BTHM>)YZi;eI#;9uNVch|X-go#ckf=VQmKq2-ORBYaGo52 zejyg&!SS;_ltMX3~N9_#ORsfn&tMTp}T$j*yAd)6-A(_4O6g z0=-^ug|9bVkxorbSsNQ0x9sPG&EF`laq6qgf=!d ztnQGKnVtDqz_Vx1Y=Kr=TU+Vx?;nS;5H`1m#Lv%9fqI)#T3Y%!3C+yRSpE-E!h;77 zwm7Z1{&Y;%TkkIqz&m9sAKBbnCkzsHry#@vbY{a-wI?zu7 zloV4Q9NtQWLUAT7Ev=G-*4EZ6|HZd^F*!MDB>C#<>PDGN_5sGi_Yq4ZlG7@css!ck z9};wyN`LrygSGPaaLVfqXl2Z+Nkm;ygvo12>(Bf+YwDwC`Hbwy5foiCI>(Z2*F z+nZVe;)K}P*aF#9Y8tUS3{lK|w(!NULrkdP#x17leSb zXU`h&IIwaw4`8eqNV6{>BDOh|vjhZ0E{e&QDDu0Pe|>%Zmb;{dg@s0w$z&rPA0K~+ zu^J$UblaCq5g(ljxEe?Y`8AmFYt-vOfqZ&;+Eh?bV07kp3Z#jN34Zfk3!OW_7k zM!Hz%fopN!Lja&lI}y+lIZjBszTeT&@!Ra|?DQ)q4Us*EN5ey8M=zh0NVTlX;X`2G z(+8kuN)-Dfn@v@Ns?$arfE9ks%*_0?uCDGc0&cYN@bK_KngiO{r&oDx0_$@6^x5~= zW5Gx^5k=$2z;)mYpdQiR47B2ZEBzOVMD;v(on_N_Z6xdRarMj=Ped`)=n zv4Dh?$k=SYcJSdjDa(58`F?t%ZzxBbaRs;9zaA#)un(S!5dZ)H07*qoM6N<$g4RXF AD*ylh literal 0 HcmV?d00001 diff --git a/public/stylesheets/fancybox/fancy_nav_right.png b/public/stylesheets/fancybox/fancy_nav_right.png new file mode 100644 index 0000000000000000000000000000000000000000..873294e969db9160f5ddd4e1ab498ff60b080e3f GIT binary patch literal 1454 zcmV;f1yTBmP)Wa6`&Z+!IVkxf`V#(j>y7#5eg z5*PD+C=wGBwT+F9xi*_^fd=>X_FBba@wz8b0c3ma+OG#c&LYnSBp_4S(*6BG8m#QpsI))yBSw}|WBy?ft)>pk?VIMu|0u-xC@UxO$< zHa9o-0~vR8bXeVyB61x;@W6T@vgyO$TgWvPslhu zJ>BGvFeN3$D2UT9wO!c-2M2E;RvddB6cm(&J}nRg`1!DUaA;_#J})n?kc`&W*6f~w z$XoI8@o`6>)z;Ql1O^7iqc4Qr?IQ^Y2vDQmrd_^#`AagIo}RXO6Tw=o)=2K&OZ?8A zJDVKcH{^2p2j~ms)bf#Ff5Y^8{ZZ7~8Zw%koV0nHJ||9`FbS!%u(0sL`TfAafI}Du zN;}#qfQDkqhr?T=R;!O@W@c89(aOq-SHe5pO)Do4INRL6f8R{+tE;Q)Wir`E=nLN^ zERjf#VBjT`yZ^}0T`IW~brs!I17PDwDHNtJpz(@u7&_Ci&*x`nXGh4eva-_hHlhTo z>wKX6jrLg})!Ef*2q(qH#unh5y~V~`*!#E25W2>+0$@y%jAkE;d^% z7KiBQ=;#CV)c|?K?OZZNymTtyIv@+;=i$b0QLhID@u{gPOF=<_+1^cd)FbceJt|Pr3Z2#UW)pC9hbbpr%#_w3xu>9DucKZSqKjwKC}oa!!=;B zxw)ARh3h~maWUsB$KtMw06>R!GGHKatdM5?eS3TRA2TyEQ!m{-s9LkQG(13d^zuqc z)WBRWF9N%+J^)=)qIgeo*i|*CI?Xfzc;V-hCr|!<<;s9veooizpgD1ug<#0dV!Z literal 0 HcmV?d00001 diff --git a/public/stylesheets/fancybox/fancy_shadow_e.png b/public/stylesheets/fancybox/fancy_shadow_e.png new file mode 100644 index 0000000000000000000000000000000000000000..2eda0893649371f8d92b92976d8542cdd1b601ed GIT binary patch literal 107 zcmeAS@N?(olHy`uVBq!ia0vp^B0$W@!3HGnP3ltxQbwLGjv*Y^lSRZuwe#}JO|p{EaWGAM`~zK|Yh zF7SQ+m+Ig>B0@o-N8?trihfzZ+Vp1~`{zf0o*#X0$hUAi%N$P)W1wCJ22WQ%mvv4F FO#q)zAp-ya literal 0 HcmV?d00001 diff --git a/public/stylesheets/fancybox/fancy_shadow_ne.png b/public/stylesheets/fancybox/fancy_shadow_ne.png new file mode 100644 index 0000000000000000000000000000000000000000..79f6980a3ba5c43de120d963dbba2516b8f27ac7 GIT binary patch literal 347 zcmV-h0i^zkP)dR9Yb&V8f!h)aDezHAsc|y@|hdQ zYJb}?8~~zFbQ)ku!Ey)KSukutuvdZ@MKMX|x|A3tPyx?YVhN^6z!Mi4Mj2f#%<;nh z2{>?YAzu|{u^;Oq!;f7Z4tPBpJEmZ+^GZ#$=9nz(K+UmK7}|u&EPi%aRt_C3qOFB_ zHc`~N>51%{?ijG?xsHt>MwRChgk=x_z0gh3O2xSL)-6?+2LKZL74~Q>MZjWtwukkA tvjRC=&j+0R$&bLyT7MhBcTXDISHC&xXU0&5CWHV0002ovPDHLkV1fX+la~Mh literal 0 HcmV?d00001 diff --git a/public/stylesheets/fancybox/fancy_shadow_nw.png b/public/stylesheets/fancybox/fancy_shadow_nw.png new file mode 100644 index 0000000000000000000000000000000000000000..7182cd938ae98e7e28c65a0bc55df576042ff9f5 GIT binary patch literal 324 zcmV-K0lWT*P)2-&4CO{qhKP$XKD&mgeXEM77>~`RA}h@U^Z##eQZVtM>a-K?QT4 z&(8BFf(rD5V61)2I__wHYuRwoaDIqw5Vdr_JSDVr){#J@r;{vbDL|tRyCiirf~4OF zX-l=Ecm>@yR)1nSMt~dy90Zb`^`)TQbhf8jR@fA!l6V$musRyB9Y{p$SCW}!$3==V zk)fW)Xo{s^ez$t+XhmZj;ts)!kTokvmM>z)zt70000 literal 0 HcmV?d00001 diff --git a/public/stylesheets/fancybox/fancy_shadow_se.png b/public/stylesheets/fancybox/fancy_shadow_se.png new file mode 100644 index 0000000000000000000000000000000000000000..541e3ffd3e88224b34a4d2097c66a780e6060aeb GIT binary patch literal 352 zcmV-m0iXVfP){pM9=`y8<_IvWD02WY@RZ<9dgjNmAB|sYF}Xw>7Sq@O0000eMf9z;FC21=)67q_`W0*0KnS4AR00W2`RGn3i8UfsEegLO@ zPhds?2e1Tm)FK3=bymIAx?X=YFo3Mdh7W?@I#8s#svp!&PB> zwah@Ngd|l0N4SCfzvjtQnd$dZ0yM)N$X+lqdtN!Pt{Wn*_`0U}m1^#r1 mwpaW{;a?9KKt^WrpTAEd?0j1W(3L*`0000P{ho=rRL|66mGO)=r*Hk83F#~lnc)I$ztaD0e0sy?& B8X5oq literal 0 HcmV?d00001 diff --git a/public/stylesheets/fancybox/fancy_title_left.png b/public/stylesheets/fancybox/fancy_title_left.png new file mode 100644 index 0000000000000000000000000000000000000000..6049223d1ec6af46e100499c01f6489c9e2c6240 GIT binary patch literal 503 zcmV+)0005LNklqcp9&~$uJw{{rUub~E?-XJ#Upm4Fe%-Gl z!u%tb0N102a|s5;SPlQvJlFCTBbvYaK@wIW6Gjx@?i20AlVDJcHNfh25WRlbF6CIq zv9_ZnqOH`}ppaUR0@%ZcM9zpDt2uQM>f+Z#wIMmyuui3DeoYXWE|hQ{D$te=Yhgkq zIvyj+$t8T|S1wITzUftNOe(E+Qjn$kDotY;I5}1lRgwi=?K26ke)djLR5W2|!7CVH zJ-`tuAq|`lK978y+CnqGNCkUke_%Gig ukvFM-ftpWh!il7Wg7kz7Y?7xB@G*olNlgoj4E_Yv!rmdKI;Vst0Ha3^zyJUM literal 0 HcmV?d00001 diff --git a/public/stylesheets/fancybox/fancy_title_right.png b/public/stylesheets/fancybox/fancy_title_right.png new file mode 100644 index 0000000000000000000000000000000000000000..e36d9db2a7c6e570aec993d3665cbc13620115e2 GIT binary patch literal 506 zcmV+)0005ONklxjQB-g>5=x46nGBwseihc$zfzvTFh(=tCRj6cJ4M&ASrCAq-HbokPnRBAHVa2(-|l wYU(UxfYLN;KDSr z1<%~X^wgl##FWaylc_d9MY*0Xjv*Ddw)7kFH5l+P-xcE$W)3=fYI&uMKVzWNT*W|n zhqlRY)q0r(8Mg&Fu_zpISivgz+b7g)c6G&O{~njE??Y{u-MM!p^=9_W+X-j8mhfK? zj`H2Yy;kp%)!V-M3;EVThyB(Z@o88wpMja-vy^g)SgE!<&|(HpS3j3^P6|6H_V+Po~-c6$N>^IEGZ*^681?Yf#{6Zf~e!I`r4y-J+3m*Ue*gH=cNZ zzpU%p61aCO%jt%FHUKW&bEWLcUAGzK?;SYE)E{9#W9O8@uj{O@89qzNU(dkI YVCW(7-@(*!CeU;SPgg&ebxsLQ07`N|KL7v# literal 0 HcmV?d00001 diff --git a/public/stylesheets/fancybox/fancybox.png b/public/stylesheets/fancybox/fancybox.png new file mode 100644 index 0000000000000000000000000000000000000000..65e14f68fd83b87f75c22c0c074e7b20bf20a133 GIT binary patch literal 15287 zcmaKTWn3G5&@B{~;%>#=DG;={yF10TIJA^Ni@Q6dxD|J62@u>uaf*A8(n3=TLErSb z_x;^(_f!7a-E4NVIcLtyoQc=dQGJd}gNuTK@?2d_$pHDPf`Wp&gN=z?QPI&3p`b{G zsVm7Fy<0o~g!9hI>FTLkeXUCSdR`&CQ|`OGxubq*0?(JYNfXC5{*R2zWF6(Xx-T>T2>J&K|Eil&n6Lix zEi`275C{!+X!)7CS*e}=H>=RA%jh4XH)T6XDeap>QZ zuCvB3f1j3`!i;@?^<5L}xzP0QOB^9?Eo@W0)j~`y+S=c{by#*Uoo$DiKILjfWNDo7 zGyqd&{!#&d_P|oW`zcaEy@;d2w|y57JdXR@m44ad$Gcyz{_I2&GK4@SU`c&Hd(VQh zn#vD^;#Q75G(~U%V%iDZL@L=Tw9hMZzCDFM9j?16?PmU()egI=v!xGRv3`4gH%jYG z*XB5pVfpH2C-V9c_8xe%8@rGrVEZ`G|9I83-+!6xowV&cMz2~U_i)uGJ@S3*cKE#^ znI+w0?#cY$pob>5_bg~ZYi`wc9G?Q_yI;!^xaByQ6*CF-F7!LoI6}!W%HOm zn)78kmGgzB<<3%Ss~TX_waZ9m05q-1AFMtfR>_#;a^F#k^#p)TMJWuMY$%F z%=%jUAKs6$O@3rjj7b9g9%p$QdV5l>n-#J#o(%rG=J6u=#jCJnOQN^y{2O0)x&Yqprl%*#!!_|zCVEW-yaI3-X52yuJ!c9 zz6iUCoS&ax%2yIfhCSZHUTwP$BhI})gzWuY_kNXgz1*K3Fz$UQmp8oH;@~mz(&g{T z0*5JN@$_j~RW(h1-Lq}xFRb{(q)D{SX3WtO`gObC;WQ9!DO#{`WS)_(*3(jJ3Lmxc)?Yc*Af>4 zXe$gst9FHmyt#7KrhMt(-!b86SnN$#XDi-;E-tXxuPcS#V1!6;)8@e~HvOb#ByQ&M zcK?UuX`Ca?v*Y!yriExsd@4QoJ$zOm`&Ikyszd50kEry*&*@-WOMQL)1w}jVgR0J4 z{o{+}~L{4c-2cW8G<*T_5Qs0y+A@Nh*tb7dX$-KpW;Hf3Q%V!a9Rc-`M0ex{kr z|Il@RukPls=sp>NOZq~@c{)Hzjg^FF1czDSutYx6{UFoI%G9*$Xv+5SH(imbfq_9E z94fW)v+sKAibW+UZyC+*=Fjjeg3ZG`hZG6-&ECL;o_yU8w+oxRXfU4syJ9}5*O&7g zvgp|981c0xY6-ssnoDEoubAhwe~C1Ph{=UKRM=Dc2hC?qWyga7}FOlQ163X0-*oqNwC4Yek|~X5e^P*VcQF zkUhPwZc!iLY%3QJ2{Ho@I z%dr=>z!}k%0N@^JagB=^_|LrNx>w)TvQA5t8{oB96C=sH!(KuDB6Dd zQ~jz>|K~1IPiLg9-A#L4s^n>nME}i*z)>Q=T2~fvkfEN*E;={T9sKDFYe0s$@o-*( zoEh}zmtQ}znV$kaO$S!N?@O$4?1l{p$z5d4tKilfaUnH1{9i^XqJR3|Uyi+nOHf+* z3}Rk8>MrX*)A&fo;0NC5B%=VEvC=)mu&29i0Z0O`ytHlX;cF(qYo*pLff_-FgJM~; z`)Tu;nHg_i7E0>?{jNgCtlz)6Iu&!AhGYMFn3H~ zJ`xR}4KY&CDsFSI%$sALezXs*9+#c^b>%GE&f)276Jgv<&zGpyo3TDQ%pvJt+&`&! z{Shd!jqXoDjbjmZGxVY}3?{YhMhsiwHT=CS0NllEL&%itR?%i52HSB+*%#wyeQC#y zyVd6XT%3pt6!g3rD_gah3DtT()o>Rv4_d#VyNVK(HhUM8cE8n3B|E| zh}3;3MgAV}^Qx*Ui6_lVS8s3c9PNhg`}5c(1ENE!P=VRx+IEQGL91)lZX=qnPZ9q1 zw5yZO!no+NVgMz&qw6SP=(&e&;Z$>q9{zXi2*K8@yh{H9B^0|1%fk897`kfNUA1#u z!{IV-MMi{e(bIe`_|JA-W3M}=w#mV-ajYBW{>-4l+bof*j=QrEjP12y!e;c>Z&;;V zM^8p8Eobfr3B$fYlBk55<1%$+d-RJ$p7W&h#Y+@F{BUtO>E#R`VBQJ{x&;Dkx&$}H zhOSgb-6>zcMD(`*QoD<9_c&DiV!qaNaA$kj=NWEQ*MFBH`?d@mR1eODIlr^8TQ&6! z?Zu%cuPP3^JxSi%Ej-q-8cKc578ijX@M73*YmY660uq2%TywHd$$rc+JHxc=>e{aVhBM(C=M%@zXsoNWf$<@*&Si zfBaE0iEyQmu4#8O^y-Lkv9sT1-MYB#6SxX;Zup)VKSW5h^`mE2w@xP1CKEEQVqieE z-|qCmnZTox4%cD$#KBz8wr>J;jgQ;vP03?pziiiZf^9Ya9A+z3FRHlvj1|4zu(0z) zk!NHd77L4tsP$B}E)KJnWQ(xqc50Cd4qeLyo7NSYC(nUG-q(2o8G`N>r}!nR>VooB zgQ~`?w`)w4s9nI9q&{b&YrC(Q$Ybmtlea49Z8$%cgf)F5FpZ`{>nRg=iw*s=fI|x~ zs(Z3*nj?^gW{3$m)_kYV>2TDRihE(6$#=dJLrPn*^e2K-^tNl$r_6h8P?Ida`U7x3 zS=_602o@XE{9@RMKYg?j(ay&?`SPJK7pZm`;)Ul4eqxd^hX@u12smf1_zTYw*g(E^ zM>kZdJXPfif?ct?IE8t==XZliUxmmBke(C$Z9FIp@<~(>*En>z|3+X31BNaT$SY4M zNkx5vUujEG6+;x6sn725w@+MSoBhFHH>`f}h`>2f5Ojs|e21azA#TBNt+Y$R*0x%yhV(lOeN^%?TxVUzBBxe;St&eUh^Ev#1hE2>Fug5G zX0^DLvfguwUx&H2HtZ~8ygSPI>L&0uAoGh!j%9nnc2Cq}!FhthK>F_tp1{3$4vMKg z&#>U&p2+u9cG&k*{#!$}l9H0kukL=dX8|r7HIXq9h#IinounmdhBFKZqZ(xogX!ubN$md{4_8j{mQ2-|aUw4ZOE9DntRlBlZA$gv;G`P+hM&gLaJ zWH?F#8W%iq1I_poC(54AEv(1nYfRsk*%bleNu;9*L>Ou`FBBpuWk)I=cHcRX%htu> zoP@h!b-onASogDD5C4iX*0tkphDUA3I5@(^@qjz)0#*F^F*g#b`UY#EgjQIY+24A7 z@C0-HO_z0psDI#nETB7|@i%u8+$!cBZ%r)7`}NwOcb-^o2fg$I+KL&PkO&kFw(ilc z$Pd`|O7c#T*p_Qo)bpL6`-gnArJ&|QEv*&j1huMidI%JOS$n?YrAN37{#C`;uDB{; zyWOtHZi9)3tMHEtWzN2Rxhf*2*O&)7-)tCvtW;~KmwmZ%hb;U8DrV3KV zdtfrOdSFhq9-+a9j6eFPV+yUfr|TerITV2O=`OJg#4kzEg62zxF!xS_aG-5XOH~Ph zBsQi&)mfq6xujyijEGi$)3@y_|G@Ghobn{i3^-dSYmG9`2pZe1n%zFSvE`uUrBIaV zzXbKIyw@biKIOz>_^ar2;dpqe(DIya=(rwN`IoT-avuKeZr^=d$8Df(#4 zQx6RhoGc+FO>z+;V|&$8)7p>mH8pBo%xZ)Y?4=7jd&_3?KfbrE*aRPD!;PXec-5VY ztVuS6m%vD` zoFWnCLFAr|)tHdxa5LU%cnR&ZiDzEf^=`|CrdD4p#UQI?7Za&z^nDH^+;r^D3su@r znNEYJ)kW{!!(ADt52^N9LeqKWImiG2VNz=zL0mAJRx* z8p&o_w`Su}@UH6F+V;~J(5X~mftrXhiiHfeuD^`ZY<+loNH*~9wr-rga=%Z3<-y<< zn<#Z^Y$@Kb#19``Q4FH?rhOufTc3YpWm*cXIFeJ@ad^K2e52o)j-K)>zc7pZj~^G` zN}2}Q!aIUl(WZTwfU!nMU4Z;+DCMg%DBw*12}kmh8YrZ|cLN2*+$^atj*cm7sPq|r z!@1S7qXTZF#KqqJ+%T3`7D`^>7QKACwXhb%Il+maJ>}Dw5jUdMmERLj z^lV00V@9;Xs7jY1Ep8Y$fmYG^lDsBvI1vS?m0xgoY-$^Nh5gVju6}uVM$$eus+G0o{WIi^N?T&>ddhjX8|G3%UeA>(3)XB+rK zKDyDnGB0;#|Bf=;icdxo8S7+luH)X&^pZWQ_~Xo*G}_LhgSLh+9`{-v^!kk-(0dUyojhC0T| zD}}kjs(flk{NmN9fRNVyyKHy^dv>f69trQWB1iqI#6jx{`W#g|f`xve>0Chz%LT-6 z16?J6Am3OFW0`njr%oD6(|&DMv~nO5B*63L(=mob?(1$ZRh_Jh@d&H8Y+Ht1G91U- zr)RnFP0uj2WH*g@0|OG`0aJB4W%OnBA2X}U>TL(WFE}iWyCFS6;IA&P?Y_p?-q^5* znWg8?Fyl)FvOC2t(#ph^Z0U-Dwi{nMj3&kU%UHpS!oOswQfMTT2^J-H9ROFw-S;XpY4@f8S!Yi8jepr(*@yLuH$`62eH zs=Fa;YwJ&=?`ddhO&=~(KWKTq`7N`Olzm}kGvsk4^Y`r>!Ni+bg<Lw^6bY>kq~e zK=)vs&g}A91Lh< z+m;C)W8{Ihn^!PSgS>g80px2KK}N9PG)aRaRt|HjarO7-*rCv(TN+ZP<6N#M$$B6A zs*me>n>lpV{^<_^6d~Q6ihtG^Zb5StlnX1~-C{|grsBLSxxVjj0{%+cP)3pdxjVml z8x*(v7GJ6!{f$k7sd#QDuO>} zjCk;mXVWmC>n|fihn*Q_k(|}_nAGxdW!UQDM!>b1V!qV<(I@uw)o7;<*Lc9rFofpP z%S@Qp&tSpMhU_)0W+)Ph?=;TFR)G42h4ctdNEiA9D#dqL@?mF@H@9Ys<>%N#Dxt|g zAut#aXWs{Ga8VXsMoFU|(1^+dIpAX63*ceSA>&~)_(lp6jjmkXWOFvxwEdUX*?NW2 z=ZV{4N9%bQI0o5eZV`+Mn;Z?AP*zqeNNX2ZL7)4_+X;ZcHxz@joH>T)cM=9 z72M&=GuzfZU_9o)u0A0lG`Bm0IOc{Vi@l;6y}h?Yvf;Onxi6SOr*rsFF)5PIkV#9N zrX)vLEt>krTP0iwf<|vVo=;v{FQ42s-D9UQfbD_^r)hEW8ZTXjv{H4&_I>tlpVH9#F&N4Mx5=VwieJV!h6tl`gSKxTOwV`o(`2o(?@Ny=y zWz^8C>;9+Ep2eFt#`@gx77)~_urrdHT1G%!tarRQ!E!)xm`N9P&70;<;B^6}eqbG+z?~l!peI}w^v&MxDP*abNyuhW1CN~d{X#xgc z=F8VWJ!?Jp1<@~jb3YB8lOU|IMn&%YwcWZx8@m-Foy28C;if{OC||M9%}3}| z`oRb6TZ8=@mvzv-(9e9(YKZ? z-vm1-c%4+wWwBce+czuEsU7#ZolNZ~Qvpf*uRo`4-v4MbsahDfF7slbfEYv!G2GaA z?6Wc{QDP`iGbiLw}s_oFyv-?|ms6^HD1|!Dy9#g^T{c}?J5~f7vU(5GC zV17IMWmm@|el+7OV(#hAwdm10&Jc}t%V-J46$q=`^s33gtYB{V%vmKCn5E5>r!d|MS7TPrY{TqUH6$ zGgPk<$Lpg9B@a}pEw6^?p9UZCWkl@+>Jc6vebkQR{ zrI5U>EiY72u%2Z>utv};v4>8~{s+{g8rM0@@{-nnr0@sP8{q^ZM-LI?R^314!%h-j z+xtncjPhC~%0 zNpU>;J@(;LL4>Tr45BwJb^fJ&*1?)RvOp7&Ml3cV3iIGY*R;Y@Zld;5=Z~IHm$B6m z%V}kK^8^0g2W;+bWKOFW+F<c*}T=l;am@$VV6qC1M`w-a#xbePQi{EFHHjQom|`GY|TZRcV@5_-CB-B=5o_+RK=rIjVJpOT8sOyT5UG#uDp;6gl)` z913|no9~ZWf8{*flTYOy`!nVDc`PyTmT9%}GdAq&&GUM(l6@DHpwTo+X zZ#irZY^YSIpIxJ0ov_Ei*^D9tvsx<35zUZbhsHPf+7 zi&0cdDeWsq^18ZyT`hLYV^ByNKln>e^i4Ci}8GT3YQlH?U7Q$Xsu<#qDkoc6=U~ZFHB|&km$6 z-*oTp#N}ZX_Dj)t%s*MnW=N+-K#%4dFDKR zYPf|riI{wT-URu9@w-vh1!R$Y9v9n-Y;|Keheeg1$$9R%92=NyUKlkPEE_iX75#}d zAaHv?Bb08=OXp40KS2>RB6ktL5_hns5Lql(=~k_r|Ehg)Aqu?Rpo*jRr|HE8eWFwu z-H3UhwoxU?tvISr14caeJKk{j!*2guwT)BMLb2}=wA}boC3ITtTtku9?gv84&4&FQ z{(|6_`ZQv!?E%qcU9FvNm21c^L6##)5u5vj#-_c2B!l-2iYX2@ELZJf3Egea@K-|I zDc7u97JVg8+P=&&PWAukavlh#Zp?%e52NTVA>#I5tu{Dh&(OqqshoI3F^l6sb3HB8 zbgo#8f9wl7A0)gZG@-4VLCr8hDYIo^h1gRj3ZbR#>?xyym5z)Myk|UvI4m&*Jr?k1rD{3L+wq<+nC!Mv6&`Ic4+YM*Kz<5y=gZLWqT8)5FN)x0 z#J_fgUq`_^(5c@bvP(@UTRDQ98fzdF>uaD|^+TPb`21K#e1F;o9@!b2>^o@?(D1? zd#K{P?6#n$L(OR`rxK5+uIUb+ADPd%PqRN-ZUJn0e9IsSRNa~-tKgBk9UT*Eu0>Fj z2mDL1C~L0yW_6QlKx;*{Ec?HWZR>pmr)QID@jVbu8IpgSl;5q>ZrLObX9NgUdPd=h z!p`Q5Z{I1QXvhFHQ=|XA7edbsj@yk6|I^JAO{1fg{(3jtP%p#7hZFf}EdA`-B4?<6 z8w{>V1?r?f=$;|f)cyHc%hcd zPpR+0(au7hfvnhn(RkgB7>VJgSGwUMG~2%#9$%FMy$AADY^Zm&)X=& zfoU>Yb+R@=J>w-KE>iX;{UHtlnC6Vl=bF`uol?VtGmt;j4g7d}1{+*N9yak)K8sk1 zA!`~`M6eYe=-SZ+xN>3~>2bE#{*Jz(z=sb?`tisyB}j}zl;%nhjiybm%>Bt%4Imry zEdd>F8Aay30vS_>ilbPPhS^~^hBq2;Zu)?uG=|-2c0cT19`h^2O0juz>1l|%y5H02 zAKP!=ZCzV5e*HZeWXh~!hdXqEcg|?-BnII5Q~7y)>Uwc+xR_{ljArL|cMMAmcz*B9 zzp3Y_AlN8cMes^Hnh*b(kH4SD!mdLzW}1)+T_Z~z^(T9NXzuEjv8lD_uf{Jw719tl zv`RP-1Vt3Qa%#u0W;ub}DQ{YWfXaeYZjSD_&Pq!k+rb~KvjR!|7ApLSIUzHqTu5~k zZlNNS$SR;_M~4^gySor$QF19GPCJE9DfugWpS>qSB`n-=up_e2oV*lIm#PNSaEIz| zN_s5qGqgEFUSVASNv`Ub>VC?U-#HIRFN|^N1xmjLmE!K_$*>TC5_jwtCKUHv8d^_1 zs;1Q{D|ejt{D~+^C1`r{oWan8l<#~BPROc2kK>kbDn=DpRuD$}-tHq_3muSPQzKKs zFh$MNy{*XI)z$0{X;5fNTZn|AiBK%m91t1NJ)ccRWo@;nN^Hh*AT=5_7*?MJoYl7# zsG&Iq-5+G?@_(+awcx@U=FOyw5c4=US|ycM8ob=&k<&+w_5qtc_h9O!R7h`RSs|VF zIsAH?s?Jz>r}oT^kGjJzVdVGe>8WvnDz(5nJD+a38C(|0l@k*==(J-nfnvA%39?yt zd~EiFG(~-#Jv*>qQcZP)a&ksBZe))MP8-yQlOj4rqrrwD*ln zP|O<7jtX+3!JXt^M1rU4hvitgY48W)YMSr7ur+FbY_ZHqK32Ah=X_UsEIwo?x?f`5 z?4Pz2aEVh+&?_0;#=m-@UL%17-O;O-v=#VygX-}a;_ouc|AQa`J5XkOD@@79zCe}p z3=yNAr?&)8?nO4ORY2auh*4&!_#Ti2DvkwVo&KIS(tiHU0h*i4Rl+=3(mnjW7hwC1 zAi_DOVvnXn%EoQ()PtqtWt@3b&U-hqMYkfArT7a$@}~ zO1e%1uyy|n*`t=U!pne0%(E&?U;;R4>_{8Gb7YJrB*8zqn<5xV@ZOICA~tRLBSPtz-WCq`;lH&q;CHLS;k_ z&+tksI(dl8o1;tX^u$Sr(RicInuW6*AqCCMF`h#h`*AG{jfN?|H~eScV3bxjcH^9n z;(iMHcsMdAOk?-_B{#nB<{mIJEUppDRVjc3FC3Fnel3X**H6t`9$?EGSx8Imi&}O=D)3r}Mdq_BADjr22HfLfZ_yKoXDDvr`}xxW)WHPO7jgr`lKmh7b=wjb z@ok_#*2l7T0^GVbAg7TXh#%b)>+Kl!&~@BlHSKp3tm(L#f#j<1W3R>%qT!W1Oh)X` z+@Gonlml&G@O%(>1cKO8qlXeW+RVzRbL@p6Mb{tDhx`2(Q-kKEViU@7p`5M z&0X7p$-HSH$$aLDmM21-5#m&ky7QRcF49O50yET=SsFnVaw!USCMCB@w2z48G{dnT za_kDvMP;FhA~z!M&M(Z-$_&=l);?ox%USH#IFkKmrovOF_<)$Q&2cYswDSj7S+Q=8 z&mipO3k=hCZU_cV#hdBUeysHv<$ORg{Fl5jMgr^fuNs}q5k?;gI!3xBZ2g+@*I)Cs zQuvu{A&rl#d**G<4R+bqHa10!Z4Irher%O3n{Au+mL#mvkg;Y~!4Ls#_{9*RK#`Ec zD2+^9X+~ecKl|VmAhu+cbUrggXw*VW#uhA#v;d}zq_ud11YLU5r5Hm*l9dIL7#KvK zb9gLEn@zXP%6=hx;c&<<5uGw|v_i8x@`d`RigCj)QephA@g8eZtr*jq}#JboQWEKRLqUlV8Y+dy+&S)&E;Q&lgX*Q43-DzVC+kO{V-tg7w$ zfjxnRt=<;X5Nr`NV*GdG@Kx;Mmu?xQpA)1sh!%!~CEx`$EM+^U$R^P!pUy`7jc9Yb zi4Ly@w9BFnNM$uWXc|r?$}M{`J!aAU)xq4vdItgnen!&)S@c3* zA~EK|g1?ziSo!5bOjT|=Q=W1iz@E-2BsS~Rc1m+9>x=&ZpP0Yi*rEtwWL}Je!iJ>!TXxo z3cms%TXPJsy~k&4=OS?}<~_Xv##~Kga)=L3TVTe*t!p^Ye8BMT$be=Id@eN0C{?)wnjYzmbwnCf{uVL^VhXP|IDf8>g`gGQ|ssLZoNNi z_$1i(o=CB>{5p1mfBb}H~(@x%rE-{HE=-%(5ke}w95e>~LKh<_@SN*=x>{?<#X;K4c8PwA% zXPbZcp4xU^R_)cmXr~CFH2)V<+elz3|BFv5pr)(1o#B^A5X~@ZA>UhbJ+SNn4e?iq zVQ2qPMfPvcN~a?49&o`AEc%zrx}_l%-^*B6YwN`&EyPoQhc91xKj4nO>+HSY5e3NbT5>14lW zvH(!3VfDuE0#8)16}$GF<-gtJ@6ax@WShYlb8xyi5rT;sYgKp@(Sk8i5Zl+}R#?vm zarSlP%r0L|VyyVlNG_5sD=WV&OBZ~X)yRj7vKH_uokdmhkNC5>V`i)B!tc^WOd>r{ ze@+r?kXmWreq;iFO=>YJ7OKI^F^OuNZi&O|362sxH|5*CJ)m|>e14nYR3Lprfq@$D zFu+PAg1i?VD5o^^SHVU>@-U9-(1MBK0>Y3QNKS_0We5jM_5n9I6AKWG)sIqH^-D_uGJ>4%qA$!w2vKd&1%uDXv zhCgPE=93vk1-|@f4H7h&k>jF)iifw6IeKz!Y=R{Gmlbr=yOdZ6=SA@qqgEn7@&+xd z!((Z$wgwl+_Z5e0<7o8BN6GI zVsSp&4|T#AsSB3-{{=(c?~dx`5sNShg( zG#1q@Qj%K?q%%xzkL2U+dQc_TFZknbjji%plZ&gd!E$ZGg7ew+ST9&28u`mYTD;2c z^qgP7&fbSYTr_m;-WWY+kbcKKqOu(f`$TR}Ohn?ltdeW<{xb`{EXL)rMTXQ4NO6FK z*#z0$npSroAr=_=bquv4_a|5LiE2rp8M{;kxSs(^_qO0pn&F>%@op}SfPD)3cxm1br@0g4!H;1NpFvk(5T@A*kUm`Tz{x*gq;NnQ(n4u z3dtz2SYp96k0aGsMglyYF;!9xQyLV;blzZbhdY|zcVFl{pkXj|DrL9j&F7)7aX!bQ z9uyUPX|I(Pf=2uOKYSU`5@OHk83eFJp;E?k2?ii-rZY-%ln@JPkiaGuUh@YPY%iML z1P?QOK;7p|)t%?U8!E?%8SukVzP)(~8G5^t`gZIR(p6YUi4uxya-h^~ECu@6 zqqAC%xW;+t()4VM{|wJ6e$Ni7Xl}lj355EB0e141pK#~D=KRAS#y*f9n%n3*h(Xyd z@8`S&tQJN@p0;1yyyMk|xH0kL)DFj+{IgEZ{8L&PJ^rx9!ELjM;COT8jNB}US7ijV z+sA@%1LRXs{P`>F`irv9+orz1Yj@%sK8jfC)-NaI3l15UTe!Jfgqe38|O!;sI2JS^U`6FGzsESspo zJ67>9!9_8nklSSzoDnSp&(1%y>P3qusVclU!9(ebDy1zQ=T7II#d}B4wqMr-?xp9M zb4=*|Uhol>-Mf`D$~TbQCCnc=Rl{Gw+knJg)Y%*Tfb5P1qh7+YmKXa$2g>HNrW9#Q zhE-bm9OOk`nz2RjjzWl?!MMgFy|_vY_MnWl5wQM%iHK851<&M20;Eeik3|yItH%6|oN9Eun6{%d= z=N*eANB|4DmbrRaN=(|bb2)575&|JP3t}M@h=m!1$dRRp%&-+T0AF8=%d*i<2z{Lh z^F3)IGo1%ZbKG$?nNultCSy0di(F%Ybg&(;k z1izF4^>M!(M)W!<><(H=dwPQDr5OZ?ie+6C6uj**G(x37O`rWR5pseAXJt9$EgTvv zx4a84!V;Ov#?xo~Do%gr{GPUXF8H#!%uK!9%Sr-IZP?*+33*8(p3BHHv%9#C06jvGqkfob46X?zh8#~j zPJ7k1&cfrel5#z{5%T=s%-E-Z#5|L?qmmUG0d=2Ak^=?b&vnK`{Xu_3_vk^E?4$xx z*;D$%(M|j94SX0STo#sIR+rpJ*tY&@s71E=mkubfnYXRVwX8VB+&7aaX zDkYYB08*`-r~k?r|BEg|>3>NVQXVe+TgCDnY4`*WEFO2#&}dCIr(efKj#%hFlb5GZw{&Grpn$HOUs!iagffg< zUOr3@Dmwyx;;e{LUpr{gNl~)W zX@2n$J5io08JiWmLC#GBrIG(1`lzs(%$$xv4*B5(677_}0DvK1{DsG-&*K_EoMlrU z1r9}lAnTooE-E#wQ+?v#McpTvQxiAkk)126n3!C*p}Ki}-pxM`r2ez?TgTl*eVEkx*hsQ4AG1Scb@M1?Bo z64>{l#I7SqZM5$0m$gw!#s{=|bGn1d3YpvS_JPXsv{T^2Xvc)HkNba5@(>xrwNvD3 zSJGWRM!%K`GJiBn_W_SS%OI7~BQ#W!$zg(OccJ37cp#jKUfwUV>yVMqNf$*9P>0_X zQ3XzOz@}VP-r7gmFGi5ST<-NsaScbte+`6jy-v##`Q86b z6jG|SjsPcT{TA5e7iAKdP`-O5snH$Fp#~DWi2dP+tDEgGywPnPkgPeJ+9QTdTzE{X z88~L0W4K4`f9Q5Q<}Oh(JfaAvN+0-dgE;%?(P*qXNwpB_)-Zzm*mP zcex|GZO8(LWj!(h`(I@JpSU%%%+bka+4p#^=Li0xSy-m?t6ws8mE^qtzmeB(XQ@wU ZMt7F5hocMxav&E)U0Fw|QQ>vO{{ZOG+C=~W literal 0 HcmV?d00001 diff --git a/public/stylesheets/jquery.fancybox-1.3.4.css b/public/stylesheets/jquery.fancybox-1.3.4.css new file mode 100644 index 00000000..46c5f396 --- /dev/null +++ b/public/stylesheets/jquery.fancybox-1.3.4.css @@ -0,0 +1,359 @@ +/* + * FancyBox - jQuery Plugin + * Simple and fancy lightbox alternative + * + * Examples and documentation at: http://fancybox.net + * + * Copyright (c) 2008 - 2010 Janis Skarnelis + * That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated. + * + * Version: 1.3.4 (11/11/2010) + * Requires: jQuery v1.3+ + * + * Dual licensed under the MIT and GPL licenses: + * http://www.opensource.org/licenses/mit-license.php + * http://www.gnu.org/licenses/gpl.html + */ + +#fancybox-loading { + position: fixed; + top: 50%; + left: 50%; + width: 40px; + height: 40px; + margin-top: -20px; + margin-left: -20px; + cursor: pointer; + overflow: hidden; + z-index: 1104; + display: none; +} + +#fancybox-loading div { + position: absolute; + top: 0; + left: 0; + width: 40px; + height: 480px; + background-image: url('fancybox/fancybox.png'); +} + +#fancybox-overlay { + position: absolute; + top: 0; + left: 0; + width: 100%; + z-index: 1100; + display: none; +} + +#fancybox-tmp { + padding: 0; + margin: 0; + border: 0; + overflow: auto; + display: none; +} + +#fancybox-wrap { + position: absolute; + top: 0; + left: 0; + padding: 20px; + z-index: 1101; + outline: none; + display: none; +} + +#fancybox-outer { + position: relative; + width: 100%; + height: 100%; + background: #fff; +} + +#fancybox-content { + width: 0; + height: 0; + padding: 0; + outline: none; + position: relative; + overflow: hidden; + z-index: 1102; + border: 0px solid #fff; +} + +#fancybox-hide-sel-frame { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; + background: transparent; + z-index: 1101; +} + +#fancybox-close { + position: absolute; + top: -15px; + right: -15px; + width: 30px; + height: 30px; + background: transparent url('fancybox/fancybox.png') -40px 0px; + cursor: pointer; + z-index: 1103; + display: none; +} + +#fancybox-error { + color: #444; + font: normal 12px/20px Arial; + padding: 14px; + margin: 0; +} + +#fancybox-img { + width: 100%; + height: 100%; + padding: 0; + margin: 0; + border: none; + outline: none; + line-height: 0; + vertical-align: top; +} + +#fancybox-frame { + width: 100%; + height: 100%; + border: none; + display: block; +} + +#fancybox-left, #fancybox-right { + position: absolute; + bottom: 0px; + height: 100%; + width: 35%; + cursor: pointer; + outline: none; + background: transparent url('fancybox/blank.gif'); + z-index: 1102; + display: none; +} + +#fancybox-left { + left: 0px; +} + +#fancybox-right { + right: 0px; +} + +#fancybox-left-ico, #fancybox-right-ico { + position: absolute; + top: 50%; + left: -9999px; + width: 30px; + height: 30px; + margin-top: -15px; + cursor: pointer; + z-index: 1102; + display: block; +} + +#fancybox-left-ico { + background-image: url('fancybox/fancybox.png'); + background-position: -40px -30px; +} + +#fancybox-right-ico { + background-image: url('fancybox/fancybox.png'); + background-position: -40px -60px; +} + +#fancybox-left:hover, #fancybox-right:hover { + visibility: visible; /* IE6 */ +} + +#fancybox-left:hover span { + left: 20px; +} + +#fancybox-right:hover span { + left: auto; + right: 20px; +} + +.fancybox-bg { + position: absolute; + padding: 0; + margin: 0; + border: 0; + width: 20px; + height: 20px; + z-index: 1001; +} + +#fancybox-bg-n { + top: -20px; + left: 0; + width: 100%; + background-image: url('fancybox/fancybox-x.png'); +} + +#fancybox-bg-ne { + top: -20px; + right: -20px; + background-image: url('fancybox/fancybox.png'); + background-position: -40px -162px; +} + +#fancybox-bg-e { + top: 0; + right: -20px; + height: 100%; + background-image: url('fancybox/fancybox-y.png'); + background-position: -20px 0px; +} + +#fancybox-bg-se { + bottom: -20px; + right: -20px; + background-image: url('fancybox/fancybox.png'); + background-position: -40px -182px; +} + +#fancybox-bg-s { + bottom: -20px; + left: 0; + width: 100%; + background-image: url('fancybox/fancybox-x.png'); + background-position: 0px -20px; +} + +#fancybox-bg-sw { + bottom: -20px; + left: -20px; + background-image: url('fancybox/fancybox.png'); + background-position: -40px -142px; +} + +#fancybox-bg-w { + top: 0; + left: -20px; + height: 100%; + background-image: url('fancybox/fancybox-y.png'); +} + +#fancybox-bg-nw { + top: -20px; + left: -20px; + background-image: url('fancybox/fancybox.png'); + background-position: -40px -122px; +} + +#fancybox-title { + font-family: Helvetica; + font-size: 12px; + z-index: 1102; +} + +.fancybox-title-inside { + padding-bottom: 10px; + text-align: center; + color: #333; + background: #fff; + position: relative; +} + +.fancybox-title-outside { + padding-top: 10px; + color: #fff; +} + +.fancybox-title-over { + position: absolute; + bottom: 0; + left: 0; + color: #FFF; + text-align: left; +} + +#fancybox-title-over { + padding: 10px; + background-image: url('fancybox/fancy_title_over.png'); + display: block; +} + +.fancybox-title-float { + position: absolute; + left: 0; + bottom: -20px; + height: 32px; +} + +#fancybox-title-float-wrap { + border: none; + border-collapse: collapse; + width: auto; +} + +#fancybox-title-float-wrap td { + border: none; + white-space: nowrap; +} + +#fancybox-title-float-left { + padding: 0 0 0 15px; + background: url('fancybox/fancybox.png') -40px -90px no-repeat; +} + +#fancybox-title-float-main { + color: #FFF; + line-height: 29px; + font-weight: bold; + padding: 0 0 3px 0; + background: url('fancybox/fancybox-x.png') 0px -40px; +} + +#fancybox-title-float-right { + padding: 0 0 0 15px; + background: url('fancybox/fancybox.png') -55px -90px no-repeat; +} + +/* IE6 */ + +.fancybox-ie6 #fancybox-close { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_close.png', sizingMethod='scale'); } + +.fancybox-ie6 #fancybox-left-ico { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_nav_left.png', sizingMethod='scale'); } +.fancybox-ie6 #fancybox-right-ico { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_nav_right.png', sizingMethod='scale'); } + +.fancybox-ie6 #fancybox-title-over { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_title_over.png', sizingMethod='scale'); zoom: 1; } +.fancybox-ie6 #fancybox-title-float-left { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_title_left.png', sizingMethod='scale'); } +.fancybox-ie6 #fancybox-title-float-main { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_title_main.png', sizingMethod='scale'); } +.fancybox-ie6 #fancybox-title-float-right { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_title_right.png', sizingMethod='scale'); } + +.fancybox-ie6 #fancybox-bg-w, .fancybox-ie6 #fancybox-bg-e, .fancybox-ie6 #fancybox-left, .fancybox-ie6 #fancybox-right, #fancybox-hide-sel-frame { + height: expression(this.parentNode.clientHeight + "px"); +} + +#fancybox-loading.fancybox-ie6 { + position: absolute; margin-top: 0; + top: expression( (-20 + (document.documentElement.clientHeight ? document.documentElement.clientHeight/2 : document.body.clientHeight/2 ) + ( ignoreMe = document.documentElement.scrollTop ? document.documentElement.scrollTop : document.body.scrollTop )) + 'px'); +} + +#fancybox-loading.fancybox-ie6 div { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_loading.png', sizingMethod='scale'); } + +/* IE6, IE7, IE8 */ + +.fancybox-ie .fancybox-bg { background: transparent !important; } + +.fancybox-ie #fancybox-bg-n { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_n.png', sizingMethod='scale'); } +.fancybox-ie #fancybox-bg-ne { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_ne.png', sizingMethod='scale'); } +.fancybox-ie #fancybox-bg-e { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_e.png', sizingMethod='scale'); } +.fancybox-ie #fancybox-bg-se { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_se.png', sizingMethod='scale'); } +.fancybox-ie #fancybox-bg-s { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_s.png', sizingMethod='scale'); } +.fancybox-ie #fancybox-bg-sw { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_sw.png', sizingMethod='scale'); } +.fancybox-ie #fancybox-bg-w { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_w.png', sizingMethod='scale'); } +.fancybox-ie #fancybox-bg-nw { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_nw.png', sizingMethod='scale'); } \ No newline at end of file From 1e3341151642a2960eac5c93f8eb5fd5c6e6cd69 Mon Sep 17 00:00:00 2001 From: benni Date: Thu, 19 May 2011 19:49:37 +0200 Subject: [PATCH 034/335] refactored some js stuff. Fixed forms in article modul. --- app/controllers/articles_controller.rb | 19 ++-- app/controllers/home_controller.rb | 3 +- app/helpers/articles_helper.rb | 4 +- app/views/articles/_article.html.haml | 20 ++++ app/views/articles/_article_row.rhtml | 25 ----- app/views/articles/_articles.html.haml | 18 ++- app/views/articles/_edit.haml | 7 -- app/views/articles/_new_article_row.haml | 2 - app/views/articles/create.js.erb | 2 +- app/views/articles/destroy.js.erb | 4 +- app/views/articles/edit_all.rhtml | 102 +++++++++-------- app/views/articles/index.haml | 21 ++-- app/views/articles/parse_upload.html.haml | 4 +- app/views/articles/update.js.erb | 2 +- app/views/articles/upload.html.haml | 10 +- .../foodcoop/ordergroups/index.html.haml | 20 +--- app/views/foodcoop/users/index.html.haml | 16 +-- app/views/home/index.html.haml | 2 +- app/views/pages/show.html.haml | 4 +- app/views/shared/_workgroup_members.haml | 2 +- config/locales/de.yml | 1 + config/routes.rb | 3 - lib/foodcoop.rb | 35 ------ public/javascripts/application.js | 105 ++++++++++-------- public/stylesheets/main.css | 2 +- 25 files changed, 184 insertions(+), 249 deletions(-) create mode 100644 app/views/articles/_article.html.haml delete mode 100644 app/views/articles/_article_row.rhtml delete mode 100644 app/views/articles/_edit.haml delete mode 100644 app/views/articles/_new_article_row.haml delete mode 100644 lib/foodcoop.rb diff --git a/app/controllers/articles_controller.rb b/app/controllers/articles_controller.rb index aeed1c88..e98f279f 100644 --- a/app/controllers/articles_controller.rb +++ b/app/controllers/articles_controller.rb @@ -76,7 +76,7 @@ class ArticlesController < ApplicationController # Renders a form for editing all articles from a supplier def edit_all - @articles = @supplier.articles.without_deleted + @articles = @supplier.articles end # Updates all article of specific supplier @@ -130,14 +130,14 @@ class ArticlesController < ApplicationController articles.each {|a| a.update_attribute(:availability, true) } flash[:notice] = 'Alle gewählten Artikel wurden auf "verfügbar" gesetzt' else - flash[:error] = 'Keine Aktion ausgewählt!' + flash[:alert] = 'Keine Aktion ausgewählt!' end # action succeded - redirect_to supplier_articles_path(@supplier, :per_page => params[:per_page]) + redirect_to supplier_articles_url(@supplier, :per_page => params[:per_page]) - rescue => e - flash[:error] = 'Ein Fehler ist aufgetreten: ' + e - redirect_to supplier_articles_path(@supplier, :per_page => params[:per_page]) + rescue => error + redirect_to supplier_articles_url(@supplier, :per_page => params[:per_page]), + :alert => "Ein Fehler ist aufgetreten: #{error}" end # lets start with parsing articles from uploaded file, yeah @@ -174,10 +174,9 @@ class ArticlesController < ApplicationController end @articles << article end - flash.now[:notice] = @articles.size.to_s + " articles are parsed successfully." - rescue => e - flash[:error] = "An error has occurred: " + e.message - redirect_to upload_supplier_articles_path(@supplier) + flash.now[:notice] = "#{@articles.size} articles are parsed successfully." + rescue => error + redirect_to upload_supplier_articles_path(@supplier), :alert => "An error has occurred: #{error.message}" end end diff --git a/app/controllers/home_controller.rb b/app/controllers/home_controller.rb index 266e9a6f..f857992b 100644 --- a/app/controllers/home_controller.rb +++ b/app/controllers/home_controller.rb @@ -1,6 +1,5 @@ class HomeController < ApplicationController - helper :messages - + def index # unaccepted tasks @unaccepted_tasks = @current_user.unaccepted_tasks diff --git a/app/helpers/articles_helper.rb b/app/helpers/articles_helper.rb index f6b2458f..8df06524 100644 --- a/app/helpers/articles_helper.rb +++ b/app/helpers/articles_helper.rb @@ -6,9 +6,9 @@ module ArticlesHelper end def row_classes(article) - classes = " click-me" + classes = " " classes += " unavailable" if !article.availability - classes += " just_updated" if @article.recently_updated && @article.availability + classes += " just_updated" if article.recently_updated && article.availability classes end end \ No newline at end of file diff --git a/app/views/articles/_article.html.haml b/app/views/articles/_article.html.haml new file mode 100644 index 00000000..2f4fa38c --- /dev/null +++ b/app/views/articles/_article.html.haml @@ -0,0 +1,20 @@ +%tr{ :class => cycle('even','odd') + row_classes(article)}[article] + %td= check_box_tag 'selected_articles[]', article.id.to_s, false, {:id => "checkbox_#{article.id}", 'data-ignore-onchange' => true} + %td{'data-check-this' => "#checkbox_#{article.id}", :class => 'click-me'}= article.name + %td= article.origin + %td= truncate(article.article_category.name, :length => 11) if article.article_category + %td= article.unit + %td= truncate(article.note, :length => 11) + %td= article.unit_quantity + %td{:class => "currency"} + %acronym{:title => "zuletzt geändert: #{format_date(article.updated_at)} | Brutto: #{number_to_currency(article.gross_price)}"} + = number_to_currency(article.price) + %td= number_to_percentage(article.tax) if article.tax != 0 + %td= number_to_currency(article.deposit) if article.deposit != 0 + %td + = link_to icon(:edit), edit_supplier_article_path(@supplier, article), + :remote => true + = link_to icon(:delete), [@supplier, article], + :method => :delete, :confirm => 'Bist du sicher?', :remote => true + + \ No newline at end of file diff --git a/app/views/articles/_article_row.rhtml b/app/views/articles/_article_row.rhtml deleted file mode 100644 index fc26c2b5..00000000 --- a/app/views/articles/_article_row.rhtml +++ /dev/null @@ -1,25 +0,0 @@ - - <%= check_box_tag 'selected_articles[]', @article.id.to_s, false, - {:id => "checkbox_#{@article.id.to_s}", :onclick => "checkRow('#{@article.id.to_s}')"} %> - -<%= @article.name -%> -<%= @article.origin -%> -<%= truncate(@article.article_category.name, :length => 11) if @article.article_category -%> -<%= @article.unit -%> -<%= truncate(@article.note, :length => 11) -%> -<%= @article.unit_quantity -%> - - - <%= number_to_currency(@article.price) -%> - - -<%= number_to_percentage(@article.tax) if @article.tax != 0 -%> -<%= number_to_currency(@article.deposit) if @article.deposit != 0 -%> - - <%= link_to icon(:edit, :onclick => "checkRow('#{@article.id.to_s}')"), edit_supplier_article_path(@supplier, @article), - :remote => true %> - <%= link_to icon(:delete, :onclick => "checkRow('#{@article.id.to_s}')"), [@supplier, @article], - :method => :delete, :confirm => 'Bist du sicher?', :remote => true %> - - \ No newline at end of file diff --git a/app/views/articles/_articles.html.haml b/app/views/articles/_articles.html.haml index 33d7a17f..2a79e1f3 100644 --- a/app/views/articles/_articles.html.haml +++ b/app/views/articles/_articles.html.haml @@ -25,7 +25,7 @@ %th[sort_td_class_helper "note"] = sort_link_helper "Notiz", "note" %th{:style => "width: 4em;"} Gebgr. - %th{:style => "width: 4em;"} Preis + %th{:style => "width: 5em;"} Preis %th{:style => "width: 3.5em;"} MwSt %th{:style => "width: 4em;"} Pfand %th{:style => "width: 3em;"} @@ -33,19 +33,17 @@ %tbody#listbody - if @total > 0 - - for @article in @articles - %tr{ :class => cycle('even','odd') + row_classes(@article), :id => @article.id, :onclick => "checkRow('#{@article.id.to_s}')"} - = render :partial => 'article_row' + - for article in @articles + = render(article) %tfoot %tr %td{:colspan => '11'} - = check_box_tag :checkall, 1, false, :onclick => 'checkUncheckAll(this)' - %select{:name => "selected_action"} + = check_box_tag :checkall, 1, false, 'data-check-all' => '#articlesInListForm', 'data-ignore-onchange' => true + %select{:name => "selected_action", 'data-submit-onchange' => true} %option{:value => '', :selected => 'selected'} Aktion wählen ... - %option{:value => "destroy", :onclick => "if (confirm('Willst Du wirklich alle gewählten Artikel löschen?')) { this.up('form').submit(); }; return false;"} Artikel löschen - %option{:value => "setNotAvailable", :onclick => "this.up('form').submit()"} Artikel sind nicht mehr verfügbar - %option{:value => "setAvailable", :onclick => "this.up('form').submit()"} Artikel sind verfügbar - + %option{:value => "destroy", 'data-confirm' => 'Willst Du wirklich alle gewählten Artikel löschen?'} Artikel löschen + %option{:value => "setNotAvailable"} Artikel sind nicht mehr verfügbar + %option{:value => "setAvailable"} Artikel sind verfügbar = hidden_field_tag 'supplier_id', @supplier.id %p= pagination_links_remote @articles, :params => {:sort => params[:sort]} diff --git a/app/views/articles/_edit.haml b/app/views/articles/_edit.haml deleted file mode 100644 index 10e473dc..00000000 --- a/app/views/articles/_edit.haml +++ /dev/null @@ -1,7 +0,0 @@ -%h2 - Bearbeiten von - = @article.name -zuletzt aktualisiert am: -= format_time(@article.updated_at) - -= render :partial => "form" diff --git a/app/views/articles/_new_article_row.haml b/app/views/articles/_new_article_row.haml deleted file mode 100644 index c236606a..00000000 --- a/app/views/articles/_new_article_row.haml +++ /dev/null @@ -1,2 +0,0 @@ -%tr{:class => row_classes(@article), :id => @article.id, :onclick => "checkRow('#{@article.id.to_s}')"} - = render :partial => 'article_row' \ No newline at end of file diff --git a/app/views/articles/create.js.erb b/app/views/articles/create.js.erb index a06276fd..001d42eb 100644 --- a/app/views/articles/create.js.erb +++ b/app/views/articles/create.js.erb @@ -1,2 +1,2 @@ -$('#listbody').prepend('<%= escape_javascript(render("new_article_row")) %>'); +$('#listbody').prepend('<%= escape_javascript(render(@article)) %>'); $.fancybox.close(); \ No newline at end of file diff --git a/app/views/articles/destroy.js.erb b/app/views/articles/destroy.js.erb index d59480f9..17ec0157 100644 --- a/app/views/articles/destroy.js.erb +++ b/app/views/articles/destroy.js.erb @@ -1,5 +1,5 @@ <% if @order %> -$('#<%= @article.id %>').after('<%= escape_javascript(render("destroy_active_article")) %>'); +$('#article_<%= @article.id %>').after('<%= escape_javascript(render("destroy_active_article")) %>'); <% else %> -$('#<%= @article.id %>').remove(); +$('#article_<%= @article.id %>').remove(); <% end %> \ No newline at end of file diff --git a/app/views/articles/edit_all.rhtml b/app/views/articles/edit_all.rhtml index 4183db2e..40147f63 100644 --- a/app/views/articles/edit_all.rhtml +++ b/app/views/articles/edit_all.rhtml @@ -1,64 +1,62 @@ -

        Alle Artikel von <%= @supplier.name %> bearbeiten

        +<% title "Alle Artikel von #{@supplier.name} bearbeiten" %>
        - <% form_tag do -%> - <%= select_tag :switch_supplier, - options_for_select( Supplier.all.collect {|s| [s.name, url_for(edit_all_supplier_articles_path(s))] }, - url_for(edit_all_supplier_articles_path(@supplier)) ), - :onchange => "redirectTo(this)", - :style => "font-size: 0.9em;margin-left:1em;" %> - <% end %> -
        + <%= select_tag :switch_supplier, + options_for_select( Supplier.all.collect {|s| [s.name, edit_all_supplier_articles_url(s)] }, + edit_all_supplier_articles_url(@supplier)), + 'data-redirect-to' => true, + :style => "font-size: 0.9em;margin-left:1em;" %> +

        - - Pflichtfelder sind: Name, Einheit, (netto) Preis und Bestellnummer. - -

        - <% form_tag(update_all_supplier_articles_path(@supplier)) do %> - - - - - - - - - - - - - - - - <% for article in @articles %> - <% fields_for 'articles[]', article do |form| %> - > - - - - - - - - - - - <% end %> - <% end %> - - -
        verf.NameEinheitPreisGebGrBest.Nr.NotizKategorieMwSt.Pfand
        - <%= form.check_box 'availability' -%> - <%= form.text_field 'name', :size => 0 -%> - <%= form.text_field 'unit', :size => 5 -%><%= form.text_field 'price', :size => 4 -%><%= form.text_field 'unit_quantity', :size => 4 -%><%= form.text_field 'order_number', :size => 6 -%><%= form.text_field 'note', :size => 15 -%><%= form.select 'article_category_id', ArticleCategory.find(:all).collect {|a| [ a.name, a.id ] }, { :include_blank => true } -%><%= form.text_field 'tax', :size => 4 -%><%= form.text_field 'deposit', :size => 4 -%>

        - Achtung, alle Artikel werden aktualisiert!
        - <%= submit_tag 'Alle Artikel aktualisieren'%> | <%= link_to 'Abbrechen', supplier_articles_path(@supplier) %> + + Pflichtfelder sind: Name, Einheit, (netto) Preis und Bestellnummer. + +

        + <%= form_tag(update_all_supplier_articles_path(@supplier)) do %> + + + + + + + + + + + + + + + + <% for article in @articles %> + <%= fields_for 'articles[]', article do |form| %> + > + + + + + + + + + + + <% end %> + <% end %> + + +
        verf.NameEinheitPreisGebGrBest.Nr.NotizKategorieMwSt.Pfand
        + <%= form.check_box 'availability' -%> + <%= form.text_field 'name', :size => 0 -%> + <%= form.text_field 'unit', :size => 5 -%><%= form.text_field 'price', :size => 4 -%><%= form.text_field 'unit_quantity', :size => 4 -%><%= form.text_field 'order_number', :size => 6 -%><%= form.text_field 'note', :size => 15 -%><%= form.select 'article_category_id', ArticleCategory.find(:all).collect {|a| [ a.name, a.id ] }, { :include_blank => true } -%><%= form.text_field 'tax', :size => 4 -%><%= form.text_field 'deposit', :size => 4 -%>

        + Achtung, alle Artikel werden aktualisiert!
        + <%= submit_tag 'Alle Artikel aktualisieren'%> | <%= link_to 'Abbrechen', supplier_articles_path(@supplier) %> <% end %>
        \ No newline at end of file diff --git a/app/views/articles/index.haml b/app/views/articles/index.haml index d8d26897..d174bcbd 100644 --- a/app/views/articles/index.haml +++ b/app/views/articles/index.haml @@ -7,19 +7,17 @@ %li Zugriff auf externe Datenbank %ul - %li= link_to "Suchen/Importieren", "#import", 'data-toggle_this' => '#import' + %li= link_to "Suchen/Importieren", "#import", 'data-toggle-this' => '#import' %li= link_to "Synchronisieren", sync_supplier_articles_path(@supplier), :method => :post #change_supplier{:style => "padding:0 0 0.5em 0.7em;"} %span{:style => "float:left"} Lieferantin wechseln: - = form_tag do - = select_tag :switch_supplier, - options_for_select( Supplier.all(:order => 'name').collect {|s| [s.name, url_for(supplier_articles_path(s))] }, - url_for(supplier_articles_path(@supplier)) ), - :onchange => "redirectTo(this)", - :style => "font-size: 0.9em;margin-left:1em;" + = select_tag :switch_supplier, + options_for_select(Supplier.order(:name).map {|s| [s.name, supplier_articles_url(s)] }, supplier_articles_url(@supplier)), + :style => "font-size: 0.9em;margin-left:1em;", + 'data-redirect-to' => true - unless @supplier.shared_supplier.nil? #import.single_column{:style => "display:none; clear:both"} @@ -40,7 +38,7 @@ = check_box_tag "regional", "1", false #search_results // "import_search_results" will be rendered - = link_to "Schließen", "#import", 'data-toggle_this' => '#import' + = link_to "Schließen", "#import", 'data-toggle-this' => '#import' .single_column{:style => 'width:100%; clear:both'} .box_title @@ -57,12 +55,13 @@ #article_filter #article_search_form{:style=>"display:inline;"} - = form_tag supplier_articles_path(@supplier), :method => :get, :remote => true do + = form_tag supplier_articles_path(@supplier), :method => :get, :remote => true, 'data-submit-onchange' => true do %label{:for => 'article_name'} Suche im Artikelnamen: - = text_field_tag("query", params['query'], :size => 10 ) + = text_field_tag :query, params[:query], :size => 10 = submit_tag "Suchen" - = form_tag update_selected_supplier_articles_path(@supplier), :id => "articlesInListForm" do + = form_tag update_selected_supplier_articles_path(@supplier), :id => "articlesInListForm", + 'data-submit-onchange' => true do #table= render 'articles' #edit_article{:style => "display:none"} diff --git a/app/views/articles/parse_upload.html.haml b/app/views/articles/parse_upload.html.haml index 67d411d9..78052fb9 100644 --- a/app/views/articles/parse_upload.html.haml +++ b/app/views/articles/parse_upload.html.haml @@ -5,7 +5,7 @@ %br/ Achtung, momentan gibt es keine Überprüfung auf doppelte Artikel. -- form_tag(create_from_upload_supplier_articles_path(@supplier)) do += form_tag(create_from_upload_supplier_articles_path(@supplier)) do %table %tr %th Nummer @@ -20,7 +20,7 @@ %th Gebindegröße %th Kategorie - for article in @articles - - fields_for "articles[]", article do |form| + = fields_for "articles[]", article do |form| %tr{:class => cycle('even', 'odd')} %td= form.text_field 'order_number', :size => 6 %td= form.text_field 'name', :size => 0 diff --git a/app/views/articles/update.js.erb b/app/views/articles/update.js.erb index 1f2a3df0..d0bbc47e 100644 --- a/app/views/articles/update.js.erb +++ b/app/views/articles/update.js.erb @@ -1,2 +1,2 @@ -$('#<%= @article.id %>').html('<%= escape_javascript(render("article_row")) %>'); +$('#article_<%= @article.id %>').replaceWith('<%= escape_javascript(render(@article)) %>'); $.fancybox.close(); \ No newline at end of file diff --git a/app/views/articles/upload.html.haml b/app/views/articles/upload.html.haml index 6c64fcb0..dcb3bfe2 100644 --- a/app/views/articles/upload.html.haml +++ b/app/views/articles/upload.html.haml @@ -12,12 +12,12 @@ %i Korrekte Reihenfolge der Spalten: %br/ - = ["Status (x=ausgelistet)", "Bestellnummer", "Name", "Notiz", "Hersteller", "Herkunft", | - "Einheit", "Preis(netto)", "MwSt", "Pfand", "Gebindegröße", | - "Staffelmenge", "Staffelpreis", "Kategorie"].join(" | ") | + = ["Status (x=ausgelistet)", "Bestellnummer", "Name", "Notiz", "Hersteller", "Herkunft", + "Einheit", "Preis(netto)", "MwSt", "Pfand", "Gebindegröße", + "Staffelmenge", "Staffelpreis", "Kategorie"].join(" | ") #uploadArticles.uploadForm - - form_for :articles, :url => parse_upload_supplier_articles_path(@supplier), | - :html => { :multipart => true } do |form| | + = form_for :articles, :url => parse_upload_supplier_articles_path(@supplier), + :html => { :multipart => true } do |form| %p= form.file_field "file" %p= submit_tag "Datei hochladen" diff --git a/app/views/foodcoop/ordergroups/index.html.haml b/app/views/foodcoop/ordergroups/index.html.haml index b60da1f5..14a5888a 100644 --- a/app/views/foodcoop/ordergroups/index.html.haml +++ b/app/views/foodcoop/ordergroups/index.html.haml @@ -5,23 +5,13 @@ %h2 Übersicht .column_content #filter{:style => "margin-right:2em;"} - = form_tag foodcoop_ordergroups_path, :method => :get, :style=>"display:inline;", :id => 'ordergroup_search', :remote => true do + = form_tag foodcoop_ordergroups_path, :method => :get, :style=>"display:inline;", :id => 'ordergroup_search', + :remote => true, 'data-submit-onchange' => true do %label{:for => 'article_name'} Suche nach Name: - = text_field_tag(:query, params[:query], :size => 10 ) + = text_field_tag :query, params[:query], :size => 10 %label{:for => 'only_active'} Nur aktive: - = check_box_tag('only_active') + = check_box_tag 'only_active', 1, params[:only_active] %small (mindestens einmal in den letzten 3 Monaten bestellt) #ordergroups - = render :partial => "ordergroups" - -- content_for :head do - :javascript - $(function() { - $('#query').observe_field(1, function() { - $('#ordergroup_search').submit(); - }); - $('#only_active').click(function() { - $('#ordergroup_search').submit(); - }); - }); \ No newline at end of file + = render :partial => "ordergroups" \ No newline at end of file diff --git a/app/views/foodcoop/users/index.html.haml b/app/views/foodcoop/users/index.html.haml index 8932d255..00951486 100644 --- a/app/views/foodcoop/users/index.html.haml +++ b/app/views/foodcoop/users/index.html.haml @@ -1,14 +1,3 @@ -- content_for :head do - :javascript - $(function() { - $('#query').observe_field(1, function() { - $('#user_search').submit(); - }); - $('#sort_by_ordergroups').click(function() { - $('#user_search').submit(); - }); - }); - %h1 Mitglieder der Foodcoop %p %i @@ -24,9 +13,10 @@ .column_content - unless params[:sort_by_ordergroups] #user_filter{:style => "float:left; margin-right:2em;"} - = form_tag foodcoop_users_path, :method => :get, :style=>"display:inline;", :id => 'user_search', :remote => true do + = form_tag foodcoop_users_path, :method => :get, :style=>"display:inline;", :id => 'user_search', + :remote => true, 'data-submit-onchange' => true do %label{:for => 'article_name'} Suche nach Name: - = text_field_tag(:query, params[:query], :size => 10 ) + = text_field_tag :query, params[:query], :size => 10 Nach Bestellgruppen sortieren: = check_box_tag :sort_by_ordergroups, 1, params[:sort_by_ordergroups] diff --git a/app/views/home/index.html.haml b/app/views/home/index.html.haml index d2fef72c..edbd6ba3 100644 --- a/app/views/home/index.html.haml +++ b/app/views/home/index.html.haml @@ -42,7 +42,7 @@ .box_title %h2 Neuste Nachrichten .column_content - = render :partial => 'messages/messages', :locals => {:messages => Message.public.order(:create_at.desc).limit(5), :subject_length => 70} + = render :partial => 'messages/messages', :locals => {:messages => Message.public.order(:created_at.desc).limit(5), :subject_length => 70} %br/ = link_to "Alle Nachrichten einsehen", messages_path diff --git a/app/views/pages/show.html.haml b/app/views/pages/show.html.haml index 58f9de77..470de1f4 100644 --- a/app/views/pages/show.html.haml +++ b/app/views/pages/show.html.haml @@ -16,9 +16,9 @@ #sidebar #sidebar-links = link_to "Bearbeiten", edit_page_path(@page) - = link_to "Versionen (#{@page.versions.count})", "#versions", 'data-toggle_this' => '#versions' + = link_to "Versionen (#{@page.versions.count})", "#versions", 'data-toggle-this' => '#versions' - unless @page.children.empty? - = link_to "Unterseiten", "#subpages", 'data-toggle_this' => '#subpages' + = link_to "Unterseiten", "#subpages", 'data-toggle-this' => '#subpages' #versions{:style => "display:none"} .box_title %h2 Versionen diff --git a/app/views/shared/_workgroup_members.haml b/app/views/shared/_workgroup_members.haml index a09d6fbe..f1470f5a 100644 --- a/app/views/shared/_workgroup_members.haml +++ b/app/views/shared/_workgroup_members.haml @@ -1,5 +1,5 @@ - for workgroup in Workgroup.all - %h4= link_to workgroup.name, "#", 'data-toggle_this' => "#workgroup_#{workgroup.id}" + %h4= link_to workgroup.name, "#", 'data-toggle-this' => "#workgroup_#{workgroup.id}" %ul{:style => "display:none"}[workgroup] - for user in workgroup.users.order("nick") %li= "#{user.nick} (#{user.ordergroup.try(:name)})" diff --git a/config/locales/de.yml b/config/locales/de.yml index 5d293998..042f7409 100644 --- a/config/locales/de.yml +++ b/config/locales/de.yml @@ -168,6 +168,7 @@ de: unit_quantity: Gebindegröße tax: MwSt deposit: Pfand + article_category: Kategorie stock_article: price: Nettopreis user: diff --git a/config/routes.rb b/config/routes.rb index 5e711ada..cad8ccac 100644 --- a/config/routes.rb +++ b/config/routes.rb @@ -2,9 +2,6 @@ Foodsoft::Application.routes.draw do get "sessions/new" - # Use routing filter to select foodcoop config and datbase -# filter :foodcoop - root :to => redirect("/#{Foodsoft.env}") scope '/:foodcoop', :defaults => { :foodcoop => Foodsoft.env } do diff --git a/lib/foodcoop.rb b/lib/foodcoop.rb deleted file mode 100644 index f4d61c32..00000000 --- a/lib/foodcoop.rb +++ /dev/null @@ -1,35 +0,0 @@ -module RoutingFilter - class Foodcoop < Filter - def around_recognize(path, env, &block) - token = extract_token!(path) # remove the token from the beginning of the path - yield.tap do |params| # invoke the given block (calls more filters and finally routing) - params[:foodcoop] = token if token # set recognized token to the resulting params hash - end - end - - def around_generate(*args, &block) - token = args.extract_options!.delete(:foodcoop) # extract the passed :token option - token = Foodsoft.env if token.nil? # default to Foodsoft.env - - yield.tap do |result| - if token - url = result.is_a?(Array) ? result.first : result - prepend_token!(url, token) - end - end - end - - protected - - def extract_token!(path) - foodcoop = nil - path.sub! %r(^/([a-zA-Z0-9]*)(?=/|$)) do foodcoop = $1; '' end - foodcoop - end - - def prepend_token!(url, token) - url.sub!(%r(^(http.?://[^/]*)?(.*))) { "#{$1}/#{token}#{$2}" } - end - - end -end \ No newline at end of file diff --git a/public/javascripts/application.js b/public/javascripts/application.js index fcf9a074..e4059468 100644 --- a/public/javascripts/application.js +++ b/public/javascripts/application.js @@ -1,58 +1,71 @@ // Load following statements, when DOM is ready $(function() { - $('a[data-toggle_this]').click(function() { - $($(this).data('toggle_this')).toggle(); + + // Show/Hide a specific DOM element + $('a[data-toggle-this]').click(function() { + $($(this).data('toggle-this')).toggle(); return false; }); + + // Check/Uncheck a single checkbox + $('[data-check-this]').live('click', function() { + var checkbox = $($(this).data('check-this')); + checkbox.attr('checked', !checkbox.is(':checked')); + highlightRow(checkbox); + return false; + }); + + // Check/Uncheck all checkboxes for s specific form + $('input[data-check-all]').live('click', function() { + var status = $(this).is(':checked') + $($(this).data('check-all')).find('input[type="checkbox"]').each(function() { + $(this).attr('checked', status); + highlightRow($(this)); + }); + }); + + // Submit form when changing a select menu. + $('form[data-submit-onchange] select').live('change', function() { + var confirmMessage = $(this).children(':selected').data('confirm'); + if (confirmMessage && confirm(confirmMessage)) { + $(this).parents('form').submit(); + } else { + $(this).parents('form').submit(); + } + return false; + }); + + // Submit form when changing text of an input field + // Use jquery observe_field plugin + $('form[data-submit-onchange] input[type=text]').each(function() { + $(this).observe_field(1, function() { + $(this).parents('form').submit(); + }); + }); + + // Submit form when clicking on checkbox + $('form[data-submit-onchange] input[type=checkbox]:not(input[data-ignore-onchange])').click(function() { + $(this).parents('form').submit(); + }); + + $('[data-redirect-to]').bind('change', function() { + var newLocation = $(this).children(':selected').val(); + if (newLocation != "") { + document.location.href = newLocation; + } + }); }); -// Place your application-specific JavaScript functions and classes here -// This file is automatically included by javascript_include_tag :defaults - -// for checkboxes. just insert box in same form-element like: -// -// credit to Shawn Olson & http://www.shawnolson.net -function checkUncheckAll(theElement) { - var theForm = theElement.form, z = 0; - for(z=0; z Date: Thu, 19 May 2011 22:22:05 +0200 Subject: [PATCH 035/335] Refactored shared article import. Added meta search gem. --- Gemfile | 1 + Gemfile.lock | 6 +++ app/controllers/articles_controller.rb | 41 ++++--------------- app/helpers/application_helper.rb | 9 ---- app/models/shared_article.rb | 21 +++++++++- .../articles/_import_search_results.haml | 10 ++--- app/views/articles/index.haml | 7 ++-- app/views/articles/shared.js.erb | 1 + 8 files changed, 42 insertions(+), 54 deletions(-) create mode 100644 app/views/articles/shared.js.erb diff --git a/Gemfile b/Gemfile index 0906428c..46c4a51d 100644 --- a/Gemfile +++ b/Gemfile @@ -12,6 +12,7 @@ gem 'jquery-rails' gem 'simple_form' gem 'rails3_acts_as_paranoid' gem 'meta_where' +gem 'meta_search' gem 'inherited_resources' group :development do diff --git a/Gemfile.lock b/Gemfile.lock index b70016c1..9e35c0a5 100644 --- a/Gemfile.lock +++ b/Gemfile.lock @@ -50,6 +50,11 @@ GEM i18n (>= 0.4.0) mime-types (~> 1.16) treetop (~> 1.4.8) + meta_search (1.0.5) + actionpack (~> 3.0.2) + activerecord (~> 3.0.2) + activesupport (~> 3.0.2) + arel (~> 2.0.2) meta_where (1.0.4) activerecord (~> 3.0.0) activesupport (~> 3.0.0) @@ -107,6 +112,7 @@ DEPENDENCIES hirb inherited_resources jquery-rails + meta_search meta_where mysql prawn (<= 0.6.3) diff --git a/app/controllers/articles_controller.rb b/app/controllers/articles_controller.rb index e98f279f..fa9714dd 100644 --- a/app/controllers/articles_controller.rb +++ b/app/controllers/articles_controller.rb @@ -201,43 +201,18 @@ class ArticlesController < ApplicationController # renders a view to import articles in local database # def shared - conditions = [] - conditions << "supplier_id = #{@supplier.shared_supplier.id}" - # check for keywords - conditions << params[:import_query].split(' ').collect { |keyword| "name LIKE '%#{keyword}%'" }.join(' AND ') unless params[:import_query].blank? - # check for selected lists - conditions << "(" + params[:lists].collect {|list| "list = '#{list[0]}'"}.join(" OR ") + ")" if params[:lists] - # check for regional articles - conditions << "origin = 'REG'" if params[:regional] - - @articles = SharedArticle.paginate :page => params[:page], :per_page => 10, :conditions => conditions.join(" AND ") - render :update do |page| - page.replace_html 'search_results', :partial => "import_search_results" - end + # build array of keywords, required for meta search _all suffix + params[:search][:name_contains_all] = params[:search][:name_contains_all].split(' ') if params[:search] + # Build search with meta search plugin + @search = @supplier.shared_supplier.shared_articles.search(params[:search]) + @articles = @search.paginate :page => params[:page], :per_page => 10 + render :layout => false end # fills a form whith values of the selected shared_article def import - shared_article = SharedArticle.find(params[:shared_article_id]) - @article = Article.new( - :supplier_id => params[:supplier_id], - :name => shared_article.name, - :unit => shared_article.unit, - :note => shared_article.note, - :manufacturer => shared_article.manufacturer, - :origin => shared_article.origin, - :price => shared_article.price, - :tax => shared_article.tax, - :deposit => shared_article.deposit, - :unit_quantity => shared_article.unit_quantity, - :order_number => shared_article.number, - # convert to db-compatible-string - :shared_updated_on => shared_article.updated_on.to_formatted_s(:db)) - - render :update do |page| - page["edit_article"].replace_html :partial => 'new' - page["edit_article"].show - end + @article = SharedArticle.find(params[:shared_article_id]).build_new_article + render :action => 'new', :layout => false end # sync all articles with the external database diff --git a/app/helpers/application_helper.rb b/app/helpers/application_helper.rb index 6c6d2fbb..89014248 100644 --- a/app/helpers/application_helper.rb +++ b/app/helpers/application_helper.rb @@ -88,15 +88,6 @@ module ApplicationHelper return weekdays[dayNumber] end - # highlights a phrase in given text - # based on the rails text-helper 'highlight' - def highlight_phrase(text, phrase, highlighter = '\1') - unless phrase.blank? || text.nil? - phrase.split(' ').each {|keyword| text.gsub!(/(#{Regexp.escape(keyword)})/i, highlighter)} - end - return text - end - # to set a title for both the h1-tag and the title in the header def title(page_title, show_title = true) content_for(:title) { page_title.to_s } diff --git a/app/models/shared_article.rb b/app/models/shared_article.rb index 3606e77c..7a99f41a 100644 --- a/app/models/shared_article.rb +++ b/app/models/shared_article.rb @@ -23,11 +23,28 @@ # class SharedArticle < ActiveRecord::Base - + # connect to database from sharedLists-Application SharedArticle.establish_connection(Foodsoft.config[:shared_lists]) # set correct table_name in external DB set_table_name :articles - + belongs_to :shared_supplier, :foreign_key => :supplier_id + + def build_new_article + shared_supplier.supplier.articles.build( + :name => name, + :unit => unit, + :note => note, + :manufacturer => manufacturer, + :origin => origin, + :price => price, + :tax => tax, + :deposit => deposit, + :unit_quantity => unit_quantity, + :order_number => number, + # convert to db-compatible-string + :shared_updated_on => updated_on.to_formatted_s(:db) + ) + end end diff --git a/app/views/articles/_import_search_results.haml b/app/views/articles/_import_search_results.haml index 180425ae..89c3ce33 100644 --- a/app/views/articles/_import_search_results.haml +++ b/app/views/articles/_import_search_results.haml @@ -1,5 +1,4 @@ -%p= pagination_links_remote @articles, :per_page => 10, | - :params => {:import_query => params[:import_query], :lists => params[:lists], :regional => params[:regional]} | +%p= pagination_links_remote @articles, :per_page => 10, :params => {:search => params[:search]} %table.list %thead %tr @@ -14,14 +13,13 @@ %tbody - for article in @articles %tr{:class => cycle('even','odd', :name => 'import_search_results')} - %td= highlight_phrase article.name, params[:import_query] + %td= highlight article.name, params[:search][:name_contains_all] %td= article.origin %td= article.manufacturer %td= article.note %td= number_to_currency(article.price) %td= article.unit %td= article.unit_quantity - %td= link_to_remote 'importieren', | - :url => import_supplier_articles_path(@supplier, :shared_article_id => article.id), | - :method => :get | + %td= link_to 'importieren', import_supplier_articles_path(@supplier, :shared_article_id => article.id), + :remote => true \ No newline at end of file diff --git a/app/views/articles/index.haml b/app/views/articles/index.haml index d174bcbd..12e1b2ab 100644 --- a/app/views/articles/index.haml +++ b/app/views/articles/index.haml @@ -26,18 +26,17 @@ .column_content #search{:style => "padding-bottom:3em"} = form_tag shared_supplier_articles_path(@supplier), :method => :get, :remote => true do - = text_field_tag :import_query, params['import_query'], :size => 10 + = text_field_tag "search[name_contains_all]", "", :size => 10 = submit_tag "Suchen" - if @supplier.shared_supplier.lists Suche in folgenden Listen: - @supplier.shared_supplier.lists.each do |token, name| - = check_box_tag "lists[#{token}]", "1", true + = check_box_tag "search[list_equals_any][]", token, true = name | Nur aus der Region: - = check_box_tag "regional", "1", false + = check_box_tag "search[origin_equals]", "REG", false #search_results - // "import_search_results" will be rendered = link_to "Schließen", "#import", 'data-toggle-this' => '#import' .single_column{:style => 'width:100%; clear:both'} diff --git a/app/views/articles/shared.js.erb b/app/views/articles/shared.js.erb new file mode 100644 index 00000000..08ce3fa7 --- /dev/null +++ b/app/views/articles/shared.js.erb @@ -0,0 +1 @@ +$('#search_results').html('<%= escape_javascript(render("import_search_results")) %>'); \ No newline at end of file From 3f133bb8c3feed0f0e69f81b0554d0fd7c473d27 Mon Sep 17 00:00:00 2001 From: benni Date: Thu, 19 May 2011 22:35:13 +0200 Subject: [PATCH 036/335] Added client side validations. Fixed shared sync. --- Gemfile | 1 + Gemfile.lock | 3 + app/controllers/articles_controller.rb | 6 +- app/models/supplier.rb | 2 +- app/views/articles/_form.html.haml | 2 +- app/views/layouts/application.haml | 2 +- .../initializers/client_side_validations.rb | 14 + public/javascripts/rails.validations.js | 390 ++++++++++++++++++ 8 files changed, 413 insertions(+), 7 deletions(-) create mode 100644 config/initializers/client_side_validations.rb create mode 100644 public/javascripts/rails.validations.js diff --git a/Gemfile b/Gemfile index 46c4a51d..50a772bd 100644 --- a/Gemfile +++ b/Gemfile @@ -9,6 +9,7 @@ gem "prawn", '<=0.6.3' gem 'haml' gem "will_paginate", "~> 3.0.pre2" gem 'jquery-rails' +gem 'client_side_validations' gem 'simple_form' gem 'rails3_acts_as_paranoid' gem 'meta_where' diff --git a/Gemfile.lock b/Gemfile.lock index 9e35c0a5..a4fba99b 100644 --- a/Gemfile.lock +++ b/Gemfile.lock @@ -31,6 +31,8 @@ GEM annotate (2.4.0) arel (2.0.9) builder (2.1.2) + client_side_validations (3.0.4) + activesupport (~> 3.0.0) erubis (2.6.6) abstract (>= 1.0.0) exception_notification (2.4.0) @@ -106,6 +108,7 @@ PLATFORMS DEPENDENCIES annotate + client_side_validations exception_notification fastercsv haml diff --git a/app/controllers/articles_controller.rb b/app/controllers/articles_controller.rb index fa9714dd..7e07e71f 100644 --- a/app/controllers/articles_controller.rb +++ b/app/controllers/articles_controller.rb @@ -220,16 +220,14 @@ class ArticlesController < ApplicationController def sync # check if there is an shared_supplier unless @supplier.shared_supplier - flash[:error]= "#{@supplier.name} ist nicht mit einer externen Datenbank verknüpft." - redirect_to supplier_articles_path(@supplier) + redirect_to supplier_articles_url(@supplier), :alert => "#{@supplier.name} ist nicht mit einer externen Datenbank verknüpft." end # sync articles against external database @updated_articles, @outlisted_articles = @supplier.sync_all # convert to db-compatible-string @updated_articles.each {|a, b| a.shared_updated_on = a.shared_updated_on.to_formatted_s(:db)} if @updated_articles.empty? && @outlisted_articles.empty? - flash[:notice] = "Der Katalog ist aktuell." - redirect_to supplier_articles_path(@supplier) + redirect_to supplier_articles_path(@supplier), :notice => "Der Katalog ist aktuell." end end end \ No newline at end of file diff --git a/app/models/supplier.rb b/app/models/supplier.rb index ae5854cb..8df6b6b0 100644 --- a/app/models/supplier.rb +++ b/app/models/supplier.rb @@ -27,7 +27,7 @@ class Supplier < ActiveRecord::Base def sync_all updated_articles = Array.new outlisted_articles = Array.new - for article in articles.without_deleted + for article in articles # try to find the associated shared_article shared_article = article.shared_article diff --git a/app/views/articles/_form.html.haml b/app/views/articles/_form.html.haml index be3dc68e..6d2caa51 100644 --- a/app/views/articles/_form.html.haml +++ b/app/views/articles/_form.html.haml @@ -1,4 +1,4 @@ -= simple_form_for [@supplier, @article], :remote => true do |f| += simple_form_for [@supplier, @article], :validate => true, :remote => true do |f| = f.input :availability = f.input :name = f.input :origin diff --git a/app/views/layouts/application.haml b/app/views/layouts/application.haml index be33c9b3..3c0ed10e 100644 --- a/app/views/layouts/application.haml +++ b/app/views/layouts/application.haml @@ -10,7 +10,7 @@ = stylesheet_link_tag 'ie_hacks' = javascript_include_tag 'jquery.min', 'jquery-ui.min', 'jquery_ujs', 'jquery.tokeninput', 'jquery.observe_field', - 'application', 'ordering', 'jquery.fancybox-1.3.4.pack', :cache => 'all_cached' + 'rails.validations', 'application', 'ordering', 'jquery.fancybox-1.3.4.pack', :cache => 'all_cached' = csrf_meta_tag = yield(:head) %body diff --git a/config/initializers/client_side_validations.rb b/config/initializers/client_side_validations.rb new file mode 100644 index 00000000..caf18378 --- /dev/null +++ b/config/initializers/client_side_validations.rb @@ -0,0 +1,14 @@ +# ClientSideValidations Initializer + +require 'client_side_validations/simple_form' if defined?(::SimpleForm) +require 'client_side_validations/formtastic' if defined?(::Formtastic) + +# Uncomment the following block if you want each input field to have the validation messages attached. +# ActionView::Base.field_error_proc = Proc.new do |html_tag, instance| +# unless html_tag =~ /^
        }.html_safe +# else +# %{
        #{html_tag}
        }.html_safe +# end +# end + diff --git a/public/javascripts/rails.validations.js b/public/javascripts/rails.validations.js new file mode 100644 index 00000000..2b4ea5ee --- /dev/null +++ b/public/javascripts/rails.validations.js @@ -0,0 +1,390 @@ +/*! + * Rails 3 Client Side Validations - v3.0.1 + * https://github.com/bcardarlela/client_side_validations + * + * Copyright (c) 2011 Brian Cardarella + * Licensed under the MIT license + * http://www.opensource.org/licenses/mit-license.php + */ + +(function($) { + $.fn.validate = function() { + return this.filter('form[data-validate]').each(function() { + var form = $(this); + var settings = window[form.attr('id')]; + + // Set up the events for the form + form + .submit(function() { return form.isValid(settings.validators); }) + .bind('ajax:beforeSend', function() { return form.isValid(settings.validators); }) + // Callbacks + .bind('form:validate:after', function(eventData) { clientSideValidations.callbacks.form.after( form, eventData); }) + .bind('form:validate:before', function(eventData) { clientSideValidations.callbacks.form.before(form, eventData); }) + .bind('form:validate:fail', function(eventData) { clientSideValidations.callbacks.form.fail( form, eventData); }) + .bind('form:validate:pass', function(eventData) { clientSideValidations.callbacks.form.pass( form, eventData); }) + + // Set up the events for each validatable form element + .find('[data-validate]:input') + .live('focusout', function() { $(this).isValid(settings.validators); }) + .live('change', function() { $(this).data('changed', true); }) + // Callbacks + .live('element:validate:after', function(eventData) { clientSideValidations.callbacks.element.after( $(this), eventData); }) + .live('element:validate:before', function(eventData) { clientSideValidations.callbacks.element.before($(this), eventData); }) + .live('element:validate:fail', function(eventData, message) { + var element = $(this); + clientSideValidations.callbacks.element.fail(element, message, function() { + addError(element, message); + }, eventData) }) + .live('element:validate:pass', function(eventData) { + var element = $(this); + clientSideValidations.callbacks.element.pass(element, function() { + removeError(element); + }, eventData) }) + // Checkboxes - Live events don't support filter + .end().find('[data-validate]:checkbox') + .live('click', function() { $(this).isValid(settings.validators); }) + // Inputs for confirmations + .end().find('[id*=_confirmation]').each(function() { + var confirmationElement = $(this), + element = form.find('#' + this.id.match(/(.+)_confirmation/)[1] + '[data-validate]:input'); + + $('#' + confirmationElement.attr('id')) + .live('focusout', function() { + element.data('changed', true).isValid(settings.validators); + }) + .live('keyup', function() { + element.data('changed', true).isValid(settings.validators); + }) + }); + + var addError = function(element, message) { + clientSideValidations.formBuilders[settings.type].add(element, settings, message); + } + + var removeError = function(element) { + clientSideValidations.formBuilders[settings.type].remove(element, settings); + } + }); + } + + $.fn.isValid = function(validators) { + if ($(this[0]).is('form')) { + return validateForm($(this[0]), validators); + } else { + return validateElement($(this[0]), validators[this[0].name]); + } + } + + var validateForm = function(form, validators) { + var valid = true; + + form.trigger('form:validate:before').find('[data-validate]:input').each(function() { + if (!$(this).isValid(validators)) { valid = false; } + }); + + if (valid) { + form.trigger('form:validate:pass'); + } else { + form.trigger('form:validate:fail'); + } + + form.trigger('form:validate:after'); + return valid; + } + + var validateElement = function(element, validators) { + element.trigger('element:validate:before'); + + if (element.data('changed') !== false) { + var valid = true; + element.data('changed', false); + + // Because 'length' is defined on the list of validators we cannot call jQuery.each on + // the clientSideValidations.validators.all() object + for (kind in clientSideValidations.validators.all()) { + if (validators[kind] && (message = clientSideValidations.validators.all()[kind](element, validators[kind]))) { + element.trigger('element:validate:fail', message).data('valid', false); + valid = false; + break; + } + } + + if (valid) { element.data('valid', null); element.trigger('element:validate:pass'); } + } + + element.trigger('element:validate:after'); + return element.data('valid') === false ? false : true; + } + + // Main hook + // If new forms are dynamically introduced into the DOM the .validate() method + // must be invoked on that form + $(function() { $('form[data-validate]').validate(); }) +})(jQuery); + +var clientSideValidations = { + validators: { + all: function() { return jQuery.extend({}, clientSideValidations.validators.local, clientSideValidations.validators.remote) }, + local: { + presence: function(element, options) { + if (/^\s*$/.test(element.val())) { + return options.message; + } + }, + acceptance: function(element, options) { + switch (element.attr('type')) { + case 'checkbox': + if (!element.attr('checked')) { + return options.message; + } + break; + case 'text': + if (element.val() != (options.accept || '1')) { + return options.message; + } + break; + } + }, + format: function(element, options) { + if ((message = this.presence(element, options)) && options.allow_blank == true) { + return; + } else if (message) { + return message; + } else { + if (options['with'] && !options['with'].test(element.val())) { + return options.message; + } else if (options['without'] && options['without'].test(element.val())) { + return options.message; + } + } + }, + numericality: function(element, options) { + if (!/^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d*)?$/.test(element.val())) { + return options.messages.numericality; + } + + if (options.only_integer && !/^\d+$/.test(element.val())) { + return options.messages.only_integer; + } + + var CHECKS = { greater_than: '>', greater_than_or_equal_to: '>=', + equal_to: '==', less_than: '<', less_than_or_equal_to: '<=' } + + for (var check in CHECKS) { + if (options[check] && !(new Function("return " + element.val() + CHECKS[check] + options[check])())) { + return options.messages[check]; + } + } + + if (options.odd && !(parseInt(element.val()) % 2)) { + return options.messages.odd; + } + + if (options.even && (parseInt(element.val()) % 2)) { + return options.messages.even; + } + }, + length: function(element, options) { + var blankOptions = {}; + if (options.is) { + blankOptions.message = options.messages.is; + } else if (options.minimum) { + blankOptions.message = options.messages.minimum; + } + if ((message = this.presence(element, blankOptions)) && options.allow_blank == true && !options.maximum) { + return; + } else if (message) { + return message; + } else { + var CHECKS = { is: '==', minimum: '>=', maximum: '<=' } + var tokenizer = options.js_tokenizer || "split('')"; + var tokenized_length = new Function("element", "return (element.val()." + tokenizer + " || '').length;")(element); + + for (var check in CHECKS) { + if (options[check] && !(new Function("return " + tokenized_length + CHECKS[check] + options[check])())) { + return options.messages[check]; + } + } + } + }, + exclusion: function(element, options) { + if ((message = this.presence(element, options)) && options.allow_blank == true) { + return; + } else if (message) { + return message; + } else { + if (options['in']) { + for (var i = 0; i < options['in'].length; i++) { + if (options['in'][i] == element.val()) { + return options.message; + } + } + } else if (options['range']) { + var lower = options['range'][0], + upper = options['range'][1]; + if (element.val() >= lower && element.val() <= upper) { + return options.message; + } + } + } + }, + inclusion: function(element, options) { + if ((message = this.presence(element, options)) && options.allow_blank == true) { + return; + } else if (message) { + return message; + } else { + if (options['in']) { + for (var i = 0; i < options['in'].length; i++) { + if (options['in'][i] == element.val()) { + return; + } + } + return options.message; + } else if (options['range']) { + var lower = options['range'][0], + upper = options['range'][1]; + + if (element.val() >= lower && element.val() <= upper) { + return; + } else { + return options.message; + } + } + } + }, + confirmation: function(element, options) { + if (element.val() != jQuery('#' + element.attr('id') + '_confirmation').val()) { + return options.message; + } + } + }, + remote: { + uniqueness: function(element, options) { + var data = {}; + data['case_sensitive'] = !!options.case_sensitive; + if (options.id) { + data['id'] = options.id; + } + + if (options.scope) { + data.scope = {} + for (key in options.scope) { + var scoped_element = jQuery('[name="' + element.attr('name').replace(/\[\w+]$/, '[' + key + ']' + '"]')); + if (scoped_element[0] && scoped_element.val() != options.scope[key]) { + data.scope[key] = scoped_element.val(); + scoped_element.unbind('change.' + element.id).bind('change.' + element.id, function() { element.trigger('change'); element.trigger('focusout'); }); + } else { + data.scope[key] = options.scope[key]; + } + } + } + + // Kind of a hack but this will isolate the resource name and attribute. + // e.g. user[records_attributes][0][title] => records[title] + // e.g. user[record_attributes][title] => record[title] + // Server side handles classifying the resource properly + if (/_attributes]/.test(element.attr('name'))) { + var name = element.attr('name').match(/\[\w+_attributes]/g).pop().match(/\[(\w+)_attributes]/).pop(); + name += /(\[\w+])$/.exec(element.attr('name'))[1]; + } else { + var name = element.attr('name'); + } + data[name] = element.val(); + + if (jQuery.ajax({ + url: '/validators/uniqueness.json', + data: data, + async: false + }).status == 200) { + return options.message; + } + } + } + }, + formBuilders: { + 'ActionView::Helpers::FormBuilder': { + add: function(element, settings, message) { + if (element.data('valid') !== false) { + var inputErrorField = jQuery(settings.input_tag), + labelErrorField = jQuery(settings.label_tag), + label = jQuery('label[for="' + element.attr('id') + '"]:not(.message)'); + + if (element.attr('autofocus')) { element.attr('autofocus', false) }; + element.before(inputErrorField); + inputErrorField.find('span#input_tag').replaceWith(element); + inputErrorField.find('label.message').attr('for', element.attr('id')); + labelErrorField.find('label.message').attr('for', element.attr('id')); + label.replaceWith(labelErrorField); + labelErrorField.find('label#label_tag').replaceWith(label); + } + jQuery('label.message[for="' + element.attr('id') + '"]').text(message); + }, + remove: function(element, settings) { + var errorFieldClass = jQuery(settings.input_tag).attr('class'), + inputErrorField = element.closest('.' + errorFieldClass), + label = jQuery('label[for="' + element.attr('id') + '"]:not(.message)'), + labelErrorField = label.closest('.' + errorFieldClass); + + if (inputErrorField[0]) { + inputErrorField.find('#' + element.attr('id')).detach(); + inputErrorField.replaceWith(element); + label.detach(); + labelErrorField.replaceWith(label); + } + } + }, + 'SimpleForm::FormBuilder': { + add: function(element, settings, message) { + if (element.data('valid') !== false) { + var wrapper = element.closest(settings.wrapper_tag); + wrapper.addClass(settings.wrapper_error_class); + var errorElement = $('<' + settings.error_tag + ' class="' + settings.error_class + '">' + message + ''); + wrapper.append(errorElement); + } else { + element.parent().find(settings.error_tag + '.' + settings.error_class).text(message); + } + }, + remove: function(element, settings) { + var wrapper = element.closest(settings.wrapper_tag + '.' + settings.wrapper_error_class); + wrapper.removeClass(settings.wrapper_error_class); + var errorElement = wrapper.find(settings.error_tag + '.' + settings.error_class); + errorElement.remove(); + } + + }, + 'Formtastic::SemanticFormBuilder': { + add: function(element, settings, message) { + if (element.data('valid') !== false) { + var wrapper = element.closest('li'); + wrapper.addClass('error'); + var errorElement = $('

        ' + message + '

        '); + wrapper.append(errorElement); + } else { + element.parent().find('p.' + settings.inline_error_class).text(message); + } + }, + remove: function(element, settings) { + var wrapper = element.closest('li.error'); + wrapper.removeClass('error'); + var errorElement = wrapper.find('p.' + settings.inline_error_class); + errorElement.remove(); + } + + } + }, + callbacks: { + element: { + after: function(element, eventData) { }, + before: function(element, eventData) { }, + fail: function(element, message, addError, eventData) { addError() }, + pass: function(element, removeError, eventData) { removeError() } + }, + form: { + after: function(form, eventData) { }, + before: function(form, eventData) { }, + fail: function(form, eventData) { }, + pass: function(form, eventData) { } + } + } +} From 5bf6503a8ffc6ba921d08dd4050bec4b43cbb5c6 Mon Sep 17 00:00:00 2001 From: benni Date: Fri, 20 May 2011 00:19:58 +0200 Subject: [PATCH 037/335] Included new localize_input gem. --- Gemfile | 1 + Gemfile.lock | 7 +++++++ app/models/article.rb | 18 +++--------------- 3 files changed, 11 insertions(+), 15 deletions(-) diff --git a/Gemfile b/Gemfile index 50a772bd..91b52a8a 100644 --- a/Gemfile +++ b/Gemfile @@ -15,6 +15,7 @@ gem 'rails3_acts_as_paranoid' gem 'meta_where' gem 'meta_search' gem 'inherited_resources' +gem 'localize_input', :git => "git://github.com/bennibu/localize_input.git" group :development do gem 'annotate' diff --git a/Gemfile.lock b/Gemfile.lock index a4fba99b..b5725d29 100644 --- a/Gemfile.lock +++ b/Gemfile.lock @@ -1,3 +1,9 @@ +GIT + remote: git://github.com/bennibu/localize_input.git + revision: 1de033997a66b3c22344799cd354e45f0dab4d32 + specs: + localize_input (0.0.1) + GEM remote: http://rubygems.org/ specs: @@ -115,6 +121,7 @@ DEPENDENCIES hirb inherited_resources jquery-rails + localize_input! meta_search meta_where mysql diff --git a/app/models/article.rb b/app/models/article.rb index 43d2d1d9..43ad5ac0 100644 --- a/app/models/article.rb +++ b/app/models/article.rb @@ -28,6 +28,9 @@ class Article < ActiveRecord::Base acts_as_paranoid # Avoid deleting the article for consistency of order-results extend ActiveSupport::Memoizable # Ability to cache method results. Use memoize :expensive_method + # Replace numeric seperator with database format + localize_input_of :price, :tax, :deposit + # Associations belongs_to :supplier belongs_to :article_category @@ -47,21 +50,6 @@ class Article < ActiveRecord::Base # Callbacks before_save :update_price_history before_destroy :check_article_in_use - - # Custom attribute setter that accepts decimal numbers using localized decimal separator. - def price=(price) - self[:price] = String.delocalized_decimal(price) - end - - # Custom attribute setter that accepts decimal numbers using localized decimal separator. - def tax=(tax) - self[:tax] = String.delocalized_decimal(tax) - end - - # Custom attribute setter that accepts decimal numbers using localized decimal separator. - def deposit=(deposit) - self[:deposit] = String.delocalized_decimal(deposit) - end # The financial gross, net plus tax and deposti def gross_price From d4715fef4b4d20dc3262ebdce55dff5a88e463ca Mon Sep 17 00:00:00 2001 From: benni Date: Fri, 20 May 2011 00:23:27 +0200 Subject: [PATCH 038/335] Removed old plugin. --- vendor/plugins/auto_complete/README | 23 --- vendor/plugins/auto_complete/Rakefile | 22 --- vendor/plugins/auto_complete/init.rb | 2 - .../auto_complete/lib/auto_complete.rb | 47 ------ .../lib/auto_complete_macros_helper.rb | 143 ------------------ .../auto_complete/test/auto_complete_test.rb | 67 -------- 6 files changed, 304 deletions(-) delete mode 100644 vendor/plugins/auto_complete/README delete mode 100644 vendor/plugins/auto_complete/Rakefile delete mode 100644 vendor/plugins/auto_complete/init.rb delete mode 100644 vendor/plugins/auto_complete/lib/auto_complete.rb delete mode 100644 vendor/plugins/auto_complete/lib/auto_complete_macros_helper.rb delete mode 100644 vendor/plugins/auto_complete/test/auto_complete_test.rb diff --git a/vendor/plugins/auto_complete/README b/vendor/plugins/auto_complete/README deleted file mode 100644 index e08a8151..00000000 --- a/vendor/plugins/auto_complete/README +++ /dev/null @@ -1,23 +0,0 @@ -Example: - - # Controller - class BlogController < ApplicationController - auto_complete_for :post, :title - end - - # View - <%= text_field_with_auto_complete :post, title %> - -By default, auto_complete_for limits the results to 10 entries, -and sorts by the given field. - -auto_complete_for takes a third parameter, an options hash to -the find method used to search for the records: - - auto_complete_for :post, :title, :limit => 15, :order => 'created_at DESC' - -For more examples, see script.aculo.us: -* http://script.aculo.us/demos/ajax/autocompleter -* http://script.aculo.us/demos/ajax/autocompleter_customized - -Copyright (c) 2007 David Heinemeier Hansson, released under the MIT license diff --git a/vendor/plugins/auto_complete/Rakefile b/vendor/plugins/auto_complete/Rakefile deleted file mode 100644 index 5af4e826..00000000 --- a/vendor/plugins/auto_complete/Rakefile +++ /dev/null @@ -1,22 +0,0 @@ -require 'rake' -require 'rake/testtask' -require 'rake/rdoctask' - -desc 'Default: run unit tests.' -task :default => :test - -desc 'Test auto_complete plugin.' -Rake::TestTask.new(:test) do |t| - t.libs << 'lib' - t.pattern = 'test/**/*_test.rb' - t.verbose = true -end - -desc 'Generate documentation for auto_complete plugin.' -Rake::RDocTask.new(:rdoc) do |rdoc| - rdoc.rdoc_dir = 'rdoc' - rdoc.title = 'Auto Complete' - rdoc.options << '--line-numbers' << '--inline-source' - rdoc.rdoc_files.include('README') - rdoc.rdoc_files.include('lib/**/*.rb') -end diff --git a/vendor/plugins/auto_complete/init.rb b/vendor/plugins/auto_complete/init.rb deleted file mode 100644 index 87bf027d..00000000 --- a/vendor/plugins/auto_complete/init.rb +++ /dev/null @@ -1,2 +0,0 @@ -ActionController::Base.send :include, AutoComplete -ActionController::Base.helper AutoCompleteMacrosHelper \ No newline at end of file diff --git a/vendor/plugins/auto_complete/lib/auto_complete.rb b/vendor/plugins/auto_complete/lib/auto_complete.rb deleted file mode 100644 index 4afc7c2e..00000000 --- a/vendor/plugins/auto_complete/lib/auto_complete.rb +++ /dev/null @@ -1,47 +0,0 @@ -module AutoComplete - - def self.included(base) - base.extend(ClassMethods) - end - - # - # Example: - # - # # Controller - # class BlogController < ApplicationController - # auto_complete_for :post, :title - # end - # - # # View - # <%= text_field_with_auto_complete :post, title %> - # - # By default, auto_complete_for limits the results to 10 entries, - # and sorts by the given field. - # - # auto_complete_for takes a third parameter, an options hash to - # the find method used to search for the records: - # - # auto_complete_for :post, :title, :limit => 15, :order => 'created_at DESC' - # - # For help on defining text input fields with autocompletion, - # see ActionView::Helpers::JavaScriptHelper. - # - # For more examples, see script.aculo.us: - # * http://script.aculo.us/demos/ajax/autocompleter - # * http://script.aculo.us/demos/ajax/autocompleter_customized - module ClassMethods - def auto_complete_for(object, method, options = {}) - define_method("auto_complete_for_#{object}_#{method}") do - find_options = { - :conditions => [ "LOWER(#{method}) LIKE ?", '%' + params[object][method].downcase + '%' ], - :order => "#{method} ASC", - :limit => 10 }.merge!(options) - - @items = object.to_s.camelize.constantize.find(:all, find_options) - - render :inline => "<%= auto_complete_result @items, '#{method}' %>" - end - end - end - -end \ No newline at end of file diff --git a/vendor/plugins/auto_complete/lib/auto_complete_macros_helper.rb b/vendor/plugins/auto_complete/lib/auto_complete_macros_helper.rb deleted file mode 100644 index 1d25ee47..00000000 --- a/vendor/plugins/auto_complete/lib/auto_complete_macros_helper.rb +++ /dev/null @@ -1,143 +0,0 @@ -module AutoCompleteMacrosHelper - # Adds AJAX autocomplete functionality to the text input field with the - # DOM ID specified by +field_id+. - # - # This function expects that the called action returns an HTML
          list, - # or nothing if no entries should be displayed for autocompletion. - # - # You'll probably want to turn the browser's built-in autocompletion off, - # so be sure to include an autocomplete="off" attribute with your text - # input field. - # - # The autocompleter object is assigned to a Javascript variable named field_id_auto_completer. - # This object is useful if you for example want to trigger the auto-complete suggestions through - # other means than user input (for that specific case, call the activate method on that object). - # - # Required +options+ are: - # :url:: URL to call for autocompletion results - # in url_for format. - # - # Addtional +options+ are: - # :update:: Specifies the DOM ID of the element whose - # innerHTML should be updated with the autocomplete - # entries returned by the AJAX request. - # Defaults to field_id + '_auto_complete' - # :with:: A JavaScript expression specifying the - # parameters for the XMLHttpRequest. This defaults - # to 'fieldname=value'. - # :frequency:: Determines the time to wait after the last keystroke - # for the AJAX request to be initiated. - # :indicator:: Specifies the DOM ID of an element which will be - # displayed while autocomplete is running. - # :tokens:: A string or an array of strings containing - # separator tokens for tokenized incremental - # autocompletion. Example: :tokens => ',' would - # allow multiple autocompletion entries, separated - # by commas. - # :min_chars:: The minimum number of characters that should be - # in the input field before an Ajax call is made - # to the server. - # :on_hide:: A Javascript expression that is called when the - # autocompletion div is hidden. The expression - # should take two variables: element and update. - # Element is a DOM element for the field, update - # is a DOM element for the div from which the - # innerHTML is replaced. - # :on_show:: Like on_hide, only now the expression is called - # then the div is shown. - # :after_update_element:: A Javascript expression that is called when the - # user has selected one of the proposed values. - # The expression should take two variables: element and value. - # Element is a DOM element for the field, value - # is the value selected by the user. - # :select:: Pick the class of the element from which the value for - # insertion should be extracted. If this is not specified, - # the entire element is used. - # :method:: Specifies the HTTP verb to use when the autocompletion - # request is made. Defaults to POST. - def auto_complete_field(field_id, options = {}) - function = "var #{field_id}_auto_completer = new Ajax.Autocompleter(" - function << "'#{field_id}', " - function << "'" + (options[:update] || "#{field_id}_auto_complete") + "', " - function << "'#{url_for(options[:url])}'" - - js_options = {} - js_options[:tokens] = array_or_string_for_javascript(options[:tokens]) if options[:tokens] - js_options[:callback] = "function(element, value) { return #{options[:with]} }" if options[:with] - js_options[:indicator] = "'#{options[:indicator]}'" if options[:indicator] - js_options[:select] = "'#{options[:select]}'" if options[:select] - js_options[:paramName] = "'#{options[:param_name]}'" if options[:param_name] - js_options[:frequency] = "#{options[:frequency]}" if options[:frequency] - js_options[:method] = "'#{options[:method].to_s}'" if options[:method] - - { :after_update_element => :afterUpdateElement, - :on_show => :onShow, :on_hide => :onHide, :min_chars => :minChars }.each do |k,v| - js_options[v] = options[k] if options[k] - end - - function << (', ' + options_for_javascript(js_options) + ')') - - javascript_tag(function) - end - - # Use this method in your view to generate a return for the AJAX autocomplete requests. - # - # Example action: - # - # def auto_complete_for_item_title - # @items = Item.find(:all, - # :conditions => [ 'LOWER(description) LIKE ?', - # '%' + request.raw_post.downcase + '%' ]) - # render :inline => "<%= auto_complete_result(@items, 'description') %>" - # end - # - # The auto_complete_result can of course also be called from a view belonging to the - # auto_complete action if you need to decorate it further. - def auto_complete_result(entries, field, phrase = nil) - return unless entries - items = entries.map { |entry| content_tag("li", phrase ? highlight(entry[field], phrase) : h(entry[field])) } - content_tag("ul", items.uniq) - end - - # Wrapper for text_field with added AJAX autocompletion functionality. - # - # In your controller, you'll need to define an action called - # auto_complete_for to respond the AJAX calls, - # - def text_field_with_auto_complete(object, method, tag_options = {}, completion_options = {}) - (completion_options[:skip_style] ? "" : auto_complete_stylesheet) + - text_field(object, method, tag_options) + - content_tag("div", "", :id => "#{object}_#{method}_auto_complete", :class => "auto_complete") + - auto_complete_field("#{object}_#{method}", { :url => { :action => "auto_complete_for_#{object}_#{method}" } }.update(completion_options)) - end - - private - def auto_complete_stylesheet - content_tag('style', <<-EOT, :type => Mime::CSS) - div.auto_complete { - width: 350px; - background: #fff; - } - div.auto_complete ul { - border:1px solid #888; - margin:0; - padding:0; - width:100%; - list-style-type:none; - } - div.auto_complete ul li { - margin:0; - padding:3px; - } - div.auto_complete ul li.selected { - background-color: #ffb; - } - div.auto_complete ul strong.highlight { - color: #800; - margin:0; - padding:0; - } - EOT - end - -end diff --git a/vendor/plugins/auto_complete/test/auto_complete_test.rb b/vendor/plugins/auto_complete/test/auto_complete_test.rb deleted file mode 100644 index dc9a5c91..00000000 --- a/vendor/plugins/auto_complete/test/auto_complete_test.rb +++ /dev/null @@ -1,67 +0,0 @@ -require File.expand_path(File.join(File.dirname(__FILE__), '../../../../test/test_helper')) - -class AutoCompleteTest < Test::Unit::TestCase - include AutoComplete - include AutoCompleteMacrosHelper - - include ActionView::Helpers::UrlHelper - include ActionView::Helpers::TagHelper - include ActionView::Helpers::TextHelper - include ActionView::Helpers::FormHelper - include ActionView::Helpers::CaptureHelper - - def setup - @controller = Class.new do - def url_for(options) - url = "http://www.example.com/" - url << options[:action].to_s if options and options[:action] - url - end - end - @controller = @controller.new - end - - - def test_auto_complete_field - assert_dom_equal %(), - auto_complete_field("some_input", :url => { :action => "autocomplete" }); - assert_dom_equal %(), - auto_complete_field("some_input", :url => { :action => "autocomplete" }, :tokens => ','); - assert_dom_equal %(), - auto_complete_field("some_input", :url => { :action => "autocomplete" }, :tokens => [',']); - assert_dom_equal %(), - auto_complete_field("some_input", :url => { :action => "autocomplete" }, :min_chars => 3); - assert_dom_equal %(), - auto_complete_field("some_input", :url => { :action => "autocomplete" }, :on_hide => "function(element, update){alert('me');}"); - assert_dom_equal %(), - auto_complete_field("some_input", :url => { :action => "autocomplete" }, :frequency => 2); - assert_dom_equal %(), - auto_complete_field("some_input", :url => { :action => "autocomplete" }, - :after_update_element => "function(element,value){alert('You have chosen: '+value)}"); - assert_dom_equal %(), - auto_complete_field("some_input", :url => { :action => "autocomplete" }, :param_name => 'huidriwusch'); - assert_dom_equal %(), - auto_complete_field("some_input", :url => { :action => "autocomplete" }, :method => :get); - end - - def test_auto_complete_result - result = [ { :title => 'test1' }, { :title => 'test2' } ] - assert_equal %(
          • test1
          • test2
          ), - auto_complete_result(result, :title) - assert_equal %(
          • test1
          • test2
          ), - auto_complete_result(result, :title, "est") - - resultuniq = [ { :title => 'test1' }, { :title => 'test1' } ] - assert_equal %(
          • test1
          ), - auto_complete_result(resultuniq, :title, "est") - end - - def test_text_field_with_auto_complete - assert_match %(